CA2640648A1 - Selective herbicides based on heteroaryloxy-acetamides - Google Patents
Selective herbicides based on heteroaryloxy-acetamides Download PDFInfo
- Publication number
- CA2640648A1 CA2640648A1 CA002640648A CA2640648A CA2640648A1 CA 2640648 A1 CA2640648 A1 CA 2640648A1 CA 002640648 A CA002640648 A CA 002640648A CA 2640648 A CA2640648 A CA 2640648A CA 2640648 A1 CA2640648 A1 CA 2640648A1
- Authority
- CA
- Canada
- Prior art keywords
- phenyl
- chloro
- methyl
- acetamide
- dichloro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000004009 herbicide Substances 0.000 title claims abstract description 24
- 150000001875 compounds Chemical class 0.000 claims abstract description 104
- 230000002363 herbicidal effect Effects 0.000 claims abstract description 24
- 244000038559 crop plants Species 0.000 claims abstract description 16
- 230000002195 synergetic effect Effects 0.000 claims abstract description 10
- 239000000203 mixture Substances 0.000 claims description 29
- -1 SAN-582) Chemical compound 0.000 claims description 20
- MCNOFYBITGAAGM-UHFFFAOYSA-N 2,2-dichloro-1-[5-(furan-2-yl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone Chemical compound C1N(C(=O)C(Cl)Cl)C(C)(C)OC1C1=CC=CO1 MCNOFYBITGAAGM-UHFFFAOYSA-N 0.000 claims description 16
- 241000196324 Embryophyta Species 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 13
- YRMLFORXOOIJDR-UHFFFAOYSA-N Dichlormid Chemical compound ClC(Cl)C(=O)N(CC=C)CC=C YRMLFORXOOIJDR-UHFFFAOYSA-N 0.000 claims description 12
- JLYFCTQDENRSOL-UHFFFAOYSA-N 2-chloro-N-(2,4-dimethylthiophen-3-yl)-N-(1-methoxypropan-2-yl)acetamide Chemical compound COCC(C)N(C(=O)CCl)C=1C(C)=CSC=1C JLYFCTQDENRSOL-UHFFFAOYSA-N 0.000 claims description 11
- PFJJMJDEVDLPNE-UHFFFAOYSA-N Benoxacor Chemical compound C1=CC=C2N(C(=O)C(Cl)Cl)C(C)COC2=C1 PFJJMJDEVDLPNE-UHFFFAOYSA-N 0.000 claims description 10
- YLPGTOIOYRQOHV-UHFFFAOYSA-N Pretilachlor Chemical compound CCCOCCN(C(=O)CCl)C1=C(CC)C=CC=C1CC YLPGTOIOYRQOHV-UHFFFAOYSA-N 0.000 claims description 10
- KIEDNEWSYUYDSN-UHFFFAOYSA-N clomazone Chemical compound O=C1C(C)(C)CON1CC1=CC=CC=C1Cl KIEDNEWSYUYDSN-UHFFFAOYSA-N 0.000 claims description 10
- OQZCSNDVOWYALR-UHFFFAOYSA-N flurochloridone Chemical compound FC(F)(F)C1=CC=CC(N2C(C(Cl)C(CCl)C2)=O)=C1 OQZCSNDVOWYALR-UHFFFAOYSA-N 0.000 claims description 10
- STEPQTYSZVCJPV-UHFFFAOYSA-N metazachlor Chemical compound CC1=CC=CC(C)=C1N(C(=O)CCl)CN1N=CC=C1 STEPQTYSZVCJPV-UHFFFAOYSA-N 0.000 claims description 10
- MHULQDZDXMHODA-UHFFFAOYSA-N 1-(2,2-dichloroacetyl)-3,3,8a-trimethyl-2,4,7,8-tetrahydropyrrolo[1,2-a]pyrimidin-6-one Chemical compound C1C(C)(C)CN(C(=O)C(Cl)Cl)C2(C)N1C(=O)CC2 MHULQDZDXMHODA-UHFFFAOYSA-N 0.000 claims description 9
- QWWHRELOCZEQNZ-UHFFFAOYSA-N 2,2-dichloro-1-(1-oxa-4-azaspiro[4.5]decan-4-yl)ethanone Chemical compound ClC(Cl)C(=O)N1CCOC11CCCCC1 QWWHRELOCZEQNZ-UHFFFAOYSA-N 0.000 claims description 9
- ZAWPDPLWGKAAHU-UHFFFAOYSA-N 2,2-dichloro-n-[2-oxo-2-(prop-2-enylamino)ethyl]-n-prop-2-enylacetamide Chemical compound ClC(Cl)C(=O)N(CC=C)CC(=O)NCC=C ZAWPDPLWGKAAHU-UHFFFAOYSA-N 0.000 claims description 9
- OHXLAOJLJWLEIP-UHFFFAOYSA-N 2-(dichloromethyl)-2-methyl-1,3-dioxolane Chemical compound ClC(Cl)C1(C)OCCO1 OHXLAOJLJWLEIP-UHFFFAOYSA-N 0.000 claims description 9
- BXEHUCNTIZGSOJ-UHFFFAOYSA-N Esprocarb Chemical compound CC(C)C(C)N(CC)C(=O)SCC1=CC=CC=C1 BXEHUCNTIZGSOJ-UHFFFAOYSA-N 0.000 claims description 9
- NRFQZTCQAYEXEE-UHFFFAOYSA-N Fenclorim Chemical compound ClC1=CC(Cl)=NC(C=2C=CC=CC=2)=N1 NRFQZTCQAYEXEE-UHFFFAOYSA-N 0.000 claims description 9
- DDBMQDADIHOWIC-UHFFFAOYSA-N aclonifen Chemical compound C1=C([N+]([O-])=O)C(N)=C(Cl)C(OC=2C=CC=CC=2)=C1 DDBMQDADIHOWIC-UHFFFAOYSA-N 0.000 claims description 9
- MKQSWTQPLLCSOB-UHFFFAOYSA-N benzyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate Chemical compound N1=C(Cl)SC(C(=O)OCC=2C=CC=CC=2)=C1C(F)(F)F MKQSWTQPLLCSOB-UHFFFAOYSA-N 0.000 claims description 9
- NQLVQOSNDJXLKG-UHFFFAOYSA-N prosulfocarb Chemical compound CCCN(CCC)C(=O)SCC1=CC=CC=C1 NQLVQOSNDJXLKG-UHFFFAOYSA-N 0.000 claims description 9
- KDWQYMVPYJGPHS-UHFFFAOYSA-N Thenylchlor Chemical compound C1=CSC(CN(C(=O)CCl)C=2C(=CC=CC=2C)C)=C1OC KDWQYMVPYJGPHS-UHFFFAOYSA-N 0.000 claims description 8
- HKPHPIREJKHECO-UHFFFAOYSA-N butachlor Chemical compound CCCCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC HKPHPIREJKHECO-UHFFFAOYSA-N 0.000 claims description 7
- GMBRUAIJEFRHFQ-UHFFFAOYSA-N Fenchlorazole-ethyl Chemical compound N1=C(C(=O)OCC)N=C(C(Cl)(Cl)Cl)N1C1=CC=C(Cl)C=C1Cl GMBRUAIJEFRHFQ-UHFFFAOYSA-N 0.000 claims description 6
- 239000005580 Metazachlor Substances 0.000 claims description 6
- PYKLUAIDKVVEOS-RAXLEYEMSA-N (e)-n-(cyanomethoxy)benzenecarboximidoyl cyanide Chemical compound N#CCO\N=C(\C#N)C1=CC=CC=C1 PYKLUAIDKVVEOS-RAXLEYEMSA-N 0.000 claims description 5
- 239000002890 Aclonifen Substances 0.000 claims description 5
- 239000005499 Clomazone Substances 0.000 claims description 5
- UKSLKNUCVPZQCQ-UHFFFAOYSA-N Fluxofenim Chemical compound C=1C=C(Cl)C=CC=1C(C(F)(F)F)=NOCC1OCCO1 UKSLKNUCVPZQCQ-UHFFFAOYSA-N 0.000 claims description 5
- GRSMWKLPSNHDHA-UHFFFAOYSA-N Naphthalic anhydride Chemical compound C1=CC(C(=O)OC2=O)=C3C2=CC=CC3=C1 GRSMWKLPSNHDHA-UHFFFAOYSA-N 0.000 claims description 5
- WFVUIONFJOAYPK-KAMYIIQDSA-N Oxabetrinil Chemical compound C=1C=CC=CC=1C(/C#N)=N\OCC1OCCO1 WFVUIONFJOAYPK-KAMYIIQDSA-N 0.000 claims description 5
- 239000005603 Prosulfocarb Substances 0.000 claims description 5
- ICJSJAJWTWPSBD-UHFFFAOYSA-N cloquintocet Chemical compound C1=CN=C2C(OCC(=O)O)=CC=C(Cl)C2=C1 ICJSJAJWTWPSBD-UHFFFAOYSA-N 0.000 claims description 5
- BVWXOPGJEOGGRD-UHFFFAOYSA-N heptan-2-yl 2-(8-chloroquinoxalin-5-yl)oxyacetate Chemical compound C1=CN=C2C(OCC(=O)OC(C)CCCCC)=CC=C(Cl)C2=N1 BVWXOPGJEOGGRD-UHFFFAOYSA-N 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 4
- 239000004606 Fillers/Extenders Substances 0.000 claims description 3
- JCHMGYRXQDASJE-UHFFFAOYSA-N metcamifen Chemical compound C1=CC(NC(=O)NC)=CC=C1S(=O)(=O)NC(=O)C1=CC=CC=C1OC JCHMGYRXQDASJE-UHFFFAOYSA-N 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 2
- OISQRMLHYOLTJL-UHFFFAOYSA-N 2,2-dichloro-n-(1,3-dioxolan-2-ylmethyl)-n-prop-2-enylacetamide Chemical compound ClC(Cl)C(=O)N(CC=C)CC1OCCO1 OISQRMLHYOLTJL-UHFFFAOYSA-N 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract description 9
- 229910052736 halogen Inorganic materials 0.000 abstract description 6
- 125000001113 thiadiazolyl group Chemical group 0.000 abstract description 2
- 125000005843 halogen group Chemical group 0.000 abstract 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 2
- 239000000729 antidote Substances 0.000 description 17
- RXCPQSJAVKGONC-UHFFFAOYSA-N Flumetsulam Chemical compound N1=C2N=C(C)C=CN2N=C1S(=O)(=O)NC1=C(F)C=CC=C1F RXCPQSJAVKGONC-UHFFFAOYSA-N 0.000 description 13
- VGHPMIFEKOFHHQ-UHFFFAOYSA-N Metosulam Chemical compound N1=C2N=C(OC)C=C(OC)N2N=C1S(=O)(=O)NC1=C(Cl)C=CC(C)=C1Cl VGHPMIFEKOFHHQ-UHFFFAOYSA-N 0.000 description 12
- OORLZFUTLGXMEF-UHFFFAOYSA-N sulfentrazone Chemical compound O=C1N(C(F)F)C(C)=NN1C1=CC(NS(C)(=O)=O)=C(Cl)C=C1Cl OORLZFUTLGXMEF-UHFFFAOYSA-N 0.000 description 11
- 229940075522 antidotes Drugs 0.000 description 10
- 238000009472 formulation Methods 0.000 description 10
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 9
- UPMXNNIRAGDFEH-UHFFFAOYSA-N 3,5-dibromo-4-hydroxybenzonitrile Chemical compound OC1=C(Br)C=C(C#N)C=C1Br UPMXNNIRAGDFEH-UHFFFAOYSA-N 0.000 description 9
- JTZCTMAVMHRNTR-UHFFFAOYSA-N Pyridate Chemical compound CCCCCCCCSC(=O)OC1=CC(Cl)=NN=C1C1=CC=CC=C1 JTZCTMAVMHRNTR-UHFFFAOYSA-N 0.000 description 9
- 229910052801 chlorine Inorganic materials 0.000 description 9
- 239000000460 chlorine Chemical group 0.000 description 9
- IWEDIXLBFLAXBO-UHFFFAOYSA-N dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 description 9
- MEFQWPUMEMWTJP-UHFFFAOYSA-N fluroxypyr Chemical compound NC1=C(Cl)C(F)=NC(OCC(O)=O)=C1Cl MEFQWPUMEMWTJP-UHFFFAOYSA-N 0.000 description 9
- PQTBTIFWAXVEPB-UHFFFAOYSA-N sulcotrione Chemical compound ClC1=CC(S(=O)(=O)C)=CC=C1C(=O)C1C(=O)CCCC1=O PQTBTIFWAXVEPB-UHFFFAOYSA-N 0.000 description 9
- DXXVCXKMSWHGTF-UHFFFAOYSA-N Chlomethoxyfen Chemical compound C1=C([N+]([O-])=O)C(OC)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 DXXVCXKMSWHGTF-UHFFFAOYSA-N 0.000 description 8
- HSSBORCLYSCBJR-UHFFFAOYSA-N Chloramben Chemical compound NC1=CC(Cl)=CC(C(O)=O)=C1Cl HSSBORCLYSCBJR-UHFFFAOYSA-N 0.000 description 8
- GXAMYUGOODKVRM-UHFFFAOYSA-N Flurecol Chemical compound C1=CC=C2C(C(=O)O)(O)C3=CC=CC=C3C2=C1 GXAMYUGOODKVRM-UHFFFAOYSA-N 0.000 description 8
- LVKTWOXHRYGDMM-UHFFFAOYSA-N Naproanilide Chemical compound C=1C=C2C=CC=CC2=CC=1OC(C)C(=O)NC1=CC=CC=C1 LVKTWOXHRYGDMM-UHFFFAOYSA-N 0.000 description 8
- LTUNNEGNEKBSEH-UHFFFAOYSA-N Prosulfuron Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)CCC(F)(F)F)=N1 LTUNNEGNEKBSEH-UHFFFAOYSA-N 0.000 description 8
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 8
- HYJSGOXICXYZGS-UHFFFAOYSA-N benazolin Chemical compound C1=CC=C2SC(=O)N(CC(=O)O)C2=C1Cl HYJSGOXICXYZGS-UHFFFAOYSA-N 0.000 description 8
- WZDDLAZXUYIVMU-UHFFFAOYSA-N bromobutide Chemical compound CC(C)(C)C(Br)C(=O)NC(C)(C)C1=CC=CC=C1 WZDDLAZXUYIVMU-UHFFFAOYSA-N 0.000 description 8
- HUBANNPOLNYSAD-UHFFFAOYSA-N clopyralid Chemical compound OC(=O)C1=NC(Cl)=CC=C1Cl HUBANNPOLNYSAD-UHFFFAOYSA-N 0.000 description 8
- MLKCGVHIFJBRCD-UHFFFAOYSA-N ethyl 2-chloro-3-{2-chloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl]-4-fluorophenyl}propanoate Chemical compound C1=C(Cl)C(CC(Cl)C(=O)OCC)=CC(N2C(N(C(F)F)C(C)=N2)=O)=C1F MLKCGVHIFJBRCD-UHFFFAOYSA-N 0.000 description 8
- NRXQIUSYPAHGNM-UHFFFAOYSA-N ioxynil Chemical compound OC1=C(I)C=C(C#N)C=C1I NRXQIUSYPAHGNM-UHFFFAOYSA-N 0.000 description 8
- UNAHYJYOSSSJHH-UHFFFAOYSA-N oryzalin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(S(N)(=O)=O)C=C1[N+]([O-])=O UNAHYJYOSSSJHH-UHFFFAOYSA-N 0.000 description 8
- ASRAWSBMDXVNLX-UHFFFAOYSA-N pyrazolynate Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(=O)C=1C(C)=NN(C)C=1OS(=O)(=O)C1=CC=C(C)C=C1 ASRAWSBMDXVNLX-UHFFFAOYSA-N 0.000 description 8
- FKERUJTUOYLBKB-UHFFFAOYSA-N pyrazoxyfen Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(=O)C=1C(C)=NN(C)C=1OCC(=O)C1=CC=CC=C1 FKERUJTUOYLBKB-UHFFFAOYSA-N 0.000 description 8
- ALZOLUNSQWINIR-UHFFFAOYSA-N quinmerac Chemical compound OC(=O)C1=C(Cl)C=CC2=CC(C)=CN=C21 ALZOLUNSQWINIR-UHFFFAOYSA-N 0.000 description 8
- IPPAUTOBDWNELX-UHFFFAOYSA-N (2-ethoxy-2-oxoethyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate Chemical compound C1=C([N+]([O-])=O)C(C(=O)OCC(=O)OCC)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 IPPAUTOBDWNELX-UHFFFAOYSA-N 0.000 description 7
- WNTGYJSOUMFZEP-UHFFFAOYSA-N 2-(4-chloro-2-methylphenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1C WNTGYJSOUMFZEP-UHFFFAOYSA-N 0.000 description 7
- AOQMRUTZEYVDIL-UHFFFAOYSA-N Flupoxam Chemical compound C=1C=C(Cl)C(COCC(F)(F)C(F)(F)F)=CC=1N1N=C(C(=O)N)N=C1C1=CC=CC=C1 AOQMRUTZEYVDIL-UHFFFAOYSA-N 0.000 description 7
- WLFDQEVORAMCIM-UHFFFAOYSA-N Metobromuron Chemical compound CON(C)C(=O)NC1=CC=C(Br)C=C1 WLFDQEVORAMCIM-UHFFFAOYSA-N 0.000 description 7
- 240000008042 Zea mays Species 0.000 description 7
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 7
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 7
- 235000009973 maize Nutrition 0.000 description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 7
- XTFNPKDYCLFGPV-OMCISZLKSA-N Bromofenoxim Chemical compound C1=C(Br)C(O)=C(Br)C=C1\C=N\OC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O XTFNPKDYCLFGPV-OMCISZLKSA-N 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 6
- 239000004202 carbamide Substances 0.000 description 6
- 229910052731 fluorine Inorganic materials 0.000 description 6
- 239000011737 fluorine Substances 0.000 description 6
- 125000001153 fluoro group Chemical group F* 0.000 description 6
- 239000008187 granular material Substances 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- 239000005476 Bentazone Substances 0.000 description 5
- 239000005489 Bromoxynil Substances 0.000 description 5
- WMLPCIHUFDKWJU-UHFFFAOYSA-N Cinosulfuron Chemical compound COCCOC1=CC=CC=C1S(=O)(=O)NC(=O)NC1=NC(OC)=NC(OC)=N1 WMLPCIHUFDKWJU-UHFFFAOYSA-N 0.000 description 5
- 239000005500 Clopyralid Substances 0.000 description 5
- 239000005504 Dicamba Substances 0.000 description 5
- 239000005558 Fluroxypyr Substances 0.000 description 5
- LXKOADMMGWXPJQ-UHFFFAOYSA-N Halosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2N(N=C(Cl)C=2C(O)=O)C)=N1 LXKOADMMGWXPJQ-UHFFFAOYSA-N 0.000 description 5
- 239000005582 Metosulam Substances 0.000 description 5
- CCGPUGMWYLICGL-UHFFFAOYSA-N Neburon Chemical compound CCCCN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 CCGPUGMWYLICGL-UHFFFAOYSA-N 0.000 description 5
- BGNQYGRXEXDAIQ-UHFFFAOYSA-N Pyrazosulfuron-ethyl Chemical group C1=NN(C)C(S(=O)(=O)NC(=O)NC=2N=C(OC)C=C(OC)N=2)=C1C(=O)OCC BGNQYGRXEXDAIQ-UHFFFAOYSA-N 0.000 description 5
- 239000005606 Pyridate Substances 0.000 description 5
- 239000005616 Rimsulfuron Substances 0.000 description 5
- 239000005618 Sulcotrione Substances 0.000 description 5
- ZOMSMJKLGFBRBS-UHFFFAOYSA-N bentazone Chemical compound C1=CC=C2NS(=O)(=O)N(C(C)C)C(=O)C2=C1 ZOMSMJKLGFBRBS-UHFFFAOYSA-N 0.000 description 5
- CNBGNNVCVSKAQZ-UHFFFAOYSA-N benzidamine Natural products C12=CC=CC=C2C(OCCCN(C)C)=NN1CC1=CC=CC=C1 CNBGNNVCVSKAQZ-UHFFFAOYSA-N 0.000 description 5
- ZCNQYNHDVRPZIH-UHFFFAOYSA-N fluthiacet-methyl Chemical compound C1=C(Cl)C(SCC(=O)OC)=CC(N=C2N3CCCCN3C(=O)S2)=C1F ZCNQYNHDVRPZIH-UHFFFAOYSA-N 0.000 description 5
- 229910052500 inorganic mineral Inorganic materials 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- MEFOUWRMVYJCQC-UHFFFAOYSA-N rimsulfuron Chemical compound CCS(=O)(=O)C1=CC=CN=C1S(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 MEFOUWRMVYJCQC-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 4
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 4
- OJQNCUXLSMVQLC-UHFFFAOYSA-N 1-(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonyl-1-(4,6-dimethoxypyrimidin-2-yl)urea Chemical compound COC1=CC(OC)=NC(N(C(N)=O)S(=O)(=O)C=2N3C=CC=CC3=NC=2Cl)=N1 OJQNCUXLSMVQLC-UHFFFAOYSA-N 0.000 description 4
- WBXQTLDEARFTTB-UHFFFAOYSA-N 1-(4-methylphenyl)-1-(2-phenylpropan-2-yl)urea Chemical compound C1=CC(C)=CC=C1N(C(N)=O)C(C)(C)C1=CC=CC=C1 WBXQTLDEARFTTB-UHFFFAOYSA-N 0.000 description 4
- BXKKQFGRMSOANI-UHFFFAOYSA-N 1-methoxy-3-[4-[(2-methoxy-2,4,4-trimethyl-3h-chromen-7-yl)oxy]phenyl]-1-methylurea Chemical compound C1=CC(NC(=O)N(C)OC)=CC=C1OC1=CC=C2C(C)(C)CC(C)(OC)OC2=C1 BXKKQFGRMSOANI-UHFFFAOYSA-N 0.000 description 4
- HXKWSTRRCHTUEC-UHFFFAOYSA-N 2,4-Dichlorophenoxyaceticacid Chemical compound OC(=O)C(Cl)OC1=CC=C(Cl)C=C1 HXKWSTRRCHTUEC-UHFFFAOYSA-N 0.000 description 4
- WSSHVDBIOMHNLW-UHFFFAOYSA-N 5-methyl-2-(4-methyl-5-oxo-4-propyl-1h-imidazol-2-yl)pyridine-3-carboxylic acid Chemical compound N1C(=O)C(CCC)(C)N=C1C1=NC=C(C)C=C1C(O)=O WSSHVDBIOMHNLW-UHFFFAOYSA-N 0.000 description 4
- HZKBYBNLTLVSPX-UHFFFAOYSA-N 6-[(6,6-dimethyl-5,7-dihydropyrrolo[2,1-c][1,2,4]thiadiazol-3-ylidene)amino]-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one Chemical compound C#CCN1C(=O)COC(C=C2F)=C1C=C2N=C1SN=C2CC(C)(C)CN21 HZKBYBNLTLVSPX-UHFFFAOYSA-N 0.000 description 4
- YUBJPYNSGLJZPQ-UHFFFAOYSA-N Dithiopyr Chemical compound CSC(=O)C1=C(C(F)F)N=C(C(F)(F)F)C(C(=O)SC)=C1CC(C)C YUBJPYNSGLJZPQ-UHFFFAOYSA-N 0.000 description 4
- XVOKUMIPKHGGTN-UHFFFAOYSA-N Imazethapyr Chemical compound OC(=O)C1=CC(CC)=CN=C1C1=NC(C)(C(C)C)C(=O)N1 XVOKUMIPKHGGTN-UHFFFAOYSA-N 0.000 description 4
- 239000005567 Imazosulfuron Substances 0.000 description 4
- NAGRVUXEKKZNHT-UHFFFAOYSA-N Imazosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2N3C=CC=CC3=NC=2Cl)=N1 NAGRVUXEKKZNHT-UHFFFAOYSA-N 0.000 description 4
- 239000005581 Metobromuron Substances 0.000 description 4
- 239000005587 Oryzalin Substances 0.000 description 4
- 239000005604 Prosulfuron Substances 0.000 description 4
- 239000005608 Quinmerac Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 239000003815 herbicide antidote Substances 0.000 description 4
- 229960002939 metizoline Drugs 0.000 description 4
- DSRNRYQBBJQVCW-UHFFFAOYSA-N metoxuron Chemical compound COC1=CC=C(NC(=O)N(C)C)C=C1Cl DSRNRYQBBJQVCW-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- KMHCHZLTOITEAG-UHFFFAOYSA-N 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-[2-(2-methoxyethoxy)phenyl]sulfonylurea Chemical compound COCCOC1=CC=CC=C1S(=O)(=O)N(C(N)=O)C1=NC(OC)=NC(OC)=N1 KMHCHZLTOITEAG-UHFFFAOYSA-N 0.000 description 3
- YUIJPWVEPUXJSL-UHFFFAOYSA-N 1-[2-(cyclopropanecarbonyl)phenyl]sulfonyl-1-(4,6-dimethoxypyrimidin-2-yl)urea Chemical compound COC1=CC(OC)=NC(N(C(N)=O)S(=O)(=O)C=2C(=CC=CC=2)C(=O)C2CC2)=N1 YUIJPWVEPUXJSL-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- UHIGORQILAXUPA-UHFFFAOYSA-N 3-propyl-1h-2,1,3-benzothiadiazin-4-one Chemical compound C1=CC=C2C(=O)N(CCC)SNC2=C1 UHIGORQILAXUPA-UHFFFAOYSA-N 0.000 description 3
- JRORQDJBTMAFRO-UHFFFAOYSA-N 5-ethyl-2-(4-methyl-5-oxo-4-propyl-1h-imidazol-2-yl)pyridine-3-carboxylic acid Chemical compound N1C(=O)C(CCC)(C)N=C1C1=NC=C(CC)C=C1C(O)=O JRORQDJBTMAFRO-UHFFFAOYSA-N 0.000 description 3
- PVSGXWMWNRGTKE-UHFFFAOYSA-N 5-methyl-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid Chemical compound N1C(=O)C(C(C)C)(C)N=C1C1=NC=C(C)C=C1C(O)=O PVSGXWMWNRGTKE-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 239000005570 Isoxaben Substances 0.000 description 3
- 241000209510 Liliopsida Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 125000004775 chlorodifluoromethyl group Chemical group FC(F)(Cl)* 0.000 description 3
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 3
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- PMHURSZHKKJGBM-UHFFFAOYSA-N isoxaben Chemical compound O1N=C(C(C)(CC)CC)C=C1NC(=O)C1=C(OC)C=CC=C1OC PMHURSZHKKJGBM-UHFFFAOYSA-N 0.000 description 3
- LMXUEVWZDFEYSO-UHFFFAOYSA-N methyl 2-[2-chloro-4-fluoro-5-[(3-oxo-1,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-5-ylidene)amino]phenyl]sulfanylacetate Chemical compound C1=C(Cl)C(SCC(=O)OC)=CC(N=C2N3C(=O)SCN3CCC2)=C1F LMXUEVWZDFEYSO-UHFFFAOYSA-N 0.000 description 3
- LVZSBWHVRFWYPX-UHFFFAOYSA-N methyl 5-[carbamoyl-(4,6-dimethoxypyrimidin-2-yl)sulfamoyl]-3-chloro-1-methylpyrazole-4-carboxylate Chemical compound ClC1=NN(C)C(S(=O)(=O)N(C(N)=O)C=2N=C(OC)C=C(OC)N=2)=C1C(=O)OC LVZSBWHVRFWYPX-UHFFFAOYSA-N 0.000 description 3
- 239000002480 mineral oil Substances 0.000 description 3
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 3
- 235000015112 vegetable and seed oil Nutrition 0.000 description 3
- 239000008158 vegetable oil Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- SXRHGLQCOLNZPT-UHFFFAOYSA-N 3,5-dibromo-4-hydroxybenzaldehyde Chemical compound OC1=C(Br)C=C(C=O)C=C1Br SXRHGLQCOLNZPT-UHFFFAOYSA-N 0.000 description 2
- 235000005781 Avena Nutrition 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 235000021506 Ipomoea Nutrition 0.000 description 2
- 241000207783 Ipomoea Species 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical class [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241000209094 Oryza Species 0.000 description 2
- 241000209117 Panicum Species 0.000 description 2
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 2
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 235000002634 Solanum Nutrition 0.000 description 2
- 241000207763 Solanum Species 0.000 description 2
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 2
- 244000062793 Sorghum vulgare Species 0.000 description 2
- 241000209140 Triticum Species 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- XQNAUQUKWRBODG-UHFFFAOYSA-N chlornitrofen Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=C(Cl)C=C(Cl)C=C1Cl XQNAUQUKWRBODG-UHFFFAOYSA-N 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- FPNNLPPKBRUZGV-UHFFFAOYSA-N ethyl 5-[carbamoyl-(4,6-dimethoxypyrimidin-2-yl)sulfamoyl]-1-methylpyrazole-4-carboxylate Chemical compound C1=NN(C)C(S(=O)(=O)N(C(N)=O)C=2N=C(OC)C=C(OC)N=2)=C1C(=O)OCC FPNNLPPKBRUZGV-UHFFFAOYSA-N 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000015097 nutrients Nutrition 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- MVYCPRGXXHWGPW-UHFFFAOYSA-N 1-(4,6-dimethoxypyrimidin-2-yl)-1-(3-ethylsulfonylpyridin-2-yl)sulfonylurea Chemical compound CCS(=O)(=O)C1=CC=CN=C1S(=O)(=O)N(C(N)=O)C1=NC(OC)=CC(OC)=N1 MVYCPRGXXHWGPW-UHFFFAOYSA-N 0.000 description 1
- OBGFMRSXJROQDT-UHFFFAOYSA-N 1-methoxy-1-methylurea Chemical compound CON(C)C(N)=O OBGFMRSXJROQDT-UHFFFAOYSA-N 0.000 description 1
- JTBBWRKSUYCPFY-UHFFFAOYSA-N 2,3-dihydro-1h-pyrimidin-4-one Chemical compound O=C1NCNC=C1 JTBBWRKSUYCPFY-UHFFFAOYSA-N 0.000 description 1
- FADBTYJJOWRDIY-UHFFFAOYSA-N 2-(2,6-dimethylphenyl)-N-[(3-methoxythiophen-2-yl)methyl]acetamide Chemical compound CC1=C(C(=CC=C1)C)CC(=O)NCC=1SC=CC1OC FADBTYJJOWRDIY-UHFFFAOYSA-N 0.000 description 1
- IKFPRBOUOSGYCS-UHFFFAOYSA-N 3-butoxy-2-chloro-n-(2,6-diethylphenyl)propanamide Chemical compound CCCCOCC(Cl)C(=O)NC1=C(CC)C=CC=C1CC IKFPRBOUOSGYCS-UHFFFAOYSA-N 0.000 description 1
- JAMWWGXYGGGMGS-UHFFFAOYSA-N 3-pyrazol-1-ylpropanamide Chemical compound NC(=O)CCN1C=CC=N1 JAMWWGXYGGGMGS-UHFFFAOYSA-N 0.000 description 1
- PZGKNOHFEJISTH-UHFFFAOYSA-N 6-(2,6-difluorophenyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide Chemical compound CC1=NC2=NC(S(N)(=O)=O)=NN2C=C1C1=C(F)C=CC=C1F PZGKNOHFEJISTH-UHFFFAOYSA-N 0.000 description 1
- 241000219144 Abutilon Species 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 241000209136 Agropyron Species 0.000 description 1
- 241000743339 Agrostis Species 0.000 description 1
- RGCKGOZRHPZPFP-UHFFFAOYSA-N Alizarin Natural products C1=CC=C2C(=O)C3=C(O)C(O)=CC=C3C(=O)C2=C1 RGCKGOZRHPZPFP-UHFFFAOYSA-N 0.000 description 1
- 241000234282 Allium Species 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 244000099147 Ananas comosus Species 0.000 description 1
- 241000404028 Anthemis Species 0.000 description 1
- 241001666377 Apera Species 0.000 description 1
- 235000003911 Arachis Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000005340 Asparagus officinalis Nutrition 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 241000611157 Brachiaria Species 0.000 description 1
- 241000339490 Brachyachne Species 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- 235000011331 Brassica Nutrition 0.000 description 1
- 241000209200 Bromus Species 0.000 description 1
- 229910021532 Calcite Inorganic materials 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000320316 Carduus Species 0.000 description 1
- 241000132570 Centaurea Species 0.000 description 1
- 241000219312 Chenopodium Species 0.000 description 1
- 235000000509 Chenopodium ambrosioides Nutrition 0.000 description 1
- 244000098897 Chenopodium botrys Species 0.000 description 1
- 235000005490 Chenopodium botrys Nutrition 0.000 description 1
- 244000192528 Chrysanthemum parthenium Species 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 241000207892 Convolvulus Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 244000024469 Cucumis prophetarum Species 0.000 description 1
- 235000010071 Cucumis prophetarum Nutrition 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000234653 Cyperus Species 0.000 description 1
- 241000320605 Dactyloctenium Species 0.000 description 1
- 241000208296 Datura Species 0.000 description 1
- 241000208175 Daucus Species 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 241000202829 Eleocharis Species 0.000 description 1
- 241000209215 Eleusine Species 0.000 description 1
- 235000007351 Eleusine Nutrition 0.000 description 1
- 244000294661 Emex spinosa Species 0.000 description 1
- 235000006369 Emex spinosa Nutrition 0.000 description 1
- 241000234642 Festuca Species 0.000 description 1
- 241001290564 Fimbristylis Species 0.000 description 1
- 241000816457 Galeopsis Species 0.000 description 1
- 241000748465 Galinsoga Species 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 235000009438 Gossypium Nutrition 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 241000208818 Helianthus Species 0.000 description 1
- 241000209219 Hordeum Species 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- 241001327265 Ischaemum Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000208822 Lactuca Species 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 241000801118 Lepidium Species 0.000 description 1
- 241000208204 Linum Species 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 235000002262 Lycopersicon Nutrition 0.000 description 1
- 241000227653 Lycopersicon Species 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 235000003990 Monochoria hastata Nutrition 0.000 description 1
- 240000000178 Monochoria vaginalis Species 0.000 description 1
- XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methylthiourea Natural products CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 235000011096 Papaver Nutrition 0.000 description 1
- 240000001090 Papaver somniferum Species 0.000 description 1
- 241001268782 Paspalum dilatatum Species 0.000 description 1
- 241000219833 Phaseolus Species 0.000 description 1
- 241000746981 Phleum Species 0.000 description 1
- 241000219843 Pisum Species 0.000 description 1
- 241000209048 Poa Species 0.000 description 1
- 241000205407 Polygonum Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 241000219295 Portulaca Species 0.000 description 1
- 241000218206 Ranunculus Species 0.000 description 1
- 241000490453 Rorippa Species 0.000 description 1
- 241000341978 Rotala Species 0.000 description 1
- 241000209051 Saccharum Species 0.000 description 1
- 240000009132 Sagittaria sagittifolia Species 0.000 description 1
- 241000202758 Scirpus Species 0.000 description 1
- 241000209056 Secale Species 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- 239000004113 Sepiolite Substances 0.000 description 1
- 244000275012 Sesbania cannabina Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 241000488874 Sonchus Species 0.000 description 1
- 244000273618 Sphenoclea zeylanica Species 0.000 description 1
- 235000017967 Sphenoclea zeylanica Nutrition 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- 241000245665 Taraxacum Species 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 241000219793 Trifolium Species 0.000 description 1
- 241000219422 Urtica Species 0.000 description 1
- 240000005592 Veronica officinalis Species 0.000 description 1
- 241000219873 Vicia Species 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 241000405217 Viola <butterfly> Species 0.000 description 1
- 241001506766 Xanthium Species 0.000 description 1
- 241000209149 Zea Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 244000193174 agave Species 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- HFVAFDPGUJEFBQ-UHFFFAOYSA-M alizarin red S Chemical compound [Na+].O=C1C2=CC=CC=C2C(=O)C2=C1C=C(S([O-])(=O)=O)C(O)=C2O HFVAFDPGUJEFBQ-UHFFFAOYSA-M 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 239000001166 ammonium sulphate Substances 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- LDECUSDQMXVUMP-UHFFFAOYSA-N benzyl 3-[6-[[2-(butylamino)-1-[3-methoxycarbonyl-4-(2-methoxy-2-oxoethoxy)phenyl]-2-oxoethyl]-hexylamino]-6-oxohexyl]-4-methyl-2-oxo-6-(4-phenylphenyl)-1,6-dihydropyrimidine-5-carboxylate Chemical compound O=C1NC(C=2C=CC(=CC=2)C=2C=CC=CC=2)C(C(=O)OCC=2C=CC=CC=2)=C(C)N1CCCCCC(=O)N(CCCCCC)C(C(=O)NCCCC)C1=CC=C(OCC(=O)OC)C(C(=O)OC)=C1 LDECUSDQMXVUMP-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- DCYOBGZUOMKFPA-UHFFFAOYSA-N iron(2+);iron(3+);octadecacyanide Chemical compound [Fe+2].[Fe+2].[Fe+2].[Fe+3].[Fe+3].[Fe+3].[Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] DCYOBGZUOMKFPA-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical class [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000004579 marble Substances 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940042880 natural phospholipid Drugs 0.000 description 1
- 229920005615 natural polymer Polymers 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 229960003351 prussian blue Drugs 0.000 description 1
- 239000013225 prussian blue Substances 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052624 sepiolite Inorganic materials 0.000 description 1
- 235000019355 sepiolite Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 230000000576 supplementary effect Effects 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/82—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with three ring hetero atoms
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4446341 | 1994-12-23 | ||
| DEP4446341.3 | 1994-12-23 | ||
| CA002165743A CA2165743C (en) | 1994-12-23 | 1995-12-20 | Selective herbicides based on heteroaryloxy-acetamides |
Related Parent Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002165743A Division CA2165743C (en) | 1994-12-23 | 1995-12-20 | Selective herbicides based on heteroaryloxy-acetamides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2640648A1 true CA2640648A1 (en) | 1996-06-24 |
Family
ID=6536946
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002640648A Abandoned CA2640648A1 (en) | 1994-12-23 | 1995-12-20 | Selective herbicides based on heteroaryloxy-acetamides |
| CA002165743A Expired - Lifetime CA2165743C (en) | 1994-12-23 | 1995-12-20 | Selective herbicides based on heteroaryloxy-acetamides |
| CA002640574A Abandoned CA2640574A1 (en) | 1994-12-23 | 1995-12-20 | Selective herbicides based on heteroaryloxy-acetamides |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002165743A Expired - Lifetime CA2165743C (en) | 1994-12-23 | 1995-12-20 | Selective herbicides based on heteroaryloxy-acetamides |
| CA002640574A Abandoned CA2640574A1 (en) | 1994-12-23 | 1995-12-20 | Selective herbicides based on heteroaryloxy-acetamides |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US5858920A (cg-RX-API-DMAC10.html) |
| BR (1) | BR9506064A (cg-RX-API-DMAC10.html) |
| CA (3) | CA2640648A1 (cg-RX-API-DMAC10.html) |
| DE (1) | DE19546751B4 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2728433B1 (cg-RX-API-DMAC10.html) |
| IT (1) | IT1277096B1 (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA9510896B (cg-RX-API-DMAC10.html) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19728568B4 (de) * | 1996-07-17 | 2007-06-14 | Bayer Cropscience Ag | Herbizide Mittel auf Basis von (5-Trifluormethyl-1,3,4-thiadiazol-2-yl-oxy)-essigsäure-N-isopropyl-N-(4fluorphenyl)-amid |
| DE19634701A1 (de) | 1996-08-28 | 1998-03-05 | Bayer Ag | Herbizide Mittel auf Basis von 4-Brom-l-methyl-5-trifluormethyl-3-(2-fluor-4-chlor-5-isopropoxycarbonsylphenyl)pyrazol |
| JP2001517952A (ja) * | 1997-03-25 | 2001-10-09 | ビーエーエスエフ アクチェンゲゼルシャフト | 除草剤耐性を生じさせるための、植物における除草剤結合ポリペプチドの発現 |
| US6001774A (en) * | 1997-05-06 | 1999-12-14 | Sumitomo Chemical Company, Limited | Herbicidal composition |
| US6127318A (en) * | 1998-04-03 | 2000-10-03 | Monsanto Company | Combination of glyphosate and a triazolinone herbicide |
| JP4200559B2 (ja) | 1998-10-23 | 2008-12-24 | 住友化学株式会社 | 除草剤組成物 |
| GB9912562D0 (en) * | 1999-05-28 | 1999-07-28 | Zeneca Ltd | Herbicide composition |
| DE19947918A1 (de) * | 1999-10-06 | 2001-04-12 | Bayer Ag | Selektive Herbizide auf Basis von Pyrimidin-Derivaten |
| EP1351571A2 (de) * | 1999-11-17 | 2003-10-15 | Bayer CropScience AG | Selektive herbizide auf basis von 2,6-disubstituierten pyridin-derivaten |
| DE10041619A1 (de) | 2000-05-22 | 2001-11-29 | Bayer Ag | Selektive Herbizide auf Basis von Heteroaryloxyacetamiden |
| CZ301614B6 (cs) * | 2000-05-22 | 2010-05-05 | Bayer Cropscience Ag | Herbicidní prostredek, zpusob jeho výroby a jeho použití pro hubení nežádoucích rostlin |
| DE10103417A1 (de) * | 2001-01-26 | 2002-08-01 | Bayer Ag | Herbizide Wirkstoffkombinationen |
| DE10103419A1 (de) * | 2001-01-26 | 2002-08-01 | Bayer Ag | Herbizide Wirkstoffkombinationen |
| AU2002333882A1 (en) * | 2001-09-27 | 2003-04-14 | Syngenta Participations Ag | Herbicidal composition |
| EP2252146A2 (en) * | 2008-02-05 | 2010-11-24 | Arysta LifeScience North America, LLC | Solid formulation of low melting active compound |
| WO2011082953A2 (de) | 2009-12-17 | 2011-07-14 | Bayer Cropscience Ag | Herbizide mittel enthaltend flufenacet |
| WO2011082968A2 (de) * | 2009-12-17 | 2011-07-14 | Bayer Cropscience Ag | Herbizide mittel enthaltend flufenacet |
| WO2011082954A2 (de) * | 2009-12-17 | 2011-07-14 | Bayer Cropscience Ag | Herbizide mittel enthaltend flufenacet |
| WO2011082955A2 (de) * | 2009-12-17 | 2011-07-14 | Bayer Cropscience Ag | Herbizide mittel enthaltend flufenacet |
| PL2515658T3 (pl) * | 2009-12-17 | 2016-12-30 | Środki chwastobójcze zawierające flufenacet | |
| WO2011082964A1 (de) | 2009-12-17 | 2011-07-14 | Bayer Cropscience Ag | Herbizide mittel enthaltend flufenacet |
| WO2011082956A2 (de) * | 2009-12-17 | 2011-07-14 | Bayer Cropscience Ag | Herbizide mittel enthaltend flufenacet |
| WO2011082959A2 (de) | 2009-12-17 | 2011-07-14 | Bayer Cropscience Ag | Herbizide mittel enthaltend flufenacet |
| WO2011082957A2 (de) | 2009-12-17 | 2011-07-14 | Bayer Cropscience Ag | Herbizide mittel enthaltend flufenacet |
| EP2512249B1 (de) * | 2009-12-17 | 2016-06-01 | Bayer Intellectual Property GmbH | Herbizide mittel enthaltend flufenacet |
| EP2512248B1 (de) | 2009-12-17 | 2016-08-10 | Bayer Intellectual Property GmbH | Herbizide mittel enthaltend flufenacet |
| GB201121314D0 (en) * | 2011-12-09 | 2012-01-25 | Syngenta Ltd | Herbicidal compositions |
| WO2014001361A1 (de) | 2012-06-27 | 2014-01-03 | Bayer Cropscience Ag | Herbizide mittel enthaltend flufenacet |
| CA2877797C (en) | 2012-06-27 | 2020-09-15 | Bayer Cropscience Ag | Herbicidal agents containing flufenacet, aclonifen, and diflufenican |
| WO2014001357A1 (de) | 2012-06-27 | 2014-01-03 | Bayer Cropscience Ag | Herbizide mittel enthaltend flufenacet |
| WO2014001248A1 (de) | 2012-06-27 | 2014-01-03 | Bayer Cropscience Ag | Herbizide mittel enthaltend flufenacet |
| WO2014095623A1 (de) | 2012-12-18 | 2014-06-26 | Bayer Cropscience Ag | Herbizide mittel enthaltend aclonifen |
| AR093999A1 (es) | 2012-12-18 | 2015-07-01 | Bayer Cropscience Ag | Agentes herbicidas que contienen aclonifeno |
| AR094000A1 (es) * | 2012-12-18 | 2015-07-01 | Bayer Cropscience Ag | Agentes herbicidas que contienen aclonifeno |
| AR093998A1 (es) | 2012-12-18 | 2015-07-01 | Bayer Cropscience Ag | Agentes herbicidas que contienen aclonifeno |
| AR094006A1 (es) | 2012-12-18 | 2015-07-01 | Bayer Cropscience Ag | Agentes herbicidas que contienen aclonifeno |
| WO2014095597A1 (de) | 2012-12-18 | 2014-06-26 | Bayer Cropscience Ag | Herbizide mittel enthaltend aclonifen |
| AR093997A1 (es) | 2012-12-18 | 2015-07-01 | Bayer Cropscience Ag | Agentes herbicidas que contienen aclonifeno |
| CA2901019A1 (en) * | 2013-03-08 | 2014-09-12 | Dow Agrosciences Llc | Herbicidal compositions comprising isoxaben and flufenacet |
| EP2936983A1 (de) | 2014-04-25 | 2015-10-28 | Bayer CropScience AG | Wirkstoffe zur Ertragssteigerung in Baumwollkulturen |
| GB2532217B (en) | 2014-11-11 | 2019-05-15 | Rotam Agrochem Int Co Ltd | Herbicidal composition and method for controlling plant growth |
| CN107751226B (zh) * | 2017-11-27 | 2020-11-13 | 浙江永太药业有限公司 | 一种含哒草特和氟噻草胺的除草剂组合物 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3418167A1 (de) * | 1984-05-16 | 1985-11-21 | Bayer Ag, 5090 Leverkusen | Verwendung von amiden zur verbesserung der kulturpflanzen-vertraeglichkeit von herbizid wirksamen heteroaryloxyacetamiden |
| US5502025A (en) * | 1987-08-13 | 1996-03-26 | Monsanto Company | Safening herbicidal pyrazolylsulfonylureas |
| DE3821597A1 (de) * | 1988-06-27 | 1989-12-28 | Bayer Ag | 5-difluormethyl-1,3,4-thiadiazol-2-yl- oxyessigsaeureamide, verfahren und 5-difluormethyl-2- methylsulfonyl- bzw. 2- methylthio-1,3,4-thiadiazol als zwischenprodukte zu ihrer herstellung und ihre verwendung als selektivherbizide |
| DE3821600A1 (de) * | 1988-06-27 | 1989-12-28 | Bayer Ag | Heteroaryloxyessigsaeure-n-isopropylanilide |
| DE4223465A1 (de) * | 1992-07-16 | 1994-01-20 | Bayer Ag | Herbizide Mittel auf Basis von Heteroaryloxyacetamiden |
-
1995
- 1995-12-14 DE DE19546751A patent/DE19546751B4/de not_active Expired - Lifetime
- 1995-12-18 IT IT95MI002656A patent/IT1277096B1/it active IP Right Grant
- 1995-12-20 CA CA002640648A patent/CA2640648A1/en not_active Abandoned
- 1995-12-20 CA CA002165743A patent/CA2165743C/en not_active Expired - Lifetime
- 1995-12-20 CA CA002640574A patent/CA2640574A1/en not_active Abandoned
- 1995-12-21 ZA ZA9510896A patent/ZA9510896B/xx unknown
- 1995-12-22 FR FR9515431A patent/FR2728433B1/fr not_active Expired - Lifetime
- 1995-12-22 BR BR9506064A patent/BR9506064A/pt not_active IP Right Cessation
-
1997
- 1997-07-21 US US08/897,188 patent/US5858920A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US5858920A (en) | 1999-01-12 |
| ITMI952656A1 (it) | 1997-06-18 |
| FR2728433B1 (fr) | 1998-12-04 |
| ZA9510896B (en) | 1996-02-15 |
| CA2165743A1 (en) | 1996-06-24 |
| BR9506064A (pt) | 1997-12-23 |
| IT1277096B1 (it) | 1997-11-04 |
| ITMI952656A0 (cg-RX-API-DMAC10.html) | 1995-12-18 |
| DE19546751B4 (de) | 2005-02-17 |
| CA2640574A1 (en) | 1996-06-24 |
| FR2728433A1 (fr) | 1996-06-28 |
| DE19546751A1 (de) | 1996-06-27 |
| CA2165743C (en) | 2009-03-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2165743C (en) | Selective herbicides based on heteroaryloxy-acetamides | |
| US5593942A (en) | Herbicidal agents based on heteroaryloxyacetamides and metribuzin | |
| US6649565B1 (en) | Selective herbicides on the basis of a substituted phenylsulfonylaminocarbonyltriazolinone and safeners | |
| US6967188B2 (en) | Selective heteroaryloxy- acetamides-based herbicides | |
| CA2867693C (en) | Herbicidal composition comprising uracil compound as active ingredient | |
| AU771265B2 (en) | Selective herbicides on the basis of N-aryl-triazoline(thi)ones | |
| US5968873A (en) | Selective herbicides based on 4-amino-5-(1-methyl-ethyl)-2-(1,1-dimethylethylaminocarbonyl)-2,4-dihydr o-3H-1,2,4-triazol-3-one | |
| AU2669101A (en) | N-aryl-uracile-based herbicides | |
| CZ20021728A3 (cs) | Synergické herbicidní kombinace účinných látek a jejich pouľití | |
| KR20030087638A (ko) | 치환된 아릴 케톤을 기본으로 하는 제초제 | |
| US7202196B2 (en) | Selective herbicide comprising a tetrazolinone derivative | |
| US6040271A (en) | Selective herbicides for the cultivation of sugar cane | |
| DK2243362T3 (en) | Selective herbicides from heteroaryloxy-acetamides | |
| AU718969B2 (en) | Herbicidal compositions based on 4-bromo-1-methyl-5- trifluoromethyl-3-(2-fluoro-4-chloro-5- isopropoxycarbonylphenyl)pyrazole | |
| KR100699525B1 (ko) | N-아릴 트리아졸린(티)온을 기본으로 한 선택적 제초제 | |
| MXPA99001934A (en) | Herbicides based on 4-bromo-1-methyl-5-trifluoromethyl-3-(2-fluoro-4-chloro-5-isopropoxycarbonylphenyl)pyrazole |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Discontinued |