CA2280028A1 - Electrostatic dissipative composition - Google Patents
Electrostatic dissipative composition Download PDFInfo
- Publication number
- CA2280028A1 CA2280028A1 CA002280028A CA2280028A CA2280028A1 CA 2280028 A1 CA2280028 A1 CA 2280028A1 CA 002280028 A CA002280028 A CA 002280028A CA 2280028 A CA2280028 A CA 2280028A CA 2280028 A1 CA2280028 A1 CA 2280028A1
- Authority
- CA
- Canada
- Prior art keywords
- thermoplastic
- group
- polyester
- thermoplastic composition
- prepared
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 133
- 229920000728 polyester Polymers 0.000 claims abstract description 47
- 229920001169 thermoplastic Polymers 0.000 claims abstract description 35
- 239000004416 thermosoftening plastic Substances 0.000 claims abstract description 35
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 25
- 125000005442 diisocyanate group Chemical group 0.000 claims abstract description 21
- 239000004615 ingredient Substances 0.000 claims abstract description 20
- 150000003856 quaternary ammonium compounds Chemical class 0.000 claims abstract description 19
- 239000004970 Chain extender Substances 0.000 claims abstract description 17
- 239000004433 Thermoplastic polyurethane Substances 0.000 claims abstract description 15
- 229920002803 thermoplastic polyurethane Polymers 0.000 claims abstract description 15
- 229920001515 polyalkylene glycol Polymers 0.000 claims abstract description 7
- 229920000642 polymer Polymers 0.000 claims description 84
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 44
- -1 hydroxyethyl groups Chemical group 0.000 claims description 39
- 239000000463 material Substances 0.000 claims description 37
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 22
- 229920002635 polyurethane Polymers 0.000 claims description 19
- 239000004814 polyurethane Substances 0.000 claims description 19
- 230000003068 static effect Effects 0.000 claims description 19
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 17
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 125000002947 alkylene group Chemical group 0.000 claims description 10
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 229920001223 polyethylene glycol Polymers 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 230000008018 melting Effects 0.000 claims description 8
- 238000002844 melting Methods 0.000 claims description 8
- 239000002202 Polyethylene glycol Substances 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 claims description 5
- 239000004606 Fillers/Extenders Substances 0.000 claims description 4
- 150000002148 esters Chemical group 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000000075 primary alcohol group Chemical group 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 4
- 229920000620 organic polymer Polymers 0.000 abstract description 4
- 229920001684 low density polyethylene Polymers 0.000 description 35
- 239000004702 low-density polyethylene Substances 0.000 description 35
- 239000000654 additive Substances 0.000 description 34
- 229920003023 plastic Polymers 0.000 description 30
- 239000004033 plastic Substances 0.000 description 30
- 230000000996 additive effect Effects 0.000 description 27
- 239000000126 substance Substances 0.000 description 24
- 239000012141 concentrate Substances 0.000 description 20
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 18
- 238000000034 method Methods 0.000 description 17
- 150000001875 compounds Chemical class 0.000 description 16
- 238000012360 testing method Methods 0.000 description 15
- 229920001577 copolymer Polymers 0.000 description 14
- 238000012545 processing Methods 0.000 description 14
- 238000005033 Fourier transform infrared spectroscopy Methods 0.000 description 11
- 239000002216 antistatic agent Substances 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 10
- 238000004519 manufacturing process Methods 0.000 description 10
- 238000002156 mixing Methods 0.000 description 9
- 230000000052 comparative effect Effects 0.000 description 8
