CH679043A5 - - Google Patents
Download PDFInfo
- Publication number
- CH679043A5 CH679043A5 CH354989A CH354989A CH679043A5 CH 679043 A5 CH679043 A5 CH 679043A5 CH 354989 A CH354989 A CH 354989A CH 354989 A CH354989 A CH 354989A CH 679043 A5 CH679043 A5 CH 679043A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- atoms
- same meaning
- epichlorohydrin
- compounds
- Prior art date
Links
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 150000001448 anilines Chemical class 0.000 claims description 14
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 238000006704 dehydrohalogenation reaction Methods 0.000 claims description 8
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 claims description 8
- VAUOPRZOGIRSMI-UHFFFAOYSA-N n-(oxiran-2-ylmethyl)aniline Chemical class C1OC1CNC1=CC=CC=C1 VAUOPRZOGIRSMI-UHFFFAOYSA-N 0.000 claims description 8
- 125000001931 aliphatic group Chemical group 0.000 claims description 7
- 239000003586 protic polar solvent Substances 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 5
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 230000007717 exclusion Effects 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 150000003945 chlorohydrins Chemical class 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000000732 arylene group Chemical group 0.000 claims description 2
- 125000004185 ester group Chemical group 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000001302 tertiary amino group Chemical group 0.000 claims description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000000203 mixture Substances 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 239000011261 inert gas Substances 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- 239000004593 Epoxy Substances 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 150000002924 oxiranes Chemical class 0.000 description 3
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 239000003822 epoxy resin Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 229920000647 polyepoxide Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- -1 aromatic anilines Chemical class 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000004377 microelectronic Methods 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical class N1(CCCC2=CC=CC=C12)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/36—Compounds containing oxirane rings with hydrocarbon radicals, substituted by nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Epoxy Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DD32051888A DD295369A5 (de) | 1988-10-06 | 1988-10-06 | Verfahren zur herstellung von substituierten glycidylanilinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH679043A5 true CH679043A5 (enExample) | 1991-12-13 |
Family
ID=5602989
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH354989A CH679043A5 (enExample) | 1988-10-06 | 1989-09-29 |
Country Status (3)
| Country | Link |
|---|---|
| CH (1) | CH679043A5 (enExample) |
| DD (1) | DD295369A5 (enExample) |
| DE (1) | DE3932352A1 (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5481011A (en) * | 1994-12-13 | 1996-01-02 | Bristol-Myers Squibb Company | Process for preparing N-protected amino acid α-halomethyl ketones and alcohols from N-protected amino acid esters |
-
1988
- 1988-10-06 DD DD32051888A patent/DD295369A5/de not_active IP Right Cessation
-
1989
- 1989-09-28 DE DE19893932352 patent/DE3932352A1/de not_active Withdrawn
- 1989-09-29 CH CH354989A patent/CH679043A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE3932352A1 (de) | 1990-04-12 |
| DD295369A5 (de) | 1991-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1151345A (en) | Curable mixtures containing dimethylamino derivatives | |
| EP0001616B1 (de) | Härtbare Epoxidharzgemische | |
| CH651006A5 (de) | Verfahren zur herstellung von 2-methylenaldehyden. | |
| DE69425288T2 (de) | Katalysatore auf Basis von bizyclischen Amidinen und ihre Verwendung in heisshärtbaren Zusammensetzungen | |
| DE2319815C2 (de) | Propionsäureglycidylestergruppen enthaltende Cycloalkanone, Verfahren zu deren Herstellung und Verwendung derselben | |
| CH679043A5 (enExample) | ||
| DE4425696A1 (de) | Verfahren zur Herstellung 1,3-disubstituierter Imidazolidinone | |
| DE3403778A1 (de) | Cyanomethyl-(2-cyano-ethyl)-(3-hydroxy-propyl)-amin seine verwendung zur herstellung von 1-(3-hydroxy-propyl)-1,4-diazepan und 1,4-bis(3-(3,4,5-trimethoxybenzoyloxy)-propyl)-diazepan | |
| DE1158083B (de) | Verfahren zur Herstellung basisch substituierter Phenylacetonitrile | |
| DE2446489A1 (de) | Verfahren zur herstellung von bis(2-cyanoaethyl)-aethylendiamin | |
| EP0000763A1 (de) | Glycidylätheramine und Verfahren zu ihrer Herstellung | |
| DE1102157B (de) | Verfahren zur Herstellung von ungesaettigten Acylaminomethyl-aminen | |
| DE60100523T2 (de) | Verfahren zur Herstellung von N-carboxy-t-leucin Anhydrid | |
| EP0085653B1 (de) | 1,10-Substituierte 1,11-Diamino-undeca-3,7-diene und Verfahren zu deren Herstellung | |
| DE1941175A1 (de) | N-Formyl-beta-(N'-alkylenimino)-alkylamine | |
| DE2111201C3 (de) | Verfahren zur Herstellung von m (beta Cyanathoxy) benzoesäure und ihrer C tief 1 4 Alkylester | |
| DE3607993A1 (de) | Verfahren zur herstellung von diaziridinen und produkte daraus | |
| DE1910295A1 (de) | Verfahren zur Herstellung von 1-Naphthyl-N-alkyl-carbamaten | |
| EP0170872B1 (de) | Verfahren zur Herstellung, von 3,7-Bisacetaminoheptanon-2 | |
| DE2145660A1 (de) | Verfahren zur herstellung von acetondicarbonsaeureestern | |
| EP0085652A1 (de) | 1,10-substituierte 10-Amino-deca-3,7-dien-nitrile und Verfahren zu deren Herstellung | |
| CH526542A (de) | Verfahren zur Herstellung neuer Indolderivate | |
| DE1137439B (de) | Verfahren zur Herstellung von substituierten Morpholinen | |
| DE1150994B (de) | Verfahren zur Herstellung von N-disubstituierten Amidosulfinyl-chloriden | |
| DE2711956A1 (de) | Ungesaettigte carbodiimide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |