CA2004029A1 - Toothbrush with a deflecting part having a deflection profile - Google Patents
Toothbrush with a deflecting part having a deflection profileInfo
- Publication number
- CA2004029A1 CA2004029A1 CA002004029A CA2004029A CA2004029A1 CA 2004029 A1 CA2004029 A1 CA 2004029A1 CA 002004029 A CA002004029 A CA 002004029A CA 2004029 A CA2004029 A CA 2004029A CA 2004029 A1 CA2004029 A1 CA 2004029A1
- Authority
- CA
- Canada
- Prior art keywords
- brush head
- stem
- elastomer
- rubber
- deflecting part
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 229920001971 elastomer Polymers 0.000 claims abstract description 19
- 239000000806 elastomer Substances 0.000 claims abstract description 11
- 239000005060 rubber Substances 0.000 claims abstract description 8
- 239000005977 Ethylene Substances 0.000 claims abstract description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229920005549 butyl rubber Polymers 0.000 claims abstract description 3
- 229910001092 metal group alloy Inorganic materials 0.000 claims abstract description 3
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims abstract description 3
- 229910000831 Steel Inorganic materials 0.000 claims abstract 2
- 239000002184 metal Substances 0.000 claims abstract 2
- 229920003052 natural elastomer Polymers 0.000 claims abstract 2
- 229920001194 natural rubber Polymers 0.000 claims abstract 2
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 claims abstract 2
- 229920002379 silicone rubber Polymers 0.000 claims abstract 2
- 239000004945 silicone rubber Substances 0.000 claims abstract 2
- 239000010959 steel Substances 0.000 claims abstract 2
- 229920003048 styrene butadiene rubber Polymers 0.000 claims abstract 2
- 229920003051 synthetic elastomer Polymers 0.000 claims abstract 2
- 239000005061 synthetic rubber Substances 0.000 claims abstract 2
- 230000007704 transition Effects 0.000 claims description 6
- 238000001746 injection moulding Methods 0.000 claims description 2
- 229920012485 Plasticized Polyvinyl chloride Polymers 0.000 claims 1
- 239000005038 ethylene vinyl acetate Substances 0.000 abstract 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 abstract 1
- 239000000463 material Substances 0.000 description 4
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- 230000001680 brushing effect Effects 0.000 description 2
- 238000007373 indentation Methods 0.000 description 2
- WCVOGSZTONGSQY-UHFFFAOYSA-N 2,4,6-trichloroanisole Chemical compound COC1=C(Cl)C=C(Cl)C=C1Cl WCVOGSZTONGSQY-UHFFFAOYSA-N 0.000 description 1
- 229910000952 Be alloy Inorganic materials 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 101100072702 Drosophila melanogaster defl gene Proteins 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 238000004873 anchoring Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- VMXUWOKSQNHOCA-UKTHLTGXSA-N ranitidine Chemical compound [O-][N+](=O)\C=C(/NC)NCCSCC1=CC=C(CN(C)C)O1 VMXUWOKSQNHOCA-UKTHLTGXSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46D—MANUFACTURE OF BRUSHES
- A46D3/00—Preparing, i.e. Manufacturing brush bodies
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46B—BRUSHES
- A46B5/00—Brush bodies; Handles integral with brushware
- A46B5/002—Brush bodies; Handles integral with brushware having articulations, joints or flexible portions
- A46B5/0054—Brush bodies; Handles integral with brushware having articulations, joints or flexible portions designed to allow relative positioning of the head to body
- A46B5/0062—Brush bodies; Handles integral with brushware having articulations, joints or flexible portions designed to allow relative positioning of the head to body being flexible or resilient during use
- A46B5/007—Inserts made of different material, e.g. springs, plates
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46B—BRUSHES
- A46B5/00—Brush bodies; Handles integral with brushware
- A46B5/002—Brush bodies; Handles integral with brushware having articulations, joints or flexible portions
- A46B5/0054—Brush bodies; Handles integral with brushware having articulations, joints or flexible portions designed to allow relative positioning of the head to body
- A46B5/0062—Brush bodies; Handles integral with brushware having articulations, joints or flexible portions designed to allow relative positioning of the head to body being flexible or resilient during use
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46B—BRUSHES
- A46B2200/00—Brushes characterized by their functions, uses or applications
- A46B2200/10—For human or animal care
- A46B2200/1066—Toothbrush for cleaning the teeth or dentures
Landscapes
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Brushes (AREA)
- Polishing Bodies And Polishing Tools (AREA)
- Massaging Devices (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3840136.3-23 | 1988-11-29 | ||
| DE3840136A DE3840136C1 (enrdf_load_stackoverflow) | 1988-11-29 | 1988-11-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2004029A1 true CA2004029A1 (en) | 1990-05-29 |
Family
ID=6368051
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002004029A Abandoned CA2004029A1 (en) | 1988-11-29 | 1989-11-28 | Toothbrush with a deflecting part having a deflection profile |
Country Status (11)
Cited By (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5758383A (en) * | 1995-12-29 | 1998-06-02 | Colgate-Palmolive Company | Contouring toothbrush head |
| US5876207A (en) * | 1997-06-03 | 1999-03-02 | Gillette Canada Inc. | Pressure-sensing toothbrush |
| US6996870B2 (en) | 1995-12-29 | 2006-02-14 | Colgate-Palmolive Company | Contouring toothbrush head |
| US7721376B2 (en) | 2002-09-20 | 2010-05-25 | Colgate-Palmolive Company | Oral care implement |
| US7908699B2 (en) | 2001-07-03 | 2011-03-22 | Colgate-Palmolive Company | Oral care implement |
| WO2012120014A1 (en) * | 2011-03-09 | 2012-09-13 | Glaxosmithkline Consumer Healthcare Gmbh & Co. Kg | Toothbrush with a flexible region in the handle |
| US8393042B2 (en) | 2002-08-09 | 2013-03-12 | Colgate-Palmolive Company | Oral care implement |
| US8544131B2 (en) | 2009-06-26 | 2013-10-01 | The Gillette Company | Pressure indicator for an oral care instrument |
| US8561247B2 (en) | 2002-08-09 | 2013-10-22 | Colgate-Palmolive Company | Oral care implement |
| US8800093B2 (en) | 2002-08-09 | 2014-08-12 | Colgate-Palmolive Company | Oral care implement |
| US8806695B2 (en) | 2002-08-09 | 2014-08-19 | Colgate-Palmolive Company | Oral care implement having flexibly supported cleaning elements extending in opposite directions |
| US8876221B2 (en) | 2002-08-09 | 2014-11-04 | Colgate-Palmolive Company | Oral care implement |
| US8990996B2 (en) | 2002-08-09 | 2015-03-31 | Colgate-Palmolive Company | Toothbrush |
| USD739658S1 (en) | 2013-03-28 | 2015-09-29 | Colgate-Palmolive Company | Toothbrush |
| US9565926B2 (en) | 2013-03-28 | 2017-02-14 | Colgate-Palmolive Company | Oral care implement |
| US11096768B1 (en) * | 2021-04-16 | 2021-08-24 | Gaosheng Lin | Brush head of an electric toothbrush |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH01161782U (enrdf_load_stackoverflow) * | 1988-04-30 | 1989-11-10 | ||
| DE3923495C1 (enrdf_load_stackoverflow) * | 1989-07-15 | 1991-01-24 | M + C Schiffer Gmbh, 5466 Neustadt, De | |
| GB9106511D0 (en) | 1991-03-27 | 1991-05-15 | Lingner & Fischer Gmbh | Novel article |
| JPH05221517A (ja) * | 1992-02-13 | 1993-08-31 | Murata Mach Ltd | トラバース機構 |
| DE4223697C2 (de) * | 1992-07-18 | 1993-10-07 | Jovica Vukosavljevic | Zahnbürste |
| DE4229152A1 (de) * | 1992-09-01 | 1994-03-03 | Jordan As Oslo | Zahnbürste sowie Herstellungsverfahren für Zahnbürsten |
| DE9310112U1 (de) * | 1993-07-07 | 1994-06-09 | Hoffmann, Kay, Dr., 53639 Königswinter | Zahnbürste |
| USD353050S (en) | 1993-10-27 | 1994-12-06 | Colgate-Palmolive Company | Toothbrush |
| GB9414140D0 (en) | 1994-07-13 | 1994-08-31 | Procter & Gamble | Toothbrush |
| DE4435888A1 (de) * | 1994-10-07 | 1996-04-11 | Coronet Werke Gmbh | Zahnbürste |
| DE19519674C1 (de) * | 1995-05-30 | 1996-07-25 | Uwe Heuler | Federnde Zahnbürste |
| DE19530057A1 (de) * | 1995-08-16 | 1997-02-20 | Coronet Werke Gmbh | Bürste und Verfahren zu ihrer Herstellung |
| EP0966901B1 (en) * | 1995-12-29 | 2004-11-17 | Colgate-Palmolive Company | Contouring toothbrush head |
| GB9600414D0 (en) * | 1996-01-10 | 1996-03-13 | Lingner & Fischer Gmbh | Toothbrush |
| AU722959B3 (en) * | 1996-01-10 | 2000-08-17 | Smithkline Beecham Consumer Healthcare Gmbh | Toothbrush |
| GB9601013D0 (en) | 1996-01-18 | 1996-03-20 | Procter & Gamble | Brush invention |
| GB9601012D0 (en) | 1996-01-18 | 1996-03-20 | Procter & Gamble | A toothbrush |
| DE19608226A1 (de) * | 1996-03-04 | 1997-09-11 | Kurt Dipl Ing Kessler | Zahnbürste mit elastisch angelenkten wechselbarem Bürstenkopf |
| GB9626862D0 (en) | 1996-12-24 | 1997-02-12 | Procter & Gamble | Improvements in brush making |
| SI0969750T1 (en) | 1997-02-24 | 2003-10-31 | Smithkline Beecham Consumer Healthcare Gmbh | Toothbrush |
| DE19727018B4 (de) * | 1997-06-25 | 2007-04-05 | Trisa Holding Ag | Elektrische Zahnbürste mit beweglichem Bürstenkörper |
| GB9909101D0 (en) | 1999-04-22 | 1999-06-16 | Smithkline Beecham Gmbh & Co | Toothbrush |
| KR100350325B1 (ko) * | 2000-03-29 | 2002-08-28 | 주식회사 엘지씨아이 | 유연한 손잡이를 갖는 칫솔 |
| NO322158B1 (no) * | 2002-07-26 | 2006-08-21 | Jordan As | Tannborste |
| DE102006026165B4 (de) * | 2006-06-06 | 2014-10-23 | Frauke Denniger | Zahnbürste |
| ITMI20061617A1 (it) | 2006-08-10 | 2008-02-11 | Ponzini Spa | Spazzolino da debi con testina oscillante a torsione |
| AU2008100507A4 (en) * | 2008-06-03 | 2008-07-03 | McCusker, Robert Martin Mr | Toothbrush |
| US8776302B2 (en) | 2008-08-29 | 2014-07-15 | Colgate-Palmolive Company | Oral care implement |
| USD655916S1 (en) | 2008-08-29 | 2012-03-20 | Colgate-Palmolive Company | Toothbrush |
| USD632084S1 (en) | 2008-08-29 | 2011-02-08 | Colgate-Palmolive Company | Toothbrush |
| USD642803S1 (en) | 2008-08-29 | 2011-08-09 | Colgate-Palmolive Company | Toothbrush |
| USD642802S1 (en) | 2008-08-29 | 2011-08-09 | Colgate-Palmolive Company | Toothbrush |
| USD671325S1 (en) | 2009-12-15 | 2012-11-27 | Colgate-Palmolive Company | Toothbrush |
| USD642804S1 (en) | 2009-12-15 | 2011-08-09 | Colgate-Palmolive Company | Toothbrush |
| USD655917S1 (en) | 2009-12-15 | 2012-03-20 | Colgate-Palmolive Company | Toothbrush |
| USD631257S1 (en) | 2009-12-15 | 2011-01-25 | Colgate-Palmolive Company | Toothbrush |
| USD655918S1 (en) | 2009-12-15 | 2012-03-20 | Colgate-Palmolive Company | Toothbrush |
| EP2361528A1 (de) | 2010-02-26 | 2011-08-31 | Trisa Holding AG | Mundhygienegerät, insbesondere Zahnbürste, und Verfahren zu dessen Herstellung |
| KR20160134643A (ko) * | 2014-03-14 | 2016-11-23 | 라이온 가부시키가이샤 | 칫솔용 핸들체, 칫솔, 및 칫솔용 핸들체의 제조방법 |
| US11006738B2 (en) | 2017-01-26 | 2021-05-18 | Unger Marketing International, Llc | Cleaning devices having selectively flexible or rigid handles |
| US11458515B2 (en) | 2017-01-26 | 2022-10-04 | Unger Marketing International, Llc | Cleaning devices for cleaning of difficult to reach locations |
| US20250213028A1 (en) * | 2023-12-29 | 2025-07-03 | Eulogio A. Guzmán-Lugo | Ergonomic flexible and adjustable brushes |
| DE102025000349A1 (de) | 2025-01-29 | 2025-03-20 | Jovica Vukosavljevic | Zahnbürste |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE260612C (enrdf_load_stackoverflow) * | ||||
| FR442832A (fr) * | 1912-04-18 | 1912-09-10 | Georges Prevost | Brosse à dents flexible |
| US2083217A (en) * | 1934-07-14 | 1937-06-08 | Edwin I Brothers | Prophylactic device for the oral cavity |
| FR2053885A5 (enrdf_load_stackoverflow) * | 1969-07-22 | 1971-04-16 | Berning Bernard | |
| DE2402785C3 (de) * | 1974-01-22 | 1979-11-08 | Willi 5421 Fachbach Lohmann | Zahnbürste |
| JPS5345814Y2 (enrdf_load_stackoverflow) * | 1975-07-08 | 1978-11-02 | ||
| DE3200681A1 (de) * | 1982-01-13 | 1983-07-28 | Ludwig Dipl.-Ing. Lang | Geteilte zahnbuerste mit wechselbuerstenkoepfen |
| DE3238035A1 (de) * | 1982-10-14 | 1984-04-19 | Ludwig Dipl.-Ing. Lang | Geteilte zahnbuerste mit wechselbuerstenkoepfen |
| US4691405A (en) * | 1985-07-29 | 1987-09-08 | Reed Joseph C | Toothbrush having adjustable bristle-mounted tabs |
| DE3612108A1 (de) * | 1986-04-10 | 1987-10-15 | Rainer Dr Seib | Zahnbuerste mit elastischem verbindungselement zwischen buerstenkopf und griff |
| DE3805326A1 (de) * | 1987-02-27 | 1988-09-08 | Mierau Hans Dieter Prof Dr | Zahnbuerste |
-
1988
- 1988-11-29 DE DE3840136A patent/DE3840136C1/de not_active Expired - Lifetime
-
1989
- 1989-11-09 DE DE68925567T patent/DE68925567T2/de not_active Revoked
- 1989-11-09 ES ES89120761T patent/ES2081827T3/es not_active Expired - Lifetime
- 1989-11-09 EP EP89120761A patent/EP0371293B1/en not_active Revoked
- 1989-11-09 AT AT89120761T patent/ATE133541T1/de not_active IP Right Cessation
- 1989-11-13 NO NO89894524A patent/NO894524L/no unknown
- 1989-11-24 DK DK590189A patent/DK590189A/da not_active Application Discontinuation
- 1989-11-28 JP JP1308824A patent/JP2831401B2/ja not_active Expired - Lifetime
- 1989-11-28 CA CA002004029A patent/CA2004029A1/en not_active Abandoned
- 1989-11-28 KR KR1019890017287A patent/KR900007366A/ko not_active Withdrawn
- 1989-11-28 IE IE379389A patent/IE75897B1/en not_active IP Right Cessation
-
1996
- 1996-02-01 GR GR960400070T patent/GR3018854T3/el unknown
Cited By (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5758383A (en) * | 1995-12-29 | 1998-06-02 | Colgate-Palmolive Company | Contouring toothbrush head |
| US6073299A (en) * | 1995-12-29 | 2000-06-13 | Colgate-Palmolive Company | Contouring toothbrush head |
| US6314606B1 (en) | 1995-12-29 | 2001-11-13 | Colgate-Palmolive Company | Contouring toothbrush head |
| US6442787B2 (en) | 1995-12-29 | 2002-09-03 | Colgate-Palmolive Company | Contouring toothbrush head |
| US6996870B2 (en) | 1995-12-29 | 2006-02-14 | Colgate-Palmolive Company | Contouring toothbrush head |
| US8857003B2 (en) | 1995-12-29 | 2014-10-14 | Colgate-Palmolive Company | Contouring toothbrush head |
| US5876207A (en) * | 1997-06-03 | 1999-03-02 | Gillette Canada Inc. | Pressure-sensing toothbrush |
| US7908699B2 (en) | 2001-07-03 | 2011-03-22 | Colgate-Palmolive Company | Oral care implement |
| US8079110B2 (en) | 2001-07-03 | 2011-12-20 | Colgate-Palmolive Company | Oral care implement |
| US8393042B2 (en) | 2002-08-09 | 2013-03-12 | Colgate-Palmolive Company | Oral care implement |
| US9167888B2 (en) | 2002-08-09 | 2015-10-27 | Colgate-Palmolive Company | Oral care implement having flexibly supported cleaning elements extending in opposite directions |
| US8561247B2 (en) | 2002-08-09 | 2013-10-22 | Colgate-Palmolive Company | Oral care implement |
| US9603441B2 (en) | 2002-08-09 | 2017-03-28 | Colgate-Palmolive Company | Toothbrush |
| US10512323B2 (en) | 2002-08-09 | 2019-12-24 | Colgate-Palmolive Company | Oral care implement |
| US8800093B2 (en) | 2002-08-09 | 2014-08-12 | Colgate-Palmolive Company | Oral care implement |
| US8806695B2 (en) | 2002-08-09 | 2014-08-19 | Colgate-Palmolive Company | Oral care implement having flexibly supported cleaning elements extending in opposite directions |
| US8839481B2 (en) | 2002-08-09 | 2014-09-23 | Colgate-Palmolive Company | Oral care implement |
| US8876221B2 (en) | 2002-08-09 | 2014-11-04 | Colgate-Palmolive Company | Oral care implement |
| US8990996B2 (en) | 2002-08-09 | 2015-03-31 | Colgate-Palmolive Company | Toothbrush |
| US9545148B2 (en) | 2002-08-09 | 2017-01-17 | Colgate-Palmolive Company | Oral care implement |
| US7721376B2 (en) | 2002-09-20 | 2010-05-25 | Colgate-Palmolive Company | Oral care implement |
| US8544131B2 (en) | 2009-06-26 | 2013-10-01 | The Gillette Company | Pressure indicator for an oral care instrument |
| US8763196B2 (en) | 2011-03-09 | 2014-07-01 | Glaxosmithkline Consumer Healthcare Gmbh & Co. | Toothbrush incorporating a flexible undulating region |
| CN103402394B (zh) * | 2011-03-09 | 2015-11-25 | 葛兰素史密斯克兰消费者保健股份有限公司 | 在刷柄中具有柔韧区域的牙刷 |
| CN103402394A (zh) * | 2011-03-09 | 2013-11-20 | 葛兰素史密斯克兰消费者保健股份有限公司 | 在刷柄中具有柔韧区域的牙刷 |
| WO2012120014A1 (en) * | 2011-03-09 | 2012-09-13 | Glaxosmithkline Consumer Healthcare Gmbh & Co. Kg | Toothbrush with a flexible region in the handle |
| USD739658S1 (en) | 2013-03-28 | 2015-09-29 | Colgate-Palmolive Company | Toothbrush |
| US9565926B2 (en) | 2013-03-28 | 2017-02-14 | Colgate-Palmolive Company | Oral care implement |
| US11096768B1 (en) * | 2021-04-16 | 2021-08-24 | Gaosheng Lin | Brush head of an electric toothbrush |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0371293A2 (en) | 1990-06-06 |
| KR900007366A (ko) | 1990-06-01 |
| DE68925567D1 (de) | 1996-03-14 |
| IE893793L (en) | 1990-05-29 |
| NO894524D0 (no) | 1989-11-13 |
| JP2831401B2 (ja) | 1998-12-02 |
| DK590189A (da) | 1990-05-30 |
| ATE133541T1 (de) | 1996-02-15 |
| JPH02257904A (ja) | 1990-10-18 |
| DE3840136C1 (enrdf_load_stackoverflow) | 1990-05-17 |
| EP0371293A3 (en) | 1991-08-07 |
| DK590189D0 (da) | 1989-11-24 |
| IE75897B1 (en) | 1997-09-24 |
| NO894524L (no) | 1990-05-30 |
| DE68925567T2 (de) | 1996-08-14 |
| EP0371293B1 (en) | 1996-01-31 |
| ES2081827T3 (es) | 1996-03-16 |
| GR3018854T3 (en) | 1996-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2004029A1 (en) | Toothbrush with a deflecting part having a deflection profile | |
| US4829621A (en) | Toothbrush | |
| US5946759A (en) | Brush head | |
| EP0871382B1 (en) | Contouring toothbrush head | |
| US6357074B1 (en) | Cleaning brush, especially a toothbrush | |
| CA2135040C (en) | Interdental toothbrush | |
| KR100540458B1 (ko) | 내박리성 연결부가 있는 헤드부를 가진 칫솔 | |
| JP3304089B2 (ja) | 歯ブラシとこのような歯ブラシを製造する方法 | |
| CA2241796A1 (en) | Toothbrush | |
| HU220362B (hu) | Fogkefe | |
| NZ242121A (en) | Toothbrush with a rockable bristle head | |
| SA98190253B1 (ar) | فرشاة اسنان | |
| EP0648448B1 (en) | Tooth-brush having a head with a variable bending angle | |
| EP0955834B1 (en) | Brush head | |
| DE8814824U1 (de) | Zahnbürste mit einem ein Auslenkprofil aufweisenden Auslenkteil | |
| EP0976345B1 (en) | Contouring toothbrush head | |
| AU766382B2 (en) | A toothbrush | |
| AU7248000A (en) | Contouring toothbrush head | |
| HK1016848B (en) | Contouring toothbrush head | |
| HK1025486A (en) | Contouring toothbrush head | |
| HK1025486B (en) | Contouring toothbrush head | |
| AU2004200311A1 (en) | Contouring toothbrush head | |
| HK1025485B (en) | Contouring toothbrush head |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Discontinued |