CS196387B2 - Method of producing m-phenoxy-benzaldehyde - Google Patents
Method of producing m-phenoxy-benzaldehyde Download PDFInfo
- Publication number
- CS196387B2 CS196387B2 CS776057A CS605777A CS196387B2 CS 196387 B2 CS196387 B2 CS 196387B2 CS 776057 A CS776057 A CS 776057A CS 605777 A CS605777 A CS 605777A CS 196387 B2 CS196387 B2 CS 196387B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- mixture
- formula
- bromine
- acid
- chlorine
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 15
- MRLGCTNJRREZHZ-UHFFFAOYSA-N 3-phenoxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2C=CC=CC=2)=C1 MRLGCTNJRREZHZ-UHFFFAOYSA-N 0.000 title claims description 11
- 239000000203 mixture Substances 0.000 claims description 30
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical group ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 13
- 239000000460 chlorine Substances 0.000 claims description 12
- 229910052801 chlorine Inorganic materials 0.000 claims description 12
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 claims description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 11
- 238000005658 halogenation reaction Methods 0.000 claims description 11
- 239000003999 initiator Substances 0.000 claims description 9
- 239000011541 reaction mixture Substances 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- 125000001246 bromo group Chemical group Br* 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 230000002140 halogenating effect Effects 0.000 claims description 6
- 239000004312 hexamethylene tetramine Substances 0.000 claims description 6
- 235000010299 hexamethylene tetramine Nutrition 0.000 claims description 6
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical group N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 claims description 5
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical group ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 4
- 239000011707 mineral Substances 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 150000003254 radicals Chemical class 0.000 claims description 3
- 239000004342 Benzoyl peroxide Substances 0.000 claims description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 claims description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 2
- UJUNUASMYSTBSK-UHFFFAOYSA-N 1-(bromomethyl)-3-phenoxybenzene Chemical compound BrCC1=CC=CC(OC=2C=CC=CC=2)=C1 UJUNUASMYSTBSK-UHFFFAOYSA-N 0.000 claims 1
- QUYVTGFWFHQVRO-UHFFFAOYSA-N 1-(chloromethyl)-3-phenoxybenzene Chemical compound ClCC1=CC=CC(OC=2C=CC=CC=2)=C1 QUYVTGFWFHQVRO-UHFFFAOYSA-N 0.000 claims 1
- XGCVFGOKEISJGC-UHFFFAOYSA-N 1-(dibromomethyl)-3-phenoxybenzene Chemical compound BrC(Br)C1=CC=CC(OC=2C=CC=CC=2)=C1 XGCVFGOKEISJGC-UHFFFAOYSA-N 0.000 claims 1
- JOVSDWRNVGOQNK-UHFFFAOYSA-N 1-(dichloromethyl)-3-phenoxybenzene Chemical compound ClC(Cl)C1=CC=CC(OC=2C=CC=CC=2)=C1 JOVSDWRNVGOQNK-UHFFFAOYSA-N 0.000 claims 1
- PYKCEDJHRUUDRK-UHFFFAOYSA-N 2-(tert-butyldiazenyl)-2-methylpropanenitrile Chemical group CC(C)(C)N=NC(C)(C)C#N PYKCEDJHRUUDRK-UHFFFAOYSA-N 0.000 claims 1
- UDONPJKEOAWFGI-UHFFFAOYSA-N 1-methyl-3-phenoxybenzene Chemical compound CC1=CC=CC(OC=2C=CC=CC=2)=C1 UDONPJKEOAWFGI-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 238000005481 NMR spectroscopy Methods 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- 150000001299 aldehydes Chemical class 0.000 description 9
- 230000026030 halogenation Effects 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 238000005660 chlorination reaction Methods 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 235000019198 oils Nutrition 0.000 description 7
- 239000000047 product Substances 0.000 description 5
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- -1 aralkyl halides Chemical class 0.000 description 2
- 239000012320 chlorinating reagent Substances 0.000 description 2
- 125000000950 dibromo group Chemical group Br* 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 2
- 150000003839 salts Chemical group 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- KDCWPNHXZLBNAX-UHFFFAOYSA-N 1-chloro-2-methyl-4-phenoxybenzene Chemical compound C1=C(Cl)C(C)=CC(OC=2C=CC=CC=2)=C1 KDCWPNHXZLBNAX-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- XVNKDGPKCQCFPL-UHFFFAOYSA-N 3-(tert-butyldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)CN=NC(C)(C)C XVNKDGPKCQCFPL-UHFFFAOYSA-N 0.000 description 1
- CAHQGWAXKLQREW-UHFFFAOYSA-N Benzal chloride Chemical compound ClC(Cl)C1=CC=CC=C1 CAHQGWAXKLQREW-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 1
- YIVJZNGAASQVEM-UHFFFAOYSA-N Lauroyl peroxide Chemical compound CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC YIVJZNGAASQVEM-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- 238000006007 Sommelet synthesis reaction Methods 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 101150047356 dec-1 gene Proteins 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000011874 heated mixture Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000004953 trihalomethyl group Chemical group 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/01—Preparation of ethers
- C07C41/18—Preparation of ethers by reactions not forming ether-oxygen bonds
- C07C41/22—Preparation of ethers by reactions not forming ether-oxygen bonds by introduction of halogens; by substitution of halogen atoms by other halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/56—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds
- C07C45/562—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds with nitrogen as the only hetero atom
- C07C45/565—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds with nitrogen as the only hetero atom by reaction with hexamethylene-tetramine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/726,017 US4108904A (en) | 1976-09-22 | 1976-09-22 | Process for the preparation of m-phenoxybenzaldehyde |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS196387B2 true CS196387B2 (en) | 1980-03-31 |
Family
ID=24916876
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS776057A CS196387B2 (en) | 1976-09-22 | 1977-09-19 | Method of producing m-phenoxy-benzaldehyde |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4108904A (de) |
| JP (1) | JPS5340732A (de) |
| AR (1) | AR220683A1 (de) |
| AT (1) | AT353251B (de) |
| AU (1) | AU512709B2 (de) |
| BE (1) | BE858911A (de) |
| BR (1) | BR7706236A (de) |
| CH (1) | CH632230A5 (de) |
| CS (1) | CS196387B2 (de) |
| DE (1) | DE2741764A1 (de) |
| ES (1) | ES462542A1 (de) |
| FR (1) | FR2365547A1 (de) |
| GB (1) | GB1557421A (de) |
| IL (1) | IL52749A0 (de) |
| IT (1) | IT1090307B (de) |
| NL (1) | NL7710031A (de) |
| PL (1) | PL200964A1 (de) |
| SU (1) | SU816397A3 (de) |
| YU (1) | YU225377A (de) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4377713A (en) * | 1977-09-26 | 1983-03-22 | Ethyl Corporation | Chemical process for preparing 3-phenoxybenzyl chloride |
| US4250340A (en) * | 1977-12-22 | 1981-02-10 | Croda Synthetic Chemicals Limited | Process for preparing aralkyl halides |
| US4229380A (en) * | 1978-07-17 | 1980-10-21 | Shell Oil Company | Preparation of 3-phenoxybenzaldehyde |
| DE2911237B2 (de) * | 1979-03-22 | 1981-01-29 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von p-tert-Butylbenzaldehyd und dessen am Kern durch Halogen mono substituierten Derivaten |
| DE2857580A1 (de) * | 1978-11-16 | 1980-07-31 | Hoechst Ag | P-tert.-butylbenzalbromid und dessen am kern durch halogen substituierte derivate |
| ATE670T1 (de) * | 1978-11-16 | 1982-02-15 | Hoechst Aktiengesellschaft | Verfahren zur herstellung von p-tert.-butylbenzaldehyd und dessen am kern durch halogen substituierten derivaten. |
| DE2850180A1 (de) * | 1978-11-18 | 1980-05-29 | Bayer Ag | Verfahren zur herstellung von 3-phenoxy-benzaldehyden |
| FR2445825B1 (fr) * | 1979-01-03 | 1985-07-26 | Shell Int Research | Procede de preparation de 3-phenoxybenzaldehyde |
| DE2926021C2 (de) * | 1979-06-28 | 1983-09-01 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von 3-Phenoxy-benzaldehyden |
| US4268457A (en) * | 1979-06-28 | 1981-05-19 | Hooker Chemicals & Plastics Corp. | Process for the preparation of paraphenoxybenzoylchloride |
| US4340740A (en) * | 1979-07-16 | 1982-07-20 | Sagami Chemical Research Center | Alpha-thio-alpha-aryl-substituted alkanonitrile and process for preparing alpha-aryl-substituted alkanonitrile therefrom |
| DE2934614C2 (de) * | 1979-08-28 | 1982-05-06 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Herstellung von Terephthalaldehyd bzw. Isophthalaldehyd |
| DE2942894A1 (de) * | 1979-10-24 | 1981-05-07 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von aromatischen aldehyden nach der sommelet-reaktion |
| JPS5690031A (en) * | 1979-12-21 | 1981-07-21 | Sumitomo Chem Co Ltd | Preparation of aromatic aldehyde |
| US4399075A (en) * | 1981-06-25 | 1983-08-16 | Asahi Chemical Company, Limited | Process for producing chlorinated phenoxytoluene derivatives |
| DE3304202A1 (de) * | 1983-02-08 | 1984-08-09 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von aromatischen aldehyden |
| IL74775A (en) * | 1985-04-01 | 1988-08-31 | Imi Tami Institute Research | Method for the manufacture of mixtures of 3-phenoxybenzyl bromide and 3-phenoxybenzal bromide |
| CH672584A5 (de) * | 1987-07-03 | 1989-12-15 | Nestle Sa |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2817632A (en) * | 1954-09-28 | 1957-12-24 | Goodyear Tire & Rubber | Side-chain halogenation of aromatic hydrocarbons |
| US2817633A (en) * | 1954-09-30 | 1957-12-24 | Goodyear Tire & Rubber | Side-chain halogenation of aromatic compounds |
| US2816144A (en) * | 1955-08-04 | 1957-12-10 | Robert W Harris | Production of benzaldehyde |
| US3442960A (en) * | 1967-01-23 | 1969-05-06 | Marathon Oil Co | High selectivity process for the chlorination of methylbenzenes |
| US3448156A (en) * | 1968-02-21 | 1969-06-03 | Marathon Oil Co | Preparation of naphthalene polyaldehydes |
| US3624157A (en) * | 1969-12-17 | 1971-11-30 | Velsicol Chemical Corp | Process for preparing ortho-chlorobenzaldehyde |
| IL43969A0 (en) * | 1973-01-19 | 1974-05-16 | Sumitomo Chemical Co | The preparation of m-phenoxybenzyl-alcohol and side-chain halogenated m-phenoxytoluenes |
| JPS5110228B2 (de) * | 1973-01-19 | 1976-04-02 | ||
| GB1533856A (en) * | 1975-03-24 | 1978-11-29 | Shell Int Research | Process for the preparation of meta-aryloxy benzyl bromides |
| US4085147A (en) * | 1976-02-05 | 1978-04-18 | Shell Oil Company | Preparation of meta-aryloxy-benzaldehydes |
| US4242357A (en) * | 1976-04-09 | 1980-12-30 | Bayer Aktiengesellschaft | Carboxylic acid esters for combating pests |
-
1976
- 1976-09-22 US US05/726,017 patent/US4108904A/en not_active Expired - Lifetime
-
1977
- 1977-08-16 IL IL52749A patent/IL52749A0/xx unknown
- 1977-08-24 AR AR268927A patent/AR220683A1/es active
- 1977-08-25 GB GB35795/77A patent/GB1557421A/en not_active Expired
- 1977-08-28 AU AU28091/77A patent/AU512709B2/en not_active Expired
- 1977-09-13 NL NL7710031A patent/NL7710031A/xx not_active Application Discontinuation
