CA2776849A1 - Novel heterocyclic acrylamides and their use as pharmaceuticals - Google Patents
Novel heterocyclic acrylamides and their use as pharmaceuticals Download PDFInfo
- Publication number
- CA2776849A1 CA2776849A1 CA2776849A CA2776849A CA2776849A1 CA 2776849 A1 CA2776849 A1 CA 2776849A1 CA 2776849 A CA2776849 A CA 2776849A CA 2776849 A CA2776849 A CA 2776849A CA 2776849 A1 CA2776849 A1 CA 2776849A1
- Authority
- CA
- Canada
- Prior art keywords
- naphthyridin
- dihydro
- mmol
- azetidin
- oxo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- -1 heterocyclic acrylamides Chemical class 0.000 title claims abstract description 39
- 239000003814 drug Substances 0.000 title claims abstract description 14
- 150000001875 compounds Chemical class 0.000 claims abstract description 181
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 8
- 239000000203 mixture Substances 0.000 claims description 112
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 75
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical class OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims description 30
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 29
- 125000000623 heterocyclic group Chemical group 0.000 claims description 28
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 26
- 229910052731 fluorine Inorganic materials 0.000 claims description 25
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 23
- 150000003839 salts Chemical class 0.000 claims description 23
- 125000005843 halogen group Chemical group 0.000 claims description 22
- 241000191967 Staphylococcus aureus Species 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 19
- CQQVSXRUVDVVNO-UBNNNTKFSA-N 6-[(e)-3-[3-[(e)-c-methyl-n-propoxycarbonimidoyl]azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1C(C(/C)=N/OCCC)CN1C(=O)\C=C\C1=CN=C(NC(=O)CC2)C2=C1 CQQVSXRUVDVVNO-UBNNNTKFSA-N 0.000 claims description 16
- 208000015181 infectious disease Diseases 0.000 claims description 15
- 125000003118 aryl group Chemical group 0.000 claims description 14
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 14
- 125000005842 heteroatom Chemical group 0.000 claims description 14
- 239000011737 fluorine Substances 0.000 claims description 13
- 125000004076 pyridyl group Chemical group 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 12
- QATPMNXCDSKNPZ-ZZXKWVIFSA-N 6-[(e)-3-oxo-3-[3-(thiophen-2-ylmethoxy)azetidin-1-yl]prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)CCC2=CC=1/C=C/C(=O)N(C1)CC1OCC1=CC=CS1 QATPMNXCDSKNPZ-ZZXKWVIFSA-N 0.000 claims description 11
- 230000000813 microbial effect Effects 0.000 claims description 11
- 239000012453 solvate Substances 0.000 claims description 11
- 238000011282 treatment Methods 0.000 claims description 11
- IRGSWLRUVQHHTF-VMPITWQZSA-N 6-[(e)-3-[3-(1-benzofuran-2-yl)azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1=CC=C2OC(C3CN(C3)C(\C=C\C=3C=C4CCC(=O)NC4=NC=3)=O)=CC2=C1 IRGSWLRUVQHHTF-VMPITWQZSA-N 0.000 claims description 10
- OTHXOQIDEXDBSX-RMKNXTFCSA-N 6-[(e)-3-[3-(3-methyl-1-benzofuran-2-yl)azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound N1C(=O)CCC2=CC(/C=C/C(=O)N3CC(C3)C3=C(C4=CC=CC=C4O3)C)=CN=C21 OTHXOQIDEXDBSX-RMKNXTFCSA-N 0.000 claims description 10
- 229910052794 bromium Inorganic materials 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 150000002367 halogens Chemical group 0.000 claims description 10
- GEPUKYDVWNGEBX-ZZXKWVIFSA-N 6-[(e)-3-oxo-3-[3-(2-thiophen-2-ylethoxy)azetidin-1-yl]prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)CCC2=CC=1/C=C/C(=O)N(C1)CC1OCCC1=CC=CS1 GEPUKYDVWNGEBX-ZZXKWVIFSA-N 0.000 claims description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- LPWJPETURXRRBE-AATRIKPKSA-N ethyl 2-[2-oxo-6-[(e)-3-oxo-3-[3-(thiophen-2-ylmethoxy)azetidin-1-yl]prop-1-enyl]-1,4-dihydropyrido[2,3-d]pyrimidin-3-yl]acetate Chemical compound C=1N=C2NC(=O)N(CC(=O)OCC)CC2=CC=1\C=C\C(=O)N(C1)CC1OCC1=CC=CS1 LPWJPETURXRRBE-AATRIKPKSA-N 0.000 claims description 8
- 229910052717 sulfur Inorganic materials 0.000 claims description 8
- SXSVFNIDZQSXDO-DUXPYHPUSA-N (e)-3-(6-aminopyridin-3-yl)-1-[3-(pyridin-4-ylmethoxy)azetidin-1-yl]prop-2-en-1-one Chemical compound C1=NC(N)=CC=C1\C=C\C(=O)N1CC(OCC=2C=CN=CC=2)C1 SXSVFNIDZQSXDO-DUXPYHPUSA-N 0.000 claims description 7
- IEAWJZJDIUZANC-AATRIKPKSA-N (e)-3-[3-[(dimethylamino)methyl]-1h-pyrrolo[2,3-b]pyridin-5-yl]-1-[3-(thiophen-2-ylmethoxy)azetidin-1-yl]prop-2-en-1-one Chemical compound C1=C2C(CN(C)C)=CNC2=NC=C1\C=C\C(=O)N(C1)CC1OCC1=CC=CS1 IEAWJZJDIUZANC-AATRIKPKSA-N 0.000 claims description 7
- JEMJJOWUMZGZLV-SNAWJCMRSA-N 1'-methyl-6-[(e)-3-oxo-3-[3-(thiophen-2-ylmethoxy)azetidin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one Chemical compound C1CN(C)CCC21C(=O)NC1=NC=C(\C=C\C(=O)N3CC(C3)OCC=3SC=CC=3)C=C1C2 JEMJJOWUMZGZLV-SNAWJCMRSA-N 0.000 claims description 7
- WUULBUPSYVJOJS-SNAWJCMRSA-N 3-[2-(4-methylpiperazin-1-yl)ethyl]-6-[(e)-3-oxo-3-[3-(thiophen-2-ylmethoxy)azetidin-1-yl]prop-1-enyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-one Chemical compound C1CN(C)CCN1CCN1C(=O)NC2=NC=C(\C=C\C(=O)N3CC(C3)OCC=3SC=CC=3)C=C2C1 WUULBUPSYVJOJS-SNAWJCMRSA-N 0.000 claims description 7
- DQRVPQOECHQEIS-QPJJXVBHSA-N 6-[(e)-3-(3-butoxyazetidin-1-yl)-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1C(OCCCC)CN1C(=O)\C=C\C1=CN=C(NC(=O)CC2)C2=C1 DQRVPQOECHQEIS-QPJJXVBHSA-N 0.000 claims description 7
- LFCYAMHFEITVFX-ZZXKWVIFSA-N 6-[(e)-3-[3-(2-methylprop-2-enoxy)azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1C(OCC(=C)C)CN1C(=O)\C=C\C1=CN=C(NC(=O)CC2)C2=C1 LFCYAMHFEITVFX-ZZXKWVIFSA-N 0.000 claims description 7
- KTFKUVJNZVKKJW-ZZXKWVIFSA-N 6-[(e)-3-[3-(furan-2-ylmethoxy)azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)CCC2=CC=1/C=C/C(=O)N(C1)CC1OCC1=CC=CO1 KTFKUVJNZVKKJW-ZZXKWVIFSA-N 0.000 claims description 7
- MHQJJKSHMWQUPO-GORDUTHDSA-N 6-[(e)-3-[3-[(3-methylthiophen-2-yl)methoxy]azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1=CSC(COC2CN(C2)C(=O)\C=C\C=2C=C3CCC(=O)NC3=NC=2)=C1C MHQJJKSHMWQUPO-GORDUTHDSA-N 0.000 claims description 7
- VGRSOAVDMJUWIS-LHPQVSFSSA-N 6-[(e)-3-[3-[(e)-2-methylbut-2-enoxy]azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1C(OCC(/C)=C/C)CN1C(=O)\C=C\C1=CN=C(NC(=O)CC2)C2=C1 VGRSOAVDMJUWIS-LHPQVSFSSA-N 0.000 claims description 7
- QAKGQHANERWTJB-AOGGBPEJSA-N 6-[(e)-3-[3-[(e)-but-2-enoxy]azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1C(OC/C=C/C)CN1C(=O)\C=C\C1=CN=C(NC(=O)CC2)C2=C1 QAKGQHANERWTJB-AOGGBPEJSA-N 0.000 claims description 7
- QAKGQHANERWTJB-UDJLOATDSA-N 6-[(e)-3-[3-[(z)-but-2-enoxy]azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1C(OC\C=C/C)CN1C(=O)\C=C\C1=CN=C(NC(=O)CC2)C2=C1 QAKGQHANERWTJB-UDJLOATDSA-N 0.000 claims description 7
- PJZDJQFKDJPICJ-LZCJLJQNSA-N 6-[(e)-3-[4-[(4-fluorophenoxy)methyl]piperidin-1-yl]-3-oxoprop-1-enyl]-2-oxo-1h-1,8-naphthyridine-3-carboxamide Chemical compound C=1N=C2NC(=O)C(C(=O)N)=CC2=CC=1\C=C\C(=O)N(CC1)CCC1COC1=CC=C(F)C=C1 PJZDJQFKDJPICJ-LZCJLJQNSA-N 0.000 claims description 7
- XRTUEMFKRZPEGQ-LZCJLJQNSA-N 6-[(e)-3-[4-[(4-fluorophenoxy)methyl]piperidin-1-yl]-3-oxoprop-1-enyl]-2-oxo-3,4-dihydro-1h-1,8-naphthyridine-3-carboxamide Chemical compound C=1N=C2NC(=O)C(C(=O)N)CC2=CC=1\C=C\C(=O)N(CC1)CCC1COC1=CC=C(F)C=C1 XRTUEMFKRZPEGQ-LZCJLJQNSA-N 0.000 claims description 7
- FHLCDKAROOLURZ-LZCJLJQNSA-N 6-[(e)-3-[4-[(4-fluorophenoxy)methyl]piperidin-1-yl]-3-oxoprop-1-enyl]-3-(hydroxymethyl)-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)C(CO)CC2=CC=1\C=C\C(=O)N(CC1)CCC1COC1=CC=C(F)C=C1 FHLCDKAROOLURZ-LZCJLJQNSA-N 0.000 claims description 7
- JGWYJIPGJZUQTP-VMPITWQZSA-N 6-[(e)-3-oxo-3-(3-pentoxyazetidin-1-yl)prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1C(OCCCCC)CN1C(=O)\C=C\C1=CN=C(NC(=O)CC2)C2=C1 JGWYJIPGJZUQTP-VMPITWQZSA-N 0.000 claims description 7
- IUDCXSXORCOVKT-ZZXKWVIFSA-N 6-[(e)-3-oxo-3-(3-pyridin-3-yloxypyrrolidin-1-yl)prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)CCC2=CC=1/C=C/C(=O)N(C1)CCC1OC1=CC=CN=C1 IUDCXSXORCOVKT-ZZXKWVIFSA-N 0.000 claims description 7
- CQWYOYXISMMZRJ-DAFODLJHSA-N 6-[(e)-3-oxo-3-[3-(1,3-thiazol-5-ylmethoxy)azetidin-1-yl]prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)CCC2=CC=1/C=C/C(=O)N(C1)CC1OCC1=CN=CS1 CQWYOYXISMMZRJ-DAFODLJHSA-N 0.000 claims description 7
- WMRHMMUTJPJVQF-DAFODLJHSA-N 6-[(e)-3-oxo-3-[3-(3,3,3-trifluoropropoxy)azetidin-1-yl]prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1C(OCCC(F)(F)F)CN1C(=O)\C=C\C1=CN=C(NC(=O)CC2)C2=C1 WMRHMMUTJPJVQF-DAFODLJHSA-N 0.000 claims description 7
- HMQPTXWWOPSKRZ-GORDUTHDSA-N 6-[(e)-3-oxo-3-[3-(4,4,4-trifluorobutoxy)azetidin-1-yl]prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1C(OCCCC(F)(F)F)CN1C(=O)\C=C\C1=CN=C(NC(=O)CC2)C2=C1 HMQPTXWWOPSKRZ-GORDUTHDSA-N 0.000 claims description 7
- UNZNFNYPXVCRKQ-ONEGZZNKSA-N 6-[(e)-3-oxo-3-[3-(thiophen-2-ylmethoxy)azetidin-1-yl]prop-1-enyl]-1,3-dihydroimidazo[4,5-b]pyridin-2-one Chemical compound C=1N=C2NC(=O)NC2=CC=1/C=C/C(=O)N(C1)CC1OCC1=CC=CS1 UNZNFNYPXVCRKQ-ONEGZZNKSA-N 0.000 claims description 7
- AAWFCVXAWCTPJX-UHFFFAOYSA-N 6-[3-[3-[(4-methylthiophen-2-yl)methoxy]azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound CC1=CSC(COC2CN(C2)C(=O)C=CC=2C=C3CCC(=O)NC3=NC=2)=C1 AAWFCVXAWCTPJX-UHFFFAOYSA-N 0.000 claims description 7
- SIIWVGRQAAYYBW-ONEGZZNKSA-N 7-[(e)-3-oxo-3-[3-(thiophen-2-ylmethoxy)azetidin-1-yl]prop-1-enyl]-1,3,4,5-tetrahydropyrido[2,3-e][1,4]diazepin-2-one Chemical compound C=1N=C2NC(=O)CNCC2=CC=1/C=C/C(=O)N(C1)CC1OCC1=CC=CS1 SIIWVGRQAAYYBW-ONEGZZNKSA-N 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- PPLOEUSGELSLMK-BQYQJAHWSA-N 1'-methyl-6-[(e)-3-[3-(3-methyl-1-benzofuran-2-yl)azetidin-1-yl]-3-oxoprop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one Chemical compound C1CN(C)CCC21C(=O)NC1=NC=C(\C=C\C(=O)N3CC(C3)C3=C(C4=CC=CC=C4O3)C)C=C1C2 PPLOEUSGELSLMK-BQYQJAHWSA-N 0.000 claims description 6
- NKNFQSGFCHDMGX-SNAWJCMRSA-N 1'-methyl-6-[(e)-3-oxo-3-[3-(2-thiophen-2-ylethoxy)azetidin-1-yl]prop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one Chemical compound C1CN(C)CCC21C(=O)NC1=NC=C(\C=C\C(=O)N3CC(C3)OCCC=3SC=CC=3)C=C1C2 NKNFQSGFCHDMGX-SNAWJCMRSA-N 0.000 claims description 6
- XSYSYTCUZNKYJG-AATRIKPKSA-N 6-[(e)-3-(3-butoxyazetidin-1-yl)-3-oxoprop-1-enyl]-1'-methylspiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one Chemical compound C1C(OCCCC)CN1C(=O)\C=C\C1=CN=C(NC(=O)C2(CCN(C)CC2)C2)C2=C1 XSYSYTCUZNKYJG-AATRIKPKSA-N 0.000 claims description 6
- PIWRXGNNZZAHLZ-VOTSOKGWSA-N 6-[(e)-3-[3-(1-benzofuran-2-yl)azetidin-1-yl]-3-oxoprop-1-enyl]-1'-methylspiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one Chemical compound C1CN(C)CCC21C(=O)NC1=NC=C(\C=C\C(=O)N3CC(C3)C=3OC4=CC=CC=C4C=3)C=C1C2 PIWRXGNNZZAHLZ-VOTSOKGWSA-N 0.000 claims description 6
- HYWKTOWHHWNECX-VMPITWQZSA-N 6-[(e)-3-[3-(1-benzothiophen-2-ylmethoxy)azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1=CC=C2SC(COC3CN(C3)C(\C=C\C=3C=C4CCC(=O)NC4=NC=3)=O)=CC2=C1 HYWKTOWHHWNECX-VMPITWQZSA-N 0.000 claims description 6
- KMUUZBAIAHTLTC-GORDUTHDSA-N 6-[(e)-3-[3-[(1-methylpyrazol-3-yl)methoxy]azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound CN1C=CC(COC2CN(C2)C(=O)\C=C\C=2C=C3CCC(=O)NC3=NC=2)=N1 KMUUZBAIAHTLTC-GORDUTHDSA-N 0.000 claims description 6
- ZIRROQDMKBOMQJ-DAFODLJHSA-N 6-[(e)-3-[3-[(4-bromothiophen-2-yl)methoxy]azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound BrC1=CSC(COC2CN(C2)C(=O)\C=C\C=2C=C3CCC(=O)NC3=NC=2)=C1 ZIRROQDMKBOMQJ-DAFODLJHSA-N 0.000 claims description 6
- ZZARNBFLZRFGDW-DAFODLJHSA-N 6-[(e)-3-[3-[(4-chlorothiophen-2-yl)methoxy]azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound ClC1=CSC(COC2CN(C2)C(=O)\C=C\C=2C=C3CCC(=O)NC3=NC=2)=C1 ZZARNBFLZRFGDW-DAFODLJHSA-N 0.000 claims description 6
- DYQOBDOAKVJDIV-XVNBXDOJSA-N 6-[(e)-3-[3-[(5-methylthiophen-2-yl)methoxy]azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound S1C(C)=CC=C1COC1CN(C(=O)\C=C\C=2C=C3CCC(=O)NC3=NC=2)C1 DYQOBDOAKVJDIV-XVNBXDOJSA-N 0.000 claims description 6
- WYKRWRKJVRDEPC-DAFODLJHSA-N 6-[(e)-3-[4-(2-hydroxyethyl)piperidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1CC(CCO)CCN1C(=O)\C=C\C1=CN=C(NC(=O)CC2)C2=C1 WYKRWRKJVRDEPC-DAFODLJHSA-N 0.000 claims description 6
- ZGGLXSGTNJGICQ-DHZHZOJOSA-N 6-[(e)-3-oxo-3-(2-phenylpyrrolidin-1-yl)prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)CCC2=CC=1/C=C/C(=O)N1CCCC1C1=CC=CC=C1 ZGGLXSGTNJGICQ-DHZHZOJOSA-N 0.000 claims description 6
- MIUDHBYEEHQKIE-RMKNXTFCSA-N 6-[(e)-3-oxo-3-(3-phenoxypyrrolidin-1-yl)prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)CCC2=CC=1/C=C/C(=O)N(C1)CCC1OC1=CC=CC=C1 MIUDHBYEEHQKIE-RMKNXTFCSA-N 0.000 claims description 6
- SNXFJGDLNWCNJI-QPJJXVBHSA-N 6-[(e)-3-oxo-3-(4-propylpiperidin-1-yl)prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1CC(CCC)CCN1C(=O)\C=C\C1=CN=C(NC(=O)CC2)C2=C1 SNXFJGDLNWCNJI-QPJJXVBHSA-N 0.000 claims description 6
- GPCLMQRZYYYQLI-VMPITWQZSA-N 6-[(e)-3-oxo-3-[3-(3-thiophen-2-ylpropoxy)azetidin-1-yl]prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)CCC2=CC=1/C=C/C(=O)N(C1)CC1OCCCC1=CC=CS1 GPCLMQRZYYYQLI-VMPITWQZSA-N 0.000 claims description 6
- WGWUWXYHWXPSCP-QPJJXVBHSA-N 6-[(e)-3-oxo-3-piperidin-1-ylprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)CCC2=CC=1/C=C/C(=O)N1CCCCC1 WGWUWXYHWXPSCP-QPJJXVBHSA-N 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 125000005647 linker group Chemical group 0.000 claims description 6
- SBFXWSFMQLMVAN-FARCUNLSSA-N methyl 6-[(e)-3-[4-[(4-fluorophenoxy)methyl]piperidin-1-yl]-3-oxoprop-1-enyl]-2-oxo-3,4-dihydro-1h-1,8-naphthyridine-3-carboxylate Chemical compound C=1N=C2NC(=O)C(C(=O)OC)CC2=CC=1\C=C\C(=O)N(CC1)CCC1COC1=CC=C(F)C=C1 SBFXWSFMQLMVAN-FARCUNLSSA-N 0.000 claims description 6
- DWDZGSBLDPOJOY-HWKANZROSA-N n-[5-[(e)-3-oxo-3-[3-(pyridin-4-ylmethoxy)azetidin-1-yl]prop-1-enyl]pyridin-2-yl]acetamide Chemical compound C1=NC(NC(=O)C)=CC=C1\C=C\C(=O)N1CC(OCC=2C=CN=CC=2)C1 DWDZGSBLDPOJOY-HWKANZROSA-N 0.000 claims description 6
- SYUUXAROKMQQDY-VMPITWQZSA-N 6-[(e)-3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound O1C(C)=NC(C2N(CCCC2)C(=O)\C=C\C=2C=C3CCC(=O)NC3=NC=2)=N1 SYUUXAROKMQQDY-VMPITWQZSA-N 0.000 claims description 5
- HCJAKVQPQLYNNM-ZZXKWVIFSA-N 6-[(e)-3-[3-(2-methylpropoxy)azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1C(OCC(C)C)CN1C(=O)\C=C\C1=CN=C(NC(=O)CC2)C2=C1 HCJAKVQPQLYNNM-ZZXKWVIFSA-N 0.000 claims description 5
- LAROSUWXDPDOQF-VMPITWQZSA-N 6-[(e)-3-oxo-3-(3-pentylsulfonylazetidin-1-yl)prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1C(S(=O)(=O)CCCCC)CN1C(=O)\C=C\C1=CN=C(NC(=O)CC2)C2=C1 LAROSUWXDPDOQF-VMPITWQZSA-N 0.000 claims description 5
- XLPKMGVYSWAPAJ-RMKNXTFCSA-N 6-[(e)-3-oxo-3-(3-phenoxyazetidin-1-yl)prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)CCC2=CC=1/C=C/C(=O)N(C1)CC1OC1=CC=CC=C1 XLPKMGVYSWAPAJ-RMKNXTFCSA-N 0.000 claims description 5
- HNGPQMJMLWSXHM-RMKNXTFCSA-N 6-[(e)-3-oxo-3-(3-phenylmethoxyazetidin-1-yl)prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)CCC2=CC=1/C=C/C(=O)N(C1)CC1OCC1=CC=CC=C1 HNGPQMJMLWSXHM-RMKNXTFCSA-N 0.000 claims description 5
- KISSQSDZTGAZSH-DAFODLJHSA-N 6-[(e)-3-oxo-3-[3-(1,3-thiazol-2-ylmethoxy)azetidin-1-yl]prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)CCC2=CC=1/C=C/C(=O)N(C1)CC1OCC1=NC=CS1 KISSQSDZTGAZSH-DAFODLJHSA-N 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 5
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 5
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 5
- 125000001624 naphthyl group Chemical group 0.000 claims description 5
- VFHWQEBTECYEOD-USGQHZDISA-N 1'-methyl-6-[(e)-3-[3-[(e)-c-methyl-n-phenylmethoxycarbonimidoyl]azetidin-1-yl]-3-oxoprop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one Chemical compound C1CN(C)CCC21C(=O)NC1=NC=C(\C=C\C(=O)N3CC(C3)C(\C)=N\OCC=3C=CC=CC=3)C=C1C2 VFHWQEBTECYEOD-USGQHZDISA-N 0.000 claims description 4
- XEWAXJQCXCRSSU-JHVREWCZSA-N 1'-methyl-6-[(e)-3-[3-[(e)-c-methyl-n-propoxycarbonimidoyl]azetidin-1-yl]-3-oxoprop-1-enyl]spiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-2-one Chemical compound C1C(C(/C)=N/OCCC)CN1C(=O)\C=C\C1=CN=C(NC(=O)C2(CCN(C)CC2)C2)C2=C1 XEWAXJQCXCRSSU-JHVREWCZSA-N 0.000 claims description 4
- FPEKLOOAKYGFFC-RMKNXTFCSA-N 6-[(e)-3-(4-hydroxy-4-phenylpiperidin-1-yl)-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1CN(C(=O)\C=C\C=2C=C3CCC(=O)NC3=NC=2)CCC1(O)C1=CC=CC=C1 FPEKLOOAKYGFFC-RMKNXTFCSA-N 0.000 claims description 4
- KUGSQMJLYWUVGU-GORDUTHDSA-N 6-[(e)-3-(azetidin-1-yl)-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)CCC2=CC=1/C=C/C(=O)N1CCC1 KUGSQMJLYWUVGU-GORDUTHDSA-N 0.000 claims description 4
- ZXRBPIJNVOXFME-VMPITWQZSA-N 6-[(e)-3-[3-(1-benzofuran-3-yl)azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1=CC=C2C(C3CN(C3)C(\C=C\C=3C=C4CCC(=O)NC4=NC=3)=O)=COC2=C1 ZXRBPIJNVOXFME-VMPITWQZSA-N 0.000 claims description 4
- FQNBBGYEGMHCAK-QPJJXVBHSA-N 6-[(e)-3-[3-(1-benzofuran-7-yloxy)azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)CCC2=CC=1/C=C/C(=O)N(C1)CC1OC1=CC=CC2=C1OC=C2 FQNBBGYEGMHCAK-QPJJXVBHSA-N 0.000 claims description 4
- GHQDABZURSXDAP-VMPITWQZSA-N 6-[(e)-3-[3-(1-benzothiophen-3-yloxy)azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1=CC=C2C(OC3CN(C3)C(\C=C\C=3C=C4CCC(=O)NC4=NC=3)=O)=CSC2=C1 GHQDABZURSXDAP-VMPITWQZSA-N 0.000 claims description 4
- JCULLUDCSGOFBT-GORDUTHDSA-N 6-[(e)-3-[3-(5-methyl-1,2,4-oxadiazol-3-yl)azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound O1C(C)=NC(C2CN(C2)C(=O)\C=C\C=2C=C3CCC(=O)NC3=NC=2)=N1 JCULLUDCSGOFBT-GORDUTHDSA-N 0.000 claims description 4
- VSHDRPBKHBGVSG-PFQRDXGZSA-N 6-[(e)-3-[3-[(z)-c-methyl-n-(2,2,2-trifluoroethoxy)carbonimidoyl]azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1C(C(=N\OCC(F)(F)F)/C)CN1C(=O)\C=C\C1=CN=C(NC(=O)CC2)C2=C1 VSHDRPBKHBGVSG-PFQRDXGZSA-N 0.000 claims description 4
- NVPQSHFBQKIUEH-LGCJVJRSSA-N 6-[(e)-3-[3-[(z)-n-ethoxy-c-methylcarbonimidoyl]azetidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1C(C(\C)=N/OCC)CN1C(=O)\C=C\C1=CN=C(NC(=O)CC2)C2=C1 NVPQSHFBQKIUEH-LGCJVJRSSA-N 0.000 claims description 4
- YBVZLKFXSIGXLL-ZZXKWVIFSA-N 6-[(e)-3-oxo-3-(3-thiophen-2-ylsulfanylazetidin-1-yl)prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)CCC2=CC=1/C=C/C(=O)N(C1)CC1SC1=CC=CS1 YBVZLKFXSIGXLL-ZZXKWVIFSA-N 0.000 claims description 4
- GQMLYNXCQKUYTD-MFZKSGLQSA-N 6-[(e)-3-oxo-3-[3-[(e)-1-pyrimidin-2-ylpropan-2-ylideneamino]oxyazetidin-1-yl]prop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1N(C(=O)\C=C\C=2C=C3CCC(=O)NC3=NC=2)CC1O\N=C(/C)CC1=NC=CC=N1 GQMLYNXCQKUYTD-MFZKSGLQSA-N 0.000 claims description 4
- WZFFTNBBSJVUDW-ZZXKWVIFSA-N 6-[(e)-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C=1N=C2NC(=O)CCC2=CC=1/C=C/C(=O)N1CCCC1 WZFFTNBBSJVUDW-ZZXKWVIFSA-N 0.000 claims description 4
- 241000588724 Escherichia coli Species 0.000 claims description 4
- 241001465754 Metazoa Species 0.000 claims description 4
- RJQXTJLFIWVMTO-TYNCELHUSA-N Methicillin Chemical compound COC1=CC=CC(OC)=C1C(=O)N[C@@H]1C(=O)N2[C@@H](C(O)=O)C(C)(C)S[C@@H]21 RJQXTJLFIWVMTO-TYNCELHUSA-N 0.000 claims description 4
- 241000223960 Plasmodium falciparum Species 0.000 claims description 4
- 108010059993 Vancomycin Proteins 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 229960003085 meticillin Drugs 0.000 claims description 4
- 229960003165 vancomycin Drugs 0.000 claims description 4
- MYPYJXKWCTUITO-UHFFFAOYSA-N vancomycin Natural products O1C(C(=C2)Cl)=CC=C2C(O)C(C(NC(C2=CC(O)=CC(O)=C2C=2C(O)=CC=C3C=2)C(O)=O)=O)NC(=O)C3NC(=O)C2NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(CC(C)C)NC)C(O)C(C=C3Cl)=CC=C3OC3=CC2=CC1=C3OC1OC(CO)C(O)C(O)C1OC1CC(C)(N)C(O)C(C)O1 MYPYJXKWCTUITO-UHFFFAOYSA-N 0.000 claims description 4
- MYPYJXKWCTUITO-LYRMYLQWSA-O vancomycin(1+) Chemical compound O([C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC1=C2C=C3C=C1OC1=CC=C(C=C1Cl)[C@@H](O)[C@H](C(N[C@@H](CC(N)=O)C(=O)N[C@H]3C(=O)N[C@H]1C(=O)N[C@H](C(N[C@@H](C3=CC(O)=CC(O)=C3C=3C(O)=CC=C1C=3)C([O-])=O)=O)[C@H](O)C1=CC=C(C(=C1)Cl)O2)=O)NC(=O)[C@@H](CC(C)C)[NH2+]C)[C@H]1C[C@](C)([NH3+])[C@H](O)[C@H](C)O1 MYPYJXKWCTUITO-LYRMYLQWSA-O 0.000 claims description 4
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 claims description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- 241000588626 Acinetobacter baumannii Species 0.000 claims description 3
- 241000894006 Bacteria Species 0.000 claims description 3
- 241001647372 Chlamydia pneumoniae Species 0.000 claims description 3
- 241000606768 Haemophilus influenzae Species 0.000 claims description 3
- 241000590002 Helicobacter pylori Species 0.000 claims description 3
- 241000588747 Klebsiella pneumoniae Species 0.000 claims description 3
- 241000187479 Mycobacterium tuberculosis Species 0.000 claims description 3
- 241000588650 Neisseria meningitidis Species 0.000 claims description 3
- 125000002619 bicyclic group Chemical group 0.000 claims description 3
- 229940023064 escherichia coli Drugs 0.000 claims description 3
- 229940047650 haemophilus influenzae Drugs 0.000 claims description 3
- 229940037467 helicobacter pylori Drugs 0.000 claims description 3
- 229940045505 klebsiella pneumoniae Drugs 0.000 claims description 3
- 125000002950 monocyclic group Chemical group 0.000 claims description 3
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 229910052727 yttrium Inorganic materials 0.000 claims description 3
- 241000606748 Actinobacillus pleuropneumoniae Species 0.000 claims description 2
- 241000193738 Bacillus anthracis Species 0.000 claims description 2
- 241000588779 Bordetella bronchiseptica Species 0.000 claims description 2
- 241001293418 Mannheimia haemolytica Species 0.000 claims description 2
- 241000606856 Pasteurella multocida Species 0.000 claims description 2
- 241000191980 Staphylococcus intermedius Species 0.000 claims description 2
- 229940065181 bacillus anthracis Drugs 0.000 claims description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 244000000010 microbial pathogen Species 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims description 2
- 238000002560 therapeutic procedure Methods 0.000 claims description 2
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims description 2
- CXTHEZRFDLOSGG-DHZHZOJOSA-N 6-[(e)-3-[2-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound C1=CC=C2OC(C3CCCCN3C(\C=C\C=3C=C4CCC(=O)NC4=NC=3)=O)=NC2=C1 CXTHEZRFDLOSGG-DHZHZOJOSA-N 0.000 claims 2
- 230000000844 anti-bacterial effect Effects 0.000 abstract description 9
- 239000000543 intermediate Substances 0.000 abstract description 9
- 238000002360 preparation method Methods 0.000 abstract description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 580
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 486
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 398
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 361
- 239000011541 reaction mixture Substances 0.000 description 271
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 231
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 212
- 239000000243 solution Substances 0.000 description 203
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 183
- 235000019439 ethyl acetate Nutrition 0.000 description 173
- 239000007787 solid Substances 0.000 description 170
- 238000005160 1H NMR spectroscopy Methods 0.000 description 146
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 126
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 118
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 112
- 239000000047 product Substances 0.000 description 110
- 239000003480 eluent Substances 0.000 description 105
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 104
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 99
- 229910001868 water Inorganic materials 0.000 description 99
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 98
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 97
- 229910052938 sodium sulfate Inorganic materials 0.000 description 90
- 235000011152 sodium sulphate Nutrition 0.000 description 90
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 84
- 239000003921 oil Substances 0.000 description 79
- 235000019198 oils Nutrition 0.000 description 79
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 74
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 74
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 73
- 239000012074 organic phase Substances 0.000 description 73
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 70
- 238000007792 addition Methods 0.000 description 69
- 239000012047 saturated solution Substances 0.000 description 67
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 57
- 239000000741 silica gel Substances 0.000 description 57
- 229910002027 silica gel Inorganic materials 0.000 description 57
- 229960004132 diethyl ether Drugs 0.000 description 56
- 239000010410 layer Substances 0.000 description 56
- 239000011780 sodium chloride Substances 0.000 description 56
- 238000000132 electrospray ionisation Methods 0.000 description 54
- 238000004587 chromatography analysis Methods 0.000 description 53
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 48
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 46
- YXKQPQYEPVOEAE-DYVSEJHDSA-N (e)-3-(7-oxo-6,8-dihydro-5h-1,8-naphthyridin-3-yl)prop-2-enoic acid;hydrochloride Chemical compound Cl.N1C(=O)CCC2=CC(/C=C/C(=O)O)=CN=C21 YXKQPQYEPVOEAE-DYVSEJHDSA-N 0.000 description 44
- 229910000104 sodium hydride Inorganic materials 0.000 description 42
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 40
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 40
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 34
- 239000000725 suspension Substances 0.000 description 34
- 238000000746 purification Methods 0.000 description 33
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 29
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 29
- QOPVNWQGBQYBBP-UHFFFAOYSA-N chloroethyl chloroformate Chemical compound CC(Cl)OC(Cl)=O QOPVNWQGBQYBBP-UHFFFAOYSA-N 0.000 description 28
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- 239000003208 petroleum Substances 0.000 description 27
- 238000010992 reflux Methods 0.000 description 27
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 25
- 229910052786 argon Inorganic materials 0.000 description 25
- 238000012746 preparative thin layer chromatography Methods 0.000 description 25
- 230000002829 reductive effect Effects 0.000 description 25
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 24
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 24
- 238000004440 column chromatography Methods 0.000 description 24
- 229910052757 nitrogen Inorganic materials 0.000 description 22
- 229910003827 NRaRb Inorganic materials 0.000 description 21
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 20
- 239000008346 aqueous phase Substances 0.000 description 20
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 20
- 239000012312 sodium hydride Substances 0.000 description 20
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 19
- 239000000706 filtrate Substances 0.000 description 19
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 19
- 238000001816 cooling Methods 0.000 description 18
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 16
- 239000012279 sodium borohydride Substances 0.000 description 15
- 229910000033 sodium borohydride Inorganic materials 0.000 description 15
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 13
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 13
- 239000002244 precipitate Substances 0.000 description 13
- ISXSCDLOGDJUNJ-UHFFFAOYSA-N tert-butyl prop-2-enoate Chemical compound CC(C)(C)OC(=O)C=C ISXSCDLOGDJUNJ-UHFFFAOYSA-N 0.000 description 13
- 239000012267 brine Substances 0.000 description 12
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 12
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 12
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 11
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 11
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 11
- 239000012044 organic layer Substances 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- 239000007832 Na2SO4 Substances 0.000 description 10
- 230000008569 process Effects 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- 238000001665 trituration Methods 0.000 description 10
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 9
- 239000003112 inhibitor Substances 0.000 description 9
- MSVZMUILYMLJCF-UHFFFAOYSA-N (1-benzhydrylazetidin-3-yl) methanesulfonate Chemical compound C1C(OS(=O)(=O)C)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 MSVZMUILYMLJCF-UHFFFAOYSA-N 0.000 description 8
- LYRUYJHPHGVEKU-UHFFFAOYSA-N 3-(thiophen-2-ylmethoxy)azetidine;hydrochloride Chemical compound Cl.C=1C=CSC=1COC1CNC1 LYRUYJHPHGVEKU-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 238000005481 NMR spectroscopy Methods 0.000 description 8
- 235000019502 Orange oil Nutrition 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000010502 orange oil Substances 0.000 description 8
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 8
- MMAJXKGUZYDTHV-UHFFFAOYSA-N 1-benzhydrylazetidin-3-ol Chemical compound C1C(O)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 MMAJXKGUZYDTHV-UHFFFAOYSA-N 0.000 description 7
- HWARTXMPXSZHGE-UHFFFAOYSA-N 5-bromo-3-(bromomethyl)pyridin-2-amine;hydrobromide Chemical compound Br.NC1=NC=C(Br)C=C1CBr HWARTXMPXSZHGE-UHFFFAOYSA-N 0.000 description 7
- 102000004190 Enzymes Human genes 0.000 description 7
- 108090000790 Enzymes Proteins 0.000 description 7
- 239000003242 anti bacterial agent Substances 0.000 description 7
- 239000007864 aqueous solution Substances 0.000 description 7
- 239000012230 colorless oil Substances 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 125000004566 azetidin-1-yl group Chemical group N1(CCC1)* 0.000 description 6
- 230000001580 bacterial effect Effects 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- DNWBPFYWQAZTII-UHFFFAOYSA-N 4-[(4-fluorophenoxy)methyl]piperidine;hydrochloride Chemical compound Cl.C1=CC(F)=CC=C1OCC1CCNCC1 DNWBPFYWQAZTII-UHFFFAOYSA-N 0.000 description 5
- 229940095054 ammoniac Drugs 0.000 description 5
- 235000019270 ammonium chloride Nutrition 0.000 description 5
- 239000003096 antiparasitic agent Substances 0.000 description 5
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 238000003818 flash chromatography Methods 0.000 description 5
- 125000001715 oxadiazolyl group Chemical group 0.000 description 5
- 125000003386 piperidinyl group Chemical group 0.000 description 5
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 5
- 238000001228 spectrum Methods 0.000 description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- 239000001993 wax Substances 0.000 description 5
- HIVQAWXDBPYNDU-UHFFFAOYSA-N (2-amino-5-bromopyridin-3-yl)methanol Chemical compound NC1=NC=C(Br)C=C1CO HIVQAWXDBPYNDU-UHFFFAOYSA-N 0.000 description 4
- FEIACFYXEWBKHU-UHFFFAOYSA-N (2-aminopyridin-3-yl)methanol Chemical compound NC1=NC=CC=C1CO FEIACFYXEWBKHU-UHFFFAOYSA-N 0.000 description 4
- TUXALUGHPWWRHA-UHFFFAOYSA-N 1-benzhydryl-3-pentoxyazetidine Chemical compound C1C(OCCCCC)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 TUXALUGHPWWRHA-UHFFFAOYSA-N 0.000 description 4
- DNLRIAHFIWYTLJ-UHFFFAOYSA-N 3-[(4-methylthiophen-2-yl)methoxy]azetidine;hydrochloride Chemical compound Cl.CC1=CSC(COC2CNC2)=C1 DNLRIAHFIWYTLJ-UHFFFAOYSA-N 0.000 description 4
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- 229930040373 Paraformaldehyde Natural products 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 4
- 229940125687 antiparasitic agent Drugs 0.000 description 4
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- JFJSWGJVUXFFLB-SNAWJCMRSA-N ethyl (e)-3-(1'-methyl-7-oxospiro[5,8-dihydro-1,8-naphthyridine-6,4'-piperidine]-3-yl)prop-2-enoate Chemical compound C1C2=CC(/C=C/C(=O)OCC)=CN=C2NC(=O)C21CCN(C)CC2 JFJSWGJVUXFFLB-SNAWJCMRSA-N 0.000 description 4
- RUJPPJYDHHAEEK-UHFFFAOYSA-N ethyl piperidine-4-carboxylate Chemical compound CCOC(=O)C1CCNCC1 RUJPPJYDHHAEEK-UHFFFAOYSA-N 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 150000004665 fatty acids Chemical class 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical compound NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 4
- 229910003002 lithium salt Inorganic materials 0.000 description 4
- 159000000002 lithium salts Chemical class 0.000 description 4
- 238000012544 monitoring process Methods 0.000 description 4
- 229920002866 paraformaldehyde Polymers 0.000 description 4
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- KBJPEEKMTGAFKO-UHFFFAOYSA-N tert-butyl 4-[(4-fluorophenoxy)methyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1COC1=CC=C(F)C=C1 KBJPEEKMTGAFKO-UHFFFAOYSA-N 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 3
- DHOBZYGMEYEAEM-UHFFFAOYSA-N 3-(chloromethyl)-1-methylpyrazole Chemical compound CN1C=CC(CCl)=N1 DHOBZYGMEYEAEM-UHFFFAOYSA-N 0.000 description 3
- RHMPLDJJXGPMEX-UHFFFAOYSA-N 4-fluorophenol Chemical compound OC1=CC=C(F)C=C1 RHMPLDJJXGPMEX-UHFFFAOYSA-N 0.000 description 3
- VJEOGGNIBLORIJ-UHFFFAOYSA-N 6-bromo-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound N1C(=O)CCC2=CC(Br)=CN=C21 VJEOGGNIBLORIJ-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- 101150041968 CDC13 gene Proteins 0.000 description 3
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 3
- XEFQLINVKFYRCS-UHFFFAOYSA-N Triclosan Chemical compound OC1=CC(Cl)=CC=C1OC1=CC=C(Cl)C=C1Cl XEFQLINVKFYRCS-UHFFFAOYSA-N 0.000 description 3
- 150000003926 acrylamides Chemical class 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 3
- 125000002393 azetidinyl group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 239000013058 crude material Substances 0.000 description 3
