CS198187B2 - Method of producing new derivatives diazine - Google Patents
Method of producing new derivatives diazine Download PDFInfo
- Publication number
- CS198187B2 CS198187B2 CS763445A CS344576A CS198187B2 CS 198187 B2 CS198187 B2 CS 198187B2 CS 763445 A CS763445 A CS 763445A CS 344576 A CS344576 A CS 344576A CS 198187 B2 CS198187 B2 CS 198187B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- formula
- снз
- nitrogen
- amide
- atom
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 14
- SEEPANYCNGTZFQ-UHFFFAOYSA-N sulfadiazine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)NC1=NC=CC=N1 SEEPANYCNGTZFQ-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 27
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 5
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 5
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 4
- 125000005331 diazinyl group Chemical class N1=NC(=CC=C1)* 0.000 claims abstract 4
- 125000005843 halogen group Chemical group 0.000 claims abstract 4
- -1 nitrogen-containing heterocyclic compounds Chemical class 0.000 claims description 63
- 150000001408 amides Chemical class 0.000 claims description 16
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 16
- 229910052757 nitrogen Inorganic materials 0.000 claims description 11
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 10
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 229910052717 sulfur Inorganic materials 0.000 claims description 8
- 150000001204 N-oxides Chemical group 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 125000004434 sulfur atom Chemical group 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 150000003839 salts Chemical group 0.000 claims description 6
- LKLLNYWECKEQIB-UHFFFAOYSA-N 1,3,5-triazinane Chemical compound C1NCNCN1 LKLLNYWECKEQIB-UHFFFAOYSA-N 0.000 claims description 5
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 239000007858 starting material Substances 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- 239000003701 inert diluent Substances 0.000 claims description 2
- 239000007800 oxidant agent Substances 0.000 claims description 2
- 150000003462 sulfoxides Chemical class 0.000 claims description 2
- 150000003242 quaternary ammonium salts Chemical group 0.000 claims 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims 2
- 229910052760 oxygen Inorganic materials 0.000 claims 2
- 239000001301 oxygen Substances 0.000 claims 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 1
- 235000010290 biphenyl Nutrition 0.000 claims 1
- 239000004305 biphenyl Substances 0.000 claims 1
- 125000002653 sulfanylmethyl group Chemical group [H]SC([H])([H])[*] 0.000 claims 1
- 239000011593 sulfur Substances 0.000 claims 1
- 150000008053 sultones Chemical class 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 21
- 241000224483 Coccidia Species 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 27
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 241000287828 Gallus gallus Species 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 235000013330 chicken meat Nutrition 0.000 description 7
- 244000144977 poultry Species 0.000 description 7
- 235000013594 poultry meat Nutrition 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 229910001868 water Inorganic materials 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000013543 active substance Substances 0.000 description 6
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical group C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 4
- 239000005995 Aluminium silicate Substances 0.000 description 4
- 208000003495 Coccidiosis Diseases 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 206010023076 Isosporiasis Diseases 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- 235000012211 aluminium silicate Nutrition 0.000 description 4
- 230000002192 coccidiostatic effect Effects 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 241000223932 Eimeria tenella Species 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 210000003250 oocyst Anatomy 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 125000004076 pyridyl group Chemical group 0.000 description 3
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- HLNJFEXZDGURGZ-UHFFFAOYSA-M 1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC=C1 HLNJFEXZDGURGZ-UHFFFAOYSA-M 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 206010003011 Appendicitis Diseases 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 150000004891 diazines Chemical class 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 230000003902 lesion Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- HHPRAYYKBSMXAS-UHFFFAOYSA-N 1,2,3-trimethyltriazinane Chemical compound CN1CCCN(C)N1C HHPRAYYKBSMXAS-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- TZQZNPXAAMVOKE-UHFFFAOYSA-N 2,6-dichloropyridine-3-carboxamide Chemical compound NC(=O)C1=CC=C(Cl)N=C1Cl TZQZNPXAAMVOKE-UHFFFAOYSA-N 0.000 description 1
- FFNVQNRYTPFDDP-UHFFFAOYSA-N 2-cyanopyridine Chemical class N#CC1=CC=CC=N1 FFNVQNRYTPFDDP-UHFFFAOYSA-N 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- RKASPWAVGDRTEI-UHFFFAOYSA-N 3-methyl-6-pyridin-2-yl-4h-1,3,5-oxadiazin-2-one Chemical group O1C(=O)N(C)CN=C1C1=CC=CC=N1 RKASPWAVGDRTEI-UHFFFAOYSA-N 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- SWAHETPZOXXXSE-UHFFFAOYSA-N 6-(2,6-dichloropyridin-3-yl)-3-methyl-4h-1,3,5-oxadiazin-2-one Chemical compound O1C(=O)N(C)CN=C1C1=CC=C(Cl)N=C1Cl SWAHETPZOXXXSE-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- 101100294102 Caenorhabditis elegans nhr-2 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000223924 Eimeria Species 0.000 description 1
- 241000223931 Eimeria acervulina Species 0.000 description 1
- 241000499566 Eimeria brunetti Species 0.000 description 1
- 241000223934 Eimeria maxima Species 0.000 description 1
- 241000499563 Eimeria necatrix Species 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- 240000007817 Olea europaea Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 206010047897 Weight gain poor Diseases 0.000 description 1
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 description 1
- SZPWXAOBLNYOHY-UHFFFAOYSA-N [C]1=CC=NC2=CC=CC=C12 Chemical group [C]1=CC=NC2=CC=CC=C12 SZPWXAOBLNYOHY-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 238000005902 aminomethylation reaction Methods 0.000 description 1
- 230000001195 anabolic effect Effects 0.000 description 1
- 230000000507 anthelmentic effect Effects 0.000 description 1
- 239000000921 anthelmintic agent Substances 0.000 description 1
- 229940124339 anthelmintic agent Drugs 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 238000011888 autopsy Methods 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 239000000022 bacteriostatic agent Substances 0.000 description 1
- 230000003385 bacteriostatic effect Effects 0.000 description 1
- 239000012455 biphasic mixture Substances 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 239000003224 coccidiostatic agent Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- 239000004491 dispersible concentrate Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 230000001408 fungistatic effect Effects 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- SPFONVKVPNUTBB-UHFFFAOYSA-N n-(methylaminomethyl)pyrazine-2-carboxamide;hydrochloride Chemical compound Cl.CNCNC(=O)C1=CN=CC=N1 SPFONVKVPNUTBB-UHFFFAOYSA-N 0.000 description 1
- YXIKWRWLYDBDRG-UHFFFAOYSA-N n-(methylaminomethyl)pyridine-2-carboxamide;dihydrochloride Chemical compound Cl.Cl.CNCNC(=O)C1=CC=CC=N1 YXIKWRWLYDBDRG-UHFFFAOYSA-N 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- DNXIASIHZYFFRO-UHFFFAOYSA-N pyrazoline Chemical class C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 125000005289 uranyl group Chemical group 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23K—FODDER
- A23K20/00—Accessory food factors for animal feeding-stuffs
- A23K20/10—Organic substances
- A23K20/116—Heterocyclic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Polymers & Plastics (AREA)
- Animal Husbandry (AREA)
- Zoology (AREA)
- Engineering & Computer Science (AREA)
- Food Science & Technology (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH710475 | 1975-06-02 | ||
| CH406576 | 1976-04-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS198187B2 true CS198187B2 (en) | 1980-05-30 |
Family
ID=25694550
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS763445A CS198187B2 (en) | 1975-06-02 | 1976-05-24 | Method of producing new derivatives diazine |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4064243A (de) |
| JP (1) | JPS5236677A (de) |
| AT (1) | AT346351B (de) |
| AU (1) | AU504998B2 (de) |
| CS (1) | CS198187B2 (de) |
| DE (1) | DE2624341A1 (de) |
| DK (1) | DK239976A (de) |
| ES (1) | ES448439A1 (de) |
| FR (1) | FR2313066A1 (de) |
| GB (1) | GB1549356A (de) |
| IL (1) | IL49699A (de) |
| LU (1) | LU75054A1 (de) |
| NL (1) | NL7605788A (de) |
| NZ (1) | NZ181037A (de) |
| SE (1) | SE7606163L (de) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH621049A5 (de) * | 1976-04-01 | 1981-01-15 | Ciba Geigy Ag | |
| JPS5572090A (en) * | 1978-11-27 | 1980-05-30 | Clarion Co Ltd | Elastic surface wave element |
| EP0230863A3 (de) * | 1986-01-09 | 1988-08-17 | Ciba-Geigy Ag | Oxadiazinone |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3136763A (en) * | 1962-02-27 | 1964-06-09 | Allied Chem | 3, 5-disubstituted-tetrahydro-4h-1, 3, 5-oxadiazin-4-ones |
| NL129430C (de) * | 1964-04-30 | |||
| US3468884A (en) * | 1966-08-15 | 1969-09-23 | Abbott Lab | 5-aminooxadiazines |
| US3833577A (en) * | 1972-11-13 | 1974-09-03 | Du Pont | Herbicidal oxadiazines and thiadiazines |
| US3829419A (en) * | 1973-03-26 | 1974-08-13 | Rohm & Haas | Tetrahydro-4h-1,3,5-oxadiazin-4-one |
| CH595363A5 (de) * | 1973-12-19 | 1978-02-15 | Ciba Geigy Ag |
-
1976
- 1976-05-24 CS CS763445A patent/CS198187B2/cs unknown
- 1976-05-25 US US05/689,884 patent/US4064243A/en not_active Expired - Lifetime
- 1976-05-28 NL NL7605788A patent/NL7605788A/xx not_active Application Discontinuation
- 1976-05-31 DE DE19762624341 patent/DE2624341A1/de not_active Withdrawn
- 1976-05-31 LU LU75054A patent/LU75054A1/xx unknown
- 1976-06-01 DK DK239976A patent/DK239976A/da unknown
- 1976-06-01 NZ NZ181037A patent/NZ181037A/xx unknown
- 1976-06-01 ES ES448439A patent/ES448439A1/es not_active Expired
- 1976-06-01 SE SE7606163*7A patent/SE7606163L/xx unknown
- 1976-06-01 IL IL49699A patent/IL49699A/xx unknown
- 1976-06-01 AU AU14500/76A patent/AU504998B2/en not_active Expired
- 1976-06-01 AT AT402176A patent/AT346351B/de not_active IP Right Cessation
- 1976-06-01 FR FR7616450A patent/FR2313066A1/fr active Granted
- 1976-06-02 GB GB22785/76A patent/GB1549356A/en not_active Expired
- 1976-06-02 JP JP51064430A patent/JPS5236677A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| FR2313066B1 (de) | 1979-09-21 |
| SE7606163L (sv) | 1976-12-03 |
| ATA402176A (de) | 1978-03-15 |
| DK239976A (da) | 1976-12-03 |
| IL49699A (en) | 1979-03-12 |
| GB1549356A (en) | 1979-08-08 |
| IL49699A0 (en) | 1976-10-31 |
| FR2313066A1 (fr) | 1976-12-31 |
| LU75054A1 (de) | 1977-02-15 |
| NZ181037A (en) | 1978-07-28 |
| US4064243A (en) | 1977-12-20 |
| DE2624341A1 (de) | 1976-12-16 |
| JPS5236677A (en) | 1977-03-22 |
| ES448439A1 (es) | 1977-12-01 |
| AU504998B2 (en) | 1979-11-08 |
| NL7605788A (nl) | 1976-12-06 |
| AU1450076A (en) | 1977-12-08 |
| AT346351B (de) | 1978-11-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3995039A (en) | Pyrazolo [1,5-a] [1,3,5] triazines | |
| CZ20002349A3 (en) | Inhibition of RAF-kinase by means of aryl- and heteroaryl-substituted heterocyclic ureas | |
| US3948893A (en) | 1-Phenyl-substituted 1,3,5-triazines | |
| KR20130139889A (ko) | N-헤테로아릴 화합물 | |
| EP0299972B1 (de) | Anthelmintische quaternäre alkyl-acyl-hydrazone, verfahren zur verwendung und zusammensetzungen | |
| JPS6053024B2 (ja) | 1−(4−フエノキシ−フエニル)−1,3,5−トリアジン誘導体の製造法 | |
| CS249115B2 (en) | Method of new imidazolylphenylamides production | |
| RU2146674C1 (ru) | Производные триазина, способы их получения, антипротозойная композиция, добавка в пищу животных, способ ингибирования протозои у животных | |
| US3759938A (en) | Thiazolidine derivatives | |
| DE4437406A1 (de) | Chinoxaline, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| CS198187B2 (en) | Method of producing new derivatives diazine | |
| US3929806A (en) | Isothiocyanopyridine derivatives | |
| US3855220A (en) | Pyridylium-s-triazines | |
| US3966721A (en) | Oxa- and thia-diazin-2-ones | |
| US3970752A (en) | Coccidiocidal compositions utilizing 1-phenyl-substituted 1,3,5-triazine | |
| US4100283A (en) | Growth promoting feed additive oxadiazines | |
| US6211178B1 (en) | Triazine derivative, production and use thereof | |
| DD201594A5 (de) | Verfahren zur herstellung von neuen polyazaheterocyclischen verbindungen | |
| EP0218689B1 (de) | Wurmtötende chinolinylacylhydrazone und mittel | |
| WO1986005982A2 (en) | Anthelmintic quinolinyl acylhydrazones, method of use and compositions | |
| US20210087187A1 (en) | Antimalarial heterocyclic compounds and a process for the preparation thereof | |
| US3236853A (en) | Triazolidines and process for preparing them | |
| US3985885A (en) | Isothiocyanobenzothiazoles | |
| US3853894A (en) | Isothiocyanobenzimidazoles | |
| EP4257583A1 (de) | Biphenylpyrrolidin- und biphenyldihydroimidazolderivate zur hemmung der aktivität des 5-ht7-serotoninrezeptors und pharmazeutische zusammensetzung damit als wirkstoff |