CA2074841A1 - Therapeutic agents - Google Patents
Therapeutic agentsInfo
- Publication number
- CA2074841A1 CA2074841A1 CA002074841A CA2074841A CA2074841A1 CA 2074841 A1 CA2074841 A1 CA 2074841A1 CA 002074841 A CA002074841 A CA 002074841A CA 2074841 A CA2074841 A CA 2074841A CA 2074841 A1 CA2074841 A1 CA 2074841A1
- Authority
- CA
- Canada
- Prior art keywords
- group
- halo
- alkyl
- hydrogen
- represents hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000003814 drug Substances 0.000 title description 3
- 229940124597 therapeutic agent Drugs 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 318
- -1 carboxy, carbamoyl Chemical group 0.000 claims abstract description 213
- 239000001257 hydrogen Substances 0.000 claims abstract description 210
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 210
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 135
- 150000002431 hydrogen Chemical group 0.000 claims abstract description 110
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 90
- 239000005864 Sulphur Chemical group 0.000 claims abstract description 90
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 89
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 89
- 239000001301 oxygen Substances 0.000 claims abstract description 89
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 77
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 76
- 125000004423 acyloxy group Chemical group 0.000 claims abstract description 75
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 66
- 125000003118 aryl group Chemical group 0.000 claims abstract description 65
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract description 58
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 49
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 46
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims abstract description 45
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 44
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 37
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 35
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims abstract description 34
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims abstract description 33
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims abstract description 31
- 125000001589 carboacyl group Chemical group 0.000 claims abstract description 29
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims abstract description 25
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims abstract description 20
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 20
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 15
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims abstract description 14
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims abstract description 14
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 11
- 230000002519 immonomodulatory effect Effects 0.000 claims abstract description 8
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims abstract 13
- 125000005843 halogen group Chemical group 0.000 claims description 113
- 125000000217 alkyl group Chemical group 0.000 claims description 65
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 64
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 62
- 125000005842 heteroatom Chemical group 0.000 claims description 50
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 26
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 25
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 22
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 21
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 18
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 claims description 14
- 125000006376 (C3-C10) cycloalkyl group Chemical group 0.000 claims description 11
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 11
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 9
- 125000002837 carbocyclic group Chemical group 0.000 claims description 9
- 101100114470 Arabidopsis thaliana COR28 gene Proteins 0.000 claims description 6
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims description 5
- 201000010099 disease Diseases 0.000 claims description 5
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 3
- 230000001900 immune effect Effects 0.000 claims description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 3
- 241000124008 Mammalia Species 0.000 claims description 2
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 claims description 2
- 239000002552 dosage form Substances 0.000 claims description 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 1
- 125000006619 (C1-C6) dialkylamino group Chemical group 0.000 claims 1
- KCNKJCHARANTIP-SNAWJCMRSA-N allyl-{4-[3-(4-bromo-phenyl)-benzofuran-6-yloxy]-but-2-enyl}-methyl-amine Chemical compound C=1OC2=CC(OC/C=C/CN(CC=C)C)=CC=C2C=1C1=CC=C(Br)C=C1 KCNKJCHARANTIP-SNAWJCMRSA-N 0.000 claims 1
- 150000001721 carbon Chemical group 0.000 abstract description 6
- 125000001475 halogen functional group Chemical group 0.000 abstract 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 198
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 122
- 239000000203 mixture Substances 0.000 description 120
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 90
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 90
- 239000007787 solid Substances 0.000 description 76
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 63
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 58
- 239000011541 reaction mixture Substances 0.000 description 56
- 238000001914 filtration Methods 0.000 description 53
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 45
- 239000000243 solution Substances 0.000 description 38
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 35
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 32
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 30
- 238000010992 reflux Methods 0.000 description 30
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 28
- 125000003545 alkoxy group Chemical group 0.000 description 28
- 239000008096 xylene Substances 0.000 description 28
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 27
- 239000000047 product Substances 0.000 description 23
- 239000012258 stirred mixture Substances 0.000 description 23
- 238000012360 testing method Methods 0.000 description 23
- 238000002360 preparation method Methods 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 20
- 239000012265 solid product Substances 0.000 description 20
- 125000001424 substituent group Chemical group 0.000 description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- 239000000706 filtrate Substances 0.000 description 18
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 17
- 239000003921 oil Substances 0.000 description 17
- 235000019198 oils Nutrition 0.000 description 17
- 239000011928 denatured alcohol Substances 0.000 description 16
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 16
- 239000000377 silicon dioxide Substances 0.000 description 16
- 239000002904 solvent Substances 0.000 description 16
- 238000010438 heat treatment Methods 0.000 description 15
- MLXDUYUQINCFFV-UHFFFAOYSA-N 2-acetyloxyacetic acid Chemical compound CC(=O)OCC(O)=O MLXDUYUQINCFFV-UHFFFAOYSA-N 0.000 description 14
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 14
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 14
- 238000001816 cooling Methods 0.000 description 14
- 239000002585 base Substances 0.000 description 13
- 125000001153 fluoro group Chemical group F* 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 12
- 238000003818 flash chromatography Methods 0.000 description 12
- 235000011167 hydrochloric acid Nutrition 0.000 description 12
- 229960000443 hydrochloric acid Drugs 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 11
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 11
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 10
- HGINADPHJQTSKN-UHFFFAOYSA-N Monoethyl malonic acid Chemical compound CCOC(=O)CC(O)=O HGINADPHJQTSKN-UHFFFAOYSA-N 0.000 description 9
- 238000005917 acylation reaction Methods 0.000 description 9
- 239000012043 crude product Substances 0.000 description 9
- 239000003208 petroleum Substances 0.000 description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- 230000001225 therapeutic effect Effects 0.000 description 8
- XVSLUESFAZWGHZ-UHFFFAOYSA-N 2-(3-oxo-2H-chromeno[4,3-c]pyrazol-4-yl)acetic acid Chemical compound C1=CC=C2C3=NNC(=O)C3=C(CC(=O)O)OC2=C1 XVSLUESFAZWGHZ-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 7
- 150000001263 acyl chlorides Chemical class 0.000 description 7
- 239000002775 capsule Substances 0.000 description 7
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- RMIODHQZRUFFFF-UHFFFAOYSA-M methoxyacetate Chemical compound COCC([O-])=O RMIODHQZRUFFFF-UHFFFAOYSA-M 0.000 description 7
- 239000012453 solvate Substances 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 7
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 7
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 230000010933 acylation Effects 0.000 description 6
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 6
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 6
- 125000001246 bromo group Chemical group Br* 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 238000006748 scratching Methods 0.000 description 6
- 230000002393 scratching effect Effects 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- FKHIFSZMMVMEQY-UHFFFAOYSA-N talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 6
- SJHPCNCNNSSLPL-CSKARUKUSA-N (4e)-4-(ethoxymethylidene)-2-phenyl-1,3-oxazol-5-one Chemical compound O1C(=O)C(=C/OCC)\N=C1C1=CC=CC=C1 SJHPCNCNNSSLPL-CSKARUKUSA-N 0.000 description 5
- WXUAQHNMJWJLTG-VKHMYHEASA-N (S)-methylsuccinic acid Chemical compound OC(=O)[C@@H](C)CC(O)=O WXUAQHNMJWJLTG-VKHMYHEASA-N 0.000 description 5
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 5
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 5
- 241000699670 Mus sp. Species 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 239000008101 lactose Substances 0.000 description 5
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 5
- 238000007911 parenteral administration Methods 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- XXNOGQJZAOXWAQ-UHFFFAOYSA-N 4-chlorophenylhydrazine Chemical compound NNC1=CC=C(Cl)C=C1 XXNOGQJZAOXWAQ-UHFFFAOYSA-N 0.000 description 4
- KFXXRRQBVLINPH-UHFFFAOYSA-N 4-hydroxy-6-methoxychromen-2-one Chemical compound O1C(=O)C=C(O)C2=CC(OC)=CC=C21 KFXXRRQBVLINPH-UHFFFAOYSA-N 0.000 description 4
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 4
- 239000002841 Lewis acid Substances 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 4
- 239000012346 acetyl chloride Substances 0.000 description 4
- 150000008065 acid anhydrides Chemical class 0.000 description 4
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N coumarin Chemical compound C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 238000010790 dilution Methods 0.000 description 4
- 239000012895 dilution Substances 0.000 description 4
- QMJJQNRABVWAMR-UHFFFAOYSA-N ethyl 2-[2-(4-chlorophenyl)-3-oxochromeno[4,3-c]pyrazol-4-yl]acetate Chemical compound O=C1C2=C(CC(=O)OCC)OC3=CC=CC=C3C2=NN1C1=CC=C(Cl)C=C1 QMJJQNRABVWAMR-UHFFFAOYSA-N 0.000 description 4
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- 150000007517 lewis acids Chemical class 0.000 description 4
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 239000002674 ointment Substances 0.000 description 4
- 230000000699 topical effect Effects 0.000 description 4
- 239000003981 vehicle Substances 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- DCSQXFAJSPSNQL-UHFFFAOYSA-N 2-(4-chlorophenyl)-5-(2-hydroxyphenyl)-4H-pyrazol-3-one Chemical compound ClC1=CC=C(C=C1)N1N=C(CC1=O)C1=C(C=CC=C1)O DCSQXFAJSPSNQL-UHFFFAOYSA-N 0.000 description 3
- RGBWBQGHVUTCLG-UHFFFAOYSA-N 2-(5-chloropyridin-2-yl)-5-(2-hydroxyphenyl)-4H-pyrazol-3-one Chemical compound ClC=1C=CC(=NC1)N1N=C(CC1=O)C1=C(C=CC=C1)O RGBWBQGHVUTCLG-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- CPLLPKSEDBEEGT-UHFFFAOYSA-N 3-[(4-methoxyphenyl)methoxy]-3-oxopropanoic acid Chemical compound COC1=CC=C(COC(=O)CC(O)=O)C=C1 CPLLPKSEDBEEGT-UHFFFAOYSA-N 0.000 description 3
- ZRPZPNYZFSJUPA-UHFFFAOYSA-N ARS-1620 Chemical compound Oc1cccc(F)c1-c1c(Cl)cc2c(ncnc2c1F)N1CCN(CC1)C(=O)C=C ZRPZPNYZFSJUPA-UHFFFAOYSA-N 0.000 description 3
- 238000011725 BALB/c mouse Methods 0.000 description 3
- 101100057159 Caenorhabditis elegans atg-13 gene Proteins 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- DBNLGTYGKCMLLR-UHFFFAOYSA-N [4-(trifluoromethyl)phenyl]hydrazine Chemical compound NNC1=CC=C(C(F)(F)F)C=C1 DBNLGTYGKCMLLR-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 125000004414 alkyl thio group Chemical group 0.000 description 3
- 125000004104 aryloxy group Chemical group 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- UKFXDFUAPNAMPJ-UHFFFAOYSA-N ethylmalonic acid Chemical compound CCC(C(O)=O)C(O)=O UKFXDFUAPNAMPJ-UHFFFAOYSA-N 0.000 description 3
- 239000007903 gelatin capsule Substances 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 3
- 239000002808 molecular sieve Substances 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- 235000019271 petrolatum Nutrition 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 210000002966 serum Anatomy 0.000 description 3
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- 125000001544 thienyl group Chemical group 0.000 description 3
- 238000011200 topical administration Methods 0.000 description 3
- 238000001665 trituration Methods 0.000 description 3
- HZDNNJABYXNPPV-UHFFFAOYSA-N (2-chloro-2-oxoethyl) acetate Chemical compound CC(=O)OCC(Cl)=O HZDNNJABYXNPPV-UHFFFAOYSA-N 0.000 description 2
- YMJSQPNVQRHZDW-UHFFFAOYSA-N (3,4-dichlorophenyl)hydrazine Chemical compound NNC1=CC=C(Cl)C(Cl)=C1 YMJSQPNVQRHZDW-UHFFFAOYSA-N 0.000 description 2
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 2
- HGTBAIVLETUVCG-UHFFFAOYSA-M (methylthio)acetate Chemical compound CSCC([O-])=O HGTBAIVLETUVCG-UHFFFAOYSA-M 0.000 description 2
- NDQXKKFRNOPRDW-UHFFFAOYSA-N 1,1,1-triethoxyethane Chemical compound CCOC(C)(OCC)OCC NDQXKKFRNOPRDW-UHFFFAOYSA-N 0.000 description 2
- YAXQOLYGKLGQKA-UHFFFAOYSA-N 1-morpholin-4-ylpropan-2-ol Chemical compound CC(O)CN1CCOCC1 YAXQOLYGKLGQKA-UHFFFAOYSA-N 0.000 description 2
- PXWJTOHJADWQQO-UHFFFAOYSA-N 2-(1h-pyrazol-4-yl)acetic acid Chemical compound OC(=O)CC=1C=NNC=1 PXWJTOHJADWQQO-UHFFFAOYSA-N 0.000 description 2
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 2
- SMNDYUVBFMFKNZ-UHFFFAOYSA-M 2-furoate Chemical compound [O-]C(=O)C1=CC=CO1 SMNDYUVBFMFKNZ-UHFFFAOYSA-M 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- QJYGLIBXIXQRHZ-UHFFFAOYSA-N 2-thiomorpholin-4-ylethanol Chemical compound OCCN1CCSCC1 QJYGLIBXIXQRHZ-UHFFFAOYSA-N 0.000 description 2
- DZEVUMSAIVIXGZ-UHFFFAOYSA-N 2h-chromeno[4,3-c]pyrazol-3-one Chemical compound C1=CC=C2C3=NNC(=O)C3=COC2=C1 DZEVUMSAIVIXGZ-UHFFFAOYSA-N 0.000 description 2
- CAOMCZAIALVUPA-UHFFFAOYSA-N 3-(methylthio)propionic acid Chemical compound CSCCC(O)=O CAOMCZAIALVUPA-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- VKRFUGHXKNNIJO-UHFFFAOYSA-N 4,4,4-trifluorobutan-1-ol Chemical compound OCCCC(F)(F)F VKRFUGHXKNNIJO-UHFFFAOYSA-N 0.000 description 2
- MSHFRERJPWKJFX-UHFFFAOYSA-N 4-Methoxybenzyl alcohol Chemical compound COC1=CC=C(CO)C=C1 MSHFRERJPWKJFX-UHFFFAOYSA-N 0.000 description 2
- VXIXUWQIVKSKSA-UHFFFAOYSA-N 4-hydroxycoumarin Chemical compound C1=CC=CC2=C1OC(=O)C=C2O VXIXUWQIVKSKSA-UHFFFAOYSA-N 0.000 description 2
- ZEYHEAKUIGZSGI-UHFFFAOYSA-N 4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1 ZEYHEAKUIGZSGI-UHFFFAOYSA-N 0.000 description 2
- 229910015845 BBr3 Inorganic materials 0.000 description 2
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 2
- DXXWKVZSDNBXMK-UHFFFAOYSA-N ClC1=CC=C(C=C1)N1N=C2C(C1=O)=C(OC1=C2C(=CC=C1)O)C Chemical compound ClC1=CC=C(C=C1)N1N=C2C(C1=O)=C(OC1=C2C(=CC=C1)O)C DXXWKVZSDNBXMK-UHFFFAOYSA-N 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- 206010012434 Dermatitis allergic Diseases 0.000 description 2
- 238000002965 ELISA Methods 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 235000019759 Maize starch Nutrition 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- FFDGPVCHZBVARC-UHFFFAOYSA-N N,N-dimethylglycine Chemical compound CN(C)CC(O)=O FFDGPVCHZBVARC-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- 239000004264 Petrolatum Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 2
- OATSQCXMYKYFQO-UHFFFAOYSA-N S-methyl thioacetate Chemical compound CSC(C)=O OATSQCXMYKYFQO-UHFFFAOYSA-N 0.000 description 2
- 206010070834 Sensitisation Diseases 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 229960001413 acetanilide Drugs 0.000 description 2
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 2
- 150000001266 acyl halides Chemical class 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 2
- ZHEAXGGEDWGTDP-UHFFFAOYSA-N chromeno[4,3-c]pyrazole Chemical compound C1=CC=C2C3=NN=CC3=COC2=C1 ZHEAXGGEDWGTDP-UHFFFAOYSA-N 0.000 description 2
- 208000010247 contact dermatitis Diseases 0.000 description 2
- 235000001671 coumarin Nutrition 0.000 description 2
- 229960000956 coumarin Drugs 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000006639 cyclohexyl carbonyl group Chemical group 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000006255 cyclopropyl carbonyl group Chemical group [H]C1([H])C([H])([H])C1([H])C(*)=O 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 239000002702 enteric coating Substances 0.000 description 2
- 238000009505 enteric coating Methods 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 2
- 238000001030 gas--liquid chromatography Methods 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 125000005456 glyceride group Chemical group 0.000 description 2
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 2
- 229960003444 immunosuppressant agent Drugs 0.000 description 2
- 239000003018 immunosuppressive agent Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 2
- 238000004811 liquid chromatography Methods 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-M malonate(1-) Chemical compound OC(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-M 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- GXHFUVWIGNLZSC-UHFFFAOYSA-N meldrum's acid Chemical compound CC1(C)OC(=O)CC(=O)O1 GXHFUVWIGNLZSC-UHFFFAOYSA-N 0.000 description 2
- VRCPZWZKCGDUJC-UHFFFAOYSA-N methyl 4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1C(=O)OC(C)(C)OC1=O VRCPZWZKCGDUJC-UHFFFAOYSA-N 0.000 description 2
- FRKMJCNOIFDRQH-UHFFFAOYSA-N methyl propanimidothioate;hydrochloride Chemical compound Cl.CCC(=N)SC FRKMJCNOIFDRQH-UHFFFAOYSA-N 0.000 description 2
- ZIYVHBGGAOATLY-UHFFFAOYSA-N methylmalonic acid Chemical compound OC(=O)C(C)C(O)=O ZIYVHBGGAOATLY-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 235000001968 nicotinic acid Nutrition 0.000 description 2
- 239000011664 nicotinic acid Substances 0.000 description 2
- 235000008390 olive oil Nutrition 0.000 description 2
- 239000004006 olive oil Substances 0.000 description 2
- 150000002905 orthoesters Chemical class 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 2
- 229940066842 petrolatum Drugs 0.000 description 2
- 229940049953 phenylacetate Drugs 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- WZMQPAZKSIWCFT-UHFFFAOYSA-N propan-2-yl 3-imino-3-methoxypropanoate;hydrochloride Chemical compound Cl.COC(=N)CC(=O)OC(C)C WZMQPAZKSIWCFT-UHFFFAOYSA-N 0.000 description 2
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- HXXJMMLIEYAFOZ-UHFFFAOYSA-N (1-methylpiperidin-2-yl)methanol Chemical compound CN1CCCCC1CO HXXJMMLIEYAFOZ-UHFFFAOYSA-N 0.000 description 1
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical class OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- NRESDXFFSNBDGP-UHFFFAOYSA-N (4-bromophenyl)hydrazine Chemical compound NNC1=CC=C(Br)C=C1 NRESDXFFSNBDGP-UHFFFAOYSA-N 0.000 description 1
- 125000006555 (C3-C5) cycloalkyl group Chemical group 0.000 description 1
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 description 1
- 125000006636 (C3-C8) cycloalkylcarbonyl group Chemical group 0.000 description 1
- 125000006569 (C5-C6) heterocyclic group Chemical group 0.000 description 1
- XJDDLMJULQGRLU-UHFFFAOYSA-N 1,3-dioxane-4,6-dione Chemical compound O=C1CC(=O)OCO1 XJDDLMJULQGRLU-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- KOFFXZYMDLWRHX-UHFFFAOYSA-N 1-(5-fluoro-2-hydroxyphenyl)ethanone Chemical compound CC(=O)C1=CC(F)=CC=C1O KOFFXZYMDLWRHX-UHFFFAOYSA-N 0.000 description 1
- SUVAHLHIDSEJDQ-UHFFFAOYSA-N 1-morpholin-4-ylpropan-2-yl 2-[2-(4-chlorophenyl)-3-oxochromeno[4,3-c]pyrazol-4-yl]acetate Chemical compound O1C2=CC=CC=C2C2=NN(C=3C=CC(Cl)=CC=3)C(=O)C2=C1CC(=O)OC(C)CN1CCOCC1 SUVAHLHIDSEJDQ-UHFFFAOYSA-N 0.000 description 1
- YVPPZBPMOIKZOH-UHFFFAOYSA-N 1-o-methyl 4-o-(3-oxo-2h-chromeno[4,3-c]pyrazol-8-yl) butanedioate Chemical compound O1C=C2C(=O)NN=C2C2=CC(OC(=O)CCC(=O)OC)=CC=C21 YVPPZBPMOIKZOH-UHFFFAOYSA-N 0.000 description 1
- BADWEEUZTAADOJ-UHFFFAOYSA-N 2,2-dimethyl-5-(2-phenoxyacetyl)-1,3-dioxane-4,6-dione Chemical compound O=C1OC(C)(C)OC(=O)C1C(=O)COC1=CC=CC=C1 BADWEEUZTAADOJ-UHFFFAOYSA-N 0.000 description 1
- MRJUHUHQRULQCR-UHFFFAOYSA-N 2,2-dimethyl-5-(2-phenylacetyl)-1,3-dioxane-4,6-dione Chemical compound O=C1OC(C)(C)OC(=O)C1C(=O)CC1=CC=CC=C1 MRJUHUHQRULQCR-UHFFFAOYSA-N 0.000 description 1
- WELBFLPJHJXABJ-UHFFFAOYSA-N 2,3,3a,4-tetrahydrothiochromeno[4,3-c]pyrazol-8-yl 3-methylbenzoate Chemical compound CC=1C=C(C(=O)OC=2C=CC3=C(C2)C2=NNCC2CS3)C=CC1 WELBFLPJHJXABJ-UHFFFAOYSA-N 0.000 description 1
- XNIUQGDIIJNXGX-UHFFFAOYSA-N 2,3,3a,4-tetrahydrothiochromeno[4,3-c]pyrazol-8-yl pyridine-3-carboxylate Chemical compound C(C1=CN=CC=C1)(=O)OC=1C=CC2=C(C1)C1=NNCC1CS2 XNIUQGDIIJNXGX-UHFFFAOYSA-N 0.000 description 1
- XXJSVZNRUMTFCA-UHFFFAOYSA-N 2,3,3a,4-tetrahydrothiochromeno[4,3-c]pyrazol-8-yl thiophene-2-carboxylate Chemical compound C1(=CC=CS1)C(=O)OC=1C=CC2=C(C1)C1=NNCC1CS2 XXJSVZNRUMTFCA-UHFFFAOYSA-N 0.000 description 1
- YMDJIMKLAMELOC-UHFFFAOYSA-N 2,3-dihydrochromeno[4,3-c]pyrazol-8-yl 3-methylbenzoate Chemical compound CC=1C=C(C(=O)OC=2C=CC3=C(C2)C2=NNCC2=CO3)C=CC1 YMDJIMKLAMELOC-UHFFFAOYSA-N 0.000 description 1
- AQBKJOLWHWTYPP-UHFFFAOYSA-N 2,3-dihydrochromeno[4,3-c]pyrazol-8-yl 4-methylbenzoate Chemical compound CC1=CC=C(C(=O)OC=2C=CC3=C(C2)C2=NNCC2=CO3)C=C1 AQBKJOLWHWTYPP-UHFFFAOYSA-N 0.000 description 1
- MKJJSDYVCUAJQB-UHFFFAOYSA-N 2,3-dihydrochromeno[4,3-c]pyrazol-8-yl cyclohexanecarboxylate Chemical compound C1(CCCCC1)C(=O)OC=1C=CC2=C(C1)C1=NNCC1=CO2 MKJJSDYVCUAJQB-UHFFFAOYSA-N 0.000 description 1
- MFMGVFQASKQOTB-UHFFFAOYSA-N 2-(2-acetyloxy-3-oxochromeno[4,3-c]pyrazol-4-yl)acetic acid Chemical compound CC(=O)ON1C(=O)C2=C(OC3=CC=CC=C3C2=N1)CC(=O)O MFMGVFQASKQOTB-UHFFFAOYSA-N 0.000 description 1
- YAFPLXNRKPTRJV-UHFFFAOYSA-N 2-(3-oxo-2H-chromeno[4,3-c]pyrazol-4-yl)-N-phenylacetamide Chemical compound O=C1C=2C(=NN1)C1=C(OC2CC(=O)NC2=CC=CC=C2)C=CC=C1 YAFPLXNRKPTRJV-UHFFFAOYSA-N 0.000 description 1
- ZPUSCFFLMJBJNO-UHFFFAOYSA-N 2-(3-oxo-2H-chromeno[4,3-c]pyrazol-4-yl)acetamide Chemical compound O=C1C=2C(=NN1)C1=C(OC2CC(=O)N)C=CC=C1 ZPUSCFFLMJBJNO-UHFFFAOYSA-N 0.000 description 1
- XXHCYSLJHSDJMP-UHFFFAOYSA-N 2-(4-bromophenyl)-5-(2-hydroxy-5-methoxyphenyl)-4H-pyrazol-3-one Chemical compound BrC1=CC=C(C=C1)N1N=C(CC1=O)C1=C(C=CC(=C1)OC)O XXHCYSLJHSDJMP-UHFFFAOYSA-N 0.000 description 1
- KQXWARNSGFTTHT-UHFFFAOYSA-N 2-(4-chlorophenyl)-5-(2,5-dihydroxyphenyl)-4H-pyrazol-3-one Chemical compound ClC1=CC=C(C=C1)N1N=C(CC1=O)C1=C(C=CC(=C1)O)O KQXWARNSGFTTHT-UHFFFAOYSA-N 0.000 description 1
- SSEKRNWNSQNZBW-UHFFFAOYSA-N 2-(4-chlorophenyl)-5-(2,6-dihydroxyphenyl)-4H-pyrazol-3-one Chemical compound ClC1=CC=C(C=C1)N1N=C(CC1=O)C1=C(C=CC=C1O)O SSEKRNWNSQNZBW-UHFFFAOYSA-N 0.000 description 1
- QEKAVWMNOOBTEK-UHFFFAOYSA-N 2-(4-chlorophenyl)-5-(2-hydroxy-5-methoxyphenyl)-4H-pyrazol-3-one Chemical compound ClC1=CC=C(C=C1)N1N=C(CC1=O)C1=C(C=CC(=C1)OC)O QEKAVWMNOOBTEK-UHFFFAOYSA-N 0.000 description 1
- RJPYFADSMJAAGK-UHFFFAOYSA-N 2-(4-chlorophenyl)-5-(2-hydroxy-5-methylphenyl)-4H-pyrazol-3-one Chemical compound ClC1=CC=C(C=C1)N1N=C(CC1=O)C1=C(C=CC(=C1)C)O RJPYFADSMJAAGK-UHFFFAOYSA-N 0.000 description 1
- BGCFMMGBLBWXIH-UHFFFAOYSA-N 2-(4-chlorophenyl)-5-(2-hydroxy-6-methoxyphenyl)-4H-pyrazol-3-one Chemical compound ClC1=CC=C(C=C1)N1N=C(CC1=O)C1=C(C=CC=C1OC)O BGCFMMGBLBWXIH-UHFFFAOYSA-N 0.000 description 1
- DIBSXIBNOUUYQT-UHFFFAOYSA-N 2-(4-chlorophenyl)-5-(5-fluoro-2-hydroxyphenyl)-4H-pyrazol-3-one Chemical compound ClC1=CC=C(C=C1)N1N=C(CC1=O)C1=C(C=CC(=C1)F)O DIBSXIBNOUUYQT-UHFFFAOYSA-N 0.000 description 1
- KXGSDANVMUAMPV-UHFFFAOYSA-N 2-(4-chlorophenyl)-9-methoxy-4-methylchromeno[4,3-c]pyrazol-3-one Chemical compound C1=2C(OC)=CC=CC=2OC(C)=C(C2=O)C1=NN2C1=CC=C(Cl)C=C1 KXGSDANVMUAMPV-UHFFFAOYSA-N 0.000 description 1
- CMPCOFOXHDRPSM-UHFFFAOYSA-N 2-(4-chlorophenyl)chromeno[4,3-c]pyrazol-3-one Chemical compound C1=CC(Cl)=CC=C1N1C(=O)C2=COC3=CC=CC=C3C2=N1 CMPCOFOXHDRPSM-UHFFFAOYSA-N 0.000 description 1
- CGRXKHCZNFGCHG-UHFFFAOYSA-N 2-(4-chloropyridin-2-yl)-5-(2-hydroxyphenyl)-4H-pyrazol-3-one Chemical compound ClC1=CC(=NC=C1)N1N=C(CC1=O)C1=C(C=CC=C1)O CGRXKHCZNFGCHG-UHFFFAOYSA-N 0.000 description 1
- GJBGTHNJTNLHRR-UHFFFAOYSA-N 2-(4-fluorophenyl)-5-(2-hydroxyphenyl)-4H-pyrazol-3-one Chemical compound FC1=CC=C(C=C1)N1N=C(CC1=O)C1=C(C=CC=C1)O GJBGTHNJTNLHRR-UHFFFAOYSA-N 0.000 description 1
- KQZRASYLQZGXDV-UHFFFAOYSA-N 2-(5-chloropyridin-2-yl)-5-(2,6-dihydroxyphenyl)-4H-pyrazol-3-one Chemical compound ClC=1C=CC(=NC1)N1N=C(CC1=O)C1=C(C=CC=C1O)O KQZRASYLQZGXDV-UHFFFAOYSA-N 0.000 description 1
- KLQQLTPQYFAFNF-UHFFFAOYSA-N 2-(6-chloropyridin-2-yl)-5-(2-hydroxyphenyl)-4H-pyrazol-3-one Chemical compound ClC1=CC=CC(=N1)N1N=C(CC1=O)C1=C(C=CC=C1)O KLQQLTPQYFAFNF-UHFFFAOYSA-N 0.000 description 1
- KZTWONRVIPPDKH-UHFFFAOYSA-N 2-(piperidin-1-yl)ethanol Chemical compound OCCN1CCCCC1 KZTWONRVIPPDKH-UHFFFAOYSA-N 0.000 description 1
- RNDNSYIPLPAXAZ-UHFFFAOYSA-N 2-Phenyl-1-propanol Chemical compound OCC(C)C1=CC=CC=C1 RNDNSYIPLPAXAZ-UHFFFAOYSA-N 0.000 description 1
- HPHRSZJISGMNLT-UHFFFAOYSA-N 2-[2-(2-phenylethyl)-3H-chromeno[4,3-c]pyrazol-4-yl]acetamide Chemical compound C1(=CC=CC=C1)CCN1N=C2C(C1)=C(OC1=C2C=CC=C1)CC(=O)N HPHRSZJISGMNLT-UHFFFAOYSA-N 0.000 description 1
- NXWNDHJYMJUJKO-UHFFFAOYSA-N 2-[2-(5-chloropyridin-2-yl)-3-oxochromeno[4,3-c]pyrazol-4-yl]acetic acid Chemical compound C1=CC=C2C(=C1)C3=NN(C(=O)C3=C(O2)CC(=O)O)C4=NC=C(C=C4)Cl NXWNDHJYMJUJKO-UHFFFAOYSA-N 0.000 description 1
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- FXUPAFJNVOJWIN-UHFFFAOYSA-N 2-chromeno[4,3-c]pyrazol-4-ylacetic acid Chemical compound C1=CC=C2C3=NN=CC3=C(CC(=O)O)OC2=C1 FXUPAFJNVOJWIN-UHFFFAOYSA-N 0.000 description 1
- QJQZRLXDLORINA-UHFFFAOYSA-N 2-cyclohexylethanol Chemical compound OCCC1CCCCC1 QJQZRLXDLORINA-UHFFFAOYSA-N 0.000 description 1
- JWGMNUAJXWNFNS-UHFFFAOYSA-N 2-cyclohexylethyl 2-[2-(4-chlorophenyl)-3-oxochromeno[4,3-c]pyrazol-4-yl]acetate Chemical compound C1=CC(Cl)=CC=C1N(N=C1C2=CC=CC=C2O2)C(=O)C1=C2CC(=O)OCCC1CCCCC1 JWGMNUAJXWNFNS-UHFFFAOYSA-N 0.000 description 1
- IPOVOSHRRIJKBR-UHFFFAOYSA-N 2-ethylpropanedioyl dichloride Chemical compound CCC(C(Cl)=O)C(Cl)=O IPOVOSHRRIJKBR-UHFFFAOYSA-N 0.000 description 1
- HXDLWJWIAHWIKI-UHFFFAOYSA-N 2-hydroxyethyl acetate Chemical compound CC(=O)OCCO HXDLWJWIAHWIKI-UHFFFAOYSA-N 0.000 description 1
- 125000002927 2-methoxybenzyl group Chemical group [H]C1=C([H])C([H])=C(C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 1
- 125000006179 2-methyl benzyl group Chemical group [H]C1=C([H])C(=C(C([H])=C1[H])C([H])([H])*)C([H])([H])[H] 0.000 description 1
- XWGXLRRTBBCVMC-UHFFFAOYSA-N 2-methylbutanedioyl dichloride Chemical compound ClC(=O)C(C)CC(Cl)=O XWGXLRRTBBCVMC-UHFFFAOYSA-N 0.000 description 1
- XPZSABLJARBJII-UHFFFAOYSA-N 2-methylchromeno[4,3-c]pyrazol-3-one Chemical compound C1=CC=C2C3=NN(C)C(=O)C3=COC2=C1 XPZSABLJARBJII-UHFFFAOYSA-N 0.000 description 1
- IEEHKTFVUIVORU-UHFFFAOYSA-N 2-methylpropanedioyl dichloride Chemical compound ClC(=O)C(C)C(Cl)=O IEEHKTFVUIVORU-UHFFFAOYSA-N 0.000 description 1
- ZRIGDBVSVFSVLL-UHFFFAOYSA-N 2-methylsulfanylacetonitrile Chemical compound CSCC#N ZRIGDBVSVFSVLL-UHFFFAOYSA-N 0.000 description 1
- WBBPRCNXBQTYLF-UHFFFAOYSA-N 2-methylthioethanol Chemical compound CSCCO WBBPRCNXBQTYLF-UHFFFAOYSA-N 0.000 description 1
- QEOSQGOYIHCTDJ-UHFFFAOYSA-N 2-morpholin-4-ylethyl 2-[2-(4-chlorophenyl)-3-oxo-1,4-dihydrochromeno[4,3-c]pyrazol-4-yl]acetate Chemical compound C1=CC(Cl)=CC=C1N1C(=O)C(C(CC(=O)OCCN2CCOCC2)OC=2C3=CC=CC=2)=C3N1 QEOSQGOYIHCTDJ-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- JTQJXVWIOFPGCD-UHFFFAOYSA-N 2-piperidin-1-ylethyl 2-[2-(4-chlorophenyl)-3-oxochromeno[4,3-c]pyrazol-4-yl]acetate;hydrochloride Chemical compound Cl.C1=CC(Cl)=CC=C1N(N=C1C2=CC=CC=C2O2)C(=O)C1=C2CC(=O)OCCN1CCCCC1 JTQJXVWIOFPGCD-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- ADOREHXDLCEYIE-UHFFFAOYSA-N 2-sulfanylchromen-4-one Chemical compound C1=CC=C2OC(S)=CC(=O)C2=C1 ADOREHXDLCEYIE-UHFFFAOYSA-N 0.000 description 1
- DXJBVGZYZUFBAQ-UHFFFAOYSA-N 2-thiomorpholin-4-ylethyl 2-[2-(4-chlorophenyl)-3-oxochromeno[4,3-c]pyrazol-4-yl]acetate;hydrochloride Chemical compound Cl.C1=CC(Cl)=CC=C1N(N=C1C2=CC=CC=C2O2)C(=O)C1=C2CC(=O)OCCN1CCSCC1 DXJBVGZYZUFBAQ-UHFFFAOYSA-N 0.000 description 1
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- WSGYTJNNHPZFKR-UHFFFAOYSA-N 3-hydroxypropanenitrile Chemical compound OCCC#N WSGYTJNNHPZFKR-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- SEBSEYVENOPPEQ-UHFFFAOYSA-N 3-hydroxypropyl 2-[2-(4-chlorophenyl)-3-oxochromeno[4,3-c]pyrazol-4-yl]acetate Chemical compound O=C1C2=C(CC(=O)OCCCO)OC3=CC=CC=C3C2=NN1C1=CC=C(Cl)C=C1 SEBSEYVENOPPEQ-UHFFFAOYSA-N 0.000 description 1
- 125000006497 3-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 1
- 125000006180 3-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C([H])([H])* 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-M 3-phenylpropionate Chemical compound [O-]C(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-M 0.000 description 1
- LXMSVTJNSQLXGX-UHFFFAOYSA-N 4-(diethylaminomethyl)benzoic acid Chemical compound CCN(CC)CC1=CC=C(C(O)=O)C=C1 LXMSVTJNSQLXGX-UHFFFAOYSA-N 0.000 description 1
- FDBKKXLMBSUUKA-UHFFFAOYSA-N 4-(ethoxymethylidene)-2-phenyl-1,3-oxazole Chemical compound CCOC=C1COC(C=2C=CC=CC=2)=N1 FDBKKXLMBSUUKA-UHFFFAOYSA-N 0.000 description 1
- QYBXZYYECZFQRX-UHFFFAOYSA-N 4-(morpholin-4-ylmethyl)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1CN1CCOCC1 QYBXZYYECZFQRX-UHFFFAOYSA-N 0.000 description 1
- JDEFVRRMTIKXED-UHFFFAOYSA-N 4-[(4-methylpiperazin-1-yl)methyl]benzoic acid hydrate hydrochloride Chemical compound O.Cl.CN1CCN(CC1)CC1=CC=C(C(=O)O)C=C1 JDEFVRRMTIKXED-UHFFFAOYSA-N 0.000 description 1
- URRVGAPGOLMRGZ-UHFFFAOYSA-N 4-[2-(4-chlorophenyl)hydrazinyl]-5-methoxychromen-2-one Chemical compound C1=2C(OC)=CC=CC=2OC(=O)C=C1NNC1=CC=C(Cl)C=C1 URRVGAPGOLMRGZ-UHFFFAOYSA-N 0.000 description 1
- XRHGYUZYPHTUJZ-UHFFFAOYSA-M 4-chlorobenzoate Chemical compound [O-]C(=O)C1=CC=C(Cl)C=C1 XRHGYUZYPHTUJZ-UHFFFAOYSA-M 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- LFFCJEOKCYTBDD-UHFFFAOYSA-N 4-hydroxy-5-methoxychromen-2-one Chemical compound O1C(=O)C=C(O)C2=C1C=CC=C2OC LFFCJEOKCYTBDD-UHFFFAOYSA-N 0.000 description 1
- NIFAOMSJMGEFTQ-UHFFFAOYSA-N 4-methoxybenzenethiol Chemical compound COC1=CC=C(S)C=C1 NIFAOMSJMGEFTQ-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- ZRUHXJSGOJDYAJ-UHFFFAOYSA-N 4-methyl-2H-chromeno[4,3-c]pyrazol-3-one Chemical compound CC=1OC2=C(C=CC=C2)C2=NNC(C21)=O ZRUHXJSGOJDYAJ-UHFFFAOYSA-N 0.000 description 1
- RCNJPJCOQDTSMZ-UHFFFAOYSA-N 5-(2-cyclopentyl-1-hydroxyethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione Chemical compound O=C1OC(C)(C)OC(=O)C1=C(O)CC1CCCC1 RCNJPJCOQDTSMZ-UHFFFAOYSA-N 0.000 description 1
- NDPGWSOPTXAJGJ-UHFFFAOYSA-N 5-(2-hydroxy-5-methoxyphenyl)-2-[2-(trifluoromethyl)phenyl]-4H-pyrazol-3-one Chemical compound OC1=C(C=C(C=C1)OC)C1=NN(C(C1)=O)C1=C(C=CC=C1)C(F)(F)F NDPGWSOPTXAJGJ-UHFFFAOYSA-N 0.000 description 1
- HXJQHTATOWJNFF-UHFFFAOYSA-N 5-(2-hydroxyphenyl)-2-(4-methoxyphenyl)-4H-pyrazol-3-one Chemical compound OC1=C(C=CC=C1)C1=NN(C(C1)=O)C1=CC=C(C=C1)OC HXJQHTATOWJNFF-UHFFFAOYSA-N 0.000 description 1
- YRBHSKJCZCDKER-UHFFFAOYSA-N 5-(2-hydroxyphenyl)-2-[4-(trifluoromethyl)phenyl]-4H-pyrazol-3-one Chemical compound OC1=C(C=CC=C1)C1=NN(C(C1)=O)C1=CC=C(C=C1)C(F)(F)F YRBHSKJCZCDKER-UHFFFAOYSA-N 0.000 description 1
- VOQRGRNAIWYRTD-UHFFFAOYSA-N 5-(5-fluoro-2-hydroxyphenyl)-2-[5-(trifluoromethyl)pyridin-2-yl]-4H-pyrazol-3-one Chemical compound FC=1C=CC(=C(C1)C1=NN(C(C1)=O)C1=NC=C(C=C1)C(F)(F)F)O VOQRGRNAIWYRTD-UHFFFAOYSA-N 0.000 description 1
- KSKQQHZTXONWPD-UHFFFAOYSA-N 5-(cyclohexanecarbonyl)-2,2-dimethyl-1,3-dioxane-4,6-dione Chemical compound O=C1OC(C)(C)OC(=O)C1C(=O)C1CCCCC1 KSKQQHZTXONWPD-UHFFFAOYSA-N 0.000 description 1
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 1
- DSNSFTRQBVTEQV-UHFFFAOYSA-N 5-[2-(4-chlorophenoxy)acetyl]-2,2-dimethyl-1,3-dioxane-4,6-dione Chemical compound O=C1OC(C)(C)OC(=O)C1C(=O)COC1=CC=C(Cl)C=C1 DSNSFTRQBVTEQV-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- JCOYNGQUPPGRNB-UHFFFAOYSA-N 6-fluoro-4-hydroxychromen-2-one Chemical compound C1=CC(F)=CC2=C1OC(=O)C=C2O JCOYNGQUPPGRNB-UHFFFAOYSA-N 0.000 description 1
- ZOTKXOURMMKHFC-UHFFFAOYSA-N 6-methoxy-2,3-dihydrothiochromen-4-one Chemical compound S1CCC(=O)C2=CC(OC)=CC=C21 ZOTKXOURMMKHFC-UHFFFAOYSA-N 0.000 description 1
- FJNCXZZQNBKEJT-UHFFFAOYSA-N 8beta-hydroxymarrubiin Natural products O1C(=O)C2(C)CCCC3(C)C2C1CC(C)(O)C3(O)CCC=1C=COC=1 FJNCXZZQNBKEJT-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-M Aminoacetate Chemical compound NCC([O-])=O DHMQDGOQFOQNFH-UHFFFAOYSA-M 0.000 description 1
- 235000003911 Arachis Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- YXYZEGVQYIYUNF-UHFFFAOYSA-N C(C)(=O)OCC(=O)O.O.C(C)(=O)OCC(=O)O Chemical compound C(C)(=O)OCC(=O)O.O.C(C)(=O)OCC(=O)O YXYZEGVQYIYUNF-UHFFFAOYSA-N 0.000 description 1
- FWIRPGUBOOOFMS-UHFFFAOYSA-N C12=CC=CC=C2OC(CC(=O)O)=C2C1=NNC2 Chemical compound C12=CC=CC=C2OC(CC(=O)O)=C2C1=NNC2 FWIRPGUBOOOFMS-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 206010012442 Dermatitis contact Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 1
- DKMROQRQHGEIOW-UHFFFAOYSA-N Diethyl succinate Chemical compound CCOC(=O)CCC(=O)OCC DKMROQRQHGEIOW-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 238000001061 Dunnett's test Methods 0.000 description 1
- 206010014025 Ear swelling Diseases 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- QXKHYNVANLEOEG-UHFFFAOYSA-N Methoxsalen Chemical group C1=CC(=O)OC2=C1C=C1C=COC1=C2OC QXKHYNVANLEOEG-UHFFFAOYSA-N 0.000 description 1
- LOMVENUNSWAXEN-UHFFFAOYSA-N Methyl oxalate Chemical compound COC(=O)C(=O)OC LOMVENUNSWAXEN-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- QGUPSBNMWQEGLN-UHFFFAOYSA-N O-methyl 6-methoxy-4-oxo-2,3-dihydrochromene-3-carbothioate Chemical compound COC=1C=C2C(C(COC2=CC1)C(=S)OC)=O QGUPSBNMWQEGLN-UHFFFAOYSA-N 0.000 description 1
- ILUJQPXNXACGAN-UHFFFAOYSA-M O-methylsalicylate Chemical compound COC1=CC=CC=C1C([O-])=O ILUJQPXNXACGAN-UHFFFAOYSA-M 0.000 description 1
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- 230000001594 aberrant effect Effects 0.000 description 1
- GPWHDDKQSYOYBF-UHFFFAOYSA-N ac1l2u0q Chemical compound Br[Br-]Br GPWHDDKQSYOYBF-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 125000001539 acetonyl group Chemical group [H]C([H])([H])C(=O)C([H])([H])* 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 239000012042 active reagent Substances 0.000 description 1
- 125000003302 alkenyloxy group Chemical group 0.000 description 1
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000005199 aryl carbonyloxy group Chemical group 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 1
- 238000005574 benzylation reaction Methods 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-N beta-phenylpropanoic acid Natural products OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 229960001631 carbomer Drugs 0.000 description 1
- 125000005518 carboxamido group Chemical group 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 1
- 229940005991 chloric acid Drugs 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 238000001944 continuous distillation Methods 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- TXWOGHSRPAYOML-UHFFFAOYSA-M cyclobutanecarboxylate Chemical compound [O-]C(=O)C1CCC1 TXWOGHSRPAYOML-UHFFFAOYSA-M 0.000 description 1
- 125000006637 cyclobutyl carbonyl group Chemical group 0.000 description 1
- WPOPOPFNZYPKAV-UHFFFAOYSA-N cyclobutylmethanol Chemical compound OCC1CCC1 WPOPOPFNZYPKAV-UHFFFAOYSA-N 0.000 description 1
- JBDSSBMEKXHSJF-UHFFFAOYSA-M cyclopentanecarboxylate Chemical compound [O-]C(=O)C1CCCC1 JBDSSBMEKXHSJF-UHFFFAOYSA-M 0.000 description 1
- YMGUBTXCNDTFJI-UHFFFAOYSA-M cyclopropanecarboxylate Chemical compound [O-]C(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-M 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- JJCFRYNCJDLXIK-UHFFFAOYSA-N cyproheptadine Chemical class C1CN(C)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JJCFRYNCJDLXIK-UHFFFAOYSA-N 0.000 description 1
- 230000000911 decarboxylating effect Effects 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 238000001212 derivatisation Methods 0.000 description 1
- 239000002027 dichloromethane extract Substances 0.000 description 1
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- PSHRANCNVXNITH-UHFFFAOYSA-N dimethylamino acetate Chemical compound CN(C)OC(C)=O PSHRANCNVXNITH-UHFFFAOYSA-N 0.000 description 1
- 108700003601 dimethylglycine Proteins 0.000 description 1
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- HUYFPNMFFXTAMQ-UHFFFAOYSA-N ethyl 2-[3-oxo-2-[4-(trifluoromethyl)phenyl]thiochromeno[4,3-c]pyrazol-4-yl]acetate Chemical compound O=C1C2=C(CC(=O)OCC)SC3=CC=CC=C3C2=NN1C1=CC=C(C(F)(F)F)C=C1 HUYFPNMFFXTAMQ-UHFFFAOYSA-N 0.000 description 1
- UKDLORMZNPQILV-UHFFFAOYSA-N ethyl 3-hydroxypropanoate Chemical compound CCOC(=O)CCO UKDLORMZNPQILV-UHFFFAOYSA-N 0.000 description 1
- NGWHJXCJBWGGTH-UHFFFAOYSA-N ethyl 6-methoxy-2-methyl-4-oxo-2,3-dihydrothiochromene-3-carboxylate Chemical compound C1=C(OC)C=C2C(=O)C(C(=O)OCC)C(C)SC2=C1 NGWHJXCJBWGGTH-UHFFFAOYSA-N 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000003349 gelling agent Substances 0.000 description 1
- 239000011491 glass wool Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000004727 humoral immunity Effects 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- MSYBLBLAMDYKKZ-UHFFFAOYSA-N hydron;pyridine-3-carbonyl chloride;chloride Chemical compound Cl.ClC(=O)C1=CC=CN=C1 MSYBLBLAMDYKKZ-UHFFFAOYSA-N 0.000 description 1
- 230000008105 immune reaction Effects 0.000 description 1
- 230000028993 immune response Effects 0.000 description 1
- 230000003308 immunostimulating effect Effects 0.000 description 1
- 238000012750 in vivo screening Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- TWBYWOBDOCUKOW-UHFFFAOYSA-M isonicotinate Chemical compound [O-]C(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-M 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- RMIODHQZRUFFFF-UHFFFAOYSA-N methoxyacetic acid Chemical compound COCC(O)=O RMIODHQZRUFFFF-UHFFFAOYSA-N 0.000 description 1
- UISRNCVCMXLUPS-UHFFFAOYSA-N methyl 2-(6-methoxy-4-oxo-2,3-dihydrothiochromen-3-yl)-2-oxoacetate Chemical compound C1=C(OC)C=C2C(=O)C(C(=O)C(=O)OC)CSC2=C1 UISRNCVCMXLUPS-UHFFFAOYSA-N 0.000 description 1
- SRXOJMOGPYFZKC-UHFFFAOYSA-N methyl 4-chloro-4-oxobutanoate Chemical compound COC(=O)CCC(Cl)=O SRXOJMOGPYFZKC-UHFFFAOYSA-N 0.000 description 1
- OUHJAVIUEBJJEN-UHFFFAOYSA-N methyl 6-methoxy-3-methyl-4-oxo-2h-thiochromene-3-carboxylate Chemical compound C1=C(OC)C=C2C(=O)C(C(=O)OC)(C)CSC2=C1 OUHJAVIUEBJJEN-UHFFFAOYSA-N 0.000 description 1
- VZCLESPVGIJYAK-UHFFFAOYSA-N methyl 6-methoxy-4-oxo-2,3-dihydrothiochromene-3-carboxylate Chemical compound C1=C(OC)C=C2C(=O)C(C(=O)OC)CSC2=C1 VZCLESPVGIJYAK-UHFFFAOYSA-N 0.000 description 1
- 239000012022 methylating agents Substances 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 229940078490 n,n-dimethylglycine Drugs 0.000 description 1
- FMASTMURQSHELY-UHFFFAOYSA-N n-(4-fluoro-2-methylphenyl)-3-methyl-n-[(2-methyl-1h-indol-4-yl)methyl]pyridine-4-carboxamide Chemical compound C1=CC=C2NC(C)=CC2=C1CN(C=1C(=CC(F)=CC=1)C)C(=O)C1=CC=NC=C1C FMASTMURQSHELY-UHFFFAOYSA-N 0.000 description 1
- SHCLTZLLAXSVKS-UHFFFAOYSA-N n-ethyl-2-[3-oxo-2-[4-(trifluoromethyl)phenyl]thiochromeno[4,3-c]pyrazol-4-yl]-n-phenylacetamide Chemical compound C=1C=CC=CC=1N(CC)C(=O)CC(=C1C2=O)SC3=CC=CC=C3C1=NN2C1=CC=C(C(F)(F)F)C=C1 SHCLTZLLAXSVKS-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000009826 neoplastic cell growth Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- ZWLPBLYKEWSWPD-UHFFFAOYSA-M o-toluate Chemical compound CC1=CC=CC=C1C([O-])=O ZWLPBLYKEWSWPD-UHFFFAOYSA-M 0.000 description 1
- 229940099990 ogen Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 235000019809 paraffin wax Nutrition 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000002831 pharmacologic agent Substances 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 239000002953 phosphate buffered saline Substances 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- LZMJNVRJMFMYQS-UHFFFAOYSA-N poseltinib Chemical compound C1CN(C)CCN1C(C=C1)=CC=C1NC1=NC(OC=2C=C(NC(=O)C=C)C=CC=2)=C(OC=C2)C2=N1 LZMJNVRJMFMYQS-UHFFFAOYSA-N 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 239000001120 potassium sulphate Substances 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- BESQLCCRQYTQQI-UHFFFAOYSA-N propan-2-yl 2-cyanoacetate Chemical compound CC(C)OC(=O)CC#N BESQLCCRQYTQQI-UHFFFAOYSA-N 0.000 description 1
- KOODSCBKXPPKHE-UHFFFAOYSA-N propanethioic s-acid Chemical compound CCC(S)=O KOODSCBKXPPKHE-UHFFFAOYSA-N 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- NLFIMXLLXGTDME-UHFFFAOYSA-N propyl 2-cyanoacetate Chemical compound CCCOC(=O)CC#N NLFIMXLLXGTDME-UHFFFAOYSA-N 0.000 description 1
- 150000003217 pyrazoles Chemical class 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 238000012306 spectroscopic technique Methods 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 201000000596 systemic lupus erythematosus Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003860 tertiary carboxamides Chemical group 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 description 1
- 239000012485 toluene extract Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D335/00—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom
- C07D335/04—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D335/06—Benzothiopyrans; Hydrogenated benzothiopyrans
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Immunology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Steroid Compounds (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB909002314A GB9002314D0 (en) | 1990-02-02 | 1990-02-02 | Therapeutic agents |
| GB9002315.1 | 1990-02-02 | ||
| GB909002315A GB9002315D0 (en) | 1990-02-02 | 1990-02-02 | Therapeutic agents |
| GB9002314.4 | 1990-02-02 | ||
| GB909002425A GB9002425D0 (en) | 1990-02-06 | 1990-02-06 | Therapeutic agents |
| GB9002425.8 | 1990-02-06 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2074841A1 true CA2074841A1 (en) | 1991-08-03 |
Family
ID=27264917
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002074841A Abandoned CA2074841A1 (en) | 1990-02-02 | 1991-01-26 | Therapeutic agents |
Country Status (14)
| Country | Link |
|---|---|
| EP (1) | EP0539372A1 (cs) |
| JP (1) | JPH05505180A (cs) |
| KR (1) | KR927003599A (cs) |
| AU (1) | AU7220991A (cs) |
| BG (1) | BG96715A (cs) |
| BR (1) | BR9105984A (cs) |
| CA (1) | CA2074841A1 (cs) |
| CS (1) | CS23891A2 (cs) |
| FI (1) | FI923486A0 (cs) |
| HU (1) | HU9202510D0 (cs) |
| IE (1) | IE910365A1 (cs) |
| IL (1) | IL97114A0 (cs) |
| PT (1) | PT96656A (cs) |
| WO (1) | WO1991011448A1 (cs) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9116241D0 (en) * | 1991-07-27 | 1991-09-11 | Boots Co Plc | Therapeutic agents |
| CA2263586A1 (en) * | 1996-09-05 | 1998-03-12 | Eifion Phillips | Novel aryl-pyridazines |
| SE0102404D0 (sv) * | 2001-07-04 | 2001-07-04 | Active Biotech Ab | Novel immunomodulating compounds |
| US6642249B2 (en) | 2001-07-04 | 2003-11-04 | Active Biotech Ab | Immunomodulating compounds |
| AU2003279687A1 (en) * | 2002-11-22 | 2004-06-18 | Active Biotech Ab | Pyrazoloquinolines with immunomodulating activity |
| WO2004055014A1 (en) * | 2002-12-16 | 2004-07-01 | Active Biotech Ab | Tetracyclic immunomodulatory compounds |
| CN103626787B (zh) * | 2013-12-10 | 2016-06-15 | 沈阳药科大学 | 噻吩并硫杂类化合物及其应用 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4268516A (en) * | 1978-10-11 | 1981-05-19 | Pfizer Inc. | [1]Benzothiopyrano[4,3-c]pyrazoles as immunoregulatory agents |
-
1991
- 1991-01-26 BR BR919105984A patent/BR9105984A/pt not_active Application Discontinuation
- 1991-01-26 KR KR1019920701838A patent/KR927003599A/ko not_active Withdrawn
- 1991-01-26 AU AU72209/91A patent/AU7220991A/en not_active Abandoned
- 1991-01-26 HU HU922510A patent/HU9202510D0/hu unknown
- 1991-01-26 EP EP91903536A patent/EP0539372A1/en not_active Withdrawn
- 1991-01-26 JP JP3503472A patent/JPH05505180A/ja active Pending
- 1991-01-26 CA CA002074841A patent/CA2074841A1/en not_active Abandoned
- 1991-01-26 WO PCT/EP1991/000154 patent/WO1991011448A1/en not_active Ceased
- 1991-01-31 IL IL97114A patent/IL97114A0/xx unknown
- 1991-02-01 PT PT96656A patent/PT96656A/pt unknown
- 1991-02-01 IE IE036591A patent/IE910365A1/en unknown
- 1991-02-01 CS CS91238A patent/CS23891A2/cs unknown
-
1992
- 1992-07-30 BG BG096715A patent/BG96715A/bg unknown
- 1992-07-31 FI FI923486A patent/FI923486A0/fi not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| JPH05505180A (ja) | 1993-08-05 |
| WO1991011448A1 (en) | 1991-08-08 |
| BR9105984A (pt) | 1992-11-10 |
| CS23891A2 (en) | 1991-09-15 |
| FI923486A7 (fi) | 1992-07-31 |
| HU9202510D0 (en) | 1992-10-28 |
| IE910365A1 (en) | 1991-08-14 |
| IL97114A0 (en) | 1992-03-29 |
| KR927003599A (ko) | 1992-12-18 |
| AU7220991A (en) | 1991-08-21 |
| PT96656A (pt) | 1991-10-31 |
| EP0539372A1 (en) | 1993-05-05 |
| FI923486A0 (fi) | 1992-07-31 |
| BG96715A (bg) | 1993-12-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0626956B1 (en) | Quinolylbenzofuran derivatives as leukotriene antagonists | |
| CA2927567C (en) | Bromodomain inhibitors | |
| EP0823413B1 (en) | Intermediates for the preparation of benzoheterocyclic compounds | |
| WO2007032466A1 (ja) | 複素環化合物、その製造方法並びに用途 | |
| JPH02141A (ja) | 新規化合物、その製法及びそれを含む医薬組成物 | |
| NZ231699A (en) | Substituted benzopyran, quinoline and naphthalene derivatives, preparation and pharmaceutical compositions thereof | |
| JPH11508267A (ja) | ピラゾール化合物および医薬組成物 | |
| WO2009060209A1 (en) | 6,6-fused bicyclic aromatic compounds and their therapeuti use | |
| JPH0517470A (ja) | ピラゾール誘導体 | |
| JP3120857B2 (ja) | 新規な縮合複素環化合物とこれを用いた抗喘息剤 | |
| CA2074841A1 (en) | Therapeutic agents | |
| IE61045B1 (en) | 4-aryl-5-carbamoyl-1, 4-dihydropyridines | |
| TWI429641B (zh) | 哌啶衍生物 | |
| JPWO1991012251A1 (ja) | 新規な縮合複素環化合物とこれを用いた抗喘息剤 | |
| CA1244436A (en) | 4-quinolone derivatives | |
| JPH05125079A (ja) | ピラゾロ[1,5−aピリミジン誘導体 | |
| AU2008215921A1 (en) | Delta 9 tetrahydrocannabinol derivatives | |
| EP0421749B1 (en) | 3-Aroyl-2-oxindole-1-carboxamides | |
| US4128549A (en) | Precursors of 4-(1-alkyl-4-piperidylidene-4H-benzo[4,5]cyclohepta-[1,2-b]thiophen-10(9H)-ones | |
| JP3162175B2 (ja) | クロマン誘導体若しくはジヒドロベンゾフラン誘導体 | |
| WO1989005808A1 (en) | Esters of nitric acid and a pharmaceutical composition | |
| WO1991009031A1 (en) | Trifluoromethyl substituted compounds and a pharmaceutical composition | |
| JP3479708B2 (ja) | 安息香酸誘導体 | |
| EP0398665A1 (en) | Benzopyran derivatives | |
| JP3512236B2 (ja) | ピラゾロピリジンオキソアルキレン酸誘導体及びその製造法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued | ||
| FZDE | Discontinued |
Effective date: 19940726 |