CH637914A5 - Dipeptid-aminosaeureester-additionsverbindungen und verfahren zu ihrer herstellung bzw. zersetzung. - Google Patents
Dipeptid-aminosaeureester-additionsverbindungen und verfahren zu ihrer herstellung bzw. zersetzung. Download PDFInfo
- Publication number
- CH637914A5 CH637914A5 CH35378A CH35378A CH637914A5 CH 637914 A5 CH637914 A5 CH 637914A5 CH 35378 A CH35378 A CH 35378A CH 35378 A CH35378 A CH 35378A CH 637914 A5 CH637914 A5 CH 637914A5
- Authority
- CH
- Switzerland
- Prior art keywords
- acid
- group
- addition compound
- methyl ester
- ester
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 152
- 238000000034 method Methods 0.000 title claims description 44
- 238000000354 decomposition reaction Methods 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title description 2
- -1 aminocarboxylic acid ester Chemical class 0.000 claims description 65
- 239000002253 acid Substances 0.000 claims description 52
- 239000000243 solution Substances 0.000 claims description 50
- 150000002148 esters Chemical class 0.000 claims description 47
- 238000006243 chemical reaction Methods 0.000 claims description 44
- 239000000047 product Substances 0.000 claims description 40
- 108010016626 Dipeptides Proteins 0.000 claims description 34
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 34
- 239000007795 chemical reaction product Substances 0.000 claims description 30
- 239000007858 starting material Substances 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 22
- 235000001014 amino acid Nutrition 0.000 claims description 20
- 239000007788 liquid Substances 0.000 claims description 19
- 239000004365 Protease Substances 0.000 claims description 17
- 230000002378 acidificating effect Effects 0.000 claims description 17
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 17
- 239000012736 aqueous medium Substances 0.000 claims description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 14
- 239000002609 medium Substances 0.000 claims description 14
- 125000003277 amino group Chemical group 0.000 claims description 13
- 239000007864 aqueous solution Substances 0.000 claims description 13
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 13
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 13
- 108091005804 Peptidases Proteins 0.000 claims description 12
- 108090000765 processed proteins & peptides Proteins 0.000 claims description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 11
- 150000007513 acids Chemical class 0.000 claims description 11
- 102000004190 Enzymes Human genes 0.000 claims description 10
- 108090000790 Enzymes Proteins 0.000 claims description 10
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 claims description 10
- 229940088598 enzyme Drugs 0.000 claims description 10
- 235000019419 proteases Nutrition 0.000 claims description 10
- 125000006239 protecting group Chemical group 0.000 claims description 10
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 claims description 9
- 239000003960 organic solvent Substances 0.000 claims description 9
- 239000007787 solid Substances 0.000 claims description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 8
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 125000005907 alkyl ester group Chemical group 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- UQDJGEHQDNVPGU-UHFFFAOYSA-N serine phosphoethanolamine Chemical compound [NH3+]CCOP([O-])(=O)OCC([NH3+])C([O-])=O UQDJGEHQDNVPGU-UHFFFAOYSA-N 0.000 claims description 7
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 6
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 6
- 108010006035 Metalloproteases Proteins 0.000 claims description 5
- 102000005741 Metalloproteases Human genes 0.000 claims description 5
- 108090000526 Papain Proteins 0.000 claims description 5
- 230000015572 biosynthetic process Effects 0.000 claims description 5
- 229940055729 papain Drugs 0.000 claims description 5
- 235000019834 papain Nutrition 0.000 claims description 5
- 102000004196 processed proteins & peptides Human genes 0.000 claims description 5
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 4
- 239000011260 aqueous acid Substances 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 4
- 235000019253 formic acid Nutrition 0.000 claims description 4
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 4
- 239000007848 Bronsted acid Substances 0.000 claims description 3
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 claims description 3
- 239000003929 acidic solution Substances 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 235000003704 aspartic acid Nutrition 0.000 claims description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 3
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 claims description 3
- 235000003599 food sweetener Nutrition 0.000 claims description 3
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 claims description 3
- 238000010647 peptide synthesis reaction Methods 0.000 claims description 3
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 3
- 239000003765 sweetening agent Substances 0.000 claims description 3
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 claims description 2
- 102000005367 Carboxypeptidases Human genes 0.000 claims description 2
- 108010006303 Carboxypeptidases Proteins 0.000 claims description 2
- 102000035195 Peptidases Human genes 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 230000002255 enzymatic effect Effects 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- 150000002576 ketones Chemical class 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000003495 polar organic solvent Substances 0.000 claims description 2
- 239000000758 substrate Substances 0.000 claims description 2
- 150000001413 amino acids Chemical class 0.000 claims 4
- 239000012429 reaction media Substances 0.000 claims 3
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 claims 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 claims 2
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 claims 2
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 claims 2
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 claims 2
- 150000003931 anilides Chemical class 0.000 claims 2
- 239000004220 glutamic acid Substances 0.000 claims 2
- 235000013922 glutamic acid Nutrition 0.000 claims 2
- 230000002441 reversible effect Effects 0.000 claims 2
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- 108090000317 Chymotrypsin Proteins 0.000 claims 1
- 239000004471 Glycine Substances 0.000 claims 1
- 241000764238 Isis Species 0.000 claims 1
- 108010056079 Subtilisins Proteins 0.000 claims 1
- 102000005158 Subtilisins Human genes 0.000 claims 1
- 125000000539 amino acid group Chemical group 0.000 claims 1
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 229960002376 chymotrypsin Drugs 0.000 claims 1
- 238000006911 enzymatic reaction Methods 0.000 claims 1
- 125000004185 ester group Chemical group 0.000 claims 1
- 230000001766 physiological effect Effects 0.000 claims 1
- 239000002243 precursor Substances 0.000 claims 1
- 235000018102 proteins Nutrition 0.000 claims 1
- 102000004169 proteins and genes Human genes 0.000 claims 1
- 108090000623 proteins and genes Proteins 0.000 claims 1
- 230000017854 proteolysis Effects 0.000 claims 1
- 230000000717 retained effect Effects 0.000 claims 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 77
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 66
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 66
- VSDUZFOSJDMAFZ-VIFPVBQESA-N methyl L-phenylalaninate Chemical compound COC(=O)[C@@H](N)CC1=CC=CC=C1 VSDUZFOSJDMAFZ-VIFPVBQESA-N 0.000 description 56
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 38
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 36
- 239000013078 crystal Substances 0.000 description 29
- 239000002244 precipitate Substances 0.000 description 25
- XYXYXSKSTZAEJW-VIFPVBQESA-N (2s)-2-(phenylmethoxycarbonylamino)butanedioic acid Chemical compound OC(=O)C[C@@H](C(O)=O)NC(=O)OCC1=CC=CC=C1 XYXYXSKSTZAEJW-VIFPVBQESA-N 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 23
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- 238000000921 elemental analysis Methods 0.000 description 21
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 108090001109 Thermolysin Proteins 0.000 description 15
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 15
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 15
- 238000002844 melting Methods 0.000 description 15
- 230000008018 melting Effects 0.000 description 15
- 229940024606 amino acid Drugs 0.000 description 13
- 238000004458 analytical method Methods 0.000 description 13
- 238000002329 infrared spectrum Methods 0.000 description 13
- SWVMLNPDTIFDDY-FVGYRXGTSA-N methyl (2s)-2-amino-3-phenylpropanoate;hydrochloride Chemical compound Cl.COC(=O)[C@@H](N)CC1=CC=CC=C1 SWVMLNPDTIFDDY-FVGYRXGTSA-N 0.000 description 13
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 230000000704 physical effect Effects 0.000 description 11
- 239000012071 phase Substances 0.000 description 9
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 8
- 235000011114 ammonium hydroxide Nutrition 0.000 description 8
- VSDUZFOSJDMAFZ-SECBINFHSA-N methyl (2r)-2-amino-3-phenylpropanoate Chemical compound COC(=O)[C@H](N)CC1=CC=CC=C1 VSDUZFOSJDMAFZ-SECBINFHSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 7
- 239000012046 mixed solvent Substances 0.000 description 7
- 230000003287 optical effect Effects 0.000 description 7
- 238000000926 separation method Methods 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 6
- WORJRXHJTUTINR-UHFFFAOYSA-N 1,4-dioxane;hydron;chloride Chemical compound Cl.C1COCCO1 WORJRXHJTUTINR-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 244000061456 Solanum tuberosum Species 0.000 description 6
- 235000002595 Solanum tuberosum Nutrition 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 6
- 229960005261 aspartic acid Drugs 0.000 description 6
- 238000003776 cleavage reaction Methods 0.000 description 6
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 239000003112 inhibitor Substances 0.000 description 6
- 230000035484 reaction time Effects 0.000 description 6
- 230000007017 scission Effects 0.000 description 6
- 239000011877 solvent mixture Substances 0.000 description 6
- MSHFRERJPWKJFX-UHFFFAOYSA-N 4-Methoxybenzyl alcohol Chemical compound COC1=CC=C(CO)C=C1 MSHFRERJPWKJFX-UHFFFAOYSA-N 0.000 description 5
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 5
- 239000003729 cation exchange resin Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- OMSMPWHEGLNQOD-UWVGGRQHSA-N Asn-Phe Chemical compound NC(=O)C[C@H](N)C(=O)N[C@H](C(O)=O)CC1=CC=CC=C1 OMSMPWHEGLNQOD-UWVGGRQHSA-N 0.000 description 4
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 4
- 230000009102 absorption Effects 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 239000000872 buffer Substances 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 229940093915 gynecological organic acid Drugs 0.000 description 4
- 238000004811 liquid chromatography Methods 0.000 description 4
- 150000007522 mineralic acids Chemical class 0.000 description 4
- 150000007524 organic acids Chemical class 0.000 description 4
- 235000005985 organic acids Nutrition 0.000 description 4
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 4
- 229960005190 phenylalanine Drugs 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 150000003839 salts Chemical group 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000007853 buffer solution Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- CJGXMNONHNZEQQ-UHFFFAOYSA-N ethyl 2-amino-3-phenylpropanoate Chemical compound CCOC(=O)C(N)CC1=CC=CC=C1 CJGXMNONHNZEQQ-UHFFFAOYSA-N 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- SWVMLNPDTIFDDY-UHFFFAOYSA-N hydron;methyl 2-amino-3-phenylpropanoate;chloride Chemical compound Cl.COC(=O)C(N)CC1=CC=CC=C1 SWVMLNPDTIFDDY-UHFFFAOYSA-N 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 108090000371 Esterases Proteins 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000003295 alanine group Chemical group N[C@@H](C)C(=O)* 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000012223 aqueous fraction Substances 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- FPFQPLFYTKMCHN-PPHPATTJSA-N ethyl (2s)-2-amino-3-phenylpropanoate;hydron;chloride Chemical compound Cl.CCOC(=O)[C@@H](N)CC1=CC=CC=C1 FPFQPLFYTKMCHN-PPHPATTJSA-N 0.000 description 2
- 125000000741 isoleucyl group Chemical group [H]N([H])C(C(C([H])([H])[H])C([H])([H])C([H])([H])[H])C(=O)O* 0.000 description 2
- 125000001909 leucine group Chemical group [H]N(*)C(C(*)=O)C([H])([H])C(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- GSYSFVSGPABNNL-UHFFFAOYSA-N methyl 2-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetate Chemical group COC(=O)C(P(=O)(OC)OC)NC(=O)OCC1=CC=CC=C1 GSYSFVSGPABNNL-UHFFFAOYSA-N 0.000 description 2
- BBACSHIJBOGXKL-UHFFFAOYSA-N methyl 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate Chemical compound C=1C=CC=CC=1COC(=O)NC(C(=O)OC)CC1=CC=CC=C1 BBACSHIJBOGXKL-UHFFFAOYSA-N 0.000 description 2
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- COLNVLDHVKWLRT-QMMMGPOBSA-N phenylalanine group Chemical group N[C@@H](CC1=CC=CC=C1)C(=O)O COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 230000006340 racemization Effects 0.000 description 2
- 239000012266 salt solution Substances 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 125000002987 valine group Chemical group [H]N([H])C([H])(C(*)=O)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- PVFCXMDXBIEMQG-JTQLQIEISA-N (2s)-2-(phenylmethoxycarbonylamino)pentanedioic acid Chemical compound OC(=O)CC[C@@H](C(O)=O)NC(=O)OCC1=CC=CC=C1 PVFCXMDXBIEMQG-JTQLQIEISA-N 0.000 description 1
- ULPMRIXXHGUZFA-UHFFFAOYSA-N (R)-4-Methyl-3-hexanone Natural products CCC(C)C(=O)CC ULPMRIXXHGUZFA-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- XYXYXSKSTZAEJW-UHFFFAOYSA-N 2-(phenylmethoxycarbonylamino)butanedioic acid Chemical compound OC(=O)CC(C(O)=O)NC(=O)OCC1=CC=CC=C1 XYXYXSKSTZAEJW-UHFFFAOYSA-N 0.000 description 1
- JDDWQACHQPUIRR-OALUTQOASA-N COC([C@@H](NC([C@@H](NC(=O)OCC1=CC=C(C=C1)OC)CC(N)=O)=O)CC1=CC=CC=C1)=O Chemical compound COC([C@@H](NC([C@@H](NC(=O)OCC1=CC=C(C=C1)OC)CC(N)=O)=O)CC1=CC=CC=C1)=O JDDWQACHQPUIRR-OALUTQOASA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 102000029816 Collagenase Human genes 0.000 description 1
- 108060005980 Collagenase Proteins 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- XMBSYZWANAQXEV-QWRGUYRKSA-N Glu-Phe Chemical compound OC(=O)CC[C@H](N)C(=O)N[C@H](C(O)=O)CC1=CC=CC=C1 XMBSYZWANAQXEV-QWRGUYRKSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 102220506674 MKRN2 opposite strand protein_H26N_mutation Human genes 0.000 description 1
- 102000035092 Neutral proteases Human genes 0.000 description 1
- 108091005507 Neutral proteases Proteins 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 108010059712 Pronase Proteins 0.000 description 1
- 108010022999 Serine Proteases Proteins 0.000 description 1
- 102000012479 Serine Proteases Human genes 0.000 description 1
- 101710097834 Thiol protease Proteins 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001509 aspartic acid derivatives Chemical class 0.000 description 1
- OZPYEGOBGWQOSZ-VIFPVBQESA-N benzyl n-[(3s)-2,5-dioxooxolan-3-yl]carbamate Chemical compound C=1C=CC=CC=1COC(=O)N[C@H]1CC(=O)OC1=O OZPYEGOBGWQOSZ-VIFPVBQESA-N 0.000 description 1
- 238000005976 benzyloxycarbonylation reaction Methods 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 229960002424 collagenase Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 229940125532 enzyme inhibitor Drugs 0.000 description 1
- 239000002532 enzyme inhibitor Substances 0.000 description 1
- 238000010931 ester hydrolysis Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000003810 ethyl acetate extraction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000000291 glutamic acid group Chemical group N[C@@H](CCC(O)=O)C(=O)* 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- HNTKETWAFIINPH-ASCMOBCVSA-N methyl (2S)-3-[1-[(2S)-2,4-diamino-4-oxobutanoyl]cyclohexa-2,4-dien-1-yl]-2-(phenylmethoxycarbonylamino)propanoate Chemical compound COC([C@@H](NC(=O)OCC1=CC=CC=C1)CC1(CC=CC=C1)C([C@@H](N)CC(N)=O)=O)=O HNTKETWAFIINPH-ASCMOBCVSA-N 0.000 description 1
- SWVMLNPDTIFDDY-SBSPUUFOSA-N methyl (2r)-2-amino-3-phenylpropanoate;hydrochloride Chemical compound Cl.COC(=O)[C@H](N)CC1=CC=CC=C1 SWVMLNPDTIFDDY-SBSPUUFOSA-N 0.000 description 1
- VSDUZFOSJDMAFZ-UHFFFAOYSA-N methyl 2-amino-3-phenylpropanoate Chemical compound COC(=O)C(N)CC1=CC=CC=C1 VSDUZFOSJDMAFZ-UHFFFAOYSA-N 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 235000019605 sweet taste sensations Nutrition 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/04—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing only normal peptide links
- C07K5/06—Dipeptides
- C07K5/06104—Dipeptides with the first amino acid being acidic
- C07K5/06113—Asp- or Asn-amino acid
- C07K5/06121—Asp- or Asn-amino acid the second amino acid being aromatic or cycloaliphatic
- C07K5/0613—Aspartame
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Genetics & Genomics (AREA)
- Biochemistry (AREA)
- Biophysics (AREA)
- General Health & Medical Sciences (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Molecular Biology (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Life Sciences & Earth Sciences (AREA)
- Peptides Or Proteins (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP727977A JPS5392729A (en) | 1977-01-27 | 1977-01-27 | Adduct of dipeptide derivatives and amino acid derivatives and process for their preparation |
| JP52057036A JPS585038B2 (ja) | 1977-05-19 | 1977-05-19 | ジペプチドエステルの製造方法 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH637914A5 true CH637914A5 (de) | 1983-08-31 |
Family
ID=26341557
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH35378A CH637914A5 (de) | 1977-01-27 | 1978-01-13 | Dipeptid-aminosaeureester-additionsverbindungen und verfahren zu ihrer herstellung bzw. zersetzung. |
| CH719382A CH643532A5 (de) | 1977-01-27 | 1982-12-10 | Verfahren zur herstellung eines dipeptidesters. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH719382A CH643532A5 (de) | 1977-01-27 | 1982-12-10 | Verfahren zur herstellung eines dipeptidesters. |
Country Status (10)
| Country | Link |
|---|---|
| US (3) | US4165311A (enExample) |
| CA (1) | CA1101845A (enExample) |
| CH (2) | CH637914A5 (enExample) |
| DD (1) | DD136737A5 (enExample) |
| DE (2) | DE2857828C2 (enExample) |
| FR (1) | FR2378747A1 (enExample) |
| GB (1) | GB1548553A (enExample) |
| IT (1) | IT1091982B (enExample) |
| NL (1) | NL190413C (enExample) |
| UA (1) | UA8373A1 (enExample) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2857828C2 (enExample) | 1977-01-27 | 1990-06-07 | Toyo Soda Mfg. Co., Ltd., Shinnanyo, Yamaguchi, Jp | |
| JPS5411293A (en) * | 1977-05-23 | 1979-01-27 | Toyo Soda Mfg Co Ltd | Recovery of protease |
| JPS5411294A (en) * | 1977-05-23 | 1979-01-27 | Toyo Soda Mfg Co Ltd | Recovery of protease |
| JPS55135595A (en) * | 1979-04-03 | 1980-10-22 | Toyo Soda Mfg Co Ltd | Preparation of dipeptide |
| US4293706A (en) * | 1980-06-19 | 1981-10-06 | Ppg Industries, Inc. | Preparation of N-benzyloxycarbonyl aspartic acid |
| DE3203292A1 (de) * | 1981-02-02 | 1982-09-16 | G.D. Searle & Co., 60076 Skokie, Ill. | Verfahren zur herstellung von aminogeschuetzten l-aspartyl-l-phenylalanin-alkylestern |
| US4820729A (en) * | 1981-03-30 | 1989-04-11 | Rorer Pharmaceutical Corporation | N-substituted-amido-amino acids |
| DE3274985D1 (en) * | 1981-09-21 | 1987-02-12 | Toyo Soda Mfg Co Ltd | Process for recovering a dipeptide derivative |
| JPS5917997A (ja) * | 1982-07-23 | 1984-01-30 | Toyo Soda Mfg Co Ltd | ジペプチドエステルとアミノ酸エステルとの付加化合物の製造方法 |
| JPS5928493A (ja) * | 1982-08-06 | 1984-02-15 | Toyo Soda Mfg Co Ltd | アスパルチルフエニルアラニンアルキルエステルの製造法 |
| US5055399A (en) * | 1985-01-15 | 1991-10-08 | Genentech, Inc. | Enzymatic synthesis of alpha-L-aspartyl-L-phenyalanine lower alkyl esters |
| DE3532027A1 (de) * | 1985-09-09 | 1987-03-19 | Hoechst Ag | Verfahren zur herstellung von aspartam und mittel zu seiner durchfuehrung |
| US4873359A (en) * | 1985-10-21 | 1989-10-10 | W. R. Grace & Co. - Conn. | Process for preparing as partyl-phenylalanine dipeptides |
| US4810817A (en) * | 1985-10-21 | 1989-03-07 | W. R. Grace & Co. | Aspartyl-beta substituted phenylalanine dipeptides |
| FR2589479B1 (fr) * | 1985-11-05 | 1988-02-05 | Hoechst France | Nouvel enzyme, son procede d'obtention et son application a la preparation de n-(l-aspartyl-1)l-phenylalaninate de methyle |
| FR2589480B1 (fr) * | 1985-11-05 | 1988-09-16 | Hoechst France | Procede biologique de preparation de n-(n-benzyloxycarbonyl l-aspartyl-1) l-phenylalaninate de methyle |
| US4935355A (en) * | 1986-04-15 | 1990-06-19 | Synthetech, Inc. | Preparation of dipeptides |
| GB8621377D0 (en) * | 1986-09-04 | 1986-10-15 | Celltech Ltd | Enzymatic process |
| US5002872A (en) * | 1989-05-10 | 1991-03-26 | W. R. Grace & Co.-Conn. | Enzyme mediated coupling reactions |
| US5366862A (en) * | 1990-02-14 | 1994-11-22 | Receptor Laboratories, Inc. | Method for generating and screening useful peptides |
| DD295165A5 (de) * | 1990-06-13 | 1991-10-24 | ���������`��������`����@����k�� | Verfahren zur herstellung von peptiden |
| DE69133258T2 (de) | 1990-08-03 | 2004-03-18 | Vertex Pharmaceuticals Inc., Cambridge | Verwendung von vernetzten kristallen als neuem verfahren zur immobilisierung von enzymen |
| KR930002966B1 (ko) * | 1990-11-24 | 1993-04-16 | 주식회사 미 원 | 디펩티드의 제조방법 |
| DK0536671T3 (da) * | 1991-10-07 | 1996-08-12 | Hoechst Ag | Carboxylsyreester-beskyttelsesgrupper, en fremgangsmåde til deres fremstilling, kobling til funktionelle grupper samt deres anvendelser |
| TW306932B (enExample) * | 1993-08-27 | 1997-06-01 | Holland Sweetener Co | |
| NL9400092A (nl) * | 1994-01-20 | 1995-09-01 | Holland Sweetener Co | Enzymatische koppeling van L-fenylalaninemethylester en N-benzyloxycarbonyl-asparaginezuur. |
| JP3028852B2 (ja) * | 1994-06-24 | 2000-04-04 | ロシュ ダイアグノスティックス コーポレーション | ヒストリチクス菌から得られるコラゲナーゼおよび2つの他のプロテアーゼの精製混合物 |
| DE69613305T2 (de) * | 1995-10-11 | 2002-05-02 | Holland Sweetener Co. V.O.F., Maastricht | Verbesserte enzymatische Kupplungsreaktion von N-geschützte L-Asparaginsäure und Phenylalaninmethylester |
| US5989888A (en) * | 1996-01-24 | 1999-11-23 | Roche Diagnostics Corporation | Purified mixture of collagenase I, collagenase II and two other proteases |
| US5830741A (en) * | 1996-12-06 | 1998-11-03 | Boehringer Mannheim Corporation | Composition for tissue dissociation containing collagenase I and II from clostridium histolyticum and a neutral protease |
| JP2005040037A (ja) * | 2003-07-25 | 2005-02-17 | Ajinomoto Co Inc | ジペプチドの製造方法、それに用いるペプチド生成酵素、およびペプチド生成酵素の製造方法 |
| DE102006047617B4 (de) * | 2006-10-09 | 2008-11-27 | Clariant International Limited | Verfahren zur Herstellung basischer (Meth)acrylamide |
| DE102008017216B4 (de) * | 2008-04-04 | 2013-08-14 | Clariant International Ltd. | Kontinuierliches Verfahren zur Herstellung von Fettsäureamiden |
| DE102009031057A1 (de) * | 2009-06-30 | 2011-01-05 | Clariant International Ltd. | Kontinuierliches Verfahren zur Herstellung von Amiden aliphatischer Carbonsäuren |
| DE102009031059A1 (de) | 2009-06-30 | 2011-01-05 | Clariant International Ltd. | Vorrichtung zur kontinuierlichen Durchführung chemischer Reaktionen bei hohen Temperaturen |
| DE102009042523B4 (de) | 2009-09-22 | 2012-02-16 | Clariant International Ltd. | Vorrichtung und Verfahren zur kontinuierlichen Durchführung heterogen katalysierter chemischer Reaktionen bei hohen Temperaturen |
| DE102009042522A1 (de) | 2009-09-22 | 2011-04-07 | Clariant International Ltd. | Kontinuierliches Umesterungsverfahren |
| DE102010056564A1 (de) | 2010-12-30 | 2012-07-05 | Clariant International Limited | Hydroxylgruppen und Estergruppen tragende Polymere und Verfahren zu ihrer Herstellung |
| DE102010056565A1 (de) | 2010-12-30 | 2012-07-05 | Clariant International Ltd. | Verfahren zur Modifizierung Hydroxylgruppen tragender Polymere |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3786039A (en) | 1969-04-30 | 1974-01-15 | Ajinomoto Kk | Method of producing alpha-l-aspartyl-l-phenylalanine lower alkyl esters |
| CH553751A (de) * | 1970-05-19 | 1974-09-13 | Stamicarbon | Verfahren zur herstellung von aspartylaminosaeure-estern. |
| CH508590A (fr) * | 1970-10-29 | 1971-06-15 | Ajinomoto Kk | Procédé de préparation des esters d'alcoyle inférieurs de l'a-L-aspartyl-L-phénylalanine |
| US3853835A (en) * | 1970-11-12 | 1974-12-10 | Searle & Co | Alkyl esters of aspartyl aliphatic amino acid dipeptides |
| US3972773A (en) * | 1975-04-29 | 1976-08-03 | Sagami Chemical Research Center | Process for producing peptide |
| DE2857828C2 (enExample) | 1977-01-27 | 1990-06-07 | Toyo Soda Mfg. Co., Ltd., Shinnanyo, Yamaguchi, Jp |
-
1978
- 1978-01-12 DE DE2857828A patent/DE2857828C2/de not_active Expired - Lifetime
- 1978-01-12 DE DE2801238A patent/DE2801238C2/de not_active Expired
- 1978-01-13 CH CH35378A patent/CH637914A5/de not_active IP Right Cessation
- 1978-01-16 GB GB1646/78A patent/GB1548553A/en not_active Expired
- 1978-01-17 US US05/870,108 patent/US4165311A/en not_active Expired - Lifetime
- 1978-01-23 NL NLAANVRAGE7800767,A patent/NL190413C/xx not_active IP Right Cessation
- 1978-01-24 FR FR7801898A patent/FR2378747A1/fr active Granted
- 1978-01-25 DD DD78203419A patent/DD136737A5/xx not_active IP Right Cessation
- 1978-01-26 CA CA295,711A patent/CA1101845A/en not_active Expired
- 1978-01-26 UA UA2669397A patent/UA8373A1/uk unknown
- 1978-01-27 IT IT19706/78A patent/IT1091982B/it active
-
1979
- 1979-03-13 US US06/020,058 patent/US4256836A/en not_active Expired - Lifetime
-
1980
- 1980-06-03 US US06/270,025 patent/US4436925A/en not_active Expired - Lifetime
-
1982
- 1982-12-10 CH CH719382A patent/CH643532A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IT1091982B (it) | 1985-07-06 |
| NL7800767A (nl) | 1978-07-31 |
| CA1101845A (en) | 1981-05-26 |
| UA8373A1 (uk) | 1996-03-29 |
| US4165311A (en) | 1979-08-21 |
| NL190413C (nl) | 1994-02-16 |
| DE2801238C2 (de) | 1986-06-05 |
| DD136737A5 (de) | 1979-07-25 |
| FR2378747A1 (fr) | 1978-08-25 |
| CH643532A5 (de) | 1984-06-15 |
| US4256836A (en) | 1981-03-17 |
| US4436925A (en) | 1984-03-13 |
| NL190413B (nl) | 1993-09-16 |
| DE2801238A1 (de) | 1978-08-03 |
| DE2857828C2 (enExample) | 1990-06-07 |
| IT7819706A0 (it) | 1978-01-27 |
| GB1548553A (en) | 1979-07-18 |
| FR2378747B1 (enExample) | 1983-12-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH643532A5 (de) | Verfahren zur herstellung eines dipeptidesters. | |
| EP0236872B1 (de) | Hydroxylaminderivate, deren Herstellung und Verwendung für Heilmittel | |
| DE2366379C2 (de) | N↑α↑-geschützte N↑G↑-Nitro-L-arginyl-L-prolin-amide | |
| DE69602016T2 (de) | Herstellung von hydroxamsäurederivaten | |
| CH661931A5 (de) | N-substituierte amidoaminosaeuren, deren ester und amide. | |
| DD223148A5 (de) | Verfahren zur herstellung von gem-diaminoal-kanderivaten | |
| DE2647189A1 (de) | Verfahren zur herstellung eines peptids | |
| EP0312502A2 (en) | Dipeptides useful as plant growth regulators | |
| DE2822528A1 (de) | Verfahren zur herstellung von protease | |
| DE2660626C2 (de) | 3-Amino-2-hydroxy-4-phenyl-butansäure-Derivate und Verfahren zu ihrer Herstellung | |
| BE897844A (fr) | Alkylamides de tripeptides et de tetrapeptides biologiquement actifs, procede pour leur preparation et compositions | |
| DE69911061T2 (de) | N-3, 3-dimethylbutyl-l-asparaginsäure und ihre ester, verfahren zur herstellung dieser und das verfahren um daraus n-[n-(3,3-dimethylbutyl)-l-alpha-aspartyl)-l-phenylalanin-1-methylester herzustellen | |
| EP0010587B1 (de) | Adamantylalkyloxycarbonylderivate, deren Herstellung und Verwendung zur Darstellung von Peptiden | |
| DE3203292C2 (enExample) | ||
| DE2822527A1 (de) | Verfahren zur gewinnung von protease | |
| DE2245392C3 (de) | Verfahren zur Herstellung von N-tert-Butyloxycarbonyl-, N-tert-Amyloxycarbonyl- oder N-4-MethoxybenzyIoxycarbonylaminocarbonsäuren oder -peptiden | |
| DE68928249T2 (de) | Verfahren zur Trennung von Methylester von alpha-L-aspartyl-L-phenylalaninen | |
| DE60213880T2 (de) | Verfahren zur herstellung von lisinopril | |
| EP0943621A2 (en) | Process for the production of alkoxycarbonylpeptides intermediates in the synthesis of the lisinopril | |
| DE2647188C2 (de) | Verfahren zur Herstellung von Oligopeptiden | |
| DE3421303A1 (de) | Salze aus 3-hydroxy-4-oxo-3,4-dihydro-1,2,3-benzotriazin und amino-verbindungen | |
| DE602004001590T2 (de) | Verbessertes Verfahren zur Synthese von Diamidderivaten des Tripeptids KPV | |
| CH636877A5 (de) | Verfahren zur herstellung cyclischer ester von 3,4-dihydroxy-thiophen-1,1-dioxid und 3,4-dihydroxy-cyclopentadienon-verbindungen. | |
| DE2022032A1 (de) | Verfahren zur Herstellung von Peptiden | |
| DE1668876C3 (de) | N-Acyl geschützte Aminosäuren und Peptide, Verfahren zu ihrer Herstellung und ihre Verwendung bei Peptidsynthesen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |