CZ256294A3 - Enhanced process for preparing 2,4-di(alkylamino)-6-alkylthio-s-triazines - Google Patents
Enhanced process for preparing 2,4-di(alkylamino)-6-alkylthio-s-triazines Download PDFInfo
- Publication number
- CZ256294A3 CZ256294A3 CZ942562A CZ256294A CZ256294A3 CZ 256294 A3 CZ256294 A3 CZ 256294A3 CZ 942562 A CZ942562 A CZ 942562A CZ 256294 A CZ256294 A CZ 256294A CZ 256294 A3 CZ256294 A3 CZ 256294A3
- Authority
- CZ
- Czechia
- Prior art keywords
- triazine
- alkyl
- reaction
- methylthio
- group
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 5
- 238000000034 method Methods 0.000 claims abstract description 37
- 239000002904 solvent Substances 0.000 claims abstract description 28
- -1 alkyl mercaptan Chemical compound 0.000 claims abstract description 25
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 claims abstract description 23
- 239000003444 phase transfer catalyst Substances 0.000 claims abstract description 16
- 238000002360 preparation method Methods 0.000 claims abstract description 8
- 238000006243 chemical reaction Methods 0.000 claims description 51
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 11
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 10
- 239000011230 binding agent Substances 0.000 claims description 9
- 239000003960 organic solvent Substances 0.000 claims description 9
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 claims description 9
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 8
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 claims description 7
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 claims description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 claims description 6
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 claims description 6
- 239000008096 xylene Substances 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 claims description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 4
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- BKIMMITUMNQMOS-UHFFFAOYSA-N nonane Chemical compound CCCCCCCCC BKIMMITUMNQMOS-UHFFFAOYSA-N 0.000 claims description 4
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 claims description 4
- RSJKGSCJYJTIGS-UHFFFAOYSA-N undecane Chemical compound CCCCCCCCCCC RSJKGSCJYJTIGS-UHFFFAOYSA-N 0.000 claims description 4
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 3
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 claims description 3
- 150000003983 crown ethers Chemical class 0.000 claims description 3
- 150000001924 cycloalkanes Chemical class 0.000 claims description 3
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 3
- WEWMTNUNCCPSHW-UHFFFAOYSA-N n-tert-butyl-4,6-bis(methylsulfanyl)-1,3,5-triazin-2-amine Chemical compound CSC1=NC(NC(C)(C)C)=NC(SC)=N1 WEWMTNUNCCPSHW-UHFFFAOYSA-N 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 150000004714 phosphonium salts Chemical group 0.000 claims description 3
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 3
- IPILPUZVTYHGIL-UHFFFAOYSA-M tributyl(methyl)azanium;chloride Chemical group [Cl-].CCCC[N+](C)(CCCC)CCCC IPILPUZVTYHGIL-UHFFFAOYSA-M 0.000 claims description 3
- POEDHWVTLBLWDA-UHFFFAOYSA-N 1-butylindole-2,3-dione Chemical compound C1=CC=C2N(CCCC)C(=O)C(=O)C2=C1 POEDHWVTLBLWDA-UHFFFAOYSA-N 0.000 claims description 2
