AT353251B - Verfahren zur herstellung von m- phenoxybenzaldehyd - Google Patents
Verfahren zur herstellung von m- phenoxybenzaldehydInfo
- Publication number
- AT353251B AT353251B AT677677A AT677677A AT353251B AT 353251 B AT353251 B AT 353251B AT 677677 A AT677677 A AT 677677A AT 677677 A AT677677 A AT 677677A AT 353251 B AT353251 B AT 353251B
- Authority
- AT
- Austria
- Prior art keywords
- phenoxybenzaldehyde
- producing
- Prior art date
Links
- MRLGCTNJRREZHZ-UHFFFAOYSA-N 3-phenoxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2C=CC=CC=2)=C1 MRLGCTNJRREZHZ-UHFFFAOYSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/01—Preparation of ethers
- C07C41/18—Preparation of ethers by reactions not forming ether-oxygen bonds
- C07C41/22—Preparation of ethers by reactions not forming ether-oxygen bonds by introduction of halogens; by substitution of halogen atoms by other halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/56—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds
- C07C45/562—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds with nitrogen as the only hetero atom
- C07C45/565—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds with nitrogen as the only hetero atom by reaction with hexamethylene-tetramine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/726,017 US4108904A (en) | 1976-09-22 | 1976-09-22 | Process for the preparation of m-phenoxybenzaldehyde |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA677677A ATA677677A (de) | 1979-04-15 |
| AT353251B true AT353251B (de) | 1979-11-12 |
Family
ID=24916876
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT677677A AT353251B (de) | 1976-09-22 | 1977-09-21 | Verfahren zur herstellung von m- phenoxybenzaldehyd |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4108904A (de) |
| JP (1) | JPS5340732A (de) |
| AR (1) | AR220683A1 (de) |
| AT (1) | AT353251B (de) |
| AU (1) | AU512709B2 (de) |
| BE (1) | BE858911A (de) |
| BR (1) | BR7706236A (de) |
| CH (1) | CH632230A5 (de) |
| CS (1) | CS196387B2 (de) |
| DE (1) | DE2741764A1 (de) |
| ES (1) | ES462542A1 (de) |
| FR (1) | FR2365547A1 (de) |
| GB (1) | GB1557421A (de) |
| IL (1) | IL52749A0 (de) |
| IT (1) | IT1090307B (de) |
| NL (1) | NL7710031A (de) |
| PL (1) | PL200964A1 (de) |
| SU (1) | SU816397A3 (de) |
| YU (1) | YU225377A (de) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4377713A (en) * | 1977-09-26 | 1983-03-22 | Ethyl Corporation | Chemical process for preparing 3-phenoxybenzyl chloride |
| US4250340A (en) * | 1977-12-22 | 1981-02-10 | Croda Synthetic Chemicals Limited | Process for preparing aralkyl halides |
| US4229380A (en) * | 1978-07-17 | 1980-10-21 | Shell Oil Company | Preparation of 3-phenoxybenzaldehyde |
| EP0011281B1 (de) * | 1978-11-16 | 1982-02-10 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von p-tert.-Butylbenzaldehyd und dessen am Kern durch Halogen substituierten Derivaten. |
| DE2911237B2 (de) * | 1979-03-22 | 1981-01-29 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von p-tert-Butylbenzaldehyd und dessen am Kern durch Halogen mono substituierten Derivaten |
| DE2849692C3 (de) * | 1978-11-16 | 1988-10-20 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Herstellung von p-tert.- Butylbenzaldehyd und dessen am Kern durch Halogen monosubstituierten Derivaten |
| DE2850180A1 (de) * | 1978-11-18 | 1980-05-29 | Bayer Ag | Verfahren zur herstellung von 3-phenoxy-benzaldehyden |
| CH641435A5 (en) * | 1979-01-03 | 1984-02-29 | Shell Int Research | Process for the preparation of 3-phenoxybenzaldehyde |
| DE2926021C2 (de) * | 1979-06-28 | 1983-09-01 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von 3-Phenoxy-benzaldehyden |
| US4268457A (en) * | 1979-06-28 | 1981-05-19 | Hooker Chemicals & Plastics Corp. | Process for the preparation of paraphenoxybenzoylchloride |
| DE3065155D1 (en) * | 1979-07-16 | 1983-11-10 | Sagami Chem Res | Alpha-thio-alpha-aryl-substituted alkanonitriles, process for their preparation, process for preparing alpha-aryl-substituted alkanonitriles and the corresponding carboxylic acids therefrom and process for preparing intermediates |
| DE2934614C2 (de) * | 1979-08-28 | 1982-05-06 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Herstellung von Terephthalaldehyd bzw. Isophthalaldehyd |
| DE2942894A1 (de) * | 1979-10-24 | 1981-05-07 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von aromatischen aldehyden nach der sommelet-reaktion |
| JPS5690031A (en) * | 1979-12-21 | 1981-07-21 | Sumitomo Chem Co Ltd | Preparation of aromatic aldehyde |
| US4399075A (en) * | 1981-06-25 | 1983-08-16 | Asahi Chemical Company, Limited | Process for producing chlorinated phenoxytoluene derivatives |
| DE3304202A1 (de) * | 1983-02-08 | 1984-08-09 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von aromatischen aldehyden |
| IL74775A (en) * | 1985-04-01 | 1988-08-31 | Imi Tami Institute Research | Method for the manufacture of mixtures of 3-phenoxybenzyl bromide and 3-phenoxybenzal bromide |
| CH672584A5 (de) * | 1987-07-03 | 1989-12-15 | Nestle Sa |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2817632A (en) * | 1954-09-28 | 1957-12-24 | Goodyear Tire & Rubber | Side-chain halogenation of aromatic hydrocarbons |
| US2817633A (en) * | 1954-09-30 | 1957-12-24 | Goodyear Tire & Rubber | Side-chain halogenation of aromatic compounds |
| US2816144A (en) * | 1955-08-04 | 1957-12-10 | Robert W Harris | Production of benzaldehyde |
| US3442960A (en) * | 1967-01-23 | 1969-05-06 | Marathon Oil Co | High selectivity process for the chlorination of methylbenzenes |
| US3448156A (en) * | 1968-02-21 | 1969-06-03 | Marathon Oil Co | Preparation of naphthalene polyaldehydes |
| US3624157A (en) * | 1969-12-17 | 1971-11-30 | Velsicol Chemical Corp | Process for preparing ortho-chlorobenzaldehyde |
| IL43969A0 (en) * | 1973-01-19 | 1974-05-16 | Sumitomo Chemical Co | The preparation of m-phenoxybenzyl-alcohol and side-chain halogenated m-phenoxytoluenes |
| JPS5110228B2 (de) * | 1973-01-19 | 1976-04-02 | ||
| GB1533856A (en) * | 1975-03-24 | 1978-11-29 | Shell Int Research | Process for the preparation of meta-aryloxy benzyl bromides |
| US4085147A (en) * | 1976-02-05 | 1978-04-18 | Shell Oil Company | Preparation of meta-aryloxy-benzaldehydes |
| US4242357A (en) * | 1976-04-09 | 1980-12-30 | Bayer Aktiengesellschaft | Carboxylic acid esters for combating pests |
-
1976
- 1976-09-22 US US05/726,017 patent/US4108904A/en not_active Expired - Lifetime
-
1977
- 1977-08-16 IL IL52749A patent/IL52749A0/xx unknown
- 1977-08-24 AR AR268927A patent/AR220683A1/es active
- 1977-08-25 GB GB35795/77A patent/GB1557421A/en not_active Expired
- 1977-08-28 AU AU28091/77A patent/AU512709B2/en not_active Expired
- 1977-09-13 NL NL7710031A patent/NL7710031A/xx not_active Application Discontinuation