- 238000010511 deprotection reaction Methods 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical compound OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 229960003350 isoniazid Drugs 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- VHSIAYLBCLUAFT-UHFFFAOYSA-N n-[3-acetyl-6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-1-methyl-2-oxo-1,8-naphthyridin-4-yl]acetamide Chemical group C=1C=C(Cl)C=CC=1C=1C=C2C(NC(=O)C)=C(C(C)=O)C(=O)N(C)C2=NC=1C1=CC=C(Cl)C=C1Cl VHSIAYLBCLUAFT-UHFFFAOYSA-N 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 235000011181 potassium carbonates Nutrition 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 125000006238 prop-1-en-1-yl group Chemical group [H]\C(*)=C(/[H])C([H])([H])[H] 0.000 description 3
- 125000000714 pyrimidinyl group Chemical group 0.000 description 3
- NXWGFUGGOMGFTN-AATRIKPKSA-N tert-butyl (e)-3-[3-[2-(4-methylpiperazin-1-yl)ethyl]-2-oxo-1,4-dihydropyrido[2,3-d]pyrimidin-6-yl]prop-2-enoate Chemical compound C1CN(C)CCN1CCN1C(=O)NC2=NC=C(\C=C\C(=O)OC(C)(C)C)C=C2C1 NXWGFUGGOMGFTN-AATRIKPKSA-N 0.000 description 3
- XRRXRQJQQKMFBC-UHFFFAOYSA-N tert-butyl 3-hydroxyazetidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CC(O)C1 XRRXRQJQQKMFBC-UHFFFAOYSA-N 0.000 description 3
- APCBTRDHCDOPNY-UHFFFAOYSA-N tert-butyl 3-hydroxypyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(O)C1 APCBTRDHCDOPNY-UHFFFAOYSA-N 0.000 description 3
- 125000000335 thiazolyl group Chemical group 0.000 description 3
- 125000001544 thienyl group Chemical group 0.000 description 3
- 229960003500 triclosan Drugs 0.000 description 3
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 3
- UAQJEIWAMCLVTE-UHFFFAOYSA-N (3-methylthiophen-2-yl)methanol Chemical compound CC=1C=CSC=1CO UAQJEIWAMCLVTE-UHFFFAOYSA-N 0.000 description 2
- ZITLTSGBFHFCOG-UHFFFAOYSA-N (4-chlorothiophen-2-yl)methanol Chemical compound OCC1=CC(Cl)=CS1 ZITLTSGBFHFCOG-UHFFFAOYSA-N 0.000 description 2
- AUQLBQWHCWBCAW-UHFFFAOYSA-N (4-methylthiophen-2-yl)methanol Chemical compound CC1=CSC(CO)=C1 AUQLBQWHCWBCAW-UHFFFAOYSA-N 0.000 description 2
- YAWGNFISLHMUDV-UHFFFAOYSA-N (5-methylthiophen-2-yl)methanol Chemical compound CC1=CC=C(CO)S1 YAWGNFISLHMUDV-UHFFFAOYSA-N 0.000 description 2
- YRVBCSFXERTWHW-VEELZWTKSA-N (e)-3-(6-aminopyridin-3-yl)prop-2-enoic acid;hydrochloride Chemical compound Cl.NC1=CC=C(\C=C\C(O)=O)C=N1 YRVBCSFXERTWHW-VEELZWTKSA-N 0.000 description 2
- SCWOZVKYHJFXCN-NSCUHMNNSA-N (e)-3-(6-methoxycarbonyl-7-oxo-6,8-dihydro-5h-1,8-naphthyridin-3-yl)prop-2-enoic acid Chemical compound OC(=O)/C=C/C1=CN=C2NC(=O)C(C(=O)OC)CC2=C1 SCWOZVKYHJFXCN-NSCUHMNNSA-N 0.000 description 2
- OKZFNHQSKKJGSI-TYYBGVCCSA-N (e)-3-(7-oxospiro[5,8-dihydro-1,8-naphthyridine-6,4'-piperidine]-3-yl)prop-2-enoic acid;hydrochloride Chemical compound Cl.C1C2=CC(/C=C/C(=O)O)=CN=C2NC(=O)C21CCNCC2 OKZFNHQSKKJGSI-TYYBGVCCSA-N 0.000 description 2
- XYVUZJHMCKIDFN-BJILWQEISA-N (e)-3-[3-(2-ethoxy-2-oxoethyl)-2-oxo-1,4-dihydropyrido[2,3-d]pyrimidin-6-yl]prop-2-enoic acid;hydrochloride Chemical compound Cl.OC(=O)/C=C/C1=CN=C2NC(=O)N(CC(=O)OCC)CC2=C1 XYVUZJHMCKIDFN-BJILWQEISA-N 0.000 description 2
- LRVYYURBPMVRGX-BJILWQEISA-N (e)-3-[3-[(dimethylamino)methyl]-1h-pyrrolo[2,3-b]pyridin-5-yl]prop-2-enoic acid;hydrochloride Chemical compound Cl.C1=C(\C=C\C(O)=O)C=C2C(CN(C)C)=CNC2=N1 LRVYYURBPMVRGX-BJILWQEISA-N 0.000 description 2
- FIQPNTGHEQXJED-KQGICBIGSA-N (e)-3-[4-[(4-methoxyphenyl)methyl]-2-oxo-3,5-dihydro-1h-pyrido[2,3-e][1,4]diazepin-7-yl]prop-2-enoic acid;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1CN1CC(=O)NC2=NC=C(\C=C\C(O)=O)C=C2C1 FIQPNTGHEQXJED-KQGICBIGSA-N 0.000 description 2
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 2
- PRFRDWBMMGJXFG-NLRVBDNBSA-N (e)-n-(1-benzhydrylazetidin-3-yl)oxy-1-pyrimidin-2-ylpropan-2-imine Chemical compound C1N(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1O\N=C(/C)CC1=NC=CC=N1 PRFRDWBMMGJXFG-NLRVBDNBSA-N 0.000 description 2
- MEDCKKWESSXZQA-XHIXCECLSA-N (e)-n-(azetidin-3-yloxy)-1-pyrimidin-2-ylpropan-2-imine;hydrochloride Chemical compound Cl.C1NCC1O\N=C(/C)CC1=NC=CC=N1 MEDCKKWESSXZQA-XHIXCECLSA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- VGYSPQFKHUSUGU-UHFFFAOYSA-N 1-[4-[(4-fluorophenoxy)methyl]piperidin-1-yl]prop-2-en-1-one Chemical compound C1=CC(F)=CC=C1OCC1CCN(C(=O)C=C)CC1 VGYSPQFKHUSUGU-UHFFFAOYSA-N 0.000 description 2
- XNVCTEXESWBRKO-UHFFFAOYSA-N 1-benzhydryl-2-[(5-methylthiophen-2-yl)methoxy]azetidine Chemical compound S1C(C)=CC=C1COC1N(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 XNVCTEXESWBRKO-UHFFFAOYSA-N 0.000 description 2
- IFNVRTWGTJSQQL-UHFFFAOYSA-N 1-benzhydryl-3-(1-benzothiophen-2-ylmethoxy)azetidine Chemical compound C=1C2=CC=CC=C2SC=1COC(C1)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 IFNVRTWGTJSQQL-UHFFFAOYSA-N 0.000 description 2
- DIVHNVUDEILOGD-UHFFFAOYSA-N 1-benzhydryl-3-(2-methoxyethoxy)azetidine Chemical compound C1C(OCCOC)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 DIVHNVUDEILOGD-UHFFFAOYSA-N 0.000 description 2
- OTQKVWBZAGEKKE-UHFFFAOYSA-N 1-benzhydryl-3-(2-methylprop-2-enoxy)azetidine Chemical compound C1C(OCC(=C)C)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 OTQKVWBZAGEKKE-UHFFFAOYSA-N 0.000 description 2
- LEEBKLLGNICVBK-UHFFFAOYSA-N 1-benzhydryl-3-(2-methylpropoxy)azetidine Chemical compound C1C(OCC(C)C)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 LEEBKLLGNICVBK-UHFFFAOYSA-N 0.000 description 2
- HRPPKDKOCOPASE-UHFFFAOYSA-N 1-benzhydryl-3-(2-thiophen-2-ylethoxy)azetidine Chemical compound C1N(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1OCCC1=CC=CS1 HRPPKDKOCOPASE-UHFFFAOYSA-N 0.000 description 2
- DPHVSYZKLNTXTL-UHFFFAOYSA-N 1-benzhydryl-3-(3-methoxypropoxy)azetidine Chemical compound C1C(OCCCOC)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 DPHVSYZKLNTXTL-UHFFFAOYSA-N 0.000 description 2
- SIKGRMAMVBPPTQ-UHFFFAOYSA-N 1-benzhydryl-3-(3-thiophen-2-ylpropoxy)azetidine Chemical compound C=1C=CSC=1CCCOC(C1)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 SIKGRMAMVBPPTQ-UHFFFAOYSA-N 0.000 description 2
- DBFMKLNQGKNJBW-UHFFFAOYSA-N 1-benzhydryl-3-(4,4,4-trifluorobutoxy)azetidine Chemical compound C1C(OCCCC(F)(F)F)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 DBFMKLNQGKNJBW-UHFFFAOYSA-N 0.000 description 2
- NCODIKXONMFHDC-UHFFFAOYSA-N 1-benzhydryl-3-(furan-2-ylmethoxy)azetidine Chemical compound C=1C=COC=1COC(C1)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 NCODIKXONMFHDC-UHFFFAOYSA-N 0.000 description 2
- CXRNXQPVOBHLRR-UHFFFAOYSA-N 1-benzhydryl-3-(thiophen-2-ylmethoxy)azetidine Chemical compound C=1C=CSC=1COC(C1)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 CXRNXQPVOBHLRR-UHFFFAOYSA-N 0.000 description 2
- BHRRLZAAXPCTOU-UHFFFAOYSA-N 1-benzhydryl-3-[(3-methylthiophen-2-yl)methoxy]azetidine Chemical compound C1=CSC(COC2CN(C2)C(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1C BHRRLZAAXPCTOU-UHFFFAOYSA-N 0.000 description 2
- ROXRIKXIMSCDER-UHFFFAOYSA-N 1-benzhydryl-3-[(4-bromothiophen-2-yl)methoxy]azetidine Chemical compound BrC1=CSC(COC2CN(C2)C(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 ROXRIKXIMSCDER-UHFFFAOYSA-N 0.000 description 2
- NUEPUBPUMYOYMB-UHFFFAOYSA-N 1-benzhydryl-3-[(4-chlorothiophen-2-yl)methoxy]azetidine Chemical compound ClC1=CSC(COC2CN(C2)C(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NUEPUBPUMYOYMB-UHFFFAOYSA-N 0.000 description 2
- OBLQKXFFWCDHAV-UHFFFAOYSA-N 1-benzhydryl-3-[(4-methylthiophen-2-yl)methoxy]azetidine Chemical compound CC1=CSC(COC2CN(C2)C(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 OBLQKXFFWCDHAV-UHFFFAOYSA-N 0.000 description 2
- GRKBEWPBMMCDSY-IJUHEHPCSA-N 1-benzhydryl-3-[(e)-2-methylbut-2-enoxy]azetidine Chemical compound C1C(OCC(/C)=C/C)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 GRKBEWPBMMCDSY-IJUHEHPCSA-N 0.000 description 2
- SSCJXXDUWOZRKX-UHFFFAOYSA-N 1-benzhydryl-3-but-2-enoxyazetidine Chemical compound C1C(OCC=CC)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 SSCJXXDUWOZRKX-UHFFFAOYSA-N 0.000 description 2
- QBQUDHYWQWPODI-UHFFFAOYSA-N 1-benzhydryl-3-butoxyazetidine Chemical compound C1C(OCCCC)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 QBQUDHYWQWPODI-UHFFFAOYSA-N 0.000 description 2
- HCIXAPKKCRGXTA-UHFFFAOYSA-N 1-benzhydryl-3-pentylsulfanylazetidine Chemical compound C1C(SCCCCC)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 HCIXAPKKCRGXTA-UHFFFAOYSA-N 0.000 description 2
- IXRYJGWKUXKWRX-UHFFFAOYSA-N 1-benzhydryl-3-pentylsulfonylazetidine Chemical compound C1C(S(=O)(=O)CCCCC)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 IXRYJGWKUXKWRX-UHFFFAOYSA-N 0.000 description 2
- GLAMCKIBNCIMFW-UHFFFAOYSA-N 1-benzhydryl-3-phenoxyazetidine Chemical compound C1C(OC=2C=CC=CC=2)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 GLAMCKIBNCIMFW-UHFFFAOYSA-N 0.000 description 2
- PFXWGEBRJDLNJB-UHFFFAOYSA-N 1-benzhydryl-3-phenylmethoxyazetidine Chemical compound C=1C=CC=CC=1COC(C1)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 PFXWGEBRJDLNJB-UHFFFAOYSA-N 0.000 description 2
- BQLHMMQUVJCTAN-UHFFFAOYSA-N 1-chloro-3-methoxypropane Chemical compound COCCCCl BQLHMMQUVJCTAN-UHFFFAOYSA-N 0.000 description 2
- BLXSFCHWMBESKV-UHFFFAOYSA-N 1-iodopentane Chemical compound CCCCCI BLXSFCHWMBESKV-UHFFFAOYSA-N 0.000 description 2
- SUKBKWNTXACIFX-UHFFFAOYSA-N 1-o-tert-butyl 4-o-ethyl 4-[(2-amino-5-bromopyridin-3-yl)methyl]piperidine-1,4-dicarboxylate Chemical compound C=1C(Br)=CN=C(N)C=1CC1(C(=O)OCC)CCN(C(=O)OC(C)(C)C)CC1 SUKBKWNTXACIFX-UHFFFAOYSA-N 0.000 description 2
- QZYKNQASNNLMQJ-UHFFFAOYSA-N 1-pyrimidin-2-ylpropan-2-one Chemical compound CC(=O)CC1=NC=CC=N1 QZYKNQASNNLMQJ-UHFFFAOYSA-N 0.000 description 2
- RFMZUQBBEZILNZ-UHFFFAOYSA-N 2-(1-benzhydrylazetidin-3-yl)oxyisoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1OC(C1)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 RFMZUQBBEZILNZ-UHFFFAOYSA-N 0.000 description 2
- SDWBIJFENFPAAU-UHFFFAOYSA-N 2-(3-chloropropyl)thiophene Chemical compound ClCCCC1=CC=CS1 SDWBIJFENFPAAU-UHFFFAOYSA-N 0.000 description 2
- ILZAKGAJPLLMOW-UHFFFAOYSA-N 2-(azetidin-3-yloxymethyl)-1,3-thiazole;hydrochloride Chemical compound Cl.N=1C=CSC=1COC1CNC1 ILZAKGAJPLLMOW-UHFFFAOYSA-N 0.000 description 2
- HGPATVJUCMLGIY-UHFFFAOYSA-N 2-(bromomethyl)-1-benzothiophene Chemical compound C1=CC=C2SC(CBr)=CC2=C1 HGPATVJUCMLGIY-UHFFFAOYSA-N 0.000 description 2
- ICKMSJLWRQTIFI-UHFFFAOYSA-N 2-(chloromethyl)-1,3-thiazol-3-ium;chloride Chemical compound Cl.ClCC1=NC=CS1 ICKMSJLWRQTIFI-UHFFFAOYSA-N 0.000 description 2
- PMNASCXFSVTLTC-UHFFFAOYSA-N 2-(chloromethyl)-3-methylthiophene Chemical compound CC=1C=CSC=1CCl PMNASCXFSVTLTC-UHFFFAOYSA-N 0.000 description 2
- NGRMSGQTJBVIHN-UHFFFAOYSA-N 2-(chloromethyl)-5-methylthiophene Chemical compound CC1=CC=C(CCl)S1 NGRMSGQTJBVIHN-UHFFFAOYSA-N 0.000 description 2
- GANBJDIOIDQSGI-UHFFFAOYSA-N 2-(chloromethyl)furan Chemical compound ClCC1=CC=CO1 GANBJDIOIDQSGI-UHFFFAOYSA-N 0.000 description 2
- FUOHKPSBGLXIRL-UHFFFAOYSA-N 2-(chloromethyl)thiophene Chemical compound ClCC1=CC=CS1 FUOHKPSBGLXIRL-UHFFFAOYSA-N 0.000 description 2
- NEJDKFPXHQRVMV-HWKANZROSA-N 2-Methyl-2-buten-1-ol Chemical compound C\C=C(/C)CO NEJDKFPXHQRVMV-HWKANZROSA-N 0.000 description 2
- WUTPJAVRWVWQKU-SBSPUUFOSA-N 2-[(2r)-pyrrolidin-2-yl]-1,3-benzoxazole;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1CCN[C@H]1C1=NC2=CC=CC=C2O1 WUTPJAVRWVWQKU-SBSPUUFOSA-N 0.000 description 2
- ZEDZHTMMXFHZEP-UHFFFAOYSA-N 2-amino-5-bromopyridine-3-carbaldehyde;hydrobromide Chemical compound Br.NC1=NC=C(Br)C=C1C=O ZEDZHTMMXFHZEP-UHFFFAOYSA-N 0.000 description 2
- KPIVDNYJNOPGBE-UHFFFAOYSA-N 2-aminonicotinic acid Chemical compound NC1=NC=CC=C1C(O)=O KPIVDNYJNOPGBE-UHFFFAOYSA-N 0.000 description 2
- IHHCYKUEQAWXMJ-SNAWJCMRSA-N 2-chloropropyl 2-oxo-7-[(e)-3-oxo-3-[3-(thiophen-2-ylmethoxy)azetidin-1-yl]prop-1-enyl]-3,5-dihydro-1h-pyrido[2,3-e][1,4]diazepine-4-carboxylate Chemical compound C=1N=C2NC(=O)CN(C(=O)OCC(Cl)C)CC2=CC=1\C=C\C(=O)N(C1)CC1OCC1=CC=CS1 IHHCYKUEQAWXMJ-SNAWJCMRSA-N 0.000 description 2
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 2
- YABHVFBRWSOAOF-UHFFFAOYSA-N 3-(1-benzothiophen-2-ylmethoxy)azetidine;hydrochloride Chemical compound Cl.C=1C2=CC=CC=C2SC=1COC1CNC1 YABHVFBRWSOAOF-UHFFFAOYSA-N 0.000 description 2
- OBBNIVPMQNPASL-UHFFFAOYSA-N 3-(2-methoxyethoxy)azetidine;hydrochloride Chemical compound Cl.COCCOC1CNC1 OBBNIVPMQNPASL-UHFFFAOYSA-N 0.000 description 2
- HAFLKUAYNQYTLE-UHFFFAOYSA-N 3-(2-methylprop-2-enoxy)azetidine;hydrochloride Chemical compound Cl.CC(=C)COC1CNC1 HAFLKUAYNQYTLE-UHFFFAOYSA-N 0.000 description 2
- VYVVLPMWPWLLKT-UHFFFAOYSA-N 3-(2-methylpropoxy)azetidine;hydrochloride Chemical compound Cl.CC(C)COC1CNC1 VYVVLPMWPWLLKT-UHFFFAOYSA-N 0.000 description 2
- PKMTXEWMFFWLKN-UHFFFAOYSA-N 3-(3,3,3-trifluoropropoxy)azetidine;hydrochloride Chemical compound Cl.FC(F)(F)CCOC1CNC1 PKMTXEWMFFWLKN-UHFFFAOYSA-N 0.000 description 2
- AJBPFIPNXRNTAN-UHFFFAOYSA-N 3-(3-methoxypropoxy)azetidine;hydrochloride Chemical compound Cl.COCCCOC1CNC1 AJBPFIPNXRNTAN-UHFFFAOYSA-N 0.000 description 2
- VPHXMIFVFDFFTC-UHFFFAOYSA-N 3-(azetidin-3-yl)-5-methyl-1,2,4-oxadiazole;hydrochloride Chemical compound Cl.O1C(C)=NC(C2CNC2)=N1 VPHXMIFVFDFFTC-UHFFFAOYSA-N 0.000 description 2
- PUWJJZIDUVJXGQ-UHFFFAOYSA-N 3-(azetidin-3-yloxymethyl)-1-methylpyrazole;hydrochloride Chemical compound Cl.CN1C=CC(COC2CNC2)=N1 PUWJJZIDUVJXGQ-UHFFFAOYSA-N 0.000 description 2
- NSUJWOOGJORRLZ-UHFFFAOYSA-N 3-(furan-2-ylmethoxy)azetidine;hydrochloride Chemical compound Cl.C=1C=COC=1COC1CNC1 NSUJWOOGJORRLZ-UHFFFAOYSA-N 0.000 description 2
- RFABTXIIPHWZAW-UHFFFAOYSA-N 3-[(3-methylthiophen-2-yl)methoxy]azetidine;hydrochloride Chemical compound Cl.C1=CSC(COC2CNC2)=C1C RFABTXIIPHWZAW-UHFFFAOYSA-N 0.000 description 2
- ZXFRAMJCXDZYFU-UHFFFAOYSA-N 3-[(4-bromothiophen-2-yl)methoxy]azetidine;hydrochloride Chemical compound Cl.BrC1=CSC(COC2CNC2)=C1 ZXFRAMJCXDZYFU-UHFFFAOYSA-N 0.000 description 2
- ZYQVCZQOHBWPNV-UHFFFAOYSA-N 3-[(4-fluorophenoxy)methyl]piperidine;hydrochloride Chemical compound Cl.C1=CC(F)=CC=C1OCC1CNCCC1 ZYQVCZQOHBWPNV-UHFFFAOYSA-N 0.000 description 2
- FYJSEVULERNUSN-UHFFFAOYSA-N 3-[(5-methylthiophen-2-yl)methoxy]azetidine;hydrochloride Chemical compound Cl.S1C(C)=CC=C1COC1CNC1 FYJSEVULERNUSN-UHFFFAOYSA-N 0.000 description 2
- BSPMDQITIUTRSO-CDQVLDCRSA-N 3-[(e)-2-methylbut-2-enoxy]azetidine;hydrochloride Chemical compound Cl.C\C=C(/C)COC1CNC1 BSPMDQITIUTRSO-CDQVLDCRSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- MGJZQZZGIQFPLX-UHFFFAOYSA-N 3-but-2-enoxyazetidine;hydrochloride Chemical compound Cl.CC=CCOC1CNC1 MGJZQZZGIQFPLX-UHFFFAOYSA-N 0.000 description 2
- AQKPHICTVBTJLY-UHFFFAOYSA-N 3-butoxyazetidine;hydrochloride Chemical compound Cl.CCCCOC1CNC1 AQKPHICTVBTJLY-UHFFFAOYSA-N 0.000 description 2
- PXCSMFIAUYDGAV-UHFFFAOYSA-N 3-pentylsulfonylazetidine;hydrochloride Chemical compound Cl.CCCCCS(=O)(=O)C1CNC1 PXCSMFIAUYDGAV-UHFFFAOYSA-N 0.000 description 2
- BDSCNJYDEAUDGY-UHFFFAOYSA-N 3-phenoxyazetidine;hydrochloride Chemical compound Cl.C1NCC1OC1=CC=CC=C1 BDSCNJYDEAUDGY-UHFFFAOYSA-N 0.000 description 2
- NHLZTNBPPGIUMZ-UHFFFAOYSA-N 3-phenoxypyrrolidine;hydrochloride Chemical compound Cl.C1NCCC1OC1=CC=CC=C1 NHLZTNBPPGIUMZ-UHFFFAOYSA-N 0.000 description 2
- BQTSSUSLZRYTQB-UHFFFAOYSA-N 3-phenylmethoxyazetidine;hydrochloride Chemical compound Cl.C=1C=CC=CC=1COC1CNC1 BQTSSUSLZRYTQB-UHFFFAOYSA-N 0.000 description 2
- GRFNBEZIAWKNCO-UHFFFAOYSA-N 3-pyridinol Chemical compound OC1=CC=CN=C1 GRFNBEZIAWKNCO-UHFFFAOYSA-N 0.000 description 2
- BQFZLZCBCSKUPL-UHFFFAOYSA-N 3-thiophen-2-ylpropan-1-ol Chemical compound OCCCC1=CC=CS1 BQFZLZCBCSKUPL-UHFFFAOYSA-N 0.000 description 2
- MEUAVGJWGDPTLF-UHFFFAOYSA-N 4-(5-benzenesulfonylamino-1-methyl-1h-benzoimidazol-2-ylmethyl)-benzamidine Chemical compound N=1C2=CC(NS(=O)(=O)C=3C=CC=CC=3)=CC=C2N(C)C=1CC1=CC=C(C(N)=N)C=C1 MEUAVGJWGDPTLF-UHFFFAOYSA-N 0.000 description 2
- HPEDEPKGKGQFCL-UHFFFAOYSA-N 4-(azetidin-3-yloxymethyl)pyridine;dihydrochloride Chemical compound Cl.Cl.C=1C=NC=CC=1COC1CNC1 HPEDEPKGKGQFCL-UHFFFAOYSA-N 0.000 description 2
- JOPVYZZZKLTMMD-UHFFFAOYSA-N 4-bromo-2-(chloromethyl)thiophene Chemical compound ClCC1=CC(Br)=CS1 JOPVYZZZKLTMMD-UHFFFAOYSA-N 0.000 description 2
- JDMIRNVFANMJCV-UHFFFAOYSA-N 4-chloro-2-(chloromethyl)thiophene Chemical compound ClCC1=CC(Cl)=CS1 JDMIRNVFANMJCV-UHFFFAOYSA-N 0.000 description 2
- PNFVQVDCZUPKMF-UHFFFAOYSA-N 5-(azetidin-3-yloxymethyl)-1,3-thiazole;hydrochloride Chemical compound Cl.C=1N=CSC=1COC1CNC1 PNFVQVDCZUPKMF-UHFFFAOYSA-N 0.000 description 2
- ZIESYFUVRJDNNW-UHFFFAOYSA-N 5-(chloromethyl)-1,3-thiazole;hydrochloride Chemical compound Cl.ClCC1=CN=CS1 ZIESYFUVRJDNNW-UHFFFAOYSA-N 0.000 description 2
- ZROJJAPXIGBDIZ-UHFFFAOYSA-N 5-bromo-3-(bromomethyl)pyridin-2-amine Chemical compound NC1=NC=C(Br)C=C1CBr ZROJJAPXIGBDIZ-UHFFFAOYSA-N 0.000 description 2
- GYEGVHOJCGKORZ-UHFFFAOYSA-N 5-bromo-3-[[2-(4-methylpiperazin-1-yl)ethylamino]methyl]pyridin-2-amine Chemical compound C1CN(C)CCN1CCNCC1=CC(Br)=CN=C1N GYEGVHOJCGKORZ-UHFFFAOYSA-N 0.000 description 2
- ZRAUTWFNQAHPJE-UHFFFAOYSA-N 5-methyl-3-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride Chemical compound Cl.O1C(C)=NC(C2NCCCC2)=N1 ZRAUTWFNQAHPJE-UHFFFAOYSA-N 0.000 description 2
- LCYCKIXATFRALF-UHFFFAOYSA-N 6-bromo-3-(hydroxymethyl)-3,4-dihydro-1h-1,8-naphthyridin-2-one Chemical compound BrC1=CN=C2NC(=O)C(CO)CC2=C1 LCYCKIXATFRALF-UHFFFAOYSA-N 0.000 description 2
- SNLHLEYIPHLHDB-UHFFFAOYSA-N 6-bromo-3-[2-(4-methylpiperazin-1-yl)ethyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-one Chemical compound C1CN(C)CCN1CCN1C(=O)NC2=NC=C(Br)C=C2C1 SNLHLEYIPHLHDB-UHFFFAOYSA-N 0.000 description 2
- RCSFUPKBSZDEJQ-UHFFFAOYSA-N 7-bromo-4-[(4-methoxyphenyl)methyl]-3,5-dihydro-1h-pyrido[2,3-e][1,4]diazepin-2-one Chemical compound C1=CC(OC)=CC=C1CN1CC(=O)NC2=NC=C(Br)C=C2C1 RCSFUPKBSZDEJQ-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 235000014469 Bacillus subtilis Nutrition 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 101150005343 INHA gene Proteins 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- BAWFJGJZGIEFAR-NNYOXOHSSA-O NAD(+) Chemical compound NC(=O)C1=CC=C[N+]([C@H]2[C@@H]([C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OC[C@@H]3[C@H]([C@@H](O)[C@@H](O3)N3C4=NC=NC(N)=C4N=C3)O)O2)O)=C1 BAWFJGJZGIEFAR-NNYOXOHSSA-O 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- MJZQSPDYIKSJCN-UHFFFAOYSA-N azetidine-3-carbonitrile;hydrochloride Chemical compound Cl.N#CC1CNC1 MJZQSPDYIKSJCN-UHFFFAOYSA-N 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910000024 caesium carbonate Inorganic materials 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- MRGWUDKEBPXDJX-UHFFFAOYSA-N diazaborinine Chemical class B1=CC=CN=N1 MRGWUDKEBPXDJX-UHFFFAOYSA-N 0.000 description 2
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 2
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- UJKOECIHHOQRMN-ONEGZZNKSA-N ethyl (e)-3-(7-oxospiro[5,8-dihydro-1,8-naphthyridine-6,4'-piperidine]-3-yl)prop-2-enoate Chemical compound C1C2=CC(/C=C/C(=O)OCC)=CN=C2NC(=O)C21CCNCC2 UJKOECIHHOQRMN-ONEGZZNKSA-N 0.000 description 2
- QVUUGEZJZZWGBP-UHFFFAOYSA-N ethyl 2-(6-bromo-2-oxo-1,4-dihydropyrido[2,3-d]pyrimidin-3-yl)acetate Chemical compound BrC1=CN=C2NC(=O)N(CC(=O)OCC)CC2=C1 QVUUGEZJZZWGBP-UHFFFAOYSA-N 0.000 description 2
- HIWCTUYPVOBBPD-UHFFFAOYSA-N ethyl 2-[(2-amino-5-bromopyridin-3-yl)methylamino]acetate Chemical compound CCOC(=O)CNCC1=CC(Br)=CN=C1N HIWCTUYPVOBBPD-UHFFFAOYSA-N 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- 230000000670 limiting effect Effects 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- GLCOMIMKJWKYEZ-UHFFFAOYSA-N methyl 2-[(2-amino-5-bromopyridin-3-yl)methyl-[(4-methoxyphenyl)methyl]amino]acetate Chemical compound C=1C(Br)=CN=C(N)C=1CN(CC(=O)OC)CC1=CC=C(OC)C=C1 GLCOMIMKJWKYEZ-UHFFFAOYSA-N 0.000 description 2
- RTQRFFYQCLGKMZ-UHFFFAOYSA-N methyl 2-[(4-methoxyphenyl)methylamino]acetate Chemical compound COC(=O)CNCC1=CC=C(OC)C=C1 RTQRFFYQCLGKMZ-UHFFFAOYSA-N 0.000 description 2
- VBEIMDCNFQCLNL-UHFFFAOYSA-N methyl 2-[(4-methoxyphenyl)methylideneamino]acetate Chemical compound COC(=O)CN=CC1=CC=C(OC)C=C1 VBEIMDCNFQCLNL-UHFFFAOYSA-N 0.000 description 2
- LEMXGMUEKGWKPR-UHFFFAOYSA-N methyl 6-bromo-2-oxo-3,4-dihydro-1h-1,8-naphthyridine-3-carboxylate Chemical compound BrC1=CN=C2NC(=O)C(C(=O)OC)CC2=C1 LEMXGMUEKGWKPR-UHFFFAOYSA-N 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- IVRGAPGZIHGZRI-UHFFFAOYSA-N o-(1-benzhydrylazetidin-3-yl)hydroxylamine Chemical compound C1C(ON)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 IVRGAPGZIHGZRI-UHFFFAOYSA-N 0.000 description 2
- 229940078552 o-xylene Drugs 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 125000000160 oxazolidinyl group Chemical group 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- 244000052769 pathogen Species 0.000 description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- NPSSWQJHYLDCNV-UHFFFAOYSA-N prop-2-enoic acid;hydrochloride Chemical compound Cl.OC(=O)C=C NPSSWQJHYLDCNV-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 125000003226 pyrazolyl group Chemical group 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000008261 resistance mechanism Effects 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 2
- SPNLYDPLVVDENH-GFCCVEGCSA-N tert-butyl (2r)-2-(1,3-benzoxazol-2-yl)pyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC[C@@H]1C1=NC2=CC=CC=C2O1 SPNLYDPLVVDENH-GFCCVEGCSA-N 0.000 description 2
- FLILBIBAOJKVLF-CYBMUJFWSA-N tert-butyl (2r)-2-[(2-bromophenyl)carbamoyl]pyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC[C@@H]1C(=O)NC1=CC=CC=C1Br FLILBIBAOJKVLF-CYBMUJFWSA-N 0.000 description 2
- DSLZZEARJFGBMH-SNAWJCMRSA-N tert-butyl (e)-3-(1h-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enoate Chemical compound CC(C)(C)OC(=O)\C=C\C1=CN=C2NC=CC2=C1 DSLZZEARJFGBMH-SNAWJCMRSA-N 0.000 description 2
- AWGLBSAVOZOQDH-FNORWQNLSA-N tert-butyl (e)-3-(6-aminopyridin-3-yl)prop-2-enoate Chemical compound CC(C)(C)OC(=O)\C=C\C1=CC=C(N)N=C1 AWGLBSAVOZOQDH-FNORWQNLSA-N 0.000 description 2
- QHPWDCZHYIYBRV-QPJJXVBHSA-N tert-butyl (e)-3-(7-oxo-6,8-dihydro-5h-1,8-naphthyridin-3-yl)prop-2-enoate Chemical compound N1C(=O)CCC2=CC(/C=C/C(=O)OC(C)(C)C)=CN=C21 QHPWDCZHYIYBRV-QPJJXVBHSA-N 0.000 description 2
- UYGKQEVISVPZBN-VOTSOKGWSA-N tert-butyl (e)-3-[3-(2-ethoxy-2-oxoethyl)-2-oxo-1,4-dihydropyrido[2,3-d]pyrimidin-6-yl]prop-2-enoate Chemical compound CC(C)(C)OC(=O)/C=C/C1=CN=C2NC(=O)N(CC(=O)OCC)CC2=C1 UYGKQEVISVPZBN-VOTSOKGWSA-N 0.000 description 2
- SEYSHLIZPWJFOY-VOTSOKGWSA-N tert-butyl (e)-3-[3-[(dimethylamino)methyl]-1h-pyrrolo[2,3-b]pyridin-5-yl]prop-2-enoate Chemical compound C1=C(\C=C\C(=O)OC(C)(C)C)C=C2C(CN(C)C)=CNC2=N1 SEYSHLIZPWJFOY-VOTSOKGWSA-N 0.000 description 2
- GOBDJZYQBIVLBS-JXMROGBWSA-N tert-butyl (e)-3-[4-[(4-methoxyphenyl)methyl]-2-oxo-3,5-dihydro-1h-pyrido[2,3-e][1,4]diazepin-7-yl]prop-2-enoate Chemical compound C1=CC(OC)=CC=C1CN1CC(=O)NC2=NC=C(\C=C\C(=O)OC(C)(C)C)C=C2C1 GOBDJZYQBIVLBS-JXMROGBWSA-N 0.000 description 2
- WVGFMVVCADZODQ-UHFFFAOYSA-N tert-butyl 2-(5-methyl-1,2,4-oxadiazol-3-yl)piperidine-1-carboxylate Chemical compound O1C(C)=NC(C2N(CCCC2)C(=O)OC(C)(C)C)=N1 WVGFMVVCADZODQ-UHFFFAOYSA-N 0.000 description 2
- XZCPIKZHYXKFQO-UHFFFAOYSA-N tert-butyl 2-[(z)-n'-hydroxycarbamimidoyl]piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCCC1C(=N)NO XZCPIKZHYXKFQO-UHFFFAOYSA-N 0.000 description 2
- FQFZSDAQWODOPZ-UHFFFAOYSA-N tert-butyl 3-(1,3-thiazol-2-ylmethoxy)azetidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CC1OCC1=NC=CS1 FQFZSDAQWODOPZ-UHFFFAOYSA-N 0.000 description 2
- ORGKFQNIXRRKJZ-UHFFFAOYSA-N tert-butyl 3-(1,3-thiazol-5-ylmethoxy)azetidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CC1OCC1=CN=CS1 ORGKFQNIXRRKJZ-UHFFFAOYSA-N 0.000 description 2
- ZUDFATPBCTXCFD-UHFFFAOYSA-N tert-butyl 3-(5-methyl-1,2,4-oxadiazol-3-yl)azetidine-1-carboxylate Chemical compound O1C(C)=NC(C2CN(C2)C(=O)OC(C)(C)C)=N1 ZUDFATPBCTXCFD-UHFFFAOYSA-N 0.000 description 2
- MWRJVNILFKPQEZ-UHFFFAOYSA-N tert-butyl 3-(pyridin-4-ylmethoxy)azetidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CC1OCC1=CC=NC=C1 MWRJVNILFKPQEZ-UHFFFAOYSA-N 0.000 description 2
- YGSMPZBTLQPDCQ-UHFFFAOYSA-N tert-butyl 3-[(4-fluorophenoxy)methyl]piperidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC1COC1=CC=C(F)C=C1 YGSMPZBTLQPDCQ-UHFFFAOYSA-N 0.000 description 2
- LKMSPPMVVCKIPS-UHFFFAOYSA-N tert-butyl 3-[(e)-n'-hydroxycarbamimidoyl]azetidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CC(C(\N)=N\O)C1 LKMSPPMVVCKIPS-UHFFFAOYSA-N 0.000 description 2
- WEFREESWPHICPL-UHFFFAOYSA-N tert-butyl 3-cyanoazetidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CC(C#N)C1 WEFREESWPHICPL-UHFFFAOYSA-N 0.000 description 2
- OCZCCXARUXEYGO-UHFFFAOYSA-N tert-butyl 3-phenoxypyrrolidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC1OC1=CC=CC=C1 OCZCCXARUXEYGO-UHFFFAOYSA-N 0.000 description 2
- HZFUHDXSZJTWKB-UHFFFAOYSA-N tert-butyl 3-pyridin-3-yloxypyrrolidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC1OC1=CC=CN=C1 HZFUHDXSZJTWKB-UHFFFAOYSA-N 0.000 description 2
- CTEDVGRUGMPBHE-UHFFFAOYSA-N tert-butyl 4-(hydroxymethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(CO)CC1 CTEDVGRUGMPBHE-UHFFFAOYSA-N 0.000 description 2
- DSKMWXKOBHNDOJ-UHFFFAOYSA-N tert-butyl 6-bromo-2-oxospiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-1'-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC21C(=O)NC1=NC=C(Br)C=C1C2 DSKMWXKOBHNDOJ-UHFFFAOYSA-N 0.000 description 2
- 125000001984 thiazolidinyl group Chemical group 0.000 description 2
- 201000008827 tuberculosis Diseases 0.000 description 2
- WCKJRVKJTUIAFW-UHFFFAOYSA-N (1-methylpyrazol-3-yl)methanol Chemical compound CN1C=CC(CO)=N1 WCKJRVKJTUIAFW-UHFFFAOYSA-N 0.000 description 1
- TXTWXQXDMWILOF-UHFFFAOYSA-N (2-ethoxy-2-oxoethyl)azanium;chloride Chemical compound [Cl-].CCOC(=O)C[NH3+] TXTWXQXDMWILOF-UHFFFAOYSA-N 0.000 description 1
- ZQEBQGAAWMOMAI-SSDOTTSWSA-N (2r)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CCC[C@@H]1C(O)=O ZQEBQGAAWMOMAI-SSDOTTSWSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- AVMHMVJVHYGDOO-NSCUHMNNSA-N (e)-1-bromobut-2-ene Chemical compound C\C=C\CBr AVMHMVJVHYGDOO-NSCUHMNNSA-N 0.000 description 1
- LBILBTQVQIPDOI-NSCUHMNNSA-N (e)-3-(1'-methyl-7-oxospiro[5,8-dihydro-1,8-naphthyridine-6,4'-piperidine]-3-yl)prop-2-enoic acid Chemical compound C1CN(C)CCC21C(=O)NC1=NC=C(\C=C\C(O)=O)C=C1C2 LBILBTQVQIPDOI-NSCUHMNNSA-N 0.000 description 1
- OBSQWRGNGDQVMQ-TYYBGVCCSA-N (e)-3-(2-oxo-1,3-dihydroimidazo[4,5-b]pyridin-6-yl)prop-2-enoic acid;hydrochloride Chemical compound Cl.OC(=O)\C=C\C1=CN=C2NC(=O)NC2=C1 OBSQWRGNGDQVMQ-TYYBGVCCSA-N 0.000 description 1
- OLJYSEFXKYKJHJ-OWOJBTEDSA-N (e)-3-(7-oxospiro[5,8-dihydro-1,8-naphthyridine-6,4'-piperidine]-3-yl)prop-2-enoic acid Chemical compound C1C2=CC(/C=C/C(=O)O)=CN=C2NC(=O)C21CCNCC2 OLJYSEFXKYKJHJ-OWOJBTEDSA-N 0.000 description 1
- LRTVSLMFQBFWCD-SQQVDAMQSA-N (e)-3-[3-[2-(4-methylpiperazin-1-yl)ethyl]-2-oxo-1,4-dihydropyrido[2,3-d]pyrimidin-6-yl]prop-2-enoic acid;hydrochloride Chemical compound Cl.C1CN(C)CCN1CCN1C(=O)NC2=NC=C(\C=C\C(O)=O)C=C2C1 LRTVSLMFQBFWCD-SQQVDAMQSA-N 0.000 description 1
- JNHDLNXNYPLBMJ-UHFFFAOYSA-N 1,3-thiazol-2-ylmethanol Chemical compound OCC1=NC=CS1 JNHDLNXNYPLBMJ-UHFFFAOYSA-N 0.000 description 1
- WKBQQWDVVHGWDB-UHFFFAOYSA-N 1,3-thiazol-5-ylmethanol Chemical compound OCC1=CN=CS1 WKBQQWDVVHGWDB-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- ZRKMQKLGEQPLNS-UHFFFAOYSA-N 1-Pentanethiol Chemical compound CCCCCS ZRKMQKLGEQPLNS-UHFFFAOYSA-N 0.000 description 1
- GSASKIMOROSHRR-UHFFFAOYSA-N 1-benzhydryl-3-(3,3,3-trifluoropropoxy)azetidine Chemical compound C1C(OCCC(F)(F)F)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 GSASKIMOROSHRR-UHFFFAOYSA-N 0.000 description 1
- IXMOEAHDRKNAAG-UHFFFAOYSA-N 1-benzhydrylazetidine-3-carbonitrile Chemical compound C1C(C#N)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 IXMOEAHDRKNAAG-UHFFFAOYSA-N 0.000 description 1
- SUHKSQTXXZQEBH-UHFFFAOYSA-N 1-benzothiophen-2-ylmethanol Chemical compound C1=CC=C2SC(CO)=CC2=C1 SUHKSQTXXZQEBH-UHFFFAOYSA-N 0.000 description 1
- VGSVITFVAXDZAL-UHFFFAOYSA-N 1-bis(2-methylphenyl)phosphoryl-2-methylbenzene Chemical compound CC1=CC=CC=C1P(=O)(C=1C(=CC=CC=1)C)C1=CC=CC=C1C VGSVITFVAXDZAL-UHFFFAOYSA-N 0.000 description 1
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 1
- DEFNUDNHTUZJAL-UHFFFAOYSA-N 1-bromo-2-methylprop-1-ene Chemical compound CC(C)=CBr DEFNUDNHTUZJAL-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- XUUFXPVWVJCFCF-UHFFFAOYSA-N 2,4-dibenzylazetidin-3-ol Chemical compound C(C1=CC=CC=C1)C1NC(C1O)CC1=CC=CC=C1 XUUFXPVWVJCFCF-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- GOWUDHPKGOIDIX-UHFFFAOYSA-N 2-(4-methyl-1-piperazinyl)ethanamine Chemical compound CN1CCN(CCN)CC1 GOWUDHPKGOIDIX-UHFFFAOYSA-N 0.000 description 1
- JQDNCGRNPYKRAO-UHFFFAOYSA-N 2-(bromomethyl)pyridine;hydron;bromide Chemical compound Br.BrCC1=CC=CC=N1 JQDNCGRNPYKRAO-UHFFFAOYSA-N 0.000 description 1
- XKMDFUUIIQBBAH-UHFFFAOYSA-N 2-(chloromethyl)-4-methylthiophene Chemical compound CC1=CSC(CCl)=C1 XKMDFUUIIQBBAH-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- NXMFJCRMSDRXLD-UHFFFAOYSA-N 2-aminopyridine-3-carbaldehyde Chemical compound NC1=NC=CC=C1C=O NXMFJCRMSDRXLD-UHFFFAOYSA-N 0.000 description 1
- HXUMDXIKPVFXIP-UHFFFAOYSA-N 2-bromo-3h-thiophene-2-carbaldehyde Chemical compound O=CC1(Br)CC=CS1 HXUMDXIKPVFXIP-UHFFFAOYSA-N 0.000 description 1
- AOPBDRUWRLBSDB-UHFFFAOYSA-N 2-bromoaniline Chemical compound NC1=CC=CC=C1Br AOPBDRUWRLBSDB-UHFFFAOYSA-N 0.000 description 1
- UNCQVRBWJWWJBF-UHFFFAOYSA-N 2-chloropyrimidine Chemical compound ClC1=NC=CC=N1 UNCQVRBWJWWJBF-UHFFFAOYSA-N 0.000 description 1
- GSFNQBFZFXUTBN-UHFFFAOYSA-N 2-chlorothiophene Chemical compound ClC1=CC=CS1 GSFNQBFZFXUTBN-UHFFFAOYSA-N 0.000 description 1
- YEDUAINPPJYDJZ-UHFFFAOYSA-N 2-hydroxybenzothiazole Chemical compound C1=CC=C2SC(O)=NC2=C1 YEDUAINPPJYDJZ-UHFFFAOYSA-N 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- KDTZBYPBMTXCSO-UHFFFAOYSA-N 2-phenoxyphenol Chemical group OC1=CC=CC=C1OC1=CC=CC=C1 KDTZBYPBMTXCSO-UHFFFAOYSA-N 0.000 description 1
- JUTDHSGANMHVIC-UHFFFAOYSA-N 2-phenylpyrrolidine Chemical compound C1CCNC1C1=CC=CC=C1 JUTDHSGANMHVIC-UHFFFAOYSA-N 0.000 description 1
- LDSQQXKSEFZAPE-UHFFFAOYSA-N 2-piperidin-4-ylethanol Chemical compound OCCC1CCNCC1 LDSQQXKSEFZAPE-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- URBLMFJCTSBARA-UHFFFAOYSA-N 2-pyrrolidin-3-yloxypyridine;hydrochloride Chemical compound Cl.C1NCCC1OC1=CC=CC=N1 URBLMFJCTSBARA-UHFFFAOYSA-N 0.000 description 1
- VMJOFTHFJMLIKL-UHFFFAOYSA-N 2-thiophen-2-ylethanol Chemical compound OCCC1=CC=CS1 VMJOFTHFJMLIKL-UHFFFAOYSA-N 0.000 description 1
- HDBGBTNNPRCVND-UHFFFAOYSA-N 3,3,3-trifluoropropan-1-ol Chemical compound OCCC(F)(F)F HDBGBTNNPRCVND-UHFFFAOYSA-N 0.000 description 1
- QNLWGJRACMYSJT-UHFFFAOYSA-N 3-(2-thiophen-2-ylethoxy)azetidine;dihydrochloride Chemical compound Cl.Cl.C1NCC1OCCC1=CC=CS1 QNLWGJRACMYSJT-UHFFFAOYSA-N 0.000 description 1
- NDCFFVZOQUHXIA-UHFFFAOYSA-N 3-(2-thiophen-2-ylethoxy)azetidine;hydrochloride Chemical compound Cl.C1NCC1OCCC1=CC=CS1 NDCFFVZOQUHXIA-UHFFFAOYSA-N 0.000 description 1
- ZGUYOKMBFCKJGT-UHFFFAOYSA-N 3-(4,4,4-trifluorobutoxy)azetidine Chemical compound FC(F)(F)CCCOC1CNC1 ZGUYOKMBFCKJGT-UHFFFAOYSA-N 0.000 description 1
- KBMUHYGQKCSEBZ-UHFFFAOYSA-N 3-(4,4,4-trifluorobutoxy)azetidine;hydrochloride Chemical compound Cl.FC(F)(F)CCCOC1CNC1 KBMUHYGQKCSEBZ-UHFFFAOYSA-N 0.000 description 1
- SZARVNFLNDTQSX-UHFFFAOYSA-N 3-(ethyliminomethylideneamino)-n,n-dimethylpropan-1-amine;n-ethyl-n-propan-2-ylpropan-2-amine Chemical compound CCN(C(C)C)C(C)C.CCN=C=NCCCN(C)C SZARVNFLNDTQSX-UHFFFAOYSA-N 0.000 description 1
- ZWNXOUMSJLJGHU-UHFFFAOYSA-N 3-[(4-chlorothiophen-2-yl)methoxy]azetidine;hydrochloride Chemical compound Cl.ClC1=CSC(COC2CNC2)=C1 ZWNXOUMSJLJGHU-UHFFFAOYSA-N 0.000 description 1
- BSQKBHXYEKVKMN-UHFFFAOYSA-N 3-methylthiophene-2-carbaldehyde Chemical compound CC=1C=CSC=1C=O BSQKBHXYEKVKMN-UHFFFAOYSA-N 0.000 description 1
- LHDDKSUOMSFDRU-UHFFFAOYSA-N 3-pyrrolidin-3-yloxypyridine;hydrochloride Chemical compound Cl.C1NCCC1OC1=CC=CN=C1 LHDDKSUOMSFDRU-UHFFFAOYSA-N 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- MJPVYTKZYZPIQA-UHFFFAOYSA-N 3-thiophen-2-ylpropanoic acid Chemical compound OC(=O)CCC1=CC=CS1 MJPVYTKZYZPIQA-UHFFFAOYSA-N 0.000 description 1
- LXTSGDCHNLNEEG-RMKNXTFCSA-N 4-[(4-methoxyphenyl)methyl]-7-[(e)-3-oxo-3-[3-(thiophen-2-ylmethoxy)azetidin-1-yl]prop-1-enyl]-3,5-dihydro-1h-pyrido[2,3-e][1,4]diazepin-2-one Chemical compound C1=CC(OC)=CC=C1CN1CC(=O)NC2=NC=C(\C=C\C(=O)N3CC(C3)OCC=3SC=CC=3)C=C2C1 LXTSGDCHNLNEEG-RMKNXTFCSA-N 0.000 description 1
- HVXCGIPRXBJIRK-UHFFFAOYSA-N 4-methylthiophene-2-carbaldehyde Chemical compound CC1=CSC(C=O)=C1 HVXCGIPRXBJIRK-UHFFFAOYSA-N 0.000 description 1
- KQKFQBTWXOGINC-UHFFFAOYSA-N 4-phenylpiperidin-4-ol Chemical compound C=1C=CC=CC=1C1(O)CCNCC1 KQKFQBTWXOGINC-UHFFFAOYSA-N 0.000 description 1
- RQGBFVLTFYRYKB-UHFFFAOYSA-N 4-propylpiperidine Chemical compound CCCC1CCNCC1 RQGBFVLTFYRYKB-UHFFFAOYSA-N 0.000 description 1
- VAUMDUIUEPIGHM-UHFFFAOYSA-N 5-Methyl-2-thiophenecarboxaldehyde Chemical compound CC1=CC=C(C=O)S1 VAUMDUIUEPIGHM-UHFFFAOYSA-N 0.000 description 1
- LPTVWZSQAIDCEB-UHFFFAOYSA-N 5-bromo-1h-pyrrolo[2,3-b]pyridine Chemical compound BrC1=CN=C2NC=CC2=C1 LPTVWZSQAIDCEB-UHFFFAOYSA-N 0.000 description 1
- WGOLHUGPTDEKCF-UHFFFAOYSA-N 5-bromopyridin-2-amine Chemical compound NC1=CC=C(Br)C=N1 WGOLHUGPTDEKCF-UHFFFAOYSA-N 0.000 description 1
- YRGMYJUKFJPNPD-UHFFFAOYSA-N 5-bromopyridine-2,3-diamine Chemical compound NC1=CC(Br)=CN=C1N YRGMYJUKFJPNPD-UHFFFAOYSA-N 0.000 description 1
- VHCRLTJPUNUZRN-UHFFFAOYSA-N 6-bromo-1,3-dihydroimidazo[4,5-b]pyridin-2-one Chemical compound BrC1=CN=C2NC(=O)NC2=C1 VHCRLTJPUNUZRN-UHFFFAOYSA-N 0.000 description 1
- 125000004939 6-pyridyl group Chemical group N1=CC=CC=C1* 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 241000193830 Bacillus <bacterium> Species 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 241000689227 Cora <basidiomycete fungus> Species 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 101710198510 Enoyl-[acyl-carrier-protein] reductase [NADH] Proteins 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 1
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 239000007821 HATU Substances 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-O Methylammonium ion Chemical compound [NH3+]C BAVYZALUXZFZLV-UHFFFAOYSA-O 0.000 description 1
- 238000006751 Mitsunobu reaction Methods 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical class O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 102000001708 Protein Isoforms Human genes 0.000 description 1
- 108010029485 Protein Isoforms Proteins 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- ACWQBUSCFPJUPN-UHFFFAOYSA-N Tiglaldehyde Natural products CC=C(C)C=O ACWQBUSCFPJUPN-UHFFFAOYSA-N 0.000 description 1
- RHQDFWAXVIIEBN-UHFFFAOYSA-N Trifluoroethanol Chemical compound OCC(F)(F)F RHQDFWAXVIIEBN-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 230000002141 anti-parasite Effects 0.000 description 1
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 1
- 239000008135 aqueous vehicle Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000001851 biosynthetic effect Effects 0.000 description 1
- 230000006696 biosynthetic metabolic pathway Effects 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- MCQRPQCQMGVWIQ-UHFFFAOYSA-N boron;methylsulfanylmethane Chemical compound [B].CSC MCQRPQCQMGVWIQ-UHFFFAOYSA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-O butylazanium Chemical compound CCCC[NH3+] HQABUPZFAYXKJW-UHFFFAOYSA-O 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 238000011260 co-administration Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical compound C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 238000006352 cycloaddition reaction Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000020335 dealkylation Effects 0.000 description 1
- 238000006900 dealkylation reaction Methods 0.000 description 1
- 238000005695 dehalogenation reaction Methods 0.000 description 1
- 238000001784 detoxification Methods 0.000 description 1
- KJOZJSGOIJQCGA-UHFFFAOYSA-N dichloromethane;2,2,2-trifluoroacetic acid Chemical compound ClCCl.OC(=O)C(F)(F)F KJOZJSGOIJQCGA-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-O diethylammonium Chemical compound CC[NH2+]CC HPNMFZURTQLUMO-UHFFFAOYSA-O 0.000 description 1
- 125000005043 dihydropyranyl group Chemical group O1C(CCC=C1)* 0.000 description 1
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 1
- BEPAFCGSDWSTEL-UHFFFAOYSA-N dimethyl malonate Chemical compound COC(=O)CC(=O)OC BEPAFCGSDWSTEL-UHFFFAOYSA-N 0.000 description 1
- 125000000532 dioxanyl group Chemical group 0.000 description 1
- 125000005879 dioxolanyl group Chemical group 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- QVDYYQXUNAQSNI-UHFFFAOYSA-N ethyl acetate;pentane Chemical compound CCCCC.CCOC(C)=O QVDYYQXUNAQSNI-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-O ethylaminium Chemical compound CC[NH3+] QUSNBJAOOMFDIB-UHFFFAOYSA-O 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 238000013537 high throughput screening Methods 0.000 description 1
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- COQRGFWWJBEXRC-UHFFFAOYSA-N hydron;methyl 2-aminoacetate;chloride Chemical compound Cl.COC(=O)CN COQRGFWWJBEXRC-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N hydroxylamine group Chemical group NO AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical class 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 150000002475 indoles Chemical class 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- QTBFPMKWQKYFLR-UHFFFAOYSA-N isobutyl chloride Chemical compound CC(C)CCl QTBFPMKWQKYFLR-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- HERNUOUHSCWIGK-AATRIKPKSA-N methyl 6-[(e)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]-2-oxo-3,4-dihydro-1h-1,8-naphthyridine-3-carboxylate Chemical compound CC(C)(C)OC(=O)/C=C/C1=CN=C2NC(=O)C(C(=O)OC)CC2=C1 HERNUOUHSCWIGK-AATRIKPKSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000002687 nonaqueous vehicle Substances 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000008520 organization Effects 0.000 description 1
- 125000005968 oxazolinyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 125000005489 p-toluenesulfonic acid group Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-N palmitic acid group Chemical group C(CCCCCCCCCCCCCCC)(=O)O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 150000004841 phenylimidazoles Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 125000002265 phtalazinyl group Chemical group 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 230000005588 protonation Effects 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000005494 pyridonyl group Chemical group 0.000 description 1
- 230000001698 pyrogenic effect Effects 0.000 description 1
- JHHZLHWJQPUNKB-UHFFFAOYSA-N pyrrolidin-3-ol Chemical compound OC1CCNC1 JHHZLHWJQPUNKB-UHFFFAOYSA-N 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- SUBJHSREKVAVAR-UHFFFAOYSA-N sodium;methanol;methanolate Chemical compound [Na+].OC.[O-]C SUBJHSREKVAVAR-UHFFFAOYSA-N 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000007940 sugar coated tablet Substances 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 230000006103 sulfonylation Effects 0.000 description 1
- 238000005694 sulfonylation reaction Methods 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- ASFPEKSLXGJMSV-SNAWJCMRSA-N tert-butyl (e)-3-(2-oxo-1,3-dihydroimidazo[4,5-b]pyridin-6-yl)prop-2-enoate Chemical compound CC(C)(C)OC(=O)\C=C\C1=CN=C2NC(=O)NC2=C1 ASFPEKSLXGJMSV-SNAWJCMRSA-N 0.000 description 1
- LKAJZBMOVZIKHA-UHFFFAOYSA-N tert-butyl 2-cyanopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCCC1C#N LKAJZBMOVZIKHA-UHFFFAOYSA-N 0.000 description 1
- OJCLHERKFHHUTB-UHFFFAOYSA-N tert-butyl 3-(hydroxymethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCC(CO)C1 OJCLHERKFHHUTB-UHFFFAOYSA-N 0.000 description 1
- UDJAOAVGBYZQNR-VOTSOKGWSA-N tert-butyl 6-[(e)-3-ethoxy-3-oxoprop-1-enyl]-2-oxospiro[1,4-dihydro-1,8-naphthyridine-3,4'-piperidine]-1'-carboxylate Chemical compound C1C2=CC(/C=C/C(=O)OCC)=CN=C2NC(=O)C21CCN(C(=O)OC(C)(C)C)CC2 UDJAOAVGBYZQNR-VOTSOKGWSA-N 0.000 description 1
- 125000005886 tetrahydrobenzothienyl group Chemical group 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000005888 tetrahydroindolyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000004853 tetrahydropyridinyl group Chemical group N1(CCCC=C1)* 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical class C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000002769 thiazolinyl group Chemical group 0.000 description 1
- 150000003573 thiols Chemical group 0.000 description 1
- ZPHGMBGIFODUMF-UHFFFAOYSA-N thiophen-2-ylmethanol Chemical compound OCC1=CC=CS1 ZPHGMBGIFODUMF-UHFFFAOYSA-N 0.000 description 1
- 230000036964 tight binding Effects 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000041 toxicology testing Toxicity 0.000 description 1
- ACWQBUSCFPJUPN-HWKANZROSA-N trans-2-methyl-2-butenal Chemical compound C\C=C(/C)C=O ACWQBUSCFPJUPN-HWKANZROSA-N 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 238000007832 transition metal-catalyzed coupling reaction Methods 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/397—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having four-membered rings, e.g. azetidine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/4353—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom ortho- or peri-condensed with heterocyclic ring systems
- A61K31/4375—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom ortho- or peri-condensed with heterocyclic ring systems the heterocyclic ring system containing a six-membered ring having nitrogen as a ring heteroatom, e.g. quinolizines, naphthyridines, berberine, vincamine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
- A61P31/06—Antibacterial agents for tuberculosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
- A61P31/14—Antivirals for RNA viruses
- A61P31/16—Antivirals for RNA viruses for influenza or rhinoviruses
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P33/00—Antiparasitic agents
- A61P33/02—Antiprotozoals, e.g. for leishmaniasis, trichomoniasis, toxoplasmosis
- A61P33/06—Antimalarials
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/04—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/12—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/20—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms
- C07D211/22—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/26—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/12—Radicals substituted by halogen atoms or nitro or nitroso radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains three hetero rings
- C07D471/20—Spiro-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Medicinal Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Virology (AREA)
- Pulmonology (AREA)
- Tropical Medicine & Parasitology (AREA)
- Epidemiology (AREA)
- Molecular Biology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US26230909P | 2009-11-18 | 2009-11-18 | |
| US61/262,309 | 2009-11-18 | ||
| PCT/EP2010/067647 WO2011061214A1 (en) | 2009-11-18 | 2010-11-17 | Novel heterocyclic acrylamides and their use as pharmaceuticals |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2776849A1 true CA2776849A1 (en) | 2011-05-26 |
Family
ID=44059228
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA2776849A Abandoned CA2776849A1 (en) | 2009-11-18 | 2010-11-17 | Novel heterocyclic acrylamides and their use as pharmaceuticals |
Country Status (16)
| Country | Link |
|---|---|
| US (3) | US8846711B2 (OSRAM) |
| EP (1) | EP2501693B1 (OSRAM) |
| JP (1) | JP5816629B2 (OSRAM) |
| KR (1) | KR20130010456A (OSRAM) |
| CN (1) | CN102656158B (OSRAM) |
| AU (1) | AU2010320963B2 (OSRAM) |
| BR (1) | BR112012011793A2 (OSRAM) |
| CA (1) | CA2776849A1 (OSRAM) |
| DK (1) | DK2501693T3 (OSRAM) |
| ES (1) | ES2526567T3 (OSRAM) |
| IL (1) | IL218934A0 (OSRAM) |
| MX (1) | MX2012005759A (OSRAM) |
| NZ (1) | NZ599444A (OSRAM) |
| PL (1) | PL2501693T3 (OSRAM) |
| WO (1) | WO2011061214A1 (OSRAM) |
| ZA (1) | ZA201202489B (OSRAM) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2013190384A1 (en) * | 2012-06-19 | 2013-12-27 | Affinium Pharmaceuticals, Inc. | Prodrug derivatives of (e)-n-methyl-n-((3-methylbenzofuran-2-yl)methyl)-3-(7-oxo-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)acrylamide |
| US8895545B2 (en) | 2006-07-20 | 2014-11-25 | Debiopharm International Sa | Acrylamide derivatives as Fab I inhibitors |
| US10751351B2 (en) | 2016-02-26 | 2020-08-25 | Debiopharm International S.A. | Medicament for treatment of diabetic foot infections |
| US12403131B2 (en) | 2019-02-14 | 2025-09-02 | Debiopharm International S.A. | Afabicin formulation, method for making the same and uses thereof |
| US12414958B2 (en) | 2019-06-14 | 2025-09-16 | Debiopharm International S.A. | Medicament and use thereof for treating bacterial infections involving biofilm |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MX2012005759A (es) | 2009-11-18 | 2012-10-03 | Fab Pharma S A S | Acrilamidas heterociclicas novedosas y su uso como farmacos. |
| JO3611B1 (ar) | 2011-08-10 | 2020-08-27 | Janssen Sciences Ireland Uc | سايكلو بنتا (سي (بيرول 4,3 ثاني هيدرو 1 hمستبدله [8,1] نافثيريدينونات مضادة للجراثيم |
| EP2742044B1 (en) * | 2011-08-10 | 2019-12-04 | Janssen Sciences Ireland Unlimited Company | Antibacterial homopiperidinyl substituted 3,4-dihydro-1h-[1,8]naphthyridinones |
| CA2842531C (en) * | 2011-08-10 | 2019-07-16 | Janssen R&D Ireland | Antibacterial piperidinyl substituted 3,4-dihydro-1h-[1,8]naphthyridinones |
| EP2758376A4 (en) | 2011-09-19 | 2015-04-29 | Vitas Pharma Res Private Ltd | HETEROCYCLIC COMPOUNDS AS INHIBITORS OF FATTY ACID BIOSYNTHESIS FOR BACTERIAL INFECTIONS |
| US9062075B2 (en) | 2011-12-02 | 2015-06-23 | Aurigene Discovery Technologies Limited | Tetrahydropyridine derivatives as FabI inhibitors |
| MY165902A (en) | 2011-12-02 | 2018-05-18 | Aurigene Discovery Tech Ltd | Substituted pyridine derivatives as fabi inhibitors |
| AR090880A1 (es) | 2012-04-30 | 2014-12-10 | Janssen R & D Ireland | Derivados de pirimidina |
| CA2879623C (en) * | 2012-08-10 | 2021-11-02 | Janssen Sciences Ireland Uc | Fused bicyclic azole heterocycle as inhibitors of the enzyme fabi |
| EA201590331A1 (ru) * | 2012-08-10 | 2016-05-31 | Янссен Сайенсиз Айрлэнд Юси | Новые антибактериальные соединения |
| WO2014072930A2 (en) * | 2012-11-09 | 2014-05-15 | Aurigene Discovery Technologies Limited | Fused pyridine derivatives as antibacterial agents |
| WO2014195844A1 (en) * | 2013-06-04 | 2014-12-11 | Aurigene Discovery Technologies Limited | TETRAHYDROPYRIDINE DERIVATIVES AS FabI INHIBITORS |
| CN104292142B (zh) * | 2013-07-17 | 2019-05-14 | 天津大地康和医药技术有限公司 | 一种n-芳基杂环丁烷脱芳基方法 |
| WO2015071780A1 (en) * | 2013-11-12 | 2015-05-21 | Aurigene Discovery Technologies Limited | Alkylidine substituted heterocyclyl derivatives as anti-bacterial agents |
| CN104529854B (zh) * | 2015-01-14 | 2016-10-05 | 武汉金联药业有限公司 | 一种取代氮杂环丁烷类医药中间体化合物的合成方法 |
| TW202247838A (zh) | 2015-07-02 | 2022-12-16 | 美商地平線罕見醫學製藥有限責任公司 | Ado抗性半胱胺類似物及其用途 |
| CN108440523A (zh) * | 2018-04-23 | 2018-08-24 | 爱斯特(成都)生物制药股份有限公司 | 一种合成6-溴-3,4-二氢-1h-[1,8]萘啶-2-酮的新方法 |
| CN114351128B (zh) * | 2021-12-10 | 2022-12-13 | 江阴纳力新材料科技有限公司 | 镀铜液添加剂、镀铜液、镀铜薄膜及其制备方法、负极集流体、锂电池 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN1020864C (zh) * | 1988-09-14 | 1993-05-26 | 中国科学院上海有机化学研究所 | 醛的烯基化反应的催化剂及其应用 |
| TW224042B (OSRAM) * | 1992-04-04 | 1994-05-21 | Basf Ag | |
| WO1997033870A1 (en) * | 1996-03-15 | 1997-09-18 | Ss Pharmaceutical Co., Ltd. | Novel pyridine derivatives and medicines containing the same as active ingredient |
| CN1286684A (zh) | 1996-05-01 | 2001-03-07 | 奥索·麦克尼尔药品公司 | 治疗血栓形成疾病的吡咯烷、哌啶和六氢吖庚因的甲酰胺衍生物 |
| PE20010635A1 (es) | 1999-10-08 | 2001-08-15 | Smithkline Beecham Corp | Inhibidores de fab i utiles para el tratamiento de infecciones bacterianas |
| DK1560584T3 (da) | 2001-04-06 | 2009-05-18 | Affinium Pharm Inc | Fab I inhibitorer |
| JP2004099499A (ja) * | 2002-09-09 | 2004-04-02 | Sanei Gen Ffi Inc | 抗微生物剤 |
| AU2003298937A1 (en) | 2002-12-06 | 2004-06-30 | Affinium Pharmaceuticals, Inc. | Heterocyclic compounds, methods of making them and their use in therapy |
| DK1828167T3 (da) | 2004-06-04 | 2014-10-20 | Debiopharm Int Sa | Acrylamidderivater som antibiotiske midler |
| WO2006081273A1 (en) * | 2005-01-26 | 2006-08-03 | Allergan, Inc. | 3-aryl-3-hydroxy-2-amino-propionic acid amides, 3-heteroayryl-3-hydroxy-2-amino-propionic acid amides and related compounds having analgesic and/or immunostimulant activity |
| CA2632476A1 (en) | 2005-12-05 | 2007-06-14 | Affinium Pharmaceuticals, Inc. | Heterocyclylacrylamide compounds as fabi inhibitors and antibacterial agents |
| WO2007086584A1 (ja) * | 2006-01-30 | 2007-08-02 | Meiji Seika Kaisha, Ltd. | 新規FabKおよびFabI/K阻害剤 |
| EP1845087A1 (en) | 2006-04-14 | 2007-10-17 | Mutabilis SA | Hydroxyphenyl derivatives and biological applications thereof |
| WO2008009122A1 (en) | 2006-07-20 | 2008-01-24 | Affinium Pharmaceuticals, Inc. | Acrylamide derivatives as fab i inhibitors |
| EP1942104A1 (en) | 2006-12-20 | 2008-07-09 | sanofi-aventis | Heteroarylcyclopropanecarboxamides and their use as pharmaceuticals |
| EP1939180A1 (en) | 2006-12-20 | 2008-07-02 | sanofi-aventis | Heteroarylacrylamides and their use as pharmaceuticals for the stimulation of the expression of endothelial NO synthase |
| WO2008098374A1 (en) | 2007-02-16 | 2008-08-21 | Affinium Pharmaceuticals, Inc. | Salts, prodrugs and polymorphs of fab i inhibitors |
| WO2009110002A1 (en) * | 2008-03-05 | 2009-09-11 | Council Of Scientific & Industrial Research | Novel efflux pump inhibitors |
| JP2012102018A (ja) * | 2009-03-03 | 2012-05-31 | Astellas Pharma Inc | アミド化合物 |
| MX2012005759A (es) | 2009-11-18 | 2012-10-03 | Fab Pharma S A S | Acrilamidas heterociclicas novedosas y su uso como farmacos. |
-
2010
- 2010-11-17 MX MX2012005759A patent/MX2012005759A/es active IP Right Grant
- 2010-11-17 ES ES10776385.6T patent/ES2526567T3/es active Active
- 2010-11-17 US US13/510,564 patent/US8846711B2/en not_active Expired - Fee Related
- 2010-11-17 JP JP2012539312A patent/JP5816629B2/ja not_active Expired - Fee Related
- 2010-11-17 CN CN201080051981.2A patent/CN102656158B/zh not_active Expired - Fee Related
- 2010-11-17 WO PCT/EP2010/067647 patent/WO2011061214A1/en not_active Ceased
- 2010-11-17 CA CA2776849A patent/CA2776849A1/en not_active Abandoned
- 2010-11-17 BR BR112012011793A patent/BR112012011793A2/pt not_active IP Right Cessation
- 2010-11-17 KR KR1020127011047A patent/KR20130010456A/ko not_active Ceased
- 2010-11-17 EP EP10776385.6A patent/EP2501693B1/en not_active Not-in-force
- 2010-11-17 AU AU2010320963A patent/AU2010320963B2/en not_active Ceased
- 2010-11-17 NZ NZ599444A patent/NZ599444A/en not_active IP Right Cessation
- 2010-11-17 DK DK10776385.6T patent/DK2501693T3/en active
- 2010-11-17 PL PL10776385T patent/PL2501693T3/pl unknown
-
2012
- 2012-03-29 IL IL218934A patent/IL218934A0/en unknown
- 2012-04-04 ZA ZA2012/02489A patent/ZA201202489B/en unknown
-
2014
- 2014-08-20 US US14/463,994 patent/US9051321B2/en not_active Expired - Fee Related
-
2015
- 2015-05-04 US US14/703,004 patent/US9321769B2/en not_active Expired - Fee Related
Cited By (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8895545B2 (en) | 2006-07-20 | 2014-11-25 | Debiopharm International Sa | Acrylamide derivatives as Fab I inhibitors |
| WO2013190384A1 (en) * | 2012-06-19 | 2013-12-27 | Affinium Pharmaceuticals, Inc. | Prodrug derivatives of (e)-n-methyl-n-((3-methylbenzofuran-2-yl)methyl)-3-(7-oxo-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)acrylamide |
| US8901105B2 (en) | 2012-06-19 | 2014-12-02 | Debiopharm International Sa | Prodrug derivatives of (E)-N-methyl-N-((3-M ethylbenzofuran-2-yl)methyl)-3-(7-oxo-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)acrylamide |
| CN104684922A (zh) * | 2012-06-19 | 2015-06-03 | 德彪药业国际股份公司 | (e)-n-甲基-n-((3-甲基苯并呋喃-2-基)甲基)-3-(7-氧代-5,6,7,8-四氢-1,8-萘啶-3-基)丙烯酰胺的前药衍生物 |
| AU2013279021B2 (en) * | 2012-06-19 | 2016-09-08 | Debiopharm International Sa | Prodrug derivatives of (E)-N-methyl-N-((3-methylbenzofuran-2-yl)methyl)-3-(7-oxo-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)acrylamide |
| CN104684922B (zh) * | 2012-06-19 | 2016-10-26 | 德彪药业国际股份公司 | (e)-n-甲基-n-((3-甲基苯并呋喃-2-基)甲基)-3-(7-氧代-5,6,7,8-四氢-1,8-萘啶-3-基)丙烯酰胺的前药衍生物 |
| AU2013279021C1 (en) * | 2012-06-19 | 2017-03-16 | Debiopharm International Sa | Prodrug derivatives of (E)-N-methyl-N-((3-methylbenzofuran-2-yl)methyl)-3-(7-oxo-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)acrylamide |
| EA028136B1 (ru) * | 2012-06-19 | 2017-10-31 | Дибиофарм Интернешнл Са | Пролекарственные производные (е)-n-метил-n-((3-метилбензофуран-2-ил)метил)-3-(7-оксо-5,6,7,8-тетрагидро-1,8-нафтиридин-3-ил)акриламида |
| US10035813B2 (en) | 2012-06-19 | 2018-07-31 | Debiopharm International Sa | Prodrug derivatives of (E)-N-methyl-N-((3-methylbenzofuran-2-yl)methyl)-3-(7-oxo-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)acrylamide |
| US10751351B2 (en) | 2016-02-26 | 2020-08-25 | Debiopharm International S.A. | Medicament for treatment of diabetic foot infections |
| US12403131B2 (en) | 2019-02-14 | 2025-09-02 | Debiopharm International S.A. | Afabicin formulation, method for making the same and uses thereof |
| US12414958B2 (en) | 2019-06-14 | 2025-09-16 | Debiopharm International S.A. | Medicament and use thereof for treating bacterial infections involving biofilm |
Also Published As
| Publication number | Publication date |
|---|---|
| BR112012011793A2 (pt) | 2019-09-24 |
| ES2526567T3 (es) | 2015-01-13 |
| US9321769B2 (en) | 2016-04-26 |
| WO2011061214A1 (en) | 2011-05-26 |
| JP5816629B2 (ja) | 2015-11-18 |
| CN102656158A (zh) | 2012-09-05 |
| AU2010320963A1 (en) | 2012-05-03 |
| NZ599444A (en) | 2014-02-28 |
| AU2010320963B2 (en) | 2015-07-09 |
| EP2501693A1 (en) | 2012-09-26 |
| ZA201202489B (en) | 2013-02-27 |
| US20120277207A1 (en) | 2012-11-01 |
| US20150232466A1 (en) | 2015-08-20 |
| US9051321B2 (en) | 2015-06-09 |
| MX2012005759A (es) | 2012-10-03 |
| JP2013511486A (ja) | 2013-04-04 |
| DK2501693T3 (en) | 2014-12-08 |
| US20140357617A1 (en) | 2014-12-04 |
| US8846711B2 (en) | 2014-09-30 |
| PL2501693T3 (pl) | 2015-03-31 |
| IL218934A0 (en) | 2012-07-31 |
| EP2501693B1 (en) | 2014-09-17 |
| KR20130010456A (ko) | 2013-01-28 |
| CN102656158B (zh) | 2015-02-11 |
| HK1176358A1 (en) | 2013-07-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU2010320963B2 (en) | Novel heterocyclic acrylamides and their use as pharmaceuticals | |
| CN114867727B (zh) | Tau蛋白靶向化合物及相关使用方法 | |
| CN110234646B (zh) | 靶向PROTAC的Tau蛋白及相关使用方法 | |
| AU2008254270B2 (en) | Spiroindalones | |
| CN110869360A (zh) | 作为rock抑制剂的苯乙酰胺类 | |
| US9062002B2 (en) | Substituted pyridine derivatives as FabI inhibitors | |
| JP2009524689A (ja) | 化合物 | |
| AU2006287976A1 (en) | Novel diazaspiroalkanes and their use for treatment of CCR8 mediated diseases | |
| MX2010007430A (es) | Piridoindoles (1-azinona)-sustituidos como antagonistas de la hormona de concentracion melanina humana. | |
| CN105492434A (zh) | Rorc2抑制剂及其使用方法 | |
| JP2022527679A (ja) | インターフェロン遺伝子の刺激因子(sting)の次世代モジュレーター | |
| AU2010333024B2 (en) | MK2 inhibitors | |
| TW201833113A (zh) | 作為P13Kδ抑制劑之咪唑并[1,5-A]吡衍生物 | |
| CN117126231A (zh) | 拟肽类stat蛋白降解剂、组合物及其应用 | |
| WO2014072930A2 (en) | Fused pyridine derivatives as antibacterial agents | |
| CN117321046A (zh) | 基于吲唑的化合物和相关使用方法 | |
| HK1176358B (en) | Aza heterocyclic acrylamides and their use as bactericides | |
| US20240150346A1 (en) | Class of heteroaromatic compound, preparation method therefor and use thereof | |
| CN120957981A (zh) | 基于2,4-二苯胺嘧啶的Aurora-A激酶选择性降解诱导化合物 | |
| CN117813086A (zh) | 作为ccr6抑制剂的芳基磺酰基(羟基)哌啶 | |
| HK1219093B (en) | Heterobicycloaryl rorc2 inhibitors and methods of use thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request |
Effective date: 20151117 |
|
| FZDE | Discontinued |
Effective date: 20180313 |