CA1244053A - Process for the preparation of aldehydes - Google Patents
Process for the preparation of aldehydesInfo
- Publication number
- CA1244053A CA1244053A CA000482937A CA482937A CA1244053A CA 1244053 A CA1244053 A CA 1244053A CA 000482937 A CA000482937 A CA 000482937A CA 482937 A CA482937 A CA 482937A CA 1244053 A CA1244053 A CA 1244053A
- Authority
- CA
- Canada
- Prior art keywords
- rhodium
- water
- reaction
- soluble
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 27
- 150000001299 aldehydes Chemical class 0.000 title claims abstract description 7
- 239000010948 rhodium Substances 0.000 claims abstract description 21
- 229910052703 rhodium Inorganic materials 0.000 claims abstract description 20
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims abstract description 20
- 150000001336 alkenes Chemical class 0.000 claims abstract description 15
- 150000001875 compounds Chemical class 0.000 claims abstract description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 7
- 239000001257 hydrogen Substances 0.000 claims abstract description 7
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910002091 carbon monoxide Inorganic materials 0.000 claims abstract description 4
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 2
- 239000007791 liquid phase Substances 0.000 claims 1
- 125000001624 naphthyl group Chemical group 0.000 claims 1
- 239000003054 catalyst Substances 0.000 abstract description 17
- 150000003242 quaternary ammonium salts Chemical class 0.000 abstract description 4
- 238000006243 chemical reaction Methods 0.000 description 16
- 239000000243 solution Substances 0.000 description 9
- 239000007795 chemical reaction product Substances 0.000 description 7
- 230000000875 corresponding effect Effects 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 6
- 238000007037 hydroformylation reaction Methods 0.000 description 6
- 150000003003 phosphines Chemical class 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- ZBMZOFSLQIPSPW-UHFFFAOYSA-N 3-bis(3-sulfophenyl)phosphanylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(P(C=2C=C(C=CC=2)S(O)(=O)=O)C=2C=C(C=CC=2)S(O)(=O)=O)=C1 ZBMZOFSLQIPSPW-UHFFFAOYSA-N 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- 235000014786 phosphorus Nutrition 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 3
- 239000010941 cobalt Substances 0.000 description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- VBQDSLGFSUGBBE-UHFFFAOYSA-N benzyl(triethyl)azanium Chemical compound CC[N+](CC)(CC)CC1=CC=CC=C1 VBQDSLGFSUGBBE-UHFFFAOYSA-N 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- BPSQMWSZGQGXHF-UHFFFAOYSA-N dodecyl-ethyl-dimethylazanium Chemical compound CCCCCCCCCCCC[N+](C)(C)CC BPSQMWSZGQGXHF-UHFFFAOYSA-N 0.000 description 2
- 239000003446 ligand Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- SVOOVMQUISJERI-UHFFFAOYSA-K rhodium(3+);triacetate Chemical compound [Rh+3].CC([O-])=O.CC([O-])=O.CC([O-])=O SVOOVMQUISJERI-UHFFFAOYSA-K 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 1
- KWKAKUADMBZCLK-UHFFFAOYSA-N 1-octene Chemical compound CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 1
- BMTDZORNBFQUEA-UHFFFAOYSA-K 2-ethylhexanoate;rhodium(3+) Chemical compound [Rh+3].CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O BMTDZORNBFQUEA-UHFFFAOYSA-K 0.000 description 1
- 241001547070 Eriodes Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- YOUGRGFIHBUKRS-UHFFFAOYSA-N benzyl(trimethyl)azanium Chemical class C[N+](C)(C)CC1=CC=CC=C1 YOUGRGFIHBUKRS-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- CEJLBZWIKQJOAT-UHFFFAOYSA-N dichloroisocyanuric acid Chemical compound ClN1C(=O)NC(=O)N(Cl)C1=O CEJLBZWIKQJOAT-UHFFFAOYSA-N 0.000 description 1
- VICYBMUVWHJEFT-UHFFFAOYSA-N dodecyltrimethylammonium ion Chemical compound CCCCCCCCCCCC[N+](C)(C)C VICYBMUVWHJEFT-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-O ethylaminium Chemical class CC[NH3+] QUSNBJAOOMFDIB-UHFFFAOYSA-O 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- -1 m-sulfophenyl Chemical group 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- AFFLGGQVNFXPEV-UHFFFAOYSA-N n-decene Natural products CCCCCCCCC=C AFFLGGQVNFXPEV-UHFFFAOYSA-N 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- SJLOMQIUPFZJAN-UHFFFAOYSA-N oxorhodium Chemical class [Rh]=O SJLOMQIUPFZJAN-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003283 rhodium Chemical class 0.000 description 1
- 150000003284 rhodium compounds Chemical class 0.000 description 1
- 229910003450 rhodium oxide Inorganic materials 0.000 description 1
- YWFDDXXMOPZFFM-UHFFFAOYSA-H rhodium(3+);trisulfate Chemical compound [Rh+3].[Rh+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O YWFDDXXMOPZFFM-UHFFFAOYSA-H 0.000 description 1
- SONJTKJMTWTJCT-UHFFFAOYSA-K rhodium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Rh+3] SONJTKJMTWTJCT-UHFFFAOYSA-K 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/02—Saturated compounds having —CHO groups bound to acyclic carbon atoms or to hydrogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/49—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide
- C07C45/50—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide by oxo-reactions
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843420491 DE3420491A1 (de) | 1984-06-01 | 1984-06-01 | Verfahren zur herstellung von aldehyden |
| DEP3420491.1 | 1984-06-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1244053A true CA1244053A (en) | 1988-11-01 |
Family
ID=6237409
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000482937A Expired CA1244053A (en) | 1984-06-01 | 1985-05-31 | Process for the preparation of aldehydes |
Country Status (13)
| Country | Link |
|---|---|
| EP (1) | EP0163234B1 (enExample) |
| JP (1) | JPS611633A (enExample) |
| KR (1) | KR880001353B1 (enExample) |
| AT (1) | ATE50556T1 (enExample) |
| AU (1) | AU577382B2 (enExample) |
| BR (1) | BR8502451A (enExample) |
| CA (1) | CA1244053A (enExample) |
| DE (2) | DE3420491A1 (enExample) |
| HU (1) | HU204249B (enExample) |
| PL (1) | PL253588A1 (enExample) |
| RO (1) | RO91880B (enExample) |
| SU (1) | SU1537134A3 (enExample) |
| ZA (1) | ZA853971B (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3420493A1 (de) * | 1984-06-01 | 1985-12-05 | Ruhrchemie Ag, 4200 Oberhausen | Quartaere ammoniumsalze sulfonierter triarylphosphine |
| DE3534314A1 (de) * | 1985-09-26 | 1987-04-02 | Ruhrchemie Ag | Verfahren zur herstellung von aldehyden |
| DE3546123A1 (de) * | 1985-12-24 | 1987-06-25 | Ruhrchemie Ag | Verfahren zur herstellung von aldehyden |
| DE3616057A1 (de) * | 1986-05-13 | 1987-11-19 | Ruhrchemie Ag | Verfahren zur herstellung von aldehyden |
| US4716250A (en) * | 1986-07-10 | 1987-12-29 | Union Carbide Corporation | Hydroformylation using low volatile/organic soluble phosphine ligands |
| US4825003A (en) * | 1986-09-17 | 1989-04-25 | Mitsui Toatsu Chemicals, Incorporated | Production process of 2-chloropropionaldehyde |
| US4731486A (en) * | 1986-11-18 | 1988-03-15 | Union Carbide Corporation | Hydroformylation using low volatile phosphine ligands |
| US5113022A (en) * | 1988-08-05 | 1992-05-12 | Union Carbide Chemicals & Plastics Technology Corporation | Ionic phosphites used in homogeneous transition metal catalyzed processes |
| DE3942954A1 (de) * | 1989-12-23 | 1991-06-27 | Hoechst Ag | Verfahren zur herstellung von aldehyden |
| FR2671078A1 (fr) * | 1990-12-31 | 1992-07-03 | Rhone Poulenc Chimie | Reactif et procede d'hydrocarbonylation triphasique. |
| US5288818A (en) * | 1991-08-20 | 1994-02-22 | Exxon Chemical Patents Inc. | Method for separating a water soluble noble metal catalyst from a noble metal catalyzed hydroformylation reaction |
| US5215667A (en) * | 1991-08-20 | 1993-06-01 | Exxon Chemical Patents Inc. | Method for separating water soluble noble metal catalyst from a noble metal catalyzed hydroformylation reaction |
| DE4242725A1 (de) * | 1992-12-17 | 1994-06-23 | Hoechst Ag | Verfahren zur Herstellung von höheren, vorwiegend unverzweigten, primären Alkoholen |
| DE4440552A1 (de) * | 1994-11-12 | 1996-05-15 | Hoechst Ag | Verfahren zur Herstellung von Formylcarbonsäureestern |
| US6756411B2 (en) | 1995-06-29 | 2004-06-29 | Sasol Technology (Proprietary) Limited | Process for producing oxygenated products |
| KR100451631B1 (ko) * | 2002-05-17 | 2004-10-08 | 주식회사 바름인 | 한국형 유산균인 비피도박테리움 브레브 케이-110을이용하여 감마-아미노부 틸산과 식물성에스트로젠을강화한 대두 발효물의 제조방법 |
| KR100460697B1 (ko) * | 2002-06-01 | 2004-12-09 | 고을빛 생식마을 (주) | 고농도 이소플라본이 함유된 발아콩의 제조방법 |
| DE102008044783B4 (de) | 2008-08-28 | 2012-05-16 | Oxea Gmbh | Verfahren zur Gewinnung von aliphatischen C3- bis C10- Aldehyden aus Hochsiedern durch thermische Behandlung |
| DE102009004655B4 (de) | 2009-01-15 | 2013-02-14 | Oxea Gmbh | Verfahren zur Herstellung von Aldehyden |
| DE102009016651B4 (de) | 2009-04-07 | 2011-11-17 | Oxea Gmbh | Verfahren zur Herstellung von Aldehyden |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3928232A (en) * | 1972-10-24 | 1975-12-23 | Chevron Res | Aryl sulfonate stabilized cobalt carbonyl complex compounds |
| FR2314910A1 (fr) * | 1975-06-20 | 1977-01-14 | Rhone Poulenc Ind | Procede d'hydroformylation des olefines |
| US4248802A (en) * | 1975-06-20 | 1981-02-03 | Rhone-Poulenc Industries | Catalytic hydroformylation of olefins |
| NO156742C (no) * | 1979-03-28 | 1987-11-18 | Union Carbide Corp | Fremgangsmaate for fremstilling av et hydroformyleringsmedium, og fremgangsmaate for fremstilling av aldehyder. |
| FR2473504A1 (fr) * | 1979-10-31 | 1981-07-17 | Rhone Poulenc Ind | Procede de preparation d'aldehydes a partir d'olefines par reaction d'hydroformylation en presence d'un catalyseur au cobalt |
| GB2085874B (en) * | 1980-09-04 | 1984-08-08 | Johnson Matthey Plc | Hydroformylation of olefins |
| DE3234701A1 (de) * | 1982-09-18 | 1984-04-05 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| DE3413427A1 (de) * | 1984-04-10 | 1985-10-17 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
-
1984
- 1984-06-01 DE DE19843420491 patent/DE3420491A1/de not_active Withdrawn
-
1985
- 1985-04-26 SU SU853884106A patent/SU1537134A3/ru active
- 1985-04-30 KR KR1019850002900A patent/KR880001353B1/ko not_active Expired
- 1985-05-21 AT AT85106184T patent/ATE50556T1/de not_active IP Right Cessation
- 1985-05-21 DE DE8585106184T patent/DE3576150D1/de not_active Expired - Fee Related
- 1985-05-21 EP EP85106184A patent/EP0163234B1/de not_active Expired - Lifetime
- 1985-05-24 BR BR8502451A patent/BR8502451A/pt not_active IP Right Cessation
- 1985-05-24 PL PL25358885A patent/PL253588A1/xx unknown
- 1985-05-24 RO RO118874A patent/RO91880B/ro unknown
- 1985-05-24 ZA ZA853971A patent/ZA853971B/xx unknown
- 1985-05-27 HU HU852000A patent/HU204249B/hu not_active IP Right Cessation
- 1985-05-30 JP JP60115555A patent/JPS611633A/ja active Granted
- 1985-05-31 CA CA000482937A patent/CA1244053A/en not_active Expired
- 1985-05-31 AU AU43218/85A patent/AU577382B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| PL253588A1 (en) | 1986-02-11 |
| AU577382B2 (en) | 1988-09-22 |
| RO91880B (ro) | 1987-07-31 |
| DE3420491A1 (de) | 1985-12-05 |
| JPS611633A (ja) | 1986-01-07 |
| AU4321885A (en) | 1985-12-05 |
| SU1537134A3 (ru) | 1990-01-15 |
| EP0163234B1 (de) | 1990-02-28 |
| KR860000237A (ko) | 1986-01-27 |
| HU204249B (en) | 1991-12-30 |
| ATE50556T1 (de) | 1990-03-15 |
| RO91880A (ro) | 1987-07-30 |
| KR880001353B1 (ko) | 1988-07-28 |
| BR8502451A (pt) | 1986-01-28 |
| EP0163234A2 (de) | 1985-12-04 |
| HUT39703A (en) | 1986-10-29 |
| ZA853971B (en) | 1986-01-29 |
| JPH0140019B2 (enExample) | 1989-08-24 |
| EP0163234A3 (en) | 1987-05-27 |
| DE3576150D1 (de) | 1990-04-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1244053A (en) | Process for the preparation of aldehydes | |
| CA1307006C (en) | Hydroformylation using low volatile/organic soluble phosphine ligands | |
| US4400548A (en) | Hydroformylation process using bisphosphine monooxide ligands | |
| EP0375573B1 (en) | Low pressure rhodium catalyzed hydroformylation of olefins | |
| EP0024091B1 (en) | Hydroformylation process and novel transition metal catalysts | |
| CA1183123A (en) | Hydroformylation process using triarylphosphine and bisphosphine monooxide ligands | |
| US4260828A (en) | Hydroformylation process | |
| US4740626A (en) | Process for the preparation of aldehydes | |
| EP0214622A2 (en) | Transition metal complex catalyzed processes | |
| US4593126A (en) | Process for preparing aldehydes | |
| US4578523A (en) | Process for the preparation of aldehydes | |
| KR890003783B1 (ko) | 알데히드의 제조방법 | |
| EP0157316B1 (de) | Verfahren zur Herstellung von Aldehyden | |
| PL183632B1 (pl) | Sposób hydroformylowania olefinowo nienasyconych związków | |
| CA1118451A (en) | Process for preparing aldehydes | |
| CA1292246C (en) | Process for the preparation of aldehydes | |
| US4405496A (en) | Hydroformylation catalyst and process of using it | |
| US4731485A (en) | Process for hydroformylation with rhodium catalysts and the separation of rhodium therefrom | |
| CA1257878A (en) | Process for the production of nonadecanediols | |
| JPH06293692A (ja) | アルデヒドの製造方法 | |
| US4522933A (en) | Hydroformylation catalyst containing bisphosphine monooxide ligands | |
| CA1106407A (en) | Hydroformylation process | |
| US5741941A (en) | Process for preparing aldehydes | |
| CA2080747A1 (en) | Process for recovering rhodium from the reaction products of the oxo synthesis | |
| US6388142B1 (en) | Method for producing aldehydes by hydroformylation in the presence of crown ether |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |