CA2549400A1 - Doublure en plastique pour articles domestiques a ranger - Google Patents
Doublure en plastique pour articles domestiques a ranger Download PDFInfo
- Publication number
- CA2549400A1 CA2549400A1 CA002549400A CA2549400A CA2549400A1 CA 2549400 A1 CA2549400 A1 CA 2549400A1 CA 002549400 A CA002549400 A CA 002549400A CA 2549400 A CA2549400 A CA 2549400A CA 2549400 A1 CA2549400 A1 CA 2549400A1
- Authority
- CA
- Canada
- Prior art keywords
- container
- liner
- plastic
- plastic material
- rim
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 229920001903 high density polyethylene Polymers 0.000 title claims abstract description 39
- 238000003856 thermoforming Methods 0.000 claims abstract description 11
- 238000000071 blow moulding Methods 0.000 claims abstract description 4
- 239000000463 material Substances 0.000 claims description 82
- 238000000034 method Methods 0.000 claims description 51
- 229920003023 plastic Polymers 0.000 claims description 49
- 239000004033 plastic Substances 0.000 claims description 49
- 239000002985 plastic film Substances 0.000 claims description 23
- 238000004519 manufacturing process Methods 0.000 claims description 18
- 239000000853 adhesive Substances 0.000 claims description 14
- 230000001070 adhesive effect Effects 0.000 claims description 14
- 239000012790 adhesive layer Substances 0.000 claims description 13
- 238000009966 trimming Methods 0.000 claims description 10
- 238000010438 heat treatment Methods 0.000 claims description 2
- 239000010410 layer Substances 0.000 description 27
- 230000004888 barrier function Effects 0.000 description 24
- 239000007787 solid Substances 0.000 description 14
- 239000006260 foam Substances 0.000 description 13
- 239000004744 fabric Substances 0.000 description 12
- 239000011347 resin Substances 0.000 description 8
- 229920005989 resin Polymers 0.000 description 8
- 239000011248 coating agent Substances 0.000 description 7
- 238000000576 coating method Methods 0.000 description 7
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 6
- 238000005266 casting Methods 0.000 description 6
- 239000002023 wood Substances 0.000 description 6
- -1 for example Chemical class 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 238000000465 moulding Methods 0.000 description 5
- 229920006255 plastic film Polymers 0.000 description 5
- 229920001296 polysiloxane Polymers 0.000 description 5
- 238000003860 storage Methods 0.000 description 5
- 239000011111 cardboard Substances 0.000 description 4
- 238000010276 construction Methods 0.000 description 4
- 235000017166 Bambusa arundinacea Nutrition 0.000 description 3
- 235000017491 Bambusa tulda Nutrition 0.000 description 3
- 241001330002 Bambuseae Species 0.000 description 3
- 101100269850 Caenorhabditis elegans mask-1 gene Proteins 0.000 description 3
- 241000345998 Calamus manan Species 0.000 description 3
- 240000003826 Eichhornia crassipes Species 0.000 description 3
- 240000007058 Halophila ovalis Species 0.000 description 3
- 241000234295 Musa Species 0.000 description 3
- 235000018290 Musa x paradisiaca Nutrition 0.000 description 3
- 235000015334 Phyllostachys viridis Nutrition 0.000 description 3
- 239000004743 Polypropylene Substances 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 239000011425 bamboo Substances 0.000 description 3
- 239000011093 chipboard Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229920001971 elastomer Polymers 0.000 description 3
- 230000000149 penetrating effect Effects 0.000 description 3
- 229920001155 polypropylene Polymers 0.000 description 3
- 235000012950 rattan cane Nutrition 0.000 description 3
- 239000007779 soft material Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 239000003086 colorant Substances 0.000 description 2
- 238000010101 extrusion blow moulding Methods 0.000 description 2
- 238000010102 injection blow moulding Methods 0.000 description 2
- 238000010103 injection stretch blow moulding Methods 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- 239000002195 soluble material Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000004568 cement Substances 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000012611 container material Substances 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000003670 easy-to-clean Effects 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 239000003000 extruded plastic Substances 0.000 description 1
- 238000010413 gardening Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- ATADHKWKHYVBTJ-UHFFFAOYSA-N hydron;4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;chloride Chemical compound Cl.CNCC(O)C1=CC=C(O)C(O)=C1 ATADHKWKHYVBTJ-UHFFFAOYSA-N 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000010813 municipal solid waste Substances 0.000 description 1
- 235000021178 picnic Nutrition 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 230000000153 supplemental effect Effects 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 229920002725 thermoplastic elastomer Polymers 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B65—CONVEYING; PACKING; STORING; HANDLING THIN OR FILAMENTARY MATERIAL
- B65D—CONTAINERS FOR STORAGE OR TRANSPORT OF ARTICLES OR MATERIALS, e.g. BAGS, BARRELS, BOTTLES, BOXES, CANS, CARTONS, CRATES, DRUMS, JARS, TANKS, HOPPERS, FORWARDING CONTAINERS; ACCESSORIES, CLOSURES, OR FITTINGS THEREFOR; PACKAGING ELEMENTS; PACKAGES
- B65D25/00—Details of other kinds or types of rigid or semi-rigid containers
- B65D25/14—Linings or internal coatings
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Blow-Moulding Or Thermoforming Of Plastics Or The Like (AREA)
- Laminated Bodies (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US68856205P | 2005-06-08 | 2005-06-08 | |
| US68859805P | 2005-06-08 | 2005-06-08 | |
| US60/688,598 | 2005-06-08 | ||
| US60/688,562 | 2005-06-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2549400A1 true CA2549400A1 (fr) | 2006-12-08 |
Family
ID=37545679
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002549400A Abandoned CA2549400A1 (fr) | 2005-06-08 | 2006-05-31 | Doublure en plastique pour articles domestiques a ranger |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | US20070056970A1 (fr) |
| CA (1) | CA2549400A1 (fr) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US10233079B2 (en) | 1999-06-16 | 2019-03-19 | Ardica Technologies, Inc. | Heating methods for aluminum hydride production |
| US10435297B2 (en) | 1999-06-16 | 2019-10-08 | Ardica Technologies, Inc. | Crystallization and stabilization in the synthesis of microcrystalline alpha alane |
| US9676625B1 (en) | 2011-11-07 | 2017-06-13 | Ardica Technologies, Inc. | Synthesis of microcrystalline alpha alane |
| US8167157B2 (en) * | 2007-10-09 | 2012-05-01 | Ziva Shalomoff | Assembly of panels foldable to form a container |
| US20100108693A1 (en) * | 2008-11-04 | 2010-05-06 | The Coca-Cola Company | Insulated double-walled disposable plastic cup |
| US8291556B2 (en) * | 2010-04-14 | 2012-10-23 | Clarion Technologies, Inc. | Structurally reinforced casket and manufacturing method |
| US8763218B2 (en) | 2010-04-14 | 2014-07-01 | Clarion Technologies, Inc. | Structurally reinforced casket and manufacturing method |
| US20120017439A1 (en) * | 2010-07-26 | 2012-01-26 | Kei Edgardo Yamamoto | Method of fabricating a reaction chamber for a fuel storage assembly |
| US10246785B2 (en) | 2011-11-07 | 2019-04-02 | Ardica Technologies, Inc. | Use of fluidized-bed electrode reactors for alane production |
| US9327974B1 (en) | 2011-11-07 | 2016-05-03 | Ardica Technologies, Inc. | Aluminum hydride production |
| US9228267B1 (en) | 2011-11-07 | 2016-01-05 | Ardica Technologies, Inc. | Use of fluidized-bed electrode reactors for alane production |
| DE102014203789A1 (de) * | 2014-03-03 | 2015-09-03 | Robert Bosch Gmbh | Vorrichtung und Verfahren zum Thermoformen eines Filters, insbesondere für zumindest einen Becher umfassende Portionspackung |
| GB2542559A (en) * | 2015-09-18 | 2017-03-29 | The Benjamin Group Ltd | A collapsible container and a method of making a collapsible container |
| CN105217133A (zh) * | 2015-09-28 | 2016-01-06 | 无锡贺邦金属制品有限公司 | 塑料箱制品 |
| US20170334603A1 (en) * | 2015-12-14 | 2017-11-23 | Mark Zaremski | Collapsible sewing basket |
| IT202100012500A1 (it) * | 2021-05-14 | 2022-11-14 | W H In S R L | Contenitore per alimenti multifunzionale, biodegradabile e compostabile, opzionalmente provvisto di un rivestimento antimicrobico |
Family Cites Families (91)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US450112A (en) * | 1891-04-07 | William pl snow | ||
| US409432A (en) * | 1889-08-20 | Basket | ||
| US166215A (en) * | 1875-08-03 | Improvement in baskets | ||
| US314483A (en) * | 1885-03-24 | Manufacture of wire-cloth | ||
| US217572A (en) * | 1879-07-15 | Improvement in baskets | ||
| US209168A (en) * | 1878-10-22 | Improvement in manufacture of waste-paper baskets | ||
| US920313A (en) * | 1908-11-16 | 1909-05-04 | Emmett R Franklin | Wire basket. |
| US1102499A (en) * | 1913-08-11 | 1914-07-07 | Wade E Haist | Receptacle. |
| US1701312A (en) * | 1926-01-23 | 1929-02-05 | Grover P Shearer | Basket |
| US1906146A (en) * | 1930-11-05 | 1933-04-25 | Emil A Florang | Basket |
| US2036723A (en) * | 1935-01-07 | 1936-04-07 | W T Kline | Flexible basket |
| US2278673A (en) * | 1940-03-13 | 1942-04-07 | Savada Martin | Adhesive coated sheet material |
| US2426058A (en) * | 1945-03-19 | 1947-08-19 | Studebaker Corp | Plastic sheet material and method |
| US2573770A (en) * | 1951-03-03 | 1951-11-06 | Leon E Meadow | Handbag |
| US2692696A (en) * | 1953-06-03 | 1954-10-26 | U S Basket Co Inc | Fabric-lined box |
| US2836529A (en) * | 1954-05-03 | 1958-05-27 | Hugh Adam Kirk | Reinforced plastic |
| US2960798A (en) * | 1957-11-20 | 1960-11-22 | Frank F Lindstaedt | Nursery pots |
| US2885303A (en) * | 1957-12-13 | 1959-05-05 | Murray S Kaplan | Coated fabric |
| US3085027A (en) * | 1961-01-30 | 1963-04-09 | Us Rubber Co | Polyurethane coated fabric filled with isocyanate free elastomer and method of making same |
| US3349936A (en) * | 1965-10-12 | 1967-10-31 | James R Morton | Clothes hamper |
| US3396885A (en) * | 1967-02-16 | 1968-08-13 | Giondi Leona Ann | Bicycle wire basket liner and cover |
| US3470928A (en) * | 1967-10-26 | 1969-10-07 | Avisun Corp | Polypropylene fabric with modified selvage |
| CH489396A (de) * | 1968-09-17 | 1970-04-30 | Wilhelm Thiel Alfons | Doppelwandiger Kunststoffartikel, Verfahren zu seiner Herstellung und Vorrichtung zur Durchführung des Verfahrens |
| US3969563A (en) * | 1969-08-28 | 1976-07-13 | Hollis Sr Russell E | Protective wall structure |
| US3851786A (en) * | 1971-07-12 | 1974-12-03 | Kaempen Industries | Composite structure |
| US3784441A (en) * | 1971-07-12 | 1974-01-08 | Kaempen Industries | Composite structure |
| US3983282A (en) * | 1972-05-15 | 1976-09-28 | Seemann Iii William H | Fabric constructions useful as building bases in forming compound-curved structures |
| US3895159A (en) * | 1972-11-13 | 1975-07-15 | Ataka & Company Ltd | Cryogenic insulating material |
| US4090002A (en) * | 1973-04-16 | 1978-05-16 | Jesse Rosenblum | Reinforced fiber structures and method of making the same |
| US3923187A (en) * | 1973-06-25 | 1975-12-02 | Munksjoe Ab | Wire baskets |
| CH575319A5 (fr) * | 1974-03-08 | 1976-05-14 | Sulzer Ag | |
| US4164174A (en) * | 1975-09-30 | 1979-08-14 | Wallsten Hans Ivar | Method of preparing foodstuffs by means of boiling or steaming and means for performing the method |
| US3998228A (en) * | 1975-10-14 | 1976-12-21 | Vincent Poidomani | External catheterize device for males |
| GB1570655A (en) * | 1976-05-27 | 1980-07-02 | Energy Recycling Corp Ltd | Container and method of manufacturing same |
| US4040461A (en) * | 1976-08-09 | 1977-08-09 | Carson William S | Nestable fruit harvesting container |
| US4130103A (en) * | 1977-03-11 | 1978-12-19 | Zimmerman Leonard P | Charcoal lighter basket |
| US4211036A (en) * | 1977-05-05 | 1980-07-08 | Dalitz Shirley R | Planter basket |
| US4186648A (en) * | 1977-06-07 | 1980-02-05 | Clausen Carol W | Armor comprising ballistic fabric and particulate material in a resin matrix |
| CA1131569A (fr) * | 1977-10-25 | 1982-09-14 | Renate G. Lindner | Garniture reversible pour panier |
| US4380564A (en) * | 1979-07-16 | 1983-04-19 | Clopay Corporation | Cross-tearable decorative sheet material |
| US5683770A (en) * | 1984-05-22 | 1997-11-04 | Southpac Trust International, Inc. | Basket liner having a bonding material thereon and method |
| US5648130A (en) * | 1984-05-22 | 1997-07-15 | Southpac Trust International, Inc. | Basket liner having a bonding material thereon and method |
| US5616383A (en) * | 1984-05-22 | 1997-04-01 | Southpac Trust International, Inc. | Basket liner having a bonding material thereon and method |
| US4558801A (en) * | 1984-08-09 | 1985-12-17 | Vilutis & Co., Inc. | Conforming liner |
| US4741124A (en) * | 1985-03-01 | 1988-05-03 | Scism Bruce T | Plant basket |
| US4710185A (en) * | 1985-09-12 | 1987-12-01 | Kimberly-Clark Corporation | Foraminous net cover for absorbent articles |
| US4815603A (en) * | 1986-10-08 | 1989-03-28 | Harris Charles C | Shrink wrap package with venting openings |
| US4881553A (en) * | 1987-11-20 | 1989-11-21 | Grossman Richard A | Mesh reinforced condom |
| EP0367946B1 (fr) * | 1988-10-15 | 1993-05-05 | Sotralentz S.A. | Récipient de transport et/ou de stockage pour liquides et pour matériaux granuleux et procédé pour sa reproduction |
| US4982872A (en) * | 1988-12-15 | 1991-01-08 | Avery Donald J | Film-encapsulated-structure container for food, beverages and other consumable products and method for making of same |
| US4990384A (en) * | 1989-04-14 | 1991-02-05 | Somar Corporation | Paper cook pot |
| US5011729A (en) * | 1989-11-15 | 1991-04-30 | Mcallister Ian R | Vacuum insulated panels with concave surfaces on the surface layers |
| US5411167A (en) * | 1990-03-29 | 1995-05-02 | Highland Supply Corporation | Basket lining material having an adhesive or cohesive thereon and method |
| US5503293A (en) * | 1990-03-29 | 1996-04-02 | Highland Supply Corporation | Basket lining assembly and method |
| US5180190A (en) * | 1990-06-01 | 1993-01-19 | Halliburton Company | Damage-resistant containment device |
| US5209784A (en) * | 1990-08-24 | 1993-05-11 | Bellman David H | Method and apparatus for jewelry and small parts cleaning |
| FR2669396B1 (fr) * | 1990-11-19 | 1997-05-09 | Inst Francais Du Petrole | Reservoir de poids unitaire faible utilisable notamment pour le stockage de fluides sous pression et son procede de fabrication. |
| FR2672370B1 (fr) * | 1991-02-01 | 1993-04-23 | Inst Francais Du Petrole | Procede de fabrication d'une structure legere par expansion d'un reservoir metallique dans un tube ondule arme. |
| US5240134A (en) * | 1991-04-23 | 1993-08-31 | Mcdermott Susan M | Basket liner |
| US5097979A (en) * | 1991-04-23 | 1992-03-24 | Mcdermott Susan M | Basket liner |
| US5310077A (en) * | 1991-04-23 | 1994-05-10 | Mcdermott Susan M | Basket liner |
| ES2132221T3 (es) * | 1992-01-31 | 1999-08-16 | Ogden Inc | Material en lamina resistente al deslizamiento. |
| US5242219A (en) * | 1992-03-26 | 1993-09-07 | Tomaka Leonard P | Between rafters storage device |
| GB9313802D0 (en) * | 1993-07-03 | 1993-08-18 | Mulox Ibc Ltd | Container bag |
| USD358937S (en) * | 1993-07-26 | 1995-06-06 | Duckworth Linda D | Basket liner |
| US5471788A (en) * | 1994-01-12 | 1995-12-05 | Wonder Web Inc. | Method and apparatus for transplanting plant material |
| US5454191A (en) * | 1994-03-11 | 1995-10-03 | Mayeda; Ted | Flexible pouch-like hanging basket liner |
| DE4431046B4 (de) * | 1994-09-01 | 2005-12-29 | Empac Verpackungs-Gmbh | Kunststoffverpackungsbehälter mit verbesserter elektrostatischer Ableitfähigkeit |
| US5522340A (en) * | 1995-01-10 | 1996-06-04 | Skogman; Darrel | Vessels having a double-walled laminated frame |
| US5699564A (en) * | 1996-01-19 | 1997-12-23 | Heh; Deborah A. | Detachable organizing apparatus for children furniture |
| US6004035A (en) * | 1996-02-05 | 1999-12-21 | Hafer; Harold Franklin | Flexible bulk container with supporting side beams |
| US5756168A (en) * | 1996-03-01 | 1998-05-26 | Maag; William D. | Laminate article and method for making same |
| DE19617902C1 (de) * | 1996-05-03 | 1997-07-10 | Empac Verpackungs Gmbh | Behälterinliner |
| US6119887A (en) * | 1996-10-23 | 2000-09-19 | Titan Technologies (Usa), Inc. | Double wall storage tank having an extruded outer sheath and end caps and a method for making same |
| US6224954B1 (en) * | 1997-03-26 | 2001-05-01 | Fort James Corporation | Insulating stock material and containers and methods of making the same |
| US6287003B1 (en) * | 1998-04-16 | 2001-09-11 | Harold F. Hafer | Flexible container with supporting side beams |
| US6113270A (en) * | 1998-04-16 | 2000-09-05 | Hafer; Harold Franklin | Flexible container with supporting side beams |
| US6065601A (en) * | 1998-07-23 | 2000-05-23 | Southpac Trust International, Inc. | Liner with natural grass tuft |
| US6626570B2 (en) * | 1998-10-16 | 2003-09-30 | Kenneth Fox Supply Company | Produce bag with draw top |
| US6631630B1 (en) * | 2000-09-22 | 2003-10-14 | Board Of Trustees Of Michigan State University | Hydroforming of composite materials |
| US6648167B1 (en) * | 2001-02-14 | 2003-11-18 | Sermatech International, Inc. | Ducting passages for a polymeric lining |
| US7163339B1 (en) * | 2001-04-16 | 2007-01-16 | Plaspack U.S.A., Inc. | Composite breathable produce bag with a reinforced mesh sidewall |
| US20030024160A1 (en) * | 2001-08-03 | 2003-02-06 | Hendrickson Ronald W. | Hanging plant basket liner system |
| US6896410B2 (en) * | 2002-02-27 | 2005-05-24 | Jps Converter And Industrial Corporation | Refuse disposal in severe environments |
| US20030192897A1 (en) * | 2002-04-11 | 2003-10-16 | Ivex Packaging Corporation | Container for holding food |
| US6637155B1 (en) * | 2002-06-03 | 2003-10-28 | Jason Trent Butler | Plant container |
| US6726045B1 (en) * | 2003-02-21 | 2004-04-27 | Kenneth Yimin Chen | Interlocking structure |
| US7320411B1 (en) * | 2003-09-08 | 2008-01-22 | Shenosky Patricia L | Selectively sealable container liner |
| US6857141B1 (en) * | 2003-09-25 | 2005-02-22 | Karen R. Jackson | Lavatory wicker basin |
| US20070227066A1 (en) * | 2006-03-31 | 2007-10-04 | Pamela Crawford | Container and liner for side-planting plants and a method for same |
| WO2009137774A2 (fr) * | 2008-05-09 | 2009-11-12 | Kempf Brian J | Ensemble réceptacle de plante et procédé |
-
2006
- 2006-04-26 US US11/380,311 patent/US20070056970A1/en not_active Abandoned
- 2006-05-31 CA CA002549400A patent/CA2549400A1/fr not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| US20070056970A1 (en) | 2007-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US20070056970A1 (en) | Plastic Liner For Home Organizational Items | |
| US8308021B2 (en) | Disposable storage container | |
| US20090166369A1 (en) | Container having an articulated cover | |
| CN201729350U (zh) | 真空储存容器 | |
| CA2702003C (fr) | Systeme de conditionnement equipe d'un couvercle coiffant | |
| US9913563B2 (en) | Retaining plate | |
| US20120138608A1 (en) | Storage device having an articulated cover fitting inner and outer containers | |
| JP5680068B2 (ja) | プラスチック容器並びに製造方法 | |
| US20110180543A1 (en) | Container Having Adjustable Vented Cover | |
| CA2087349A1 (fr) | Joint d'etancheite multicouche pour contenant aerosol | |
| WO2012075567A1 (fr) | Conteneur modulaire | |
| US5516570A (en) | Method of making a covered article and substrate for making the covered article | |
| DE602007001035D1 (de) | Becher mit Fach in Form einer umgekehrten Schale | |
| WO2003101851A1 (fr) | Corps d'element de conteneur a compartiments multiples | |
| JP4943933B2 (ja) | 食品容器 | |
| JP2004504961A (ja) | 剛性フォームコアを備えたパネル構造体 | |
| CA2224508C (fr) | Emballage composite et methode de fabrication | |
| US20100068448A1 (en) | Method of manufacturing a composite multilayer material for decorative objects and materials obtained using said method | |
| JPH09323743A (ja) | 蓋付き容器 | |
| CA2919424A1 (fr) | Plateau | |
| JPH03650A (ja) | 容器、蓋等の合成樹脂シート成形品の成形方法 | |
| WO1997021603A1 (fr) | Couvercle a double composition et procede de fabrication de celui-ci | |
| RU2020141635A (ru) | Крышки контейнеров и способы их изготовления | |
| JP3080709U (ja) | 食品容器 | |
| KR200236647Y1 (ko) | 보온 도시락과 가방 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Discontinued |