- 1977-09-16 DE DE19772741764 patent/DE2741764A1/de not_active Ceased
- 1977-09-19 BR BR7706236A patent/BR7706236A/pt unknown
- 1977-09-19 CS CS776057A patent/CS196387B2/cs unknown
- 1977-09-20 SU SU772522449A patent/SU816397A3/ru active
- 1977-09-20 IT IT51089/77A patent/IT1090307B/it active
- 1977-09-20 CH CH1150677A patent/CH632230A5/de not_active IP Right Cessation
- 1977-09-21 AT AT677677A patent/AT353251B/de not_active IP Right Cessation
- 1977-09-21 BE BE181084A patent/BE858911A/xx unknown
- 1977-09-21 PL PL20096477A patent/PL200964A1/xx unknown
- 1977-09-22 YU YU02253/77A patent/YU225377A/xx unknown
- 1977-09-22 FR FR7728640A patent/FR2365547A1/fr active Pending
- 1977-09-22 ES ES462542A patent/ES462542A1/es not_active Expired
- 1977-09-22 JP JP11344777A patent/JPS5340732A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| US4108904A (en) | 1978-08-22 |
| GB1557421A (en) | 1979-12-12 |
| BE858911A (fr) | 1978-03-21 |
| AT353251B (de) | 1979-11-12 |
| ATA677677A (de) | 1979-04-15 |
| AR220683A1 (es) | 1980-11-28 |
| IL52749A0 (en) | 1977-10-31 |
| DE2741764A1 (de) | 1978-03-30 |
| AU2809177A (en) | 1979-03-01 |
| BR7706236A (pt) | 1978-07-04 |
| CH632230A5 (de) | 1982-09-30 |
| NL7710031A (nl) | 1978-03-28 |
| AU512709B2 (en) | 1980-10-23 |
| IT1090307B (it) | 1985-06-26 |
| JPS5340732A (en) | 1978-04-13 |
| ES462542A1 (es) | 1978-12-16 |
| FR2365547A1 (fr) | 1978-04-21 |
| SU816397A3 (ru) | 1981-03-23 |
| PL200964A1 (pl) | 1978-07-31 |
| YU225377A (en) | 1982-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS196387B2 (en) | Method of producing m-phenoxy-benzaldehyde | |
| Hayashi et al. | Structure and synthesis of dihydroxypentyluracil from bacteriophage SP-15 deoxyribonucleic acid | |
| Marvel et al. | The Structure of Vinyl Polymers. IV. 1 The Polymers of the Methyl α-Haloacrylates | |
| US4018838A (en) | Process of preparing alkenes | |
| HU204044B (en) | Process for producing trans-aryltetraloncarboxylic acid derivatives | |
| Cai et al. | Carbon–carbon bond formation by radical addition–fragmentation reactions of O-alkylated enols | |
| HU175042B (hu) | Sposob poluchenija zameshchjonnykh benzilovykh slozhnykh ehfirov vinil-ciklopropankarbonovoj kisloty | |
| Harris et al. | Bromination of dehydroacetic acid | |
| EP1853548A1 (de) | Verfahren zur herstellung von benzoesäurederivaten über ein neues synthesezwischenprodukt | |
| US4210611A (en) | Halogenated hydrocarbons, useful as insecticide intermediates, and methods for their preparation | |
| JPS6121542B2 (de) | ||
| US3703597A (en) | Preparation of benzilic acid compounds | |
| US4417064A (en) | Biphenyl compounds and method of preparing same | |
| Herz | Azulenes. II. Synthesis of 1, 4, 8-Trisubstituted Azulenes1 | |
| Ross et al. | Pentachlorophenyl Derivatives. I. The β-Chlorination of Ethylpentachlorobenzene and the Preparation of Pentachlorostyrene | |
| US4339593A (en) | Process for the manufacture of 3,6-dialkyl resorcylic acid esters | |
| US5144070A (en) | Process for the preparation of α-iodocarbonyl compounds | |
| Hibbert et al. | SYMMETRICAL TETRABROMO-ETHYL ETHER AND “SOCALLED” TETRABROMOBUTYRALDEHYDE | |
| US2841593A (en) | Reaction of substituted benzene, chlorine, and substituted maleic anhydride and products thereof | |
| SU1025326A3 (ru) | Способ получени 2-(2,2,2-трибромэтил)-3,3-диметил-4-хлорциклобутан-1-она | |
| HU202179B (en) | Process for producing halogenated 3,3-dimethyl-5-hexen-2-one derivatives | |
| KAEDING | The Halogenation of meta-tert-Butylphenol | |
| EP0258682B1 (de) | Herstellungsverfahren von substituierten Benzoesäureestern | |
| JPS609016B2 (ja) | ホルミル基を有するスチレン誘導体の合成方法 | |
| SU1721051A1 (ru) | Способ получени 2-галоидпроизводных фурана |