- RHLVCLIPMVJYKS-UHFFFAOYSA-N 3-octanone Chemical compound CCCCCC(=O)CC RHLVCLIPMVJYKS-UHFFFAOYSA-N 0.000 claims description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 claims description 2
- AQZGPSLYZOOYQP-UHFFFAOYSA-N Diisoamyl ether Chemical compound CC(C)CCOCCC(C)C AQZGPSLYZOOYQP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 2
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 claims description 2
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 claims description 2
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 125000006318 tert-butyl amino group Chemical group [H]N(*)C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 claims 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 claims 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 2
- 125000006317 cyclopropyl amino group Chemical group 0.000 claims 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 abstract description 17
- 150000003973 alkyl amines Chemical class 0.000 abstract description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 45
- 239000000243 solution Substances 0.000 description 30
- 239000000047 product Substances 0.000 description 25
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- 239000012044 organic layer Substances 0.000 description 16
- 150000001412 amines Chemical class 0.000 description 12
- 229910052757 nitrogen Inorganic materials 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 239000012267 brine Substances 0.000 description 11
- 238000004817 gas chromatography Methods 0.000 description 11
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 11
- 238000010533 azeotropic distillation Methods 0.000 description 10
- 229940078552 o-xylene Drugs 0.000 description 9
- 239000010410 layer Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 229910001220 stainless steel Inorganic materials 0.000 description 6
- 239000010935 stainless steel Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- PELCIGMEBSWLQC-UHFFFAOYSA-N CC(C)(C)NC1=NC(N(C=N1)SC)NC2CC2 Chemical compound CC(C)(C)NC1=NC(N(C=N1)SC)NC2CC2 PELCIGMEBSWLQC-UHFFFAOYSA-N 0.000 description 5
- 125000003282 alkyl amino group Chemical group 0.000 description 5
- 239000012065 filter cake Substances 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- HDHLIWCXDDZUFH-UHFFFAOYSA-N irgarol 1051 Chemical compound CC(C)(C)NC1=NC(SC)=NC(NC2CC2)=N1 HDHLIWCXDDZUFH-UHFFFAOYSA-N 0.000 description 4
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 3
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 238000005292 vacuum distillation Methods 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 238000005576 amination reaction Methods 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000004966 cyanoalkyl group Chemical group 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 238000003912 environmental pollution Methods 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical group O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- FTTATHOUSOIFOQ-UHFFFAOYSA-N 1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine Chemical compound C1NCCN2CCCC21 FTTATHOUSOIFOQ-UHFFFAOYSA-N 0.000 description 1
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical class C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- YIWGJFPJRAEKMK-UHFFFAOYSA-N 1-(2H-benzotriazol-5-yl)-3-methyl-8-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound CN1C(=O)N(c2ccc3n[nH]nc3c2)C2(CCN(CC2)C(=O)c2cnc(NCc3cccc(OC(F)(F)F)c3)nc2)C1=O YIWGJFPJRAEKMK-UHFFFAOYSA-N 0.000 description 1
- RUJZSBNRCJZPOC-UHFFFAOYSA-N 2,4-bis(butylsulfanyl)-6-cyclohexyl-1,3,5-triazine Chemical compound CCCCSC1=NC(SCCCC)=NC(C2CCCCC2)=N1 RUJZSBNRCJZPOC-UHFFFAOYSA-N 0.000 description 1
- HTSVYUUXJSMGQC-UHFFFAOYSA-N 2-chloro-1,3,5-triazine Chemical class ClC1=NC=NC=N1 HTSVYUUXJSMGQC-UHFFFAOYSA-N 0.000 description 1
- FCULSSZIKUBJOX-UHFFFAOYSA-N 2-n,4-n-dibenzyl-6-benzylsulfanyl-1,3,5-triazine-2,4-diamine Chemical compound C=1C=CC=CC=1CNC(N=C(SCC=1C=CC=CC=1)N=1)=NC=1NCC1=CC=CC=C1 FCULSSZIKUBJOX-UHFFFAOYSA-N 0.000 description 1
- DHYZHZFOEMUWTK-UHFFFAOYSA-N 2-n,4-n-dibenzyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine Chemical compound N=1C(NCC=2C=CC=CC=2)=NC(SC)=NC=1NCC1=CC=CC=C1 DHYZHZFOEMUWTK-UHFFFAOYSA-N 0.000 description 1
- YQSPKCXHYIXZTK-UHFFFAOYSA-N 2-n,4-n-didodecyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCCCCCCCCCNC1=NC(NCCCCCCCCCCCC)=NC(SC)=N1 YQSPKCXHYIXZTK-UHFFFAOYSA-N 0.000 description 1
- BRHDTRXHZFORCW-UHFFFAOYSA-N 2-n,4-n-dioctyl-6-propylsulfanyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCCCCCNC1=NC(NCCCCCCCC)=NC(SCCC)=N1 BRHDTRXHZFORCW-UHFFFAOYSA-N 0.000 description 1
- AMLUNAVZVOQHPJ-UHFFFAOYSA-N 2-n,4-n-diphenyl-6-phenylsulfanyl-1,3,5-triazine-2,4-diamine Chemical compound N=1C(NC=2C=CC=CC=2)=NC(SC=2C=CC=CC=2)=NC=1NC1=CC=CC=C1 AMLUNAVZVOQHPJ-UHFFFAOYSA-N 0.000 description 1
- SGNIUDRKEPUBDN-UHFFFAOYSA-N 2-n-dodecyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCCCCCCCCCNC1=NC(N)=NC(SC)=N1 SGNIUDRKEPUBDN-UHFFFAOYSA-N 0.000 description 1
- SLZDTRLZKDEWNL-UHFFFAOYSA-N 2-n-tert-butyl-4-n-cyclopropyl-6-phenylsulfanyl-1,3,5-triazine-2,4-diamine Chemical compound N=1C(SC=2C=CC=CC=2)=NC(NC(C)(C)C)=NC=1NC1CC1 SLZDTRLZKDEWNL-UHFFFAOYSA-N 0.000 description 1
- BEZDFTGPMKVUAO-UHFFFAOYSA-N 2-n-tert-butyl-6-methylsulfanyl-4-n-(oxolan-2-ylmethyl)-1,3,5-triazine-2,4-diamine Chemical compound CC(C)(C)NC1=NC(SC)=NC(NCC2OCCC2)=N1 BEZDFTGPMKVUAO-UHFFFAOYSA-N 0.000 description 1
- FDVCQFAKOKLXGE-UHFFFAOYSA-N 216978-79-9 Chemical class C1CC(C)(C)C2=CC(C=O)=CC3=C2N1CCC3(C)C FDVCQFAKOKLXGE-UHFFFAOYSA-N 0.000 description 1
- VGDXLAYZTPSEBQ-UHFFFAOYSA-N 4,6-bis(benzylsulfanyl)-n-ethyl-1,3,5-triazin-2-amine Chemical compound N=1C(SCC=2C=CC=CC=2)=NC(NCC)=NC=1SCC1=CC=CC=C1 VGDXLAYZTPSEBQ-UHFFFAOYSA-N 0.000 description 1
- JITQALGKLJTHQD-UHFFFAOYSA-N 4,6-bis(butylsulfanyl)-n-dodecyl-1,3,5-triazin-2-amine Chemical compound CCCCCCCCCCCCNC1=NC(SCCCC)=NC(SCCCC)=N1 JITQALGKLJTHQD-UHFFFAOYSA-N 0.000 description 1
- JXNDCESBHAGNRX-UHFFFAOYSA-N 4,6-bis(methylsulfanyl)-n-phenyl-1,3,5-triazin-2-amine Chemical compound CSC1=NC(SC)=NC(NC=2C=CC=CC=2)=N1 JXNDCESBHAGNRX-UHFFFAOYSA-N 0.000 description 1
- HRSXMDPVWLGVTJ-UHFFFAOYSA-N 4,6-bis(phenylsulfanyl)-1,3,5-triazin-2-amine Chemical compound N=1C(SC=2C=CC=CC=2)=NC(N)=NC=1SC1=CC=CC=C1 HRSXMDPVWLGVTJ-UHFFFAOYSA-N 0.000 description 1
- SOABTYGAZUAXRS-UHFFFAOYSA-N 4-n-ethyl-6-methylsulfanyl-2-n-(oxolan-2-ylmethyl)-1,3,5-triazine-2,4-diamine Chemical compound CSC1=NC(NCC)=NC(NCC2OCCC2)=N1 SOABTYGAZUAXRS-UHFFFAOYSA-N 0.000 description 1
- XXDCPMIWWQQVMZ-UHFFFAOYSA-N 6-butylsulfanyl-2-n-(cyclopropylmethyl)-4-n-methyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCSC1=NC(NC)=NC(NCC2CC2)=N1 XXDCPMIWWQQVMZ-UHFFFAOYSA-N 0.000 description 1
- WKSAVKBBBSIALV-UHFFFAOYSA-N 6-decylsulfanyl-2-n-octyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCCCCCCCSC1=NC(N)=NC(NCCCCCCCC)=N1 WKSAVKBBBSIALV-UHFFFAOYSA-N 0.000 description 1
- OZDBPRGJTUNDHX-UHFFFAOYSA-N 6-ethylsulfanyl-2-n-hexyl-4-n-methyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCCCNC1=NC(NC)=NC(SCC)=N1 OZDBPRGJTUNDHX-UHFFFAOYSA-N 0.000 description 1
- LTFYDXJSGLBVAH-UHFFFAOYSA-N 6-hexylsulfanyl-2-n,4-n-dipentyl-1,3,5-triazine-2,4-diamine Chemical compound CCCCCCSC1=NC(NCCCCC)=NC(NCCCCC)=N1 LTFYDXJSGLBVAH-UHFFFAOYSA-N 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- DCFGGGCMICWSJX-SNAWJCMRSA-N Butyl oleate sulfate Chemical compound CCCCOC(=O)CCCCCCC\C=C\CCCCCCCCOS(O)(=O)=O DCFGGGCMICWSJX-SNAWJCMRSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- RQVYBGPQFYCBGX-UHFFFAOYSA-N ametryn Chemical compound CCNC1=NC(NC(C)C)=NC(SC)=N1 RQVYBGPQFYCBGX-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000002519 antifouling agent Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- NVVZQXQBYZPMLJ-UHFFFAOYSA-N formaldehyde;naphthalene-1-sulfonic acid Chemical compound O=C.C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 NVVZQXQBYZPMLJ-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000010808 liquid waste Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- RKRJRPWBNUHYMT-UHFFFAOYSA-N n-cyclobutyl-4,6-bis(pentylsulfanyl)-1,3,5-triazin-2-amine Chemical compound CCCCCSC1=NC(SCCCCC)=NC(NC2CCC2)=N1 RKRJRPWBNUHYMT-UHFFFAOYSA-N 0.000 description 1
- FPHASVIQIQEPKY-UHFFFAOYSA-N n-cyclopropyl-4,6-bis(methylsulfanyl)-1,3,5-triazin-2-amine Chemical compound CSC1=NC(SC)=NC(NC2CC2)=N1 FPHASVIQIQEPKY-UHFFFAOYSA-N 0.000 description 1
- SKMMKHWPZMWFML-UHFFFAOYSA-N n-decyl-4,6-bis(ethylsulfanyl)-1,3,5-triazin-2-amine Chemical compound CCCCCCCCCCNC1=NC(SCC)=NC(SCC)=N1 SKMMKHWPZMWFML-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- AAEVYOVXGOFMJO-UHFFFAOYSA-N prometryn Chemical compound CSC1=NC(NC(C)C)=NC(NC(C)C)=N1 AAEVYOVXGOFMJO-UHFFFAOYSA-N 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- HLPHHOLZSKWDAK-UHFFFAOYSA-M sodium;formaldehyde;naphthalene-1-sulfonate Chemical compound [Na+].O=C.C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 HLPHHOLZSKWDAK-UHFFFAOYSA-M 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/42—One nitrogen atom
- C07D251/46—One nitrogen atom with oxygen or sulfur atoms attached to the two other ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/48—Two nitrogen atoms
- C07D251/52—Two nitrogen atoms with an oxygen or sulfur atom attached to the third ring carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/138,858 US5420274A (en) | 1993-10-19 | 1993-10-19 | Process for the preparation of 2,4-di(alkylamino)-6-alkylthio-s-triazines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CZ256294A3 true CZ256294A3 (en) | 1995-05-17 |
Family
ID=22483976
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CZ942562A CZ256294A3 (en) | 1993-10-19 | 1994-10-17 | Enhanced process for preparing 2,4-di(alkylamino)-6-alkylthio-s-triazines |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US5420274A (Direct) |
| EP (1) | EP0648755B1 (Direct) |
| JP (1) | JP3755109B2 (Direct) |
| KR (1) | KR100335723B1 (Direct) |
| CN (1) | CN1057761C (Direct) |
| BR (1) | BR9404139A (Direct) |
| CA (1) | CA2118282C (Direct) |
| CZ (1) | CZ256294A3 (Direct) |
| DE (1) | DE69425405T2 (Direct) |
| ES (1) | ES2149858T3 (Direct) |
| RU (1) | RU2162080C2 (Direct) |
| SK (1) | SK282246B6 (Direct) |
| TW (1) | TW265339B (Direct) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR20040002159A (ko) * | 2002-06-29 | 2004-01-07 | 삼성전자주식회사 | 세탁기 |
| CN100413851C (zh) * | 2006-03-31 | 2008-08-27 | 樊能廷 | 一种制备n-环丙基-n’-(1,1-二甲基乙基)-6-(甲硫基)-1,3,5-三嗪-2,4-二胺的方法 |
| CN101502265B (zh) * | 2009-03-06 | 2011-11-23 | 山东潍坊润丰化工有限公司 | 一种催化合成三嗪类除草剂的方法 |
| US9340725B2 (en) * | 2011-08-19 | 2016-05-17 | Baker Hughes Incorporated | Use of a BTEX-free solvent to prepare stimulation and oilfield production additives |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH492400A (de) * | 1968-03-20 | 1970-06-30 | Agripat Sa | Selektives Herbizid und dessen Verwendung zur Bekämpfung von Unkräutern und Ungräsern |
| US3558622A (en) * | 1968-07-25 | 1971-01-26 | Geigy Chem Corp | Process for the production of 2,4-diamino-6-alkylthio-s-triazine |
| US3741745A (en) * | 1969-03-14 | 1973-06-26 | Ciba Geigy Corp | Herbicidal 2-alkythio-4,6-diamino-s-triazines |
| US3753986A (en) * | 1970-04-02 | 1973-08-21 | Exxon Research Engineering Co | Triazine herbicides |
| CH534477A (de) * | 1970-08-20 | 1973-03-15 | Agripat Sa | Herbizides Mittel |
| US3766182A (en) * | 1971-05-26 | 1973-10-16 | Ciba Geigy Corp | S-triazine derivatives |
| BE792101A (fr) * | 1971-12-01 | 1973-05-30 | Ciba Geigy | Composes heterocycliques et leur emploi |
| CH627919A5 (de) * | 1977-04-14 | 1982-02-15 | Ciba Geigy Ag | Herbizide mittel. |
| EP0003749B1 (de) * | 1978-02-03 | 1982-09-15 | Ciba-Geigy Ag | 2-Methylthio-4-cyclopropylamino-6-(Alpha,Beta-dimethylpropylamino)-s-triazin und die Verwendung von Triazinderivaten als Meerwasseralgizide |
| DE2850338B2 (de) * | 1978-11-20 | 1981-05-07 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von trisubstituierten s-Trianzinverbindungen |
| SU1599370A1 (ru) * | 1984-08-14 | 1990-10-15 | Вызкумны Устав Хемицкей Технологие (Инопредприятие) | Способ получени смеси 2,4-диамино-6-алкилтио-S-триазинов с 2,4-диамино-6-хлор-S-триазинами |
| JPS61189277A (ja) * | 1985-02-15 | 1986-08-22 | Idemitsu Kosan Co Ltd | トリアジン誘導体,その製造方法およびそれを有効成分とする除草剤 |
| SU1394675A1 (ru) * | 1986-01-06 | 1995-10-10 | Л.И. Ахметов | Способ получения 2-алкилтио-4,6-бис-(алкиламино)-1,3,5-триазинов |
| US4883871A (en) * | 1988-09-02 | 1989-11-28 | Ciba-Geigy Corporation | Process for the preparation of 6-alkylthio-2,4-diamino-1,3,5-triazines |
| GB8911287D0 (en) * | 1989-05-17 | 1989-07-05 | Ciba Geigy Ag | Lubricant compositions |
| DE3927623A1 (de) * | 1989-08-22 | 1991-02-28 | Hoechst Ag | N,n'-bis-1,3,5-triazin-6-yl-piperazine und verfahren zu ihrer herstellung |
-
1993
- 1993-10-19 US US08/138,858 patent/US5420274A/en not_active Expired - Fee Related
-
1994
- 1994-09-24 TW TW083108882A patent/TW265339B/zh active
- 1994-10-11 EP EP94810593A patent/EP0648755B1/en not_active Expired - Lifetime
- 1994-10-11 ES ES94810593T patent/ES2149858T3/es not_active Expired - Lifetime
- 1994-10-11 DE DE69425405T patent/DE69425405T2/de not_active Expired - Fee Related
- 1994-10-14 RU RU94038305/04A patent/RU2162080C2/ru not_active IP Right Cessation
- 1994-10-17 SK SK1256-94A patent/SK282246B6/sk unknown
- 1994-10-17 CA CA002118282A patent/CA2118282C/en not_active Expired - Fee Related
- 1994-10-17 CZ CZ942562A patent/CZ256294A3/cs unknown
- 1994-10-18 BR BR9404139A patent/BR9404139A/pt not_active IP Right Cessation
- 1994-10-18 KR KR1019940026807A patent/KR100335723B1/ko not_active Expired - Fee Related
- 1994-10-18 CN CN94117319A patent/CN1057761C/zh not_active Expired - Fee Related
- 1994-10-19 JP JP28008394A patent/JP3755109B2/ja not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| DE69425405D1 (de) | 2000-09-07 |
| CA2118282A1 (en) | 1995-04-20 |
| EP0648755A1 (en) | 1995-04-19 |
| KR950011423A (ko) | 1995-05-15 |
| TW265339B (Direct) | 1995-12-11 |
| RU2162080C2 (ru) | 2001-01-20 |
| JP3755109B2 (ja) | 2006-03-15 |
| SK282246B6 (sk) | 2001-12-03 |
| ES2149858T3 (es) | 2000-11-16 |
| KR100335723B1 (ko) | 2002-11-29 |
| CN1057761C (zh) | 2000-10-25 |
| SK125694A3 (en) | 1995-05-10 |
| JPH07188192A (ja) | 1995-07-25 |
| CA2118282C (en) | 2005-12-06 |
| CN1110276A (zh) | 1995-10-18 |
| BR9404139A (pt) | 1995-06-13 |
| EP0648755B1 (en) | 2000-08-02 |
| RU94038305A (ru) | 1996-05-27 |
| DE69425405T2 (de) | 2001-02-08 |
| US5420274A (en) | 1995-05-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0070804B1 (de) | Fluoralkoxy-aminopyrimidine und -triazine | |
| PL159749B1 (pl) | Srodek chwastobójczy PL PL | |
| CZ256294A3 (en) | Enhanced process for preparing 2,4-di(alkylamino)-6-alkylthio-s-triazines | |
| CN102471274B (zh) | 用于制备n-取代的吡啶鎓化合物的方法和物质 | |
| AU704558B2 (en) | Method of Modifying 1,3,5-triazine derivatives | |
| Masquelin et al. | Solution-and solid-phase synthesis of combinatorial libraries of trisubstituted 1, 3, 5-triazines | |
| JP2009515923A (ja) | アミノ基及びカルボキシ基含有置換基を有するトリアジン化合物 | |
| Schnabel et al. | The synthesis of substituted melams | |
| CA1062707A (en) | Triazinedione derivatives | |
| AU622827B2 (en) | N,n'-bis-1,3,5-triazin-6-ylpiperazines, and process for their preparation | |
| AU735102B2 (en) | Improved process for the preparation of unsymmetrical 4,6-bis(aryloxy) pyrimidine compounds | |
| DE3829957A1 (de) | Verfahren zur herstellung von oxyguanidinen | |
| CA1221968A (en) | Process for the preparation of sulphonyliso(thio)ureas | |
| US3479353A (en) | Preparation of 6-amino-2,4-bis(dimethylamino)-s-triazine | |
| EP0357556B1 (de) | Verfahren zur Herstellung von 6-Alkylthio-2,4-diamino-1,3,5-triazinen | |
| JPS6169765A (ja) | 1‐(2‐オキシアミノスルホニル‐フエニルスルホニル)‐尿素の製造法 | |
| US3155651A (en) | Process for the production of n, n'-tetrasubstituted 3-amino-2-azaprop-2-en-1-ylideneammonium halides | |
| KR20190051952A (ko) | 유해 생물 방제제의 최적화된 제조방법 | |
| EP0849262B1 (en) | Aminophenyl ketone derivatives and a method for the preparation thereof | |
| HU212909B (en) | Process for producing sulfonylurea derivatives | |
| Metwally et al. | Synthesis and SomeReactions of 3-Methyl-4-aryl-1-phenyl-1H-pyrazolo [3, 4-dipyrimidine-6-thiols | |
| HK1166634B (en) | Method and substances for preparation of n-substituted pyridinium compounds | |
| HK1166634A (en) | Method and substances for preparation of n-substituted pyridinium compounds | |
| MXPA99007673A (en) | Process for substitute hydrazides used carboxylium | |
| HK1012504B (en) | Aminophenyl ketone derivatives and a method for the preparation thereof |