CS244813B2 - Production method of 1-substituted azetidin-3-ole - Google Patents
Production method of 1-substituted azetidin-3-ole Download PDFInfo
- Publication number
- CS244813B2 CS244813B2 CS843245A CS324584A CS244813B2 CS 244813 B2 CS244813 B2 CS 244813B2 CS 843245 A CS843245 A CS 843245A CS 324584 A CS324584 A CS 324584A CS 244813 B2 CS244813 B2 CS 244813B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- formula
- halide
- hal
- compound
- chem
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title abstract 2
- -1 1-substituted azetidin-3-ol Chemical class 0.000 claims abstract description 12
- 150000004820 halides Chemical class 0.000 claims abstract description 12
- 150000001875 compounds Chemical class 0.000 claims abstract description 7
- 238000002360 preparation method Methods 0.000 claims abstract description 6
- 239000012736 aqueous medium Substances 0.000 claims abstract description 5
- 239000004593 Epoxy Substances 0.000 claims abstract description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 3
- 125000002924 primary amino group Chemical class [H]N([H])* 0.000 claims abstract 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 5
- 239000003960 organic solvent Substances 0.000 claims description 5
- 229930195733 hydrocarbon Natural products 0.000 claims description 4
- 150000002430 hydrocarbons Chemical class 0.000 claims description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 150000008282 halocarbons Chemical class 0.000 claims description 3
- 150000002576 ketones Chemical class 0.000 claims description 3
- 150000002828 nitro derivatives Chemical class 0.000 claims description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 239000002253 acid Substances 0.000 abstract description 5
- GFZWHAAOIVMHOI-UHFFFAOYSA-N azetidine-3-carboxylic acid Chemical class OC(=O)C1CNC1 GFZWHAAOIVMHOI-UHFFFAOYSA-N 0.000 abstract description 4
- 239000000543 intermediate Substances 0.000 abstract description 3
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000005002 aryl methyl group Chemical group 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 150000002440 hydroxy compounds Chemical class 0.000 abstract 1
- 230000008635 plant growth Effects 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- 238000007363 ring formation reaction Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- DICYXRPFUSIVJA-UHFFFAOYSA-N 1-benzylazetidin-2-ol Chemical compound OC1CCN1CC1=CC=CC=C1 DICYXRPFUSIVJA-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000003141 primary amines Chemical class 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- JOXQHYFVXZZGQZ-UHFFFAOYSA-N 1-benzylazetidin-3-ol Chemical compound C1C(O)CN1CC1=CC=CC=C1 JOXQHYFVXZZGQZ-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000012431 aqueous reaction media Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- GMWFCJXSQQHBPI-UHFFFAOYSA-N azetidin-3-ol Chemical class OC1CNC1 GMWFCJXSQQHBPI-UHFFFAOYSA-N 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical class [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- MGHPNCMVUAKAIE-UHFFFAOYSA-N diphenylmethanamine Chemical compound C=1C=CC=CC=1C(N)C1=CC=CC=C1 MGHPNCMVUAKAIE-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000036512 infertility Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000009993 protective function Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- 238000009966 trimming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/04—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Epoxy Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838312104A GB8312104D0 (en) | 1983-05-04 | 1983-05-04 | Preparation of 1-substituted azetidin-3-ol derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CS324584A2 CS324584A2 (en) | 1985-09-17 |
| CS244813B2 true CS244813B2 (en) | 1986-08-14 |
Family
ID=10542093
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS843245A CS244813B2 (en) | 1983-05-04 | 1984-05-02 | Production method of 1-substituted azetidin-3-ole |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4560507A (de) |
| EP (1) | EP0125714B1 (de) |
| JP (1) | JPS59206350A (de) |
| KR (1) | KR840009086A (de) |
| AT (1) | ATE30718T1 (de) |
| AU (1) | AU563050B2 (de) |
| BR (1) | BR8402056A (de) |
| CA (1) | CA1240685A (de) |
| CS (1) | CS244813B2 (de) |
| DD (1) | DD222015A5 (de) |
| DE (1) | DE3467345D1 (de) |
| ES (1) | ES532098A0 (de) |
| GB (1) | GB8312104D0 (de) |
| HU (1) | HU191682B (de) |
| IL (1) | IL71722A (de) |
| SU (1) | SU1318156A3 (de) |
| ZA (1) | ZA843258B (de) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8412814D0 (en) * | 1984-05-18 | 1984-06-27 | Shell Int Research | 1-substituted azetidine-3-ol derivatives |
| GB8419085D0 (en) * | 1984-07-26 | 1984-08-30 | Shell Int Research | Azetidine derivatives |
| GB8627493D0 (en) * | 1986-11-18 | 1986-12-17 | Shell Int Research | Catalytic hydrogenolysis |
| CA2362290A1 (en) * | 1999-02-18 | 2000-08-24 | Kaken Pharmaceutical Co., Ltd. | Novel amide derivatives as growth hormone secretagogues |
| KR101128678B1 (ko) * | 2008-01-16 | 2012-03-23 | 알카텔-루센트 유에스에이 인코포레이티드 | 제한된 목적들을 위한 네트워크들로의 액세스 |
| CN115385840B (zh) * | 2022-09-05 | 2024-07-02 | 北京京宇复瑞科技集团有限责任公司 | 制备3-甲氧基氮杂环丁烷盐酸盐的方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE934508C (de) * | 1954-04-23 | 1955-10-27 | Dehydag Gmbh | Verfahren zur Herstellung galvanischer Metallueberzuege |
| DE1111638B (de) * | 1956-06-22 | 1961-07-27 | Ernst Schneider Dipl Chem Dr R | Verfahren zur Herstellung von Trimethyleniminverbindungen |
| GB1236078A (en) * | 1968-07-04 | 1971-06-16 | Beecham Group Ltd | Substituted azetidinols |
| US3649618A (en) * | 1970-10-02 | 1972-03-14 | Abbott Lab | Certain 1-aralkyl azetidines |
| US4341887A (en) * | 1980-03-07 | 1982-07-27 | Petrolite Corporation | Azetidinium salts and polymers and copolymers thereof |
-
1983
- 1983-05-04 GB GB838312104A patent/GB8312104D0/en active Pending
-
1984
- 1984-04-10 CA CA000451647A patent/CA1240685A/en not_active Expired
- 1984-04-13 DE DE8484200534T patent/DE3467345D1/de not_active Expired
- 1984-04-13 AT AT84200534T patent/ATE30718T1/de not_active IP Right Cessation
- 1984-04-13 EP EP84200534A patent/EP0125714B1/de not_active Expired
- 1984-04-27 US US06/604,696 patent/US4560507A/en not_active Expired - Fee Related
- 1984-05-02 AU AU27586/84A patent/AU563050B2/en not_active Ceased
- 1984-05-02 ES ES532098A patent/ES532098A0/es active Granted
- 1984-05-02 DD DD84262630A patent/DD222015A5/de not_active IP Right Cessation
- 1984-05-02 KR KR1019840002377A patent/KR840009086A/ko not_active Withdrawn
- 1984-05-02 BR BR8402056A patent/BR8402056A/pt not_active IP Right Cessation
- 1984-05-02 ZA ZA843258A patent/ZA843258B/xx unknown
- 1984-05-02 JP JP59087982A patent/JPS59206350A/ja active Pending
- 1984-05-02 CS CS843245A patent/CS244813B2/cs unknown
- 1984-05-02 HU HU841701A patent/HU191682B/hu not_active IP Right Cessation
- 1984-05-02 IL IL71722A patent/IL71722A/xx unknown
- 1984-05-03 SU SU843735695A patent/SU1318156A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| EP0125714A1 (de) | 1984-11-21 |
| ES8505947A1 (es) | 1985-06-16 |
| IL71722A0 (en) | 1984-09-30 |
| AU563050B2 (en) | 1987-06-25 |
| ZA843258B (en) | 1984-12-24 |
| US4560507A (en) | 1985-12-24 |
| EP0125714B1 (de) | 1987-11-11 |
| HU191682B (en) | 1987-03-30 |
| HUT34002A (en) | 1985-01-28 |
| SU1318156A3 (ru) | 1987-06-15 |
| IL71722A (en) | 1987-12-20 |
| CA1240685A (en) | 1988-08-16 |
| ES532098A0 (es) | 1985-06-16 |
| GB8312104D0 (en) | 1983-06-08 |
| CS324584A2 (en) | 1985-09-17 |
| DD222015A5 (de) | 1985-05-08 |
| JPS59206350A (ja) | 1984-11-22 |
| KR840009086A (ko) | 1984-12-24 |
| DE3467345D1 (en) | 1987-12-17 |
| BR8402056A (pt) | 1984-12-11 |
| ATE30718T1 (de) | 1987-11-15 |
| AU2758684A (en) | 1984-11-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI67695B (fi) | Foerfarande foer framstaellning av 4-hydroxi-2-oxo-1-pyrrolidinalkanamider | |
| EP1383770B1 (de) | Verfahren zur herstellung von 4,6-diaminopyrimido 5,4-d]pyrimidinen | |
| CS244813B2 (en) | Production method of 1-substituted azetidin-3-ole | |
| EP0045910B1 (de) | Indolderivate und Verfahren zu ihrer Herstellung | |
| CA1122989A (en) | 5-imidazolidinones and thiohydantoin compounds | |
| DE69410222T2 (de) | Verfahren zur Herstellung von optisch aktiven Erythro-3-amino-1,2-epoxy-Verbindungen | |
| DE69325660T2 (de) | Amidderivate | |
| HU178886B (en) | Process for preparing pyrazol-indazol derivatives | |
| EP0052333A1 (de) | 4-Fluor-5-oxypyrazol-Derivate und Verfahren zu ihrer Herstellung | |
| RU2329253C2 (ru) | Способ получения производных замещенного имидазола и промежуточные соединения, используемые в этом способе | |
| EP0071741B1 (de) | Verfahren zur Herstellung von 2,4-Diamino-(3,5-dimethoxy-4-methoxy-ethoxy-benzyl)-Pyrimidin | |
| GB2036744A (en) | Eburnane derivatives | |
| EP0169602B1 (de) | Herstellung von N-substituierten Azetidin-3-carbonsäurederivaten | |
| CA1197847A (en) | N-substituted polyglycidyl urazole compounds, processes for their production and pharmaceutical preparations | |
| EP0094065A2 (de) | 2-Aminobenzosäurederivate, Verfahren zu ihrer Herstellung und pharmazeutische Zubereitungen | |
| CS212220B2 (en) | Method of making the 3,3-ethylendioxy-4,5-seko-19-norandrost-9-en-5, 17-dione | |
| JPS6355512B2 (de) | ||
| US5142066A (en) | Stereoselective process for the preparation of 2-amino-ethanol derivatives having a central analgesic activity and intermidiates thereof | |
| CH646968A5 (de) | 1,4-dioxaspiro(4,5)decen-verbindungen sowie verfahren zur herstellung von 2-hydroxy-3-substituierten propylarylaethern. | |
| US3822252A (en) | 3-azetidinols | |
| US4992568A (en) | Synthesis of benzofurans | |
| JP2631668B2 (ja) | 新規ウロカニン酸誘導体 | |
| US4639334A (en) | Preparation of 1-benzylazetidine-3-ol derivatives | |
| FR2681323A1 (fr) | Nouveau derive de l'amino-2 imidazole, sa preparation et son emploi. | |
| US6328855B1 (en) | Method for producing (+)-exo-6-phenyl-3-azabicyclo-[3.2.0]heptanes |