- 1977-09-16 DE DE19772741764 patent/DE2741764A1/de not_active Ceased
- 1977-09-19 BR BR7706236A patent/BR7706236A/pt unknown
- 1977-09-19 CS CS776057A patent/CS196387B2/cs unknown
- 1977-09-20 CH CH1150677A patent/CH632230A5/de not_active IP Right Cessation
- 1977-09-20 SU SU772522449A patent/SU816397A3/ru active
- 1977-09-20 IT IT51089/77A patent/IT1090307B/it active
- 1977-09-21 BE BE181084A patent/BE858911A/xx unknown
- 1977-09-21 PL PL20096477A patent/PL200964A1/xx unknown
- 1977-09-21 AT AT677677A patent/AT353251B/de not_active IP Right Cessation
- 1977-09-22 FR FR7728640A patent/FR2365547A1/fr active Pending
- 1977-09-22 JP JP11344777A patent/JPS5340732A/ja active Pending
- 1977-09-22 YU YU02253/77A patent/YU225377A/xx unknown
- 1977-09-22 ES ES462542A patent/ES462542A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2365547A1 (fr) | 1978-04-21 |
| NL7710031A (nl) | 1978-03-28 |
| DE2741764A1 (de) | 1978-03-30 |
| GB1557421A (en) | 1979-12-12 |
| PL200964A1 (pl) | 1978-07-31 |
| SU816397A3 (ru) | 1981-03-23 |
| AU2809177A (en) | 1979-03-01 |
| BE858911A (fr) | 1978-03-21 |
| AR220683A1 (es) | 1980-11-28 |
| ES462542A1 (es) | 1978-12-16 |
| CH632230A5 (de) | 1982-09-30 |
| ATA677677A (de) | 1979-04-15 |
| BR7706236A (pt) | 1978-07-04 |
| YU225377A (en) | 1982-06-30 |
| AU512709B2 (en) | 1980-10-23 |
| JPS5340732A (en) | 1978-04-13 |
| IL52749A0 (en) | 1977-10-31 |
| CS196387B2 (en) | 1980-03-31 |
| US4108904A (en) | 1978-08-22 |
| IT1090307B (it) | 1985-06-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ATA196177A (de) | Verfahren zur herstellung von chlordioxid | |
| AT363196B (de) | Verfahren zur herstellung von androstan-17-on-derivaten | |
| AT353251B (de) | Verfahren zur herstellung von m- phenoxybenzaldehyd | |
| AT352701B (de) | Verfahren zur herstellung von m-phenoxybenzal- dehyd | |
| AT358729B (de) | Verfahren zur herstellung von 3-halogenmethyl-3 -cephemen | |
| AT352138B (de) | Verfahren zur herstellung von 2-chlorsulfinyl- azetidin-4-onen | |
| AT347437B (de) | Verfahren zur herstellung von benzoylcyanid | |
| AT347439B (de) | Verfahren zur herstellung von benzoylcyanid | |
| AT364817B (de) | Verfahren zur herstellung von aminocyclolen | |
| AT356129B (de) | Verfahren zur herstellung von substituierten 1-carbamoyl-2-cyanaziridinen | |
| AT347438B (de) | Verfahren zur herstellung von benzoylcyanid | |
| DD134228A5 (de) | Verfahren zur herstellung von spirooxazolidindionen | |
| AT374809B (de) | Verfahren zur herstellung von alkalizellulose | |
| AT355013B (de) | Verfahren zur herstellung von 2-oxo-pyrrolidin- n-alkylamiden | |
| AT352910B (de) | Verfahren zur herstellung von beta-mehtyl- digoxin | |
| AT358055B (de) | Verfahren zur herstellung von 2-chlor-4,6-bis- -alkylamino-s-triazinen | |
| DD130659A5 (de) | Verfahren zur herstellung von oxothiaverbindungen | |
| AT362009B (de) | Verfahren zur herstellung von leiterplatten | |
| AT361226B (de) | Verfahren zur herstellung von spanplatten | |
| AT375848B (de) | Verfahren zur herstellung von bloecken | |
| ATA966976A (de) | Verfahren zur herstellung von 2-aminoindanderivaten | |
| AT352274B (de) | Verfahren zur herstellung von 7-alkoxy-3- brommethylcephemen | |
| AT388155B (de) | Verfahren zur herstellung von chlordioxid | |
| ATA9884A (de) | Verfahren zur herstellung von chlordioxid | |
| DD138018A3 (de) | Verfahren zur herstellung von polyphenylchinoxalinimiden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |