CA2446336C - Direct synthesis of hydrogen peroxide in a multicomponent solvent system - Google Patents
Direct synthesis of hydrogen peroxide in a multicomponent solvent system Download PDFInfo
- Publication number
- CA2446336C CA2446336C CA2446336A CA2446336A CA2446336C CA 2446336 C CA2446336 C CA 2446336C CA 2446336 A CA2446336 A CA 2446336A CA 2446336 A CA2446336 A CA 2446336A CA 2446336 C CA2446336 C CA 2446336C
- Authority
- CA
- Canada
- Prior art keywords
- process according
- reaction solvent
- ranges
- weight
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 title claims abstract description 33
- 239000002904 solvent Substances 0.000 title claims description 7
- 230000015572 biosynthetic process Effects 0.000 title abstract description 7
- 238000003786 synthesis reaction Methods 0.000 title description 5
- 238000000034 method Methods 0.000 claims abstract description 84
- 239000007810 chemical reaction solvent Substances 0.000 claims abstract description 38
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical group [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims abstract description 31
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 25
- 239000000203 mixture Substances 0.000 claims abstract description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims abstract description 19
- 239000001257 hydrogen Substances 0.000 claims abstract description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 15
- 229910052751 metal Inorganic materials 0.000 claims abstract description 15
- 239000002184 metal Substances 0.000 claims abstract description 15
- 239000002253 acid Substances 0.000 claims abstract description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims abstract description 11
- 229930195733 hydrocarbon Natural products 0.000 claims abstract description 11
- 150000002430 hydrocarbons Chemical class 0.000 claims abstract description 11
- 150000001298 alcohols Chemical class 0.000 claims abstract description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 9
- 150000002739 metals Chemical class 0.000 claims abstract description 9
- 239000001301 oxygen Substances 0.000 claims abstract description 9
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 9
- 238000004519 manufacturing process Methods 0.000 claims abstract description 8
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 7
- 239000002638 heterogeneous catalyst Substances 0.000 claims abstract description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 42
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 30
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 27
- 239000003054 catalyst Substances 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 21
- 229910052763 palladium Inorganic materials 0.000 claims description 13
- 229910052697 platinum Inorganic materials 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 239000000126 substance Substances 0.000 claims description 10
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 claims description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- -1 hydrogen ions Chemical class 0.000 claims description 7
- 230000003647 oxidation Effects 0.000 claims description 7
- 238000007254 oxidation reaction Methods 0.000 claims description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 claims description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 6
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 6
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 claims description 6
- 150000004996 alkyl benzenes Chemical class 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 239000012429 reaction media Substances 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- QEGNUYASOUJEHD-UHFFFAOYSA-N 1,1-dimethylcyclohexane Chemical compound CC1(C)CCCCC1 QEGNUYASOUJEHD-UHFFFAOYSA-N 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 claims description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 4
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 claims description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 claims description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 claims description 4
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 claims description 4
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 claims description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 claims description 4
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical group S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 claims description 3
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical group COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 claims description 3
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 3
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052737 gold Inorganic materials 0.000 claims description 3
- 239000010931 gold Substances 0.000 claims description 3
- 238000005470 impregnation Methods 0.000 claims description 3
- 239000011261 inert gas Substances 0.000 claims description 3
- 229910052741 iridium Inorganic materials 0.000 claims description 3
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 3
- 239000002243 precursor Substances 0.000 claims description 3
- 229910052703 rhodium Inorganic materials 0.000 claims description 3
- 239000010948 rhodium Substances 0.000 claims description 3
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 3
- 229910052707 ruthenium Inorganic materials 0.000 claims description 3
- 239000010936 titanium Substances 0.000 claims description 3
- 229910052719 titanium Inorganic materials 0.000 claims description 3
- PXXNTAGJWPJAGM-VCOUNFBDSA-N Decaline Chemical compound C=1([C@@H]2C3)C=C(OC)C(OC)=CC=1OC(C=C1)=CC=C1CCC(=O)O[C@H]3C[C@H]1N2CCCC1 PXXNTAGJWPJAGM-VCOUNFBDSA-N 0.000 claims description 2
- GWESVXSMPKAFAS-UHFFFAOYSA-N Isopropylcyclohexane Natural products CC(C)C1CCCCC1 GWESVXSMPKAFAS-UHFFFAOYSA-N 0.000 claims description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 2
- 150000001336 alkenes Chemical class 0.000 claims description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 2
- 229910021529 ammonia Inorganic materials 0.000 claims description 2
- 229910052786 argon Inorganic materials 0.000 claims description 2
- 150000001491 aromatic compounds Chemical class 0.000 claims description 2
- 150000001728 carbonyl compounds Chemical class 0.000 claims description 2
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethylcyclohexane Chemical compound CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 claims description 2
- 239000007792 gaseous phase Substances 0.000 claims description 2
- 229910052734 helium Inorganic materials 0.000 claims description 2
- 239000001307 helium Substances 0.000 claims description 2
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 claims description 2
- 150000007522 mineralic acids Chemical group 0.000 claims description 2
- 229940075566 naphthalene Drugs 0.000 claims description 2
- 229910017604 nitric acid Inorganic materials 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 235000005985 organic acids Nutrition 0.000 claims description 2
- 238000001556 precipitation Methods 0.000 claims description 2
- 239000000377 silicon dioxide Substances 0.000 claims description 2
- XUXNAKZDHHEHPC-UHFFFAOYSA-M sodium bromate Chemical compound [Na+].[O-]Br(=O)=O XUXNAKZDHHEHPC-UHFFFAOYSA-M 0.000 claims description 2
- 150000003460 sulfonic acids Chemical class 0.000 claims description 2
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 150000003738 xylenes Chemical class 0.000 claims description 2
- 239000010457 zeolite Substances 0.000 claims description 2
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 claims 1
- 150000001649 bromium compounds Chemical class 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 239000000758 substrate Substances 0.000 claims 1
- 239000011877 solvent mixture Substances 0.000 abstract description 4
- 229960002163 hydrogen peroxide Drugs 0.000 description 12
- 230000035611 feeding Effects 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 8
- 239000000306 component Substances 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 239000012153 distilled water Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 235000019647 acidic taste Nutrition 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000008246 gaseous mixture Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 229960005419 nitrogen Drugs 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 2
- BVEIKFLZWBDLJG-UHFFFAOYSA-N 1-butylanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2CCCC BVEIKFLZWBDLJG-UHFFFAOYSA-N 0.000 description 1
- HSKPJQYAHCKJQC-UHFFFAOYSA-N 1-ethylanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2CC HSKPJQYAHCKJQC-UHFFFAOYSA-N 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- OPFTUNCRGUEPRZ-QLFBSQMISA-N Cyclohexane Natural products CC(=C)[C@@H]1CC[C@@](C)(C=C)[C@H](C(C)=C)C1 OPFTUNCRGUEPRZ-QLFBSQMISA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 229910002621 H2PtCl6 Inorganic materials 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 229910003244 Na2PdCl4 Inorganic materials 0.000 description 1
- 241001236212 Pinus pinaster Species 0.000 description 1
- 235000005105 Pinus pinaster Nutrition 0.000 description 1
- 229960000510 ammonia Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 239000003139 biocide Substances 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000006735 epoxidation reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910000856 hastalloy Inorganic materials 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000033444 hydroxylation Effects 0.000 description 1
- 238000005805 hydroxylation reaction Methods 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 239000003077 lignite Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000001603 reducing effect Effects 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/01—Hydrogen peroxide
- C01B15/029—Preparation from hydrogen and oxygen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
- Oxygen, Ozone, And Oxides In General (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2001MI001016A ITMI20011016A1 (it) | 2001-05-17 | 2001-05-17 | Sintesi diretta di acqua ossigenata in un nuovo sitema solvente multicomponente |
| ITMI2001A001016 | 2001-05-17 | ||
| PCT/EP2002/004862 WO2002092502A1 (en) | 2001-05-17 | 2002-04-29 | Direct synthesis of hydrogen peroxide in a multicomponent solvent system |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2446336A1 CA2446336A1 (en) | 2002-11-21 |
| CA2446336C true CA2446336C (en) | 2010-07-06 |
Family
ID=11447676
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA2446336A Expired - Fee Related CA2446336C (en) | 2001-05-17 | 2002-04-29 | Direct synthesis of hydrogen peroxide in a multicomponent solvent system |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US7105142B2 (cg-RX-API-DMAC7.html) |
| EP (1) | EP1390288B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JP4328535B2 (cg-RX-API-DMAC7.html) |
| KR (1) | KR100848419B1 (cg-RX-API-DMAC7.html) |
| AT (1) | ATE294134T1 (cg-RX-API-DMAC7.html) |
| CA (1) | CA2446336C (cg-RX-API-DMAC7.html) |
| DE (1) | DE60203900T2 (cg-RX-API-DMAC7.html) |
| DK (1) | DK1390288T3 (cg-RX-API-DMAC7.html) |
| IT (1) | ITMI20011016A1 (cg-RX-API-DMAC7.html) |
| NO (1) | NO337555B1 (cg-RX-API-DMAC7.html) |
| RU (1) | RU2270165C2 (cg-RX-API-DMAC7.html) |
| SA (1) | SA02230339B1 (cg-RX-API-DMAC7.html) |
| TW (1) | TW593130B (cg-RX-API-DMAC7.html) |
| WO (1) | WO2002092502A1 (cg-RX-API-DMAC7.html) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7067103B2 (en) | 2003-03-28 | 2006-06-27 | Headwaters Nanokinetix, Inc. | Direct hydrogen peroxide production using staged hydrogen addition |
| US7655137B2 (en) | 2003-07-14 | 2010-02-02 | Headwaters Technology Innovation, Llc | Reforming catalysts having a controlled coordination structure and methods for preparing such compositions |
| US7045479B2 (en) | 2003-07-14 | 2006-05-16 | Headwaters Nanokinetix, Inc. | Intermediate precursor compositions used to make supported catalysts having a controlled coordination structure and methods for preparing such compositions |
| US7569508B2 (en) | 2004-11-17 | 2009-08-04 | Headwaters Technology Innovation, Llc | Reforming nanocatalysts and method of making and using such catalysts |
| US7011807B2 (en) * | 2003-07-14 | 2006-03-14 | Headwaters Nanokinetix, Inc. | Supported catalysts having a controlled coordination structure and methods for preparing such catalysts |
| US7144565B2 (en) * | 2003-07-29 | 2006-12-05 | Headwaters Nanokinetix, Inc. | Process for direct catalytic hydrogen peroxide production |
| US7632775B2 (en) * | 2004-11-17 | 2009-12-15 | Headwaters Technology Innovation, Llc | Multicomponent nanoparticles formed using a dispersing agent |
| US7396795B2 (en) | 2005-08-31 | 2008-07-08 | Headwaters Technology Innovation, Llc | Low temperature preparation of supported nanoparticle catalysts having increased dispersion |
| US7514476B2 (en) * | 2006-03-17 | 2009-04-07 | Headwaters Technology Innovation, Llc | Stable concentrated metal colloids and methods of making same |
| US7718710B2 (en) | 2006-03-17 | 2010-05-18 | Headwaters Technology Innovation, Llc | Stable concentrated metal colloids and methods of making same |
| US7541309B2 (en) | 2006-05-16 | 2009-06-02 | Headwaters Technology Innovation, Llc | Reforming nanocatalysts and methods of making and using such catalysts |
| US7563742B2 (en) | 2006-09-22 | 2009-07-21 | Headwaters Technology Innovation, Llc | Supported nickel catalysts having high nickel loading and high metal dispersion and methods of making same |
| US7601668B2 (en) | 2006-09-29 | 2009-10-13 | Headwaters Technology Innovation, Llc | Methods for manufacturing bi-metallic catalysts having a controlled crystal face exposure |
| US7501532B1 (en) | 2007-11-20 | 2009-03-10 | Lyondell Chemical Technology, L.P. | Process for producing hydrogen peroxide |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL294400A (cg-RX-API-DMAC7.html) * | 1962-06-21 | |||
| GB1056125A (en) * | 1964-01-24 | 1967-01-25 | Ici Ltd | Palladium salts of condensed phosphoric acid |
| JPS5271000A (en) * | 1975-12-10 | 1977-06-13 | Tokuyama Soda Co Ltd | Production of hydrogen peroxide |
| US4336238A (en) | 1980-10-10 | 1982-06-22 | Air Products And Chemicals, Inc. | Process for producing hydrogen peroxide |
| US4335092A (en) * | 1980-10-10 | 1982-06-15 | Air Products And Chemicals, Inc. | Synthesis of hydrogen peroxide |
| US4772458A (en) * | 1986-11-19 | 1988-09-20 | E. I. Du Pont De Nemours And Company | Catalytic process for making hydrogen peroxide from hydrogen and oxygen employing a bromide promoter |
| RU2099278C1 (ru) * | 1992-01-21 | 1997-12-20 | Ека Нобель Актиеболаг | Способ получения пероксида водорода, катализатор и способ его получения |
| BE1006078A3 (fr) * | 1992-07-15 | 1994-05-10 | Solvay Interox | Procede pour la fabrication de peroxyde d'hydrogene par synthese directe a partir d'hydrogene et d'oxygene. |
| US5641467A (en) * | 1994-08-16 | 1997-06-24 | Princeton Advanced Technology, Inc. | Method for producing hydrogen peroxide from hydrogen and oxygen |
| US5965101A (en) * | 1996-01-30 | 1999-10-12 | Sumitomo Chemical Company, Limited | Process for producing hydrogen peroxide |
| IT1283040B1 (it) * | 1996-05-21 | 1998-04-07 | Enichem Spa | Procedimento per la preparazione di acqua ossigenata |
| SE9602484D0 (sv) * | 1996-06-24 | 1996-06-24 | Eka Chemicals Ab | Method of producing a chemical compound |
| CA2259386C (en) * | 1996-06-28 | 2002-06-25 | Matsushita Electric Works, Ltd. | Modification apparatus |
| DE19642770A1 (de) | 1996-10-16 | 1998-04-23 | Basf Ag | Verfahren zur Herstellung von Wasserstoffperoxid |
| IT1301999B1 (it) | 1998-08-05 | 2000-07-20 | Enichem Spa | Catalizzatore, processo per la produzione di acqua ossigenata esuo impiego in processi di ossidazione. |
| US6576214B2 (en) * | 2000-12-08 | 2003-06-10 | Hydrocarbon Technologies, Inc. | Catalytic direct production of hydrogen peroxide from hydrogen and oxygen feeds |
| US6162267A (en) | 1998-12-11 | 2000-12-19 | Uop Llc | Process for the generation of pure hydrogen for use with fuel cells |
| EP1094031A4 (en) * | 1999-04-20 | 2005-02-02 | Tokyo Gas Co Ltd | CYLINDRICAL ONE-TUBE REFORMER AND METHOD OF USE THEREOF |
| IT1318550B1 (it) | 2000-06-01 | 2003-08-27 | Eni Spa | Catalizzatore e processo per la sintesi diretta di acqua ossigenata. |
| DE10057537A1 (de) * | 2000-11-20 | 2002-06-06 | Viessmann Werke Kg | Apparat zur Erzeugung von Wasserstoff |
| US6468496B2 (en) * | 2000-12-21 | 2002-10-22 | Arco Chemical Technology, L.P. | Process for producing hydrogen peroxide |
| US6534661B1 (en) * | 2000-12-28 | 2003-03-18 | Hydrocarbon Technologies, Inc. | Integrated process and dual-function catalyst for olefin epoxidation |
-
2001
- 2001-05-17 IT IT2001MI001016A patent/ITMI20011016A1/it unknown
-
2002
- 2002-04-29 CA CA2446336A patent/CA2446336C/en not_active Expired - Fee Related
- 2002-04-29 US US10/477,196 patent/US7105142B2/en not_active Expired - Fee Related
- 2002-04-29 RU RU2003131961/15A patent/RU2270165C2/ru not_active IP Right Cessation
- 2002-04-29 EP EP02740557A patent/EP1390288B1/en not_active Expired - Lifetime
- 2002-04-29 AT AT02740557T patent/ATE294134T1/de active
- 2002-04-29 DE DE60203900T patent/DE60203900T2/de not_active Expired - Lifetime
- 2002-04-29 KR KR1020037014356A patent/KR100848419B1/ko not_active Expired - Fee Related
- 2002-04-29 JP JP2002589394A patent/JP4328535B2/ja not_active Expired - Fee Related
- 2002-04-29 DK DK02740557T patent/DK1390288T3/da active
- 2002-04-29 WO PCT/EP2002/004862 patent/WO2002092502A1/en not_active Ceased
- 2002-05-06 TW TW091109354A patent/TW593130B/zh not_active IP Right Cessation
- 2002-09-29 SA SA02230339A patent/SA02230339B1/ar unknown
-
2003
- 2003-11-14 NO NO20035092A patent/NO337555B1/no not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| KR20040012787A (ko) | 2004-02-11 |
| ATE294134T1 (de) | 2005-05-15 |
| ITMI20011016A0 (it) | 2001-05-17 |
| WO2002092502A1 (en) | 2002-11-21 |
| NO20035092D0 (no) | 2003-11-14 |
| JP2004528262A (ja) | 2004-09-16 |
| RU2270165C2 (ru) | 2006-02-20 |
| EP1390288B1 (en) | 2005-04-27 |
| US7105142B2 (en) | 2006-09-12 |
| KR100848419B1 (ko) | 2008-07-28 |
| EP1390288A1 (en) | 2004-02-25 |
| JP4328535B2 (ja) | 2009-09-09 |
| ITMI20011016A1 (it) | 2002-11-17 |
| NO337555B1 (no) | 2016-05-09 |
| DK1390288T3 (da) | 2005-06-13 |
| RU2003131961A (ru) | 2005-04-20 |
| TW593130B (en) | 2004-06-21 |
| NO20035092L (no) | 2004-01-16 |
| US20040151660A1 (en) | 2004-08-05 |
| SA02230339B1 (ar) | 2006-12-10 |
| DE60203900D1 (de) | 2005-06-02 |
| DE60203900T2 (de) | 2005-08-25 |
| CA2446336A1 (en) | 2002-11-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1412287B8 (en) | Catalyst and its use in the synthesis of hydrogen peroxide | |
| US6630118B2 (en) | Process for the direct synthesis of hydrogen peroxide | |
| JP5073134B2 (ja) | 過酸化水素の連続製造法 | |
| CA2446336C (en) | Direct synthesis of hydrogen peroxide in a multicomponent solvent system | |
| US20040151659A1 (en) | Direct synthesis of hydrogen peroxide in a multicomponent solvent system |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKLA | Lapsed |
Effective date: 20180430 |