- 229920001610 polycaprolactone Polymers 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 239000004743 Polypropylene Substances 0.000 description 7
- 238000004458 analytical method Methods 0.000 description 7
- 239000005022 packaging material Substances 0.000 description 7
- 239000008188 pellet Substances 0.000 description 7
- 239000004632 polycaprolactone Substances 0.000 description 7
- 229920001155 polypropylene Polymers 0.000 description 7
- 229960000380 propiolactone Drugs 0.000 description 7
- HLWRUJAIJJEZDL-UHFFFAOYSA-M sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate Chemical compound [Na+].OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC([O-])=O HLWRUJAIJJEZDL-UHFFFAOYSA-M 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 239000004952 Polyamide Substances 0.000 description 6
- 239000004698 Polyethylene Substances 0.000 description 6
- VEZXCJBBBCKRPI-UHFFFAOYSA-N beta-propiolactone Chemical class O=C1CCO1 VEZXCJBBBCKRPI-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 229920002647 polyamide Polymers 0.000 description 6
- 229920000573 polyethylene Polymers 0.000 description 6
- 230000008569 process Effects 0.000 description 6
- ULKFLOVGORAZDI-UHFFFAOYSA-N 3,3-dimethyloxetan-2-one Chemical compound CC1(C)COC1=O ULKFLOVGORAZDI-UHFFFAOYSA-N 0.000 description 5
- 239000004604 Blowing Agent Substances 0.000 description 5
- 239000004793 Polystyrene Substances 0.000 description 5
- 239000003963 antioxidant agent Substances 0.000 description 5
- 235000006708 antioxidants Nutrition 0.000 description 5
- 238000005102 attenuated total reflection Methods 0.000 description 5
- 230000001413 cellular effect Effects 0.000 description 5
- 239000000945 filler Substances 0.000 description 5
- 229920001903 high density polyethylene Polymers 0.000 description 5
- 239000004700 high-density polyethylene Substances 0.000 description 5
- 150000002430 hydrocarbons Chemical class 0.000 description 5
- 229920006113 non-polar polymer Polymers 0.000 description 5
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- 238000002835 absorbance Methods 0.000 description 4
- 229920005601 base polymer Polymers 0.000 description 4
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000005516 engineering process Methods 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 230000012447 hatching Effects 0.000 description 4
- 229920000570 polyether Polymers 0.000 description 4
- 229920000098 polyolefin Polymers 0.000 description 4
- 229920002223 polystyrene Polymers 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 230000001681 protective effect Effects 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 3
- 239000004594 Masterbatch (MB) Substances 0.000 description 3
- 229920002292 Nylon 6 Polymers 0.000 description 3
- 239000004721 Polyphenylene oxide Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 3
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 description 3
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000013329 compounding Methods 0.000 description 3
- 239000011231 conductive filler Substances 0.000 description 3
- 150000002334 glycols Chemical class 0.000 description 3
- 229920001519 homopolymer Polymers 0.000 description 3
- 238000010348 incorporation Methods 0.000 description 3
- 230000005012 migration Effects 0.000 description 3
- 238000013508 migration Methods 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 229920001451 polypropylene glycol Polymers 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 230000002787 reinforcement Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- RTTZISZSHSCFRH-UHFFFAOYSA-N 1,3-bis(isocyanatomethyl)benzene Chemical compound O=C=NCC1=CC=CC(CN=C=O)=C1 RTTZISZSHSCFRH-UHFFFAOYSA-N 0.000 description 2
- 239000005059 1,4-Cyclohexyldiisocyanate Substances 0.000 description 2
- ALQLPWJFHRMHIU-UHFFFAOYSA-N 1,4-diisocyanatobenzene Chemical compound O=C=NC1=CC=C(N=C=O)C=C1 ALQLPWJFHRMHIU-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- NYAWADGYOWCCLK-UHFFFAOYSA-N [Na].[Zr] Chemical compound [Na].[Zr] NYAWADGYOWCCLK-UHFFFAOYSA-N 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 230000032683 aging Effects 0.000 description 2
- 230000003078 antioxidant effect Effects 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- 238000005266 casting Methods 0.000 description 2
- 239000002666 chemical blowing agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000002131 composite material Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 150000001993 dienes Chemical class 0.000 description 2
- LDQMVMLZQFWREI-UHFFFAOYSA-N dimethyl(octyl)azanium;methanesulfonate Chemical class CS([O-])(=O)=O.CCCCCCCC[NH+](C)C LDQMVMLZQFWREI-UHFFFAOYSA-N 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 230000001617 migratory effect Effects 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 239000011116 polymethylpentene Substances 0.000 description 2
- 229920000306 polymethylpentene Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000007639 printing Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000007789 sealing Methods 0.000 description 2
- 239000004065 semiconductor Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 238000005211 surface analysis Methods 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- FSSPGSAQUIYDCN-UHFFFAOYSA-N 1,3-Propane sultone Chemical compound O=S1(=O)CCCO1 FSSPGSAQUIYDCN-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- 229940035437 1,3-propanediol Drugs 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical group C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SBJCUZQNHOLYMD-UHFFFAOYSA-N 1,5-Naphthalene diisocyanate Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1N=C=O SBJCUZQNHOLYMD-UHFFFAOYSA-N 0.000 description 1
- 229940043375 1,5-pentanediol Drugs 0.000 description 1
- ROHFBIREHKPELA-UHFFFAOYSA-N 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]prop-2-enoic acid;methane Chemical group C.CC(C)(C)C1=CC(CC(=C)C(O)=O)=CC(C(C)(C)C)=C1O.CC(C)(C)C1=CC(CC(=C)C(O)=O)=CC(C(C)(C)C)=C1O.CC(C)(C)C1=CC(CC(=C)C(O)=O)=CC(C(C)(C)C)=C1O.CC(C)(C)C1=CC(CC(=C)C(O)=O)=CC(C(C)(C)C)=C1O ROHFBIREHKPELA-UHFFFAOYSA-N 0.000 description 1
- MFYSUUPKMDJYPF-UHFFFAOYSA-N 2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-n-phenylbutanamide Chemical compound C=1C=CC=CC=1NC(=O)C(C(=O)C)N=NC1=CC=C(C)C=C1[N+]([O-])=O MFYSUUPKMDJYPF-UHFFFAOYSA-N 0.000 description 1
- OSPOJLWAJPWJTO-UHFFFAOYSA-N 3-[hexadecyl(dimethyl)azaniumyl]-2-hydroxypropane-1-sulfonate Chemical compound CCCCCCCCCCCCCCCC[N+](C)(C)CC(O)CS([O-])(=O)=O OSPOJLWAJPWJTO-UHFFFAOYSA-N 0.000 description 1
- JRQLZCFSWYQHPI-UHFFFAOYSA-N 4,5-dichloro-2-cyclohexyl-1,2-thiazol-3-one Chemical compound O=C1C(Cl)=C(Cl)SN1C1CCCCC1 JRQLZCFSWYQHPI-UHFFFAOYSA-N 0.000 description 1
- NBOCQTNZUPTTEI-UHFFFAOYSA-N 4-[4-(hydrazinesulfonyl)phenoxy]benzenesulfonohydrazide Chemical compound C1=CC(S(=O)(=O)NN)=CC=C1OC1=CC=C(S(=O)(=O)NN)C=C1 NBOCQTNZUPTTEI-UHFFFAOYSA-N 0.000 description 1
- 241000931526 Acer campestre Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000004156 Azodicarbonamide Substances 0.000 description 1
- 125000006539 C12 alkyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- DQEFEBPAPFSJLV-UHFFFAOYSA-N Cellulose propionate Chemical compound CCC(=O)OCC1OC(OC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C1OC1C(OC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C(COC(=O)CC)O1 DQEFEBPAPFSJLV-UHFFFAOYSA-N 0.000 description 1
- PQUCIEFHOVEZAU-UHFFFAOYSA-N Diammonium sulfite Chemical compound [NH4+].[NH4+].[O-]S([O-])=O PQUCIEFHOVEZAU-UHFFFAOYSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- 229920003354 Modic® Polymers 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- ALQSHHUCVQOPAS-UHFFFAOYSA-N Pentane-1,5-diol Chemical compound OCCCCCO ALQSHHUCVQOPAS-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920002319 Poly(methyl acrylate) Polymers 0.000 description 1
- 229920005830 Polyurethane Foam Polymers 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 241001233279 Scalopus Species 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 229920002433 Vinyl chloride-vinyl acetate copolymer Polymers 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- BGYHLZZASRKEJE-UHFFFAOYSA-N [3-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]-2,2-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxymethyl]propyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)OCC(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 BGYHLZZASRKEJE-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000002318 adhesion promoter Substances 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 230000000712 assembly Effects 0.000 description 1
- 238000000429 assembly Methods 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- XOZUGNYVDXMRKW-AATRIKPKSA-N azodicarbonamide Chemical compound NC(=O)\N=N\C(N)=O XOZUGNYVDXMRKW-AATRIKPKSA-N 0.000 description 1
- 235000019399 azodicarbonamide Nutrition 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 1
- 229920006218 cellulose propionate Polymers 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000002144 chemical decomposition reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 235000013365 dairy product Nutrition 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- KORSJDCBLAPZEQ-UHFFFAOYSA-N dicyclohexylmethane-4,4'-diisocyanate Chemical compound C1CC(N=C=O)CCC1CC1CCC(N=C=O)CC1 KORSJDCBLAPZEQ-UHFFFAOYSA-N 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical class C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- 238000003618 dip coating Methods 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920006242 ethylene acrylic acid copolymer Polymers 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000003000 extruded plastic Substances 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000003574 free electron Substances 0.000 description 1
- 239000002828 fuel tank Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000009477 glass transition Effects 0.000 description 1
- 150000002311 glutaric acids Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 150000008040 ionic compounds Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002596 lactones Chemical group 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000033001 locomotion Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 238000004377 microelectronic Methods 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 1
- 239000000615 nonconductor Substances 0.000 description 1
- 235000019645 odor Nutrition 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000011056 performance test Methods 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 150000003047 pimelic acids Chemical class 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920000120 polyethyl acrylate Polymers 0.000 description 1
- 229940093430 polyethylene glycol 1500 Drugs 0.000 description 1
- 229940057838 polyethylene glycol 4000 Drugs 0.000 description 1
- 229940057847 polyethylene glycol 600 Drugs 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 239000002861 polymer material Substances 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 239000011496 polyurethane foam Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229920000131 polyvinylidene Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- KCXFHTAICRTXLI-UHFFFAOYSA-M propane-1-sulfonate Chemical compound CCCS([O-])(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-M 0.000 description 1
- 238000004537 pulping Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 238000007151 ring opening polymerisation reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003330 sebacic acids Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 239000012748 slip agent Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- SFVFIFLLYFPGHH-UHFFFAOYSA-M stearalkonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 SFVFIFLLYFPGHH-UHFFFAOYSA-M 0.000 description 1
- 230000035882 stress Effects 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 150000003442 suberic acids Chemical class 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003444 succinic acids Chemical class 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920005613 synthetic organic polymer Polymers 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 238000007039 two-step reaction Methods 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 238000009834 vaporization Methods 0.000 description 1
- 230000008016 vaporization Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical compound O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01B—CABLES; CONDUCTORS; INSULATORS; SELECTION OF MATERIALS FOR THEIR CONDUCTIVE, INSULATING OR DIELECTRIC PROPERTIES
- H01B1/00—Conductors or conductive bodies characterised by the conductive materials; Selection of materials as conductors
- H01B1/20—Conductive material dispersed in non-conductive organic material
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01B—CABLES; CONDUCTORS; INSULATORS; SELECTION OF MATERIALS FOR THEIR CONDUCTIVE, INSULATING OR DIELECTRIC PROPERTIES
- H01B1/00—Conductors or conductive bodies characterised by the conductive materials; Selection of materials as conductors
- H01B1/06—Conductors or conductive bodies characterised by the conductive materials; Selection of materials as conductors mainly consisting of other non-metallic substances
- H01B1/12—Conductors or conductive bodies characterised by the conductive materials; Selection of materials as conductors mainly consisting of other non-metallic substances organic substances
- H01B1/122—Ionic conductors
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/41—Compounds containing sulfur bound to oxygen
- C08K5/42—Sulfonic acids; Derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L75/00—Compositions of polyureas or polyurethanes; Compositions of derivatives of such polymers
- C08L75/04—Polyurethanes
- C08L75/08—Polyurethanes from polyethers
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Dispersion Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/795,873 | 1997-02-06 | ||
| US08/795,873 US5863466A (en) | 1997-02-06 | 1997-02-06 | Electrostatic dissipative composition |
| PCT/US1998/002209 WO1998035359A1 (en) | 1997-02-06 | 1998-02-02 | Electrostatic dissipative composition |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2280028A1 true CA2280028A1 (en) | 1998-08-13 |
Family
ID=25166670
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002280028A Abandoned CA2280028A1 (en) | 1997-02-06 | 1998-02-02 | Electrostatic dissipative composition |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US5863466A (enExample) |
| EP (1) | EP0963589A4 (enExample) |
| JP (1) | JP2001512503A (enExample) |
| KR (1) | KR20000070850A (enExample) |
| AU (1) | AU6650498A (enExample) |
| CA (1) | CA2280028A1 (enExample) |
| NO (1) | NO312038B1 (enExample) |
| WO (1) | WO1998035359A1 (enExample) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6534422B1 (en) * | 1999-06-10 | 2003-03-18 | National Semiconductor Corporation | Integrated ESD protection method and system |
| US6197486B1 (en) * | 1999-12-27 | 2001-03-06 | Eastman Kodak Company | Reflective print material with extruded antistatic layer |
| US6207361B1 (en) * | 1999-12-27 | 2001-03-27 | Eastman Kodak Company | Photographic film with base containing polymeric antistatic material |
| US6231788B1 (en) | 2000-02-03 | 2001-05-15 | General Electric Company | Carbon-reinforced PC-ABS composition and articles made from same |
| US6248262B1 (en) | 2000-02-03 | 2001-06-19 | General Electric Company | Carbon-reinforced thermoplastic resin composition and articles made from same |
| US6689835B2 (en) * | 2001-04-27 | 2004-02-10 | General Electric Company | Conductive plastic compositions and method of manufacture thereof |
| US6872501B2 (en) * | 2001-05-11 | 2005-03-29 | Eastman Kodak Company | Antistat of onium salt and polyether polymer |
| US6740410B2 (en) * | 2001-05-16 | 2004-05-25 | Noveon Ip Holdings Corp. | Electrostatic dissipating polymeric multi-layer article or laminate |
| US6528572B1 (en) | 2001-09-14 | 2003-03-04 | General Electric Company | Conductive polymer compositions and methods of manufacture thereof |
| US7238744B2 (en) * | 2002-04-12 | 2007-07-03 | Daramic, Inc. | Ultrahigh molecular weight polyethylene articles and method of manufacture |
| US7018567B2 (en) * | 2002-07-22 | 2006-03-28 | General Electric Company | Antistatic flame retardant resin composition and methods for manufacture thereof |
| US20070179255A1 (en) * | 2002-11-08 | 2007-08-02 | Noveon, Inc. | Heat Resistant High Moisture Vapor Transmission Thermoplastic Polyurethane |
| US7202322B2 (en) | 2002-11-08 | 2007-04-10 | Noveon, Inc. | Heat resistant high moisture vapor transmission thermoplastic polyurethane |
| US6893592B2 (en) | 2003-02-26 | 2005-05-17 | Eastman Kodak Company | Process of making an image recording element with an extruded polyester-containing image-receiving layer |
| US20040211942A1 (en) * | 2003-04-28 | 2004-10-28 | Clark Darren Cameron | Electrically conductive compositions and method of manufacture thereof |
| US20040232389A1 (en) * | 2003-05-22 | 2004-11-25 | Elkovitch Mark D. | Electrically conductive compositions and method of manufacture thereof |
| US20040262581A1 (en) * | 2003-06-27 | 2004-12-30 | Rodrigues David E. | Electrically conductive compositions and method of manufacture thereof |
| JP2007512658A (ja) * | 2003-08-08 | 2007-05-17 | ゼネラル・エレクトリック・カンパニイ | 導電性組成物及びその製造方法 |
| US7026432B2 (en) * | 2003-08-12 | 2006-04-11 | General Electric Company | Electrically conductive compositions and method of manufacture thereof |
| US7354988B2 (en) * | 2003-08-12 | 2008-04-08 | General Electric Company | Electrically conductive compositions and method of manufacture thereof |
| US7309727B2 (en) * | 2003-09-29 | 2007-12-18 | General Electric Company | Conductive thermoplastic compositions, methods of manufacture and articles derived from such compositions |
| US20050070658A1 (en) * | 2003-09-30 | 2005-03-31 | Soumyadeb Ghosh | Electrically conductive compositions, methods of manufacture thereof and articles derived from such compositions |
| US7325744B2 (en) * | 2004-01-09 | 2008-02-05 | Arthur James Porter | Memory card holder device |
| JP2006022282A (ja) * | 2004-07-09 | 2006-01-26 | Regulus Co Ltd | 導電性樹脂組成物および導電性樹脂成形物 |
| JP5153053B2 (ja) * | 2004-07-22 | 2013-02-27 | Sabicイノベーティブプラスチックスジャパン合同会社 | 難燃性帯電防止ポリエステル系樹脂組成物 |
| US7462656B2 (en) * | 2005-02-15 | 2008-12-09 | Sabic Innovative Plastics Ip B.V. | Electrically conductive compositions and method of manufacture thereof |
| DE102005028056A1 (de) * | 2005-06-16 | 2006-12-21 | Basf Ag | Thermoplastisches Polyurethan enthaltend Isocyanat |
| US20080163542A1 (en) * | 2007-01-08 | 2008-07-10 | Innospec, Inc. | Synergistic fuel composition for enhancing fuel cold flow properties |
| DE102007027842A1 (de) * | 2007-06-13 | 2008-12-18 | Tesa Ag | Compound und Wickelband aus TPU |
| WO2009013536A2 (en) | 2007-07-20 | 2009-01-29 | Innospec Limited | Improvements in or relating to hydrocarbon compositions |
| JP5277659B2 (ja) * | 2008-02-20 | 2013-08-28 | 東洋インキScホールディングス株式会社 | 熱可塑性樹脂組成物及びその成形品 |
| US20100005706A1 (en) | 2008-07-11 | 2010-01-14 | Innospec Fuel Specialties, LLC | Fuel composition with enhanced low temperature properties |
| US8163848B2 (en) * | 2009-05-01 | 2012-04-24 | E. I. Du Pont De Nemours And Company | Antistatic poly(hydroxyalkanoic acid) compositions |
| US8861167B2 (en) | 2011-05-12 | 2014-10-14 | Global Plasma Solutions, Llc | Bipolar ionization device |
| GB201111799D0 (en) | 2011-07-08 | 2011-08-24 | Innospec Ltd | Improvements in fuels |
| US9260602B2 (en) | 2012-10-11 | 2016-02-16 | Sabic Global Technologies B.V. | Antistatic flame retardant resin compositions and methods and uses thereof |
| WO2018035092A1 (en) | 2016-08-15 | 2018-02-22 | Sabic Global Tecnologies B.V. | Multifunctional flame retardant thermoplastic compositions for connected personal protective equipment |
| US11566164B2 (en) | 2017-07-06 | 2023-01-31 | Innospec Oil Field Chemicals Llc | Compositions and methods and uses relating thereto |
Family Cites Families (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2129264A (en) * | 1935-03-29 | 1938-09-06 | Du Pont | Nitrogen-containing organic compounds |
| US2697116A (en) * | 1951-09-25 | 1954-12-14 | California Research Corp | Quaternary taurine type compounds as surface-active agents |
| US2871218A (en) * | 1955-12-01 | 1959-01-27 | Goodrich Co B F | Simulated vulcanizates of polyurethane elastomers |
| US3012992A (en) * | 1959-03-25 | 1961-12-12 | Mobay Chemical Corp | Polyurethane castings |
| DE1159957B (de) * | 1960-11-08 | 1963-12-27 | Bayer Ag | Verfahren zur Herstellung von quaternaeren Ammoniumverbindungen |
| US3280179A (en) * | 1961-03-16 | 1966-10-18 | Textilana Corp | Processes for producing acyclic surfactant sulfobetaines |
| US3214411A (en) * | 1961-05-10 | 1965-10-26 | Mobay Chemical Corp | Polyester urethanes made with diphenylmethane diisocyanate which are processable by thermoplastic techniques |
| US3644482A (en) * | 1961-10-30 | 1972-02-22 | Geigy Ag J R | (4-hydroxy-5-alkylphenyl) alkanoic acid esters of polyols |
| DE1520759A1 (de) * | 1962-03-30 | 1969-11-27 | Shell Int Research | Verfahren zur Herstellung von hochmolekularen Polyestern aus Lactonen |
| US3299171A (en) * | 1964-04-20 | 1967-01-17 | Du Pont | Fibers of modified polypivalolactone |
| SE339731B (enExample) * | 1964-10-06 | 1971-10-18 | Procter & Gamble | |
| US3285855A (en) * | 1965-03-11 | 1966-11-15 | Geigy Chem Corp | Stabilization of organic material with esters containing an alkylhydroxy-phenyl group |
| US3539521A (en) * | 1965-05-03 | 1970-11-10 | Procter & Gamble | Detergent composition |
| US3619115A (en) * | 1967-09-08 | 1971-11-09 | Procter & Gamble | Cool water laundering process |
| GB1182376A (en) * | 1968-07-01 | 1970-02-25 | Shell Int Research | Process for the Polymerization or Copolymerization of Beta-Propiolactones |
| US4088612A (en) * | 1968-08-15 | 1978-05-09 | Lever Brothers Company | Detergent compositions |
| GB1419096A (en) * | 1972-06-20 | 1975-12-24 | Procter & Gamble Ltd | Zwitterionic surface-active agents |
| US3867324A (en) * | 1972-07-28 | 1975-02-18 | Union Carbide Corp | Environmentally degradable-biodegradable blend of an oxyalkanoyl polymer and an environmentally degradable ethylene polymer |
| US4005029A (en) * | 1973-08-01 | 1977-01-25 | The Procter & Gamble Company | Laundering adjunct |
| US4191818A (en) * | 1975-10-25 | 1980-03-04 | Basf Wyandotte Corporation | Process for preparing heat-resistant polyurethane elastomers having no secondary softening range |
| JPS57111311A (en) * | 1980-12-29 | 1982-07-10 | Nippon Polyurethan Kogyo Kk | Thermoplastic polyurethane resin |
| US4439552A (en) * | 1981-05-08 | 1984-03-27 | Gravi-Mechanics Co. | Method of preparing a urethane prepolymer and polymer |
| JPS6043666A (ja) * | 1983-08-19 | 1985-03-08 | Kimoto & Co Ltd | オ−バ−ヘツドプロジエクタ−用フイルム |
| US5015412A (en) * | 1985-05-09 | 1991-05-14 | Sherex Chemical Company, Inc. | Alkaline tolerant sulfobetaine amphoteric surfactants |
| US4797447A (en) * | 1985-08-16 | 1989-01-10 | Shell Oil Company | Impact resistant blends of thermoplastic polyesters and modified block copolymers |
| DE3613790A1 (de) * | 1986-04-24 | 1987-10-29 | Bayer Ag | Verfahren zur herstellung von thermoplastischen polyurethanen fuer die strahlenvernetzung und ihre verwendung |
| DD296974A5 (de) * | 1987-04-20 | 1991-12-19 | Chemiefaserwerk | Verschleissminderndes antistatikum |
| CA1326720C (en) * | 1987-12-31 | 1994-02-01 | Michael John Modic | Impact resistant blends of polar thermoplastic polymers and modified block copolymers |
| US5187214A (en) * | 1988-11-08 | 1993-02-16 | Ppg Industries, Inc. | Quaternary ammonium antistatic polymer compositions |
| US4900776A (en) * | 1988-12-01 | 1990-02-13 | Georgia-Pacific Resins, Inc. | Potassium catalyst system for preparing polyurethane based plywood-patch compositions |
| US5096939A (en) * | 1989-06-07 | 1992-03-17 | Techmer Pm | Degradable polymeric compositions |
| US5159053A (en) * | 1989-08-28 | 1992-10-27 | The B. F. Goodrich Company | Polyurethane for use in electrostatic dissipating applications |
| BR9105924A (pt) * | 1990-01-05 | 1992-11-10 | Goodrich Co B F | Composicao polimerica dissipadora de eletrostatica,artigo polimerico e processo para preparar a dita composicao |
| US5259989A (en) * | 1993-03-25 | 1993-11-09 | Xerox Corporation | Electrically conductive elastomer |
| US5478486A (en) * | 1993-11-18 | 1995-12-26 | Henkel Corporation | Composition and method for treating substrates to reduce electrostatic charge and resultant article |
-
1997
- 1997-02-06 US US08/795,873 patent/US5863466A/en not_active Expired - Fee Related
-
1998
- 1998-02-02 WO PCT/US1998/002209 patent/WO1998035359A1/en not_active Ceased
- 1998-02-02 CA CA002280028A patent/CA2280028A1/en not_active Abandoned
- 1998-02-02 JP JP53488398A patent/JP2001512503A/ja active Pending
- 1998-02-02 AU AU66504/98A patent/AU6650498A/en not_active Abandoned
- 1998-02-02 EP EP98908471A patent/EP0963589A4/en not_active Withdrawn
- 1998-02-02 KR KR1019997007115A patent/KR20000070850A/ko not_active Ceased
-
1999
- 1999-08-05 NO NO19993785A patent/NO312038B1/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NO993785L (no) | 1999-10-05 |
| EP0963589A1 (en) | 1999-12-15 |
| KR20000070850A (ko) | 2000-11-25 |
| NO312038B1 (no) | 2002-03-04 |
| AU6650498A (en) | 1998-08-26 |
| WO1998035359A1 (en) | 1998-08-13 |
| EP0963589A4 (en) | 2001-11-14 |
| US5863466A (en) | 1999-01-26 |
| JP2001512503A (ja) | 2001-08-21 |
| NO993785D0 (no) | 1999-08-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5863466A (en) | Electrostatic dissipative composition | |
| WO1998035359A9 (en) | Electrostatic dissipative composition | |
| US5159053A (en) | Polyurethane for use in electrostatic dissipating applications | |
| US5574104A (en) | Chain extended low molecular weight polyoxiranes and electrostatic dissipating blend compositions based thereon | |
| CA2304674A1 (en) | Compositions of interpolymers of alpha-olefin monomers with one or more vinyl or vinylidene aromatic monomers | |
| US4800115A (en) | Agent for imparting antistatic characteristics to a thermoplastic polymer and a thermoplastic polymer composition containing the agent | |
| CA1316281C (en) | Antistatic thermoplastic polyamide-polyether compositions and antistatic polymeric films made therefrom | |
| US6139948A (en) | Coated aliphatic polyester film | |
| AU605513B2 (en) | An agent for imparting antistatic characteristics to a thermoplastic polymer and a thermoplastic polymer composition containing the agent. | |
| US5001015A (en) | Antistatic polyolefin compositions and antistatic polyolefin films made therefrom, including oriented films | |
| US5025922A (en) | Agent for imparting antistatic characteristics to a thermoplastic polymer and a thermoplastic polymer composition containing the agent | |
| US20080248311A1 (en) | Antistatic Polymer Films with Improved Antistatic Properties | |
| JP2573986B2 (ja) | 永久帯電防止樹脂組成物 | |
| US5024792A (en) | Antistatic thermoplastic/polyamide-polyether compositions and antistatic polymeric films made therefrom | |
| US5171641A (en) | Permanent antistatic acid copolymer/quaternary amine polymeric films | |
| US4898771A (en) | Agent for imparting antistatic characteristics to a thermoplastic polymer and a thermoplastic polymer composition containing the agent | |
| MXPA99007302A (es) | Composicion disipadora electrostatica | |
| CA2008537A1 (en) | Permanently antistatic polymeric rigid containers | |
| JPH01310764A (ja) | 静電吹付塗装で使用するための帯電防止導電性マスキングフィルム | |
| AU614571B2 (en) | Permanent antistatic acid copolymer/quaternary amine mixtures and permanent antistatic polymeric films made therefrom | |
| JP2588576B2 (ja) | 帯電防止樹脂組成物 | |
| JPH06508859A (ja) | 帯電防止熱可塑性組成物 | |
| JPS62143956A (ja) | スチレン系樹脂用帯電防止剤 | |
| JPS62197434A (ja) | ポリオレフイン用帯電防止剤 | |
| MXPA01005930A (es) | Copoliesteres con propiedades antiestaticas y alta claridad |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued |