CA1256879A - 2-(5,5-disubstituted-4-oxo-2-imidazolin-2-yl) pyridine compounds - Google Patents
2-(5,5-disubstituted-4-oxo-2-imidazolin-2-yl) pyridine compoundsInfo
- Publication number
- CA1256879A CA1256879A CA000428596A CA428596A CA1256879A CA 1256879 A CA1256879 A CA 1256879A CA 000428596 A CA000428596 A CA 000428596A CA 428596 A CA428596 A CA 428596A CA 1256879 A CA1256879 A CA 1256879A
- Authority
- CA
- Canada
- Prior art keywords
- hydrogen
- methyl
- isopropyl
- alkyl
- equivalents
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 2-(5,5-disubstituted-4-oxo-2-imidazolin-2-yl) pyridine compounds Chemical class 0.000 title claims abstract description 10
- 238000000034 method Methods 0.000 claims abstract description 24
- 238000002360 preparation method Methods 0.000 claims abstract description 10
- 125000004076 pyridyl group Chemical group 0.000 claims abstract description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 30
- 239000001257 hydrogen Substances 0.000 claims description 29
- 229910052739 hydrogen Inorganic materials 0.000 claims description 29
- 150000002431 hydrogen Chemical group 0.000 claims description 18
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 15
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 10
- 229910052717 sulfur Inorganic materials 0.000 claims description 10
- 239000011593 sulfur Substances 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 7
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 7
- 239000000460 chlorine Chemical group 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 239000011737 fluorine Chemical group 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- SMUQFGGVLNAIOZ-UHFFFAOYSA-N quinaldine Chemical compound C1=CC=CC2=NC(C)=CC=C21 SMUQFGGVLNAIOZ-UHFFFAOYSA-N 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 6
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 3
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 3
- 230000003287 optical effect Effects 0.000 claims description 3
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 14
- 239000000203 mixture Substances 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- CAAMSDWKXXPUJR-UHFFFAOYSA-N 3,5-dihydro-4H-imidazol-4-one Chemical compound O=C1CNC=N1 CAAMSDWKXXPUJR-UHFFFAOYSA-N 0.000 description 5
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 5
- 239000004009 herbicide Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 239000000284 extract Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 235000001968 nicotinic acid Nutrition 0.000 description 3
- 239000011664 nicotinic acid Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- YCPQUHCGFDFLSI-UHFFFAOYSA-N 2-amino-2,3-dimethylbutanamide Chemical compound CC(C)C(C)(N)C(N)=O YCPQUHCGFDFLSI-UHFFFAOYSA-N 0.000 description 2
- NTSLROIKFLNUIJ-UHFFFAOYSA-N 5-Ethyl-2-methylpyridine Chemical compound CCC1=CC=C(C)N=C1 NTSLROIKFLNUIJ-UHFFFAOYSA-N 0.000 description 2
- VNMXIHKQNXHCMP-UHFFFAOYSA-N 5-ethoxy-2-methylpyridine Chemical compound CCOC1=CC=C(C)N=C1 VNMXIHKQNXHCMP-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical class CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 229960003512 nicotinic acid Drugs 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 description 1
- SEPPVOUBHWNCAW-FNORWQNLSA-N (E)-4-oxonon-2-enal Chemical compound CCCCCC(=O)\C=C\C=O SEPPVOUBHWNCAW-FNORWQNLSA-N 0.000 description 1
- LISKAOIANGDBTB-UHFFFAOYSA-N 2-ethoxypyridine Chemical compound CCOC1=CC=CC=N1 LISKAOIANGDBTB-UHFFFAOYSA-N 0.000 description 1
- WHXCIRYFEDTNKZ-UHFFFAOYSA-N 2-methyl-5-propan-2-yloxypyridine Chemical compound CC(C)OC1=CC=C(C)N=C1 WHXCIRYFEDTNKZ-UHFFFAOYSA-N 0.000 description 1
- LLIVOORDLIRKST-UHFFFAOYSA-N 4-methyl-3-propan-2-yl-4H-imidazol-5-one Chemical compound C(C)(C)N1C=NC(C1C)=O LLIVOORDLIRKST-UHFFFAOYSA-N 0.000 description 1
- JDUFVOBDYJLABK-UHFFFAOYSA-N 4-methyl-4-propan-2-yl-2-(5-propan-2-yloxypyridin-2-yl)-1h-imidazol-5-one Chemical compound N1=CC(OC(C)C)=CC=C1C1=NC(=O)C(C)(C(C)C)N1 JDUFVOBDYJLABK-UHFFFAOYSA-N 0.000 description 1
- 241001480079 Corymbia calophylla Species 0.000 description 1
- 235000006552 Liquidambar styraciflua Nutrition 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- 244000000188 Vaccinium ovalifolium Species 0.000 description 1
- 238000005672 Willgerodt-Kindler rearrangement reaction Methods 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical group CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000001902 propagating effect Effects 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003556 thioamides Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/65—One oxygen atom attached in position 3 or 5
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US38181782A | 1982-05-25 | 1982-05-25 | |
| US381,817 | 1982-05-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1256879A true CA1256879A (en) | 1989-07-04 |
Family
ID=23506493
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000428596A Expired CA1256879A (en) | 1982-05-25 | 1983-05-20 | 2-(5,5-disubstituted-4-oxo-2-imidazolin-2-yl) pyridine compounds |
Country Status (11)
| Country | Link |
|---|---|
| EP (1) | EP0095104B1 (enExample) |
| CA (1) | CA1256879A (enExample) |
| DE (1) | DE3368415D1 (enExample) |
| DK (1) | DK154427C (enExample) |
| ES (1) | ES522662A0 (enExample) |
| HK (1) | HK70990A (enExample) |
| HU (1) | HU197322B (enExample) |
| IL (1) | IL68785A (enExample) |
| IN (1) | IN155352B (enExample) |
| WO (1) | WO1983004252A1 (enExample) |
| ZA (1) | ZA833547B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4562257A (en) * | 1983-11-07 | 1985-12-31 | American Cyanamid Company | Preparation of substituted and unsubstituted 2-carbamoyl nicotinic and 3-quinolinecarboxylic acids |
| US4748244A (en) * | 1984-05-11 | 1988-05-31 | Ciba-Geigy Corporation | Process for the preparation of pyridine-2-3-dicarboxylic acid derivatives, and novel 1-amino-1,4-dihydropyridine-2-3-diarboxylic acid derivatives |
| EP0166907A3 (en) * | 1984-06-04 | 1988-09-14 | American Cyanamid Company | Herbicidal 2-(2-imidazolin-2-yl)-fluoroalkoxy-, alkenyloxy- and alkynyloxypyridines and quinolines |
| US4709036A (en) * | 1985-06-13 | 1987-11-24 | American Cyanamid Company | Process for the preparation of herbicidal 2-(4,4-disubstituted-5-oxo-2-imidazolin-2-yl)benzoic, nicotinic and quinoline-3-carboxylic acids, esters and salts |
| CN86106435A (zh) * | 1985-09-24 | 1987-05-27 | 舍林股份公司 | 咪唑啉基衍生物,其制备方法和含有这类化合物的具有除草作用的制剂 |
| EP0227932B1 (en) * | 1985-12-13 | 1993-01-13 | American Cyanamid Company | Novel fused pyridine compounds, intermediates for the preparation of, and use of said compounds as herbicidal agents |
| GB2174395A (en) * | 1986-05-09 | 1986-11-05 | American Cyanimid Co | Herbicidal 2-(2-imidazolin-2-yl)pyridine derivatives |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL62794A0 (en) * | 1980-06-02 | 1981-07-31 | American Cyanamid Co | Substituted nicotinic acid esters and salts thereof and their use as herbicidal agents |
-
1983
- 1983-05-12 HU HU832690A patent/HU197322B/hu unknown
- 1983-05-12 WO PCT/US1983/000722 patent/WO1983004252A1/en not_active Ceased
- 1983-05-13 EP EP83104716A patent/EP0095104B1/en not_active Expired
- 1983-05-13 DE DE8383104716T patent/DE3368415D1/de not_active Expired
- 1983-05-17 ZA ZA833547A patent/ZA833547B/xx unknown
- 1983-05-20 CA CA000428596A patent/CA1256879A/en not_active Expired
- 1983-05-24 IN IN646/CAL/83A patent/IN155352B/en unknown
- 1983-05-24 ES ES522662A patent/ES522662A0/es active Granted
- 1983-05-25 IL IL68785A patent/IL68785A/xx not_active IP Right Cessation
- 1983-09-08 DK DK408283A patent/DK154427C/da not_active IP Right Cessation
-
1990
- 1990-09-06 HK HK709/90A patent/HK70990A/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| EP0095104A2 (en) | 1983-11-30 |
| IL68785A0 (en) | 1983-09-30 |
| DK408283A (da) | 1983-12-08 |
| WO1983004252A1 (en) | 1983-12-08 |
| EP0095104A3 (en) | 1984-08-29 |
| EP0095104B1 (en) | 1986-12-17 |
| IL68785A (en) | 1986-09-30 |
| ES8504764A1 (es) | 1985-05-01 |
| ES522662A0 (es) | 1985-05-01 |
| ZA833547B (en) | 1984-02-29 |
| DE3368415D1 (en) | 1987-01-29 |
| HK70990A (en) | 1990-09-14 |
| DK154427B (da) | 1988-11-14 |
| HU197322B (en) | 1989-03-28 |
| DK408283D0 (da) | 1983-09-08 |
| DK154427C (da) | 1989-04-10 |
| IN155352B (enExample) | 1985-01-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5967267A (ja) | トリフルオロメチルピリジル(オキシ/チオ)フェノキシプロピオン酸誘導体の製造方法 | |
| US4844732A (en) | Pyridine-3-carboxamide derivatives | |
| DK165693B (da) | 2-(n-substitueret guanidino)-4-heteroarylthiazol-forbindelser og farmaceutiske praeparater indeholdende disse | |
| US4546191A (en) | Trifluoromethyl-2-pyridinone or pyridinthione compounds and process for the preparation of the same | |
| CA1066711A (en) | Thiophene derivatives | |
| CA1256879A (en) | 2-(5,5-disubstituted-4-oxo-2-imidazolin-2-yl) pyridine compounds | |
| KR20250047737A (ko) | 황 치환기를 포함하는 축합 고리 화합물, 이의 제조방법, 살충제 조성물 및 용도 | |
| NO172341B (no) | Triprolidin-mellomprodukter | |
| EP0095105B1 (en) | Process for the preparation of 2-(5,5-disubstituted-4-oxo-2-imidazolin-2-yl)-nicotinic acids, quinoline-3-carboxylic acids, and benzoic acids | |
| US4349681A (en) | 2-Amino-3-chloro-5-trifluoromethylpyridine | |
| JPH05213882A (ja) | 除草性ピコリンアミド誘導体 | |
| US4474962A (en) | Process for the preparation of pyridyl and quinolyl imidazolinones | |
| TWI305205B (en) | Catalytic process for the preparation of thiazole derivatives | |
| CA1090345A (en) | 3-pyridinol compounds for regulating plant growth | |
| KR900003399B1 (ko) | 피리딜 및 퀴놀릴 이미다졸리논류의 제법 | |
| US4098812A (en) | 4-cyano-2,6-dinitroanilines | |
| US4309554A (en) | 3-(2-Thiophenesulfonyl)-2-halopropanenitriles | |
| US3923811A (en) | Perfluoroalkanesulfonamides N-substituted by heterocyclic groups | |
| PL88905B1 (enExample) | ||
| EP0353944B1 (en) | Aminocarbonyl-substituted pyridinesulfinic acid or salts thereof | |
| SMITH et al. | Convenient Syntheses of 1, 2, 3, 4-Tetrahydroquinoxalines | |
| EP0052341B1 (en) | Orotic acid derivatives and their use as agricultural chemicals | |
| US4841089A (en) | Process for the preparation of 4-mercaptobenzonitriles, and 4-mercaptobenzonitriles | |
| CA2098982A1 (en) | Indolizine derivatives, process of preparation and use for the preparation of aminoalkoxybenzenesulphonylindolizine compounds with pharmaceutical activity | |
| JPH01301668A (ja) | マンデル酸誘導体及び除草剤 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |