CH645624A5 - Verfahren zur herstellung von pyridoxin. - Google Patents
Verfahren zur herstellung von pyridoxin. Download PDFInfo
- Publication number
- CH645624A5 CH645624A5 CH9781A CH9781A CH645624A5 CH 645624 A5 CH645624 A5 CH 645624A5 CH 9781 A CH9781 A CH 9781A CH 9781 A CH9781 A CH 9781A CH 645624 A5 CH645624 A5 CH 645624A5
- Authority
- CH
- Switzerland
- Prior art keywords
- compound
- formula
- acid
- reaction
- pyridoxine
- Prior art date
Links
- LXNHXLLTXMVWPM-UHFFFAOYSA-N pyridoxine Chemical compound CC1=NC=C(CO)C(CO)=C1O LXNHXLLTXMVWPM-UHFFFAOYSA-N 0.000 title claims description 19
- 229940011671 vitamin b6 Drugs 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 24
- 238000000034 method Methods 0.000 claims description 12
- 235000008160 pyridoxine Nutrition 0.000 claims description 9
- 239000011677 pyridoxine Substances 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 11
- 239000000203 mixture Substances 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 7
- ZUFQODAHGAHPFQ-UHFFFAOYSA-N pyridoxine hydrochloride Chemical compound Cl.CC1=NC=C(CO)C(CO)=C1O ZUFQODAHGAHPFQ-UHFFFAOYSA-N 0.000 description 7
- 229960004172 pyridoxine hydrochloride Drugs 0.000 description 7
- 235000019171 pyridoxine hydrochloride Nutrition 0.000 description 7
- 239000011764 pyridoxine hydrochloride Substances 0.000 description 7
- SKBKDEPPSMMUIC-UHFFFAOYSA-N 2-(5-ethoxy-1,3-oxazol-4-yl)acetic acid Chemical compound CCOC=1OC=NC=1CC(O)=O SKBKDEPPSMMUIC-UHFFFAOYSA-N 0.000 description 6
- 239000013078 crystal Substances 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- -1 ethylene compound Chemical class 0.000 description 4
- 150000002430 hydrocarbons Chemical group 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- DMGDSBIHRJJUGP-UHFFFAOYSA-N 2-propan-2-yl-4,7-dihydro-1,3-dioxepine Chemical compound CC(C)C1OCC=CCO1 DMGDSBIHRJJUGP-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 238000005698 Diels-Alder reaction Methods 0.000 description 3
- BGRDGMRNKXEXQD-UHFFFAOYSA-N Maleic hydrazide Chemical compound OC1=CC=C(O)N=N1 BGRDGMRNKXEXQD-UHFFFAOYSA-N 0.000 description 3
- PEEHTFAAVSWFBL-UHFFFAOYSA-N Maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229910001873 dinitrogen Inorganic materials 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229910001220 stainless steel Inorganic materials 0.000 description 3
- 239000010935 stainless steel Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- JOWXBGIZDALBJW-UHFFFAOYSA-N 3h-dioxepine Chemical compound C1OOC=CC=C1 JOWXBGIZDALBJW-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 125000000174 L-prolyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 description 2
- 239000005983 Maleic hydrazide Substances 0.000 description 2
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- ATZGUXPLGMKHOR-UHFFFAOYSA-N 2,2-dimethyl-4,7-dihydro-1,3-dioxepine Chemical compound CC1(C)OCC=CCO1 ATZGUXPLGMKHOR-UHFFFAOYSA-N 0.000 description 1
- MHNSPTUQQIYJOT-UHFFFAOYSA-N 3-(6h-benzo[c][1]benzoxepin-11-ylidene)propyl-dimethylazanium;chloride Chemical compound Cl.C1OC2=CC=CC=C2C(=CCCN(C)C)C2=CC=CC=C21 MHNSPTUQQIYJOT-UHFFFAOYSA-N 0.000 description 1
- BAKUAUDFCNFLBX-UHFFFAOYSA-N 4,7-dihydro-1,3-dioxepine Chemical compound C1OCC=CCO1 BAKUAUDFCNFLBX-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- JUEDKAHASOTKCM-UHFFFAOYSA-N C1=C(N=CO1)OCC(=O)O Chemical group C1=C(N=CO1)OCC(=O)O JUEDKAHASOTKCM-UHFFFAOYSA-N 0.000 description 1
- HNUALPPJLMYHDK-UHFFFAOYSA-N C[CH]C Chemical compound C[CH]C HNUALPPJLMYHDK-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- LVDRREOUMKACNJ-BKMJKUGQSA-N N-[(2R,3S)-2-(4-chlorophenyl)-1-(1,4-dimethyl-2-oxoquinolin-7-yl)-6-oxopiperidin-3-yl]-2-methylpropane-1-sulfonamide Chemical compound CC(C)CS(=O)(=O)N[C@H]1CCC(=O)N([C@@H]1c1ccc(Cl)cc1)c1ccc2c(C)cc(=O)n(C)c2c1 LVDRREOUMKACNJ-BKMJKUGQSA-N 0.000 description 1
- ITEPDODPZUQDIJ-UHFFFAOYSA-N acetic acid;1,3-oxazole Chemical class CC([O-])=O.C1=COC=[NH+]1 ITEPDODPZUQDIJ-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000001509 aspartic acid derivatives Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- NKDDWNXOKDWJAK-UHFFFAOYSA-N dimethoxymethane Chemical compound COCOC NKDDWNXOKDWJAK-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 235000021190 leftovers Nutrition 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/65—One oxygen atom attached in position 3 or 5
- C07D213/66—One oxygen atom attached in position 3 or 5 having in position 3 an oxygen atom and in each of the positions 4 and 5 a carbon atom bound to an oxygen, sulphur, or nitrogen atom, e.g. pyridoxal
- C07D213/67—2-Methyl-3-hydroxy-4,5-bis(hydroxy-methyl)pyridine, i.e. pyridoxine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP237280A JPS5699461A (en) | 1980-01-11 | 1980-01-11 | Preparation of pyridine derivative |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH645624A5 true CH645624A5 (de) | 1984-10-15 |
Family
ID=11527412
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH9781A CH645624A5 (de) | 1980-01-11 | 1981-01-08 | Verfahren zur herstellung von pyridoxin. |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4339586A (enExample) |
| JP (1) | JPS5699461A (enExample) |
| CA (1) | CA1128948A (enExample) |
| CH (1) | CH645624A5 (enExample) |
| DE (1) | DE3100502A1 (enExample) |
| DK (1) | DK154762C (enExample) |
| GB (1) | GB2068966B (enExample) |
| YU (1) | YU42547B (enExample) |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH505131A (de) * | 1969-03-25 | 1971-03-31 | Hoffmann La Roche | Verfahren zur Herstellung von heterocyklischen Verbindungen |
| CH505095A (de) * | 1969-03-25 | 1971-03-31 | Hoffmann La Roche | Verfahren zur Herstellung von Pyridoxin |
-
1980
- 1980-01-11 JP JP237280A patent/JPS5699461A/ja active Granted
- 1980-12-29 YU YU3301/80A patent/YU42547B/xx unknown
-
1981
- 1981-01-08 GB GB8100475A patent/GB2068966B/en not_active Expired
- 1981-01-08 CH CH9781A patent/CH645624A5/de not_active IP Right Cessation
- 1981-01-08 DK DK006281A patent/DK154762C/da not_active IP Right Cessation
- 1981-01-09 DE DE19813100502 patent/DE3100502A1/de active Granted
- 1981-01-09 CA CA368,241A patent/CA1128948A/en not_active Expired
- 1981-01-09 US US06/223,923 patent/US4339586A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6143346B2 (enExample) | 1986-09-26 |
| DK154762C (da) | 1989-05-22 |
| DE3100502C2 (enExample) | 1989-11-09 |
| DK6281A (da) | 1981-07-12 |
| CA1128948A (en) | 1982-08-03 |
| YU330180A (en) | 1983-02-28 |
| GB2068966B (en) | 1983-07-20 |
| DK154762B (da) | 1988-12-19 |
| GB2068966A (en) | 1981-08-19 |
| DE3100502A1 (de) | 1981-12-03 |
| US4339586A (en) | 1982-07-13 |
| YU42547B (en) | 1988-10-31 |
| JPS5699461A (en) | 1981-08-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2943098C2 (enExample) | ||
| DE3322459C2 (enExample) | ||
| EP0591798B1 (de) | Verfahren zur Herstellung von O-substituierten Hydroxylammoniumsalzen | |
| DE3875281T2 (de) | Herstellung von pseudoiononen. | |
| EP0847976A1 (de) | Verfahren zur Herstellung von Glyoxalmonoacetalen | |
| DE2608932C2 (de) | Verfahren zur Herstellung von 3-Oxy-4H-pyran-4-on-Derivaten | |
| EP0233337B1 (de) | Verfahren zur Herstellung von Carbonylverbindungen | |
| DE2919974A1 (de) | Verfahren zur herstellung von cyanhydrinacylaten von aldehyden | |
| DE69513869T2 (de) | Verfahren zur Wiedergewinnung von Propylenoxid | |
| DE3125329A1 (de) | Verfahren zur herstellung von derivaten der vinylphosphon- oder vinylpyrophosphonsaeure | |
| CH645624A5 (de) | Verfahren zur herstellung von pyridoxin. | |
| DE3131096A1 (de) | Verfahren zur herstellung von n-substituierten methacryl- und acrylamiden | |
| DE2430192A1 (de) | Verfahren zur herstellung von ungesaettigten ketonen | |
| EP0251058A2 (de) | Verfahren zur Racemisierung optisch aktiver- Phenoxy- propionsäureester und deren Derivate | |
| EP0171046B1 (de) | Verfahren zur Herstellung von Pantolacton | |
| DE2528367C3 (de) | Verfahren zur Herstellung von aromatischen Urethanen | |
| DE3783431T2 (de) | Herstellungsverfahren von 2,6-diacetoxynaphthalen. | |
| DE960813C (de) | Verfahren zur Herstellung von ungesaettigten ª†- und ª€-Laktonen | |
| DE3325976C2 (enExample) | ||
| EP0257519B1 (de) | Verfahren zur Behandlung von wässrigen Lösungen, die bei der Carbalkoxylierung von olefinsch ungesättigten Verbindungen anfallen | |
| EP0038007B1 (de) | Verfahren zur Herstellung von N-(3,5-Dichlorphenyl)-oxazolidin-2,4-dionen | |
| DE2314454A1 (de) | Verfahren zur kontinuierlichen herstellung von carbonsaeuren | |
| DE2629188C3 (de) | Verfahren zur gleichzeitigen Herstellung von p-Tolylsäure und Alkylenoxiden | |
| EP0773213A2 (de) | Verfahren zur Herstellung von (2RS,3RS)-3-(2'-Aminophenylthio)-2-hydroxy-3-(4"-methoxyphenyl)-propionsäuremethylester | |
| EP0361119B1 (de) | Verfahren zur Herstellung von Benzophenonen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PFA | Name/firm changed |
Owner name: TAKEDA CHEMICAL INDUSTRIES, LTD |
|
| PL | Patent ceased | ||
| PL | Patent ceased |