CS196248B2 - Process for preparing pyrocatechinetheres - Google Patents
Process for preparing pyrocatechinetheres Download PDFInfo
- Publication number
- CS196248B2 CS196248B2 CS737335A CS733573A CS196248B2 CS 196248 B2 CS196248 B2 CS 196248B2 CS 737335 A CS737335 A CS 737335A CS 733573 A CS733573 A CS 733573A CS 196248 B2 CS196248 B2 CS 196248B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- parts
- weight
- снз
- formula
- toluene
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims abstract description 20
- 150000001875 compounds Chemical class 0.000 claims abstract description 17
- YCIMNLLNPGFGHC-UHFFFAOYSA-N o-dihydroxy-benzene Natural products OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 claims abstract description 17
- -1 Pyrocatechol ethers Chemical class 0.000 claims abstract description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 26
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 18
- WBLIXGSTEMXDSM-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH2] WBLIXGSTEMXDSM-UHFFFAOYSA-N 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 5
- 241000238876 Acari Species 0.000 claims description 4
- 239000012230 colorless oil Substances 0.000 claims description 2
- 230000000694 effects Effects 0.000 claims description 2
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims 2
- 238000001816 cooling Methods 0.000 claims 2
- 239000003208 petroleum Substances 0.000 claims 2
- 239000011541 reaction mixture Substances 0.000 claims 2
- 238000001953 recrystallisation Methods 0.000 claims 2
- NFKRBIJFEJTLBQ-UHFFFAOYSA-N 2-(1-methoxyethoxy)phenol Chemical compound COC(C)OC1=CC=CC=C1O NFKRBIJFEJTLBQ-UHFFFAOYSA-N 0.000 claims 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims 1
- 239000013078 crystal Substances 0.000 claims 1
- 239000003814 drug Substances 0.000 claims 1
- 238000001704 evaporation Methods 0.000 claims 1
- 230000008020 evaporation Effects 0.000 claims 1
- 239000000463 material Substances 0.000 claims 1
- UFEJKYYYVXYMMS-UHFFFAOYSA-N methylcarbamic acid Chemical compound CNC(O)=O UFEJKYYYVXYMMS-UHFFFAOYSA-N 0.000 claims 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims 1
- 150000003014 phosphoric acid esters Chemical class 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 12
- 125000004432 carbon atom Chemical group C* 0.000 abstract description 5
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 4
- 125000000217 alkyl group Chemical group 0.000 abstract description 4
- 229910052799 carbon Inorganic materials 0.000 abstract description 4
- 239000001257 hydrogen Substances 0.000 abstract description 4
- 229910052794 bromium Inorganic materials 0.000 abstract description 3
- 150000001721 carbon Chemical group 0.000 abstract description 3
- 229910052801 chlorine Inorganic materials 0.000 abstract description 3
- 125000003342 alkenyl group Chemical group 0.000 abstract description 2
- 125000000304 alkynyl group Chemical group 0.000 abstract description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract description 2
- 229910052736 halogen Inorganic materials 0.000 abstract description 2
- 229910052740 iodine Inorganic materials 0.000 abstract description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract description 2
- 239000000376 reactant Substances 0.000 abstract description 2
- 150000003839 salts Chemical class 0.000 abstract description 2
- 125000001424 substituent group Chemical group 0.000 abstract 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 abstract 1
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 125000004430 oxygen atom Chemical group O* 0.000 abstract 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000238631 Hexapoda Species 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000004476 plant protection product Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2252198A DE2252198C2 (de) | 1972-10-25 | 1972-10-25 | Brenzkatechinäther und Verfahren zu ihrer Herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS196248B2 true CS196248B2 (en) | 1980-03-31 |
Family
ID=5859959
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS737335A CS196248B2 (en) | 1972-10-25 | 1973-10-24 | Process for preparing pyrocatechinetheres |
Country Status (13)
| Country | Link |
|---|---|
| JP (1) | JPS5747653B2 (enExample) |
| BE (1) | BE806132A (enExample) |
| CA (1) | CA1036612A (enExample) |
| CH (1) | CH589581A5 (enExample) |
| CS (1) | CS196248B2 (enExample) |
| DD (1) | DD107251A5 (enExample) |
| DE (1) | DE2252198C2 (enExample) |
| FR (1) | FR2204604B1 (enExample) |
| GB (1) | GB1444967A (enExample) |
| IL (1) | IL43480A (enExample) |
| IT (1) | IT1008584B (enExample) |
| NL (1) | NL7314701A (enExample) |
| SU (1) | SU629871A3 (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4163112A (en) * | 1977-04-04 | 1979-07-31 | Velsicol Chemical Corporation | O-alkoxy- and alkylthiophenyl carbamates |
| GR74976B (enExample) * | 1980-08-13 | 1984-07-12 | Interx Research Corp | |
| CN114230446B (zh) * | 2022-01-17 | 2022-12-20 | 山东泓瑞医药科技股份公司 | 一种藜芦醚的制备方法 |
-
1972
- 1972-10-25 DE DE2252198A patent/DE2252198C2/de not_active Expired
-
1973
- 1973-10-01 DD DD173804A patent/DD107251A5/xx unknown
- 1973-10-16 BE BE136737A patent/BE806132A/xx not_active IP Right Cessation
- 1973-10-17 CA CA183,560A patent/CA1036612A/en not_active Expired
- 1973-10-19 JP JP48117013A patent/JPS5747653B2/ja not_active Expired
- 1973-10-24 GB GB4940373A patent/GB1444967A/en not_active Expired
- 1973-10-24 IT IT53328/73A patent/IT1008584B/it active
- 1973-10-24 CS CS737335A patent/CS196248B2/cs unknown
- 1973-10-24 SU SU731965924A patent/SU629871A3/ru active
- 1973-10-24 CH CH1498573A patent/CH589581A5/xx not_active IP Right Cessation
- 1973-10-25 IL IL43480A patent/IL43480A/en unknown
- 1973-10-25 NL NL7314701A patent/NL7314701A/xx not_active Application Discontinuation
- 1973-10-25 FR FR7338131A patent/FR2204604B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SU629871A3 (ru) | 1978-10-25 |
| DE2252198A1 (de) | 1974-05-09 |
| IT1008584B (it) | 1976-11-30 |
| CA1036612A (en) | 1978-08-15 |
| IL43480A (en) | 1977-06-30 |
| AU6151773A (en) | 1975-04-17 |
| NL7314701A (enExample) | 1974-04-29 |
| DE2252198C2 (de) | 1981-11-26 |
| CH589581A5 (enExample) | 1977-07-15 |
| JPS5747653B2 (enExample) | 1982-10-12 |
| DD107251A5 (enExample) | 1974-07-20 |
| GB1444967A (en) | 1976-08-04 |
| JPS4972222A (enExample) | 1974-07-12 |
| IL43480A0 (en) | 1974-01-14 |
| FR2204604B1 (enExample) | 1978-09-08 |
| FR2204604A1 (enExample) | 1974-05-24 |
| BE806132A (fr) | 1974-04-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0182738B1 (de) | Verfahren zur Herstellung fungizid aktiver 4-Phenyl-pyrrol-Derivate | |
| US3042710A (en) | Ethenoid carbonyl compounds | |
| US2445892A (en) | Amino fatty derivatives | |
| CS196248B2 (en) | Process for preparing pyrocatechinetheres | |
| Senkus | The Preparation of Some Hexahydropyrimidines from Nitroparaffins1 | |
| US2535172A (en) | Dialkyl 2-alkoxy-ethanephosphonates and process of preparing | |
| US2395336A (en) | Amino ethers | |
| US2813877A (en) | N-substituted bicyclo-(2.2.1)-5-heptene-2, 3-dicarboximides | |
| US8729277B2 (en) | Processes for the synthesis of gamma nitrocarbonyl and gamma dicarbonyl compounds and their pyrrole derivatives | |
| US2535173A (en) | 3-phosphonopropane-1, 1-dicarboxylic acid esters and method of preparation | |
| Kharlamov et al. | Synthesis of some acyclic quaternary ammonium compounds. Alkylation of secondary and tertiary amines in a two-phase system | |
| US2390918A (en) | Gamma-nitro monocarboxylic esters | |
| US2665301A (en) | Aryl esters of chlorobenzoic acid | |
| US2956919A (en) | 1-oxo-2-halo phosphonates | |
| US3384641A (en) | 2-methylene-3-quinuclidones | |
| US4219672A (en) | Ether carboxylic acids | |
| US2394583A (en) | Thiocyano aliphatic acid esters of endoethylene-hydroxycyclopentanoindane | |
| US3213127A (en) | Cyclooctyl trichloroacetate | |
| DK159771B (da) | Fremgangsmaade til fremstillingen af cyklopropancarboxylsyreestere | |
| US3148204A (en) | Halogenated ether cyano esters | |
| US3988380A (en) | Process for preparing 1,2-disubstituted-trans-olefins | |
| US2213218A (en) | Insecticide | |
| CS198129B2 (en) | Method of preparing pyrocatechol ethers | |
| US3217036A (en) | 2-hydrocarbylthioalkanaldoxime compounds | |
| US2500942A (en) | Ethers of beta-hydroxyadiponitrile |