CS199677B2 - Method of preparing esters of acrylic acid or methacrylic acid - Google Patents
Method of preparing esters of acrylic acid or methacrylic acid Download PDFInfo
- Publication number
- CS199677B2 CS199677B2 CS773511A CS351177A CS199677B2 CS 199677 B2 CS199677 B2 CS 199677B2 CS 773511 A CS773511 A CS 773511A CS 351177 A CS351177 A CS 351177A CS 199677 B2 CS199677 B2 CS 199677B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- oxidation
- catalyst
- mixture
- olefins
- catalysts
- Prior art date
Links
- 150000002148 esters Chemical class 0.000 title claims abstract description 17
- 238000000034 method Methods 0.000 title claims description 20
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 title claims description 5
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 title description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 title 1
- 239000003054 catalyst Substances 0.000 claims abstract description 48
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims abstract description 16
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims abstract description 11
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims abstract description 11
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims abstract description 6
- 239000005977 Ethylene Substances 0.000 claims abstract description 6
- 238000006709 oxidative esterification reaction Methods 0.000 claims abstract description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 21
- 238000007254 oxidation reaction Methods 0.000 claims description 21
- 230000003647 oxidation Effects 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 16
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 9
- 150000001336 alkenes Chemical class 0.000 claims description 9
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- 229910052742 iron Inorganic materials 0.000 claims description 6
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- 229910052797 bismuth Inorganic materials 0.000 claims description 5
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 5
- 229910052698 phosphorus Inorganic materials 0.000 claims description 5
- 239000011574 phosphorus Substances 0.000 claims description 5
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 4
- 229910052684 Cerium Inorganic materials 0.000 claims description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 4
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 4
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 4
- 229910052787 antimony Inorganic materials 0.000 claims description 4
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 4
- 229910052796 boron Inorganic materials 0.000 claims description 4
- 150000001735 carboxylic acids Chemical class 0.000 claims description 4
- GWXLDORMOJMVQZ-UHFFFAOYSA-N cerium Chemical compound [Ce] GWXLDORMOJMVQZ-UHFFFAOYSA-N 0.000 claims description 4
- 229910017052 cobalt Inorganic materials 0.000 claims description 4
- 239000010941 cobalt Substances 0.000 claims description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 4
- 229910052732 germanium Inorganic materials 0.000 claims description 4
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 4
- -1 isobutylene olefins Chemical class 0.000 claims description 4
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 4
- 229910052759 nickel Inorganic materials 0.000 claims description 4
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims description 4
- 229910052718 tin Inorganic materials 0.000 claims description 4
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 4
- 229910052721 tungsten Inorganic materials 0.000 claims description 4
- 239000010937 tungsten Substances 0.000 claims description 4
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052770 Uranium Inorganic materials 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- 239000011651 chromium Substances 0.000 claims description 3
- 229910001882 dioxygen Inorganic materials 0.000 claims description 3
- 125000005395 methacrylic acid group Chemical group 0.000 claims description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 claims description 3
- 239000011135 tin Substances 0.000 claims description 3
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 claims description 3
- 229910052720 vanadium Inorganic materials 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- 229910052772 Samarium Inorganic materials 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052785 arsenic Inorganic materials 0.000 claims description 2
- 229910052793 cadmium Inorganic materials 0.000 claims description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000010949 copper Substances 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- 229910052758 niobium Inorganic materials 0.000 claims description 2
- 239000010955 niobium Substances 0.000 claims description 2
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 2
- 229910052761 rare earth metal Inorganic materials 0.000 claims description 2
- 150000002910 rare earth metals Chemical class 0.000 claims description 2
- KZUNJOHGWZRPMI-UHFFFAOYSA-N samarium atom Chemical compound [Sm] KZUNJOHGWZRPMI-UHFFFAOYSA-N 0.000 claims description 2
- 229910052714 tellurium Inorganic materials 0.000 claims description 2
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052716 thallium Inorganic materials 0.000 claims description 2
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 claims description 2
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 239000011701 zinc Substances 0.000 claims description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 4
- QBWLKDFBINPHFT-UHFFFAOYSA-L 1,3,2$l^{2}-benzodioxabismin-4-one;hydrate Chemical compound O.C1=CC=C2C(=O)O[Bi]OC2=C1 QBWLKDFBINPHFT-UHFFFAOYSA-L 0.000 claims 1
- 235000019227 E-number Nutrition 0.000 claims 1
- 239000004243 E-number Substances 0.000 claims 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 abstract description 10
- 238000004519 manufacturing process Methods 0.000 abstract description 5
- 150000001252 acrylic acid derivatives Chemical class 0.000 abstract 1
- 239000012530 fluid Substances 0.000 abstract 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 abstract 1
- 239000000376 reactant Substances 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 description 16
- 150000001299 aldehydes Chemical class 0.000 description 12
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 3
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 229910052750 molybdenum Inorganic materials 0.000 description 3
- 239000011733 molybdenum Substances 0.000 description 3
- 230000001590 oxidative effect Effects 0.000 description 3
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- 239000012808 vapor phase Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- STNJBCKSHOAVAJ-UHFFFAOYSA-N Methacrolein Chemical compound CC(=C)C=O STNJBCKSHOAVAJ-UHFFFAOYSA-N 0.000 description 1
- 241000047875 Pica hudsonia Species 0.000 description 1
- WZECUPJJEIXUKY-UHFFFAOYSA-N [O-2].[O-2].[O-2].[U+6] Chemical class [O-2].[O-2].[O-2].[U+6] WZECUPJJEIXUKY-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000003795 desorption Methods 0.000 description 1
- DKUYEPUUXLQPPX-UHFFFAOYSA-N dibismuth;molybdenum;oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[Mo].[Mo].[Bi+3].[Bi+3] DKUYEPUUXLQPPX-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 1
- 235000013980 iron oxide Nutrition 0.000 description 1
- VBMVTYDPPZVILR-UHFFFAOYSA-N iron(2+);oxygen(2-) Chemical class [O-2].[Fe+2] VBMVTYDPPZVILR-UHFFFAOYSA-N 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 239000004005 microsphere Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- JTJMJGYZQZDUJJ-UHFFFAOYSA-N phencyclidine Chemical class C1CCCCN1C1(C=2C=CC=CC=2)CCCCC1 JTJMJGYZQZDUJJ-UHFFFAOYSA-N 0.000 description 1
- 239000006069 physical mixture Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/39—Preparation of carboxylic acid esters by oxidation of groups which are precursors for the acid moiety of the ester
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/691,052 US4060545A (en) | 1976-05-28 | 1976-05-28 | Preparation of unsaturated carboxylic esters from propylene or isobutylene |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS199677B2 true CS199677B2 (en) | 1980-07-31 |
Family
ID=24774973
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS773511A CS199677B2 (en) | 1976-05-28 | 1977-05-27 | Method of preparing esters of acrylic acid or methacrylic acid |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4060545A (OSRAM) |
| JP (1) | JPS52144615A (OSRAM) |
| AT (1) | AT358001B (OSRAM) |
| BE (1) | BE855157A (OSRAM) |
| BR (1) | BR7703184A (OSRAM) |
| CA (1) | CA1114833A (OSRAM) |
| CH (1) | CH631695A5 (OSRAM) |
| CS (1) | CS199677B2 (OSRAM) |
| DD (1) | DD132338A5 (OSRAM) |
| DE (1) | DE2720861A1 (OSRAM) |
| ES (1) | ES459224A1 (OSRAM) |
| FR (1) | FR2352784A1 (OSRAM) |
| GB (1) | GB1580743A (OSRAM) |
| IT (1) | IT1074536B (OSRAM) |
| MX (1) | MX144568A (OSRAM) |
| NL (1) | NL7705770A (OSRAM) |
| NO (1) | NO771875L (OSRAM) |
| PT (1) | PT66580B (OSRAM) |
| RO (1) | RO75590A (OSRAM) |
| YU (1) | YU129877A (OSRAM) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2070601B (en) * | 1980-03-05 | 1984-05-23 | Asahi Chemical Ind | Producing unsaturated carboxylic esters |
| CA1308737C (en) * | 1987-04-16 | 1992-10-13 | Syoichi Matsumoto | Process for producing methacrylic ester |
| EP0639553B1 (en) * | 1993-08-20 | 1998-01-14 | Nkk Corporation | Catalyst and method for producing phenols |
| EP1411043A1 (en) * | 2002-10-18 | 2004-04-21 | Rohm And Haas Company | Preparation of unsaturated carboxylic acids and unsaturated carboxylic acid esters from alkanes and/or alkenes |
| US7649111B2 (en) | 2005-07-25 | 2010-01-19 | Saudi Basic Industries Corporation | Catalyst for the oxidation of a mixed aldehyde feedstock to methacrylic acid and methods for making and using same |
| US7649112B2 (en) | 2005-07-25 | 2010-01-19 | Saudi Basic Industries Corporation | Integrated plant for producing 2-ethyl-hexanol and methacrylic acid and a method based thereon |
| US7732367B2 (en) | 2005-07-25 | 2010-06-08 | Saudi Basic Industries Corporation | Catalyst for methacrolein oxidation and method for making and using same |
| US7851397B2 (en) | 2005-07-25 | 2010-12-14 | Saudi Basic Industries Corporation | Catalyst for methacrolein oxidation and method for making and using same |
| EP1994978A1 (en) * | 2007-05-25 | 2008-11-26 | Evonik Röhm GmbH | Process for preparation of methyl methacrylate by esterification during oxidation |
| US8921257B2 (en) | 2011-12-02 | 2014-12-30 | Saudi Basic Industries Corporation | Dual function partial oxidation catalyst for propane to acrylic acid conversion |
| US8722940B2 (en) | 2012-03-01 | 2014-05-13 | Saudi Basic Industries Corporation | High molybdenum mixed metal oxide catalysts for the production of unsaturated aldehydes from olefins |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3293290A (en) * | 1963-03-04 | 1966-12-20 | Union Oil Co | Process for the production of unsaturated aldehydes and acids |
| BE776751A (fr) * | 1970-12-17 | 1972-06-15 | Nat Distillers Chem Corp | Procede de preparation des acrylates et des |
-
1976
- 1976-05-28 US US05/691,052 patent/US4060545A/en not_active Expired - Lifetime
-
1977
- 1977-05-09 GB GB19289/77A patent/GB1580743A/en not_active Expired
- 1977-05-10 CA CA278,088A patent/CA1114833A/en not_active Expired
- 1977-05-10 DE DE19772720861 patent/DE2720861A1/de not_active Ceased
- 1977-05-13 MX MX169125A patent/MX144568A/es unknown
- 1977-05-17 CH CH615377A patent/CH631695A5/de not_active IP Right Cessation
- 1977-05-17 BR BR3184/77A patent/BR7703184A/pt unknown
- 1977-05-20 IT IT23837/77A patent/IT1074536B/it active
- 1977-05-20 AT AT364277A patent/AT358001B/de not_active IP Right Cessation
- 1977-05-20 PT PT66580A patent/PT66580B/pt unknown
- 1977-05-20 JP JP5859377A patent/JPS52144615A/ja active Pending
- 1977-05-24 YU YU01298/77A patent/YU129877A/xx unknown
- 1977-05-25 NL NL7705770A patent/NL7705770A/xx not_active Application Discontinuation
- 1977-05-26 RO RO7790481A patent/RO75590A/ro unknown
- 1977-05-26 FR FR7716185A patent/FR2352784A1/fr active Granted
- 1977-05-26 DD DD7700199162A patent/DD132338A5/xx unknown
- 1977-05-27 NO NO771875A patent/NO771875L/no unknown
- 1977-05-27 BE BE178010A patent/BE855157A/xx unknown
- 1977-05-27 CS CS773511A patent/CS199677B2/cs unknown
- 1977-05-27 ES ES459224A patent/ES459224A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| YU129877A (en) | 1982-08-31 |
| CH631695A5 (de) | 1982-08-31 |
| BE855157A (fr) | 1977-09-16 |
| NO771875L (no) | 1977-11-29 |
| CA1114833A (en) | 1981-12-22 |
| AT358001B (de) | 1980-08-11 |
| MX144568A (es) | 1981-10-27 |
| US4060545A (en) | 1977-11-29 |
| JPS52144615A (en) | 1977-12-02 |
| PT66580B (en) | 1978-10-20 |
| IT1074536B (it) | 1985-04-20 |
| DE2720861A1 (de) | 1977-12-15 |
| ES459224A1 (es) | 1978-06-16 |
| PT66580A (en) | 1977-06-01 |
| ATA364277A (de) | 1980-01-15 |
| GB1580743A (en) | 1980-12-03 |
| FR2352784B1 (OSRAM) | 1983-10-07 |
| BR7703184A (pt) | 1978-01-31 |
| DD132338A5 (de) | 1978-09-20 |
| FR2352784A1 (fr) | 1977-12-23 |
| RO75590A (ro) | 1981-01-30 |
| NL7705770A (nl) | 1977-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP5886322B2 (ja) | 改善されたアクロレイン/アクリル酸の製造方法 | |
| JP5881620B2 (ja) | 飽和アルデヒドを選択的に低減させる触媒と、その製造方法 | |
| US4595778A (en) | Preparation of methacrylic acid and catalyst therefor | |
| CS226406B2 (en) | Method of preparing methacrolein and methacrylic acid | |
| CS199677B2 (en) | Method of preparing esters of acrylic acid or methacrylic acid | |
| US4354044A (en) | Method for preparing methacrolein | |
| US3470239A (en) | Process for preparing methacrylic acid and its esters from isobutane | |
| US4176234A (en) | Process for the oxidation of olefins to aldehydes and acids | |
| US6933407B2 (en) | Method for producing methacrylic acid from isobutane | |
| US7176335B2 (en) | Method for producing methacrolein from isobutane | |
| US6274764B1 (en) | Process for one step gas phase production of acetic acid from ethylene | |
| EP1937406B1 (en) | An integrated plant for producing 2-ethyl-hexanol and methacrylic acid and a method based thereon | |
| US3840595A (en) | Process for the conversion of unsaturated aldehydes to acids | |
| US4209640A (en) | Catalysts for the oxidation of unsaturated aldehydes | |
| US3230248A (en) | Preparation of methyl or ethyl methacrylate | |
| JPS5824417B2 (ja) | プロピレン マタハ イソブチレンカラ アクリルサント メタクリルサンノ セイゾウホウ | |
| US4250054A (en) | Catalysts for producing unsaturated aliphatic acids | |
| US4803302A (en) | Process for the production of methacrylic acid | |
| US6329549B1 (en) | Dimethyl ether for methyl group attachment on a carbon adjacent to an electron withdrawing group | |
| CA1133505A (en) | Process for the oxidation of olefins | |
| US4075232A (en) | Preparation of maleic anhydride from n-butene in a one-reactor, fluid-bed system using two different catalysts | |
| EP0168826B1 (en) | Process for producing methacrolein and methacrylic acid | |
| US3776952A (en) | Preparation of unsaturated aldehydes and acids | |
| US3846336A (en) | Novel catalyst for conversion of olefins to unsaturated aldehydes and acids | |
| US3968149A (en) | Process for the esterification in vapor phase of alpha, beta-unsaturated monocarboxylic acids |