CA1229947A - Chemical/steam stripping - Google Patents
Chemical/steam strippingInfo
- Publication number
- CA1229947A CA1229947A CA000476520A CA476520A CA1229947A CA 1229947 A CA1229947 A CA 1229947A CA 000476520 A CA000476520 A CA 000476520A CA 476520 A CA476520 A CA 476520A CA 1229947 A CA1229947 A CA 1229947A
- Authority
- CA
- Canada
- Prior art keywords
- process according
- monomers
- weight per
- ethylenically unsaturated
- per cent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000126 substance Substances 0.000 title abstract description 6
- 239000000178 monomer Substances 0.000 claims abstract description 54
- 150000003254 radicals Chemical class 0.000 claims abstract description 37
- 239000000839 emulsion Substances 0.000 claims abstract description 22
- 238000000034 method Methods 0.000 claims description 42
- 230000008569 process Effects 0.000 claims description 38
- 229920000642 polymer Polymers 0.000 claims description 20
- 239000002253 acid Substances 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 11
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 10
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical group OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 10
- 150000001735 carboxylic acids Chemical class 0.000 claims description 9
- 239000003638 chemical reducing agent Substances 0.000 claims description 9
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 8
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims description 8
- 150000007513 acids Chemical class 0.000 claims description 8
- -1 sulphur compound Chemical class 0.000 claims description 8
- 150000002148 esters Chemical class 0.000 claims description 7
- 229920002554 vinyl polymer Polymers 0.000 claims description 7
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 claims description 6
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 claims description 6
- 150000001299 aldehydes Chemical class 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- 235000000346 sugar Nutrition 0.000 claims description 4
- 150000008163 sugars Chemical class 0.000 claims description 4
- KJPRLNWUNMBNBZ-QPJJXVBHSA-N (E)-cinnamaldehyde Chemical compound O=C\C=C\C1=CC=CC=C1 KJPRLNWUNMBNBZ-QPJJXVBHSA-N 0.000 claims description 3
- 229920002818 (Hydroxyethyl)methacrylate Polymers 0.000 claims description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 3
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 claims description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 3
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical compound OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 claims description 3
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 claims description 3
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims description 3
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 claims description 3
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 claims description 3
- STNJBCKSHOAVAJ-UHFFFAOYSA-N Methacrolein Chemical compound CC(=C)C=O STNJBCKSHOAVAJ-UHFFFAOYSA-N 0.000 claims description 3
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 3
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 3
- CNCOEDDPFOAUMB-UHFFFAOYSA-N N-Methylolacrylamide Chemical compound OCNC(=O)C=C CNCOEDDPFOAUMB-UHFFFAOYSA-N 0.000 claims description 3
- 229940117916 cinnamic aldehyde Drugs 0.000 claims description 3
- KJPRLNWUNMBNBZ-UHFFFAOYSA-N cinnamic aldehyde Natural products O=CC=CC1=CC=CC=C1 KJPRLNWUNMBNBZ-UHFFFAOYSA-N 0.000 claims description 3
- 230000000593 degrading effect Effects 0.000 claims description 3
- 230000000368 destabilizing effect Effects 0.000 claims description 3
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 claims description 3
- 150000002432 hydroperoxides Chemical class 0.000 claims description 3
- DNTMQTKDNSEIFO-UHFFFAOYSA-N n-(hydroxymethyl)-2-methylprop-2-enamide Chemical compound CC(=C)C(=O)NCO DNTMQTKDNSEIFO-UHFFFAOYSA-N 0.000 claims description 3
- KCAMXZBMXVIIQN-UHFFFAOYSA-N octan-3-yl 2-methylprop-2-enoate Chemical compound CCCCCC(CC)OC(=O)C(C)=C KCAMXZBMXVIIQN-UHFFFAOYSA-N 0.000 claims description 3
- 150000001451 organic peroxides Chemical group 0.000 claims description 3
- 239000007800 oxidant agent Substances 0.000 claims description 3
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 claims description 3
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical group [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 claims description 3
- 239000004296 sodium metabisulphite Substances 0.000 claims description 3
- 235000010262 sodium metabisulphite Nutrition 0.000 claims description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 3
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 claims description 2
- SBYMUDUGTIKLCR-UHFFFAOYSA-N 2-chloroethenylbenzene Chemical compound ClC=CC1=CC=CC=C1 SBYMUDUGTIKLCR-UHFFFAOYSA-N 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- WBZKQQHYRPRKNJ-UHFFFAOYSA-L disulfite Chemical compound [O-]S(=O)S([O-])(=O)=O WBZKQQHYRPRKNJ-UHFFFAOYSA-L 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 150000003623 transition metal compounds Chemical class 0.000 claims description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 claims 4
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims 4
- 239000005864 Sulphur Substances 0.000 claims 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 2
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 2
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 claims 2
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 claims 2
- 125000004648 C2-C8 alkenyl group Chemical group 0.000 claims 2
- 125000000217 alkyl group Chemical group 0.000 claims 2
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 claims 2
- 150000001408 amides Chemical class 0.000 claims 2
- 150000001993 dienes Chemical class 0.000 claims 2
- 239000001530 fumaric acid Substances 0.000 claims 2
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 claims 2
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 claims 2
- 150000002825 nitriles Chemical class 0.000 claims 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- YMOONIIMQBGTDU-VOTSOKGWSA-N [(e)-2-bromoethenyl]benzene Chemical compound Br\C=C\C1=CC=CC=C1 YMOONIIMQBGTDU-VOTSOKGWSA-N 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 150000008049 diazo compounds Chemical class 0.000 claims 1
- 238000010992 reflux Methods 0.000 claims 1
- 239000003999 initiator Substances 0.000 abstract 1
- 238000004326 stimulated echo acquisition mode for imaging Methods 0.000 abstract 1
- 239000004816 latex Substances 0.000 description 28
- 229920000126 latex Polymers 0.000 description 28
- 229920000180 alkyd Polymers 0.000 description 7
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 5
- 229910052753 mercury Inorganic materials 0.000 description 5
- 150000002978 peroxides Chemical class 0.000 description 5
- 150000003440 styrenes Chemical class 0.000 description 5
- 239000002174 Styrene-butadiene Substances 0.000 description 3
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000011115 styrene butadiene Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 238000010793 Steam injection (oil industry) Methods 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000002826 nitrites Chemical class 0.000 description 2
- QROGIFZRVHSFLM-UHFFFAOYSA-N prop-1-enylbenzene Chemical class CC=CC1=CC=CC=C1 QROGIFZRVHSFLM-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 229920003048 styrene butadiene rubber Polymers 0.000 description 2
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- WCVOGSZTONGSQY-UHFFFAOYSA-N 2,4,6-trichloroanisole Chemical compound COC1=C(Cl)C=C(Cl)C=C1Cl WCVOGSZTONGSQY-UHFFFAOYSA-N 0.000 description 1
- 208000002874 Acne Vulgaris Diseases 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical class [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 description 1
- 241001481833 Coryphaena hippurus Species 0.000 description 1
- 241001125840 Coryphaenidae Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical group Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 206010000496 acne Diseases 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- DQXBYHZEEUGOBF-UHFFFAOYSA-N but-3-enoic acid;ethene Chemical compound C=C.OC(=O)CC=C DQXBYHZEEUGOBF-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000001687 destabilization Effects 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 239000005038 ethylene vinyl acetate Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F6/00—Post-polymerisation treatments
- C08F6/006—Removal of residual monomers by chemical reaction, e.g. scavenging
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F6/00—Post-polymerisation treatments
- C08F6/001—Removal of residual monomers by physical means
- C08F6/003—Removal of residual monomers by physical means from polymer solutions, suspensions, dispersions or emulsions without recovery of the polymer therefrom
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Dispersion Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US598,927 | 1984-04-10 | ||
| US06/598,927 US4529753A (en) | 1984-04-10 | 1984-04-10 | Chemical/steam stripping |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1229947A true CA1229947A (en) | 1987-12-01 |
Family
ID=24397507
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000476520A Expired CA1229947A (en) | 1984-04-10 | 1985-03-14 | Chemical/steam stripping |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4529753A (enExample) |
| EP (1) | EP0158523B2 (enExample) |
| JP (1) | JPS60229902A (enExample) |
| AU (1) | AU577363B2 (enExample) |
| BR (1) | BR8501656A (enExample) |
| CA (1) | CA1229947A (enExample) |
| DE (1) | DE3565682D1 (enExample) |
| FI (1) | FI82062C (enExample) |
| FR (1) | FR2562545B1 (enExample) |
| NL (1) | NL8501008A (enExample) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4737577A (en) * | 1986-12-31 | 1988-04-12 | Minnesota Mining And Manufacturing Company | Method for removing monomer from an acrylate adhesive by reaction with a scavenger monomer |
| US4687807A (en) * | 1987-02-13 | 1987-08-18 | Nalco Chemical Company | Use of amidase for reducing the acrylamide content of water-in-oil emulsions containing acrylamide polymers |
| JPS63260907A (ja) * | 1987-04-17 | 1988-10-27 | Mitsubishi Petrochem Co Ltd | 高吸水性ポリマ−の製造法 |
| DE3724709A1 (de) * | 1987-07-25 | 1989-02-02 | Stockhausen Chem Fab Gmbh | Verfahren zur herstellung von polymerisaten mit niedrigem restmonomergehalt |
| DE4110058A1 (de) * | 1991-03-27 | 1992-10-01 | Hoechst Ag | Verfahren zur verminderung des restmonomerengehaltes in waessrigen kunststoffdispersionen auf polyvinylesterbasis |
| US5430127A (en) * | 1993-11-02 | 1995-07-04 | National Starch And Chemical Investment Holding Corporation | Process for minimizing residual monomers |
| US5506318A (en) * | 1993-12-13 | 1996-04-09 | Air Products And Chemicals, Inc. | Process for producing N-vinyl pyrrolidone polymer having low residual monomer |
| CN1120180C (zh) * | 1994-06-03 | 2003-09-03 | 巴斯福股份公司 | 聚合物水分散液的制备 |
| DE4435422A1 (de) * | 1994-10-04 | 1996-04-18 | Basf Ag | Verfahren zur Herstellung einer wäßrigen Polymerisatdispersion |
| US5459215A (en) * | 1995-01-03 | 1995-10-17 | Lucky Ltd. | Process for producing a heat-resistant copolymer |
| DE19741184A1 (de) | 1997-09-18 | 1999-03-25 | Basf Ag | Verfahren zur Verminderung von Restmonomeren in Flüssigsystemen unter Zugabe eines Redoxinitiatorsystems |
| DE19828183A1 (de) * | 1998-06-24 | 1999-12-30 | Basf Ag | Verfahren zur Entfernung von restflüchtigen Komponenten aus Polymerdispersionen |
| DE19839199A1 (de) | 1998-08-28 | 2000-03-02 | Basf Ag | Verfahren zur Verminderung der Restmonomerenmenge in wässrigen Polymerdispersionen |
| DE19840586A1 (de) | 1998-09-05 | 2000-03-09 | Basf Ag | Verfahren zur Verminderung der Restmonomerenmenge in wässrigen Polymerdispersionen |
| DE19853421A1 (de) * | 1998-11-19 | 2000-05-25 | Wacker Chemie Gmbh | Verfahren zur Minderung der Geruchsemission wässriger Schutzkolloid-stabilisierter Vinylaromat-1,3-Dien-Copolymerisat-dispersionen |
| DE19911170A1 (de) | 1999-03-12 | 2000-09-14 | Basf Ag | Verfahren zum Herstellen von W/O-Emulsionen |
| DE19928934A1 (de) | 1999-06-24 | 2000-12-28 | Wacker Polymer Systems Gmbh | Verfahren zur Minderung der Geruchsemission wässriger Vinylaromat-1,3-Dien-Copolymerisatdispersionen |
| DE10227589A1 (de) | 2002-06-20 | 2004-01-15 | Wacker Polymer Systems Gmbh & Co. Kg | Verfahren zur Verringerung der Geruchsemission in wässrigen Polymerdispersionen und in Polymerpulvern |
| DE10317434A1 (de) * | 2003-04-15 | 2004-10-28 | Basf Ag | Verfahren zur Reduzierung der Restmonomerenmenge in wässrigen Polymerdispersionen |
| DE10335958A1 (de) * | 2003-08-04 | 2005-02-24 | Basf Ag | Verfahren zur Herstellung wässriger Polymerisatdispersionen |
| DE102004002650A1 (de) * | 2004-01-16 | 2005-08-11 | Basf Ag | Acrylat-Polymerisate auf Basis von tert.-Butylacrylat zur Verwendung in Sprayformulierungen |
| KR100684425B1 (ko) * | 2004-10-21 | 2007-02-16 | 주식회사 엘지화학 | 스티렌-부타디엔계 라텍스의 제조방법 |
| DE502006003213D1 (de) * | 2005-10-07 | 2009-04-30 | Basf Se | Haarfestiger auf basis von t-butylacrylat und hydroxyalkylmethacrylat |
| US9249247B2 (en) | 2009-11-16 | 2016-02-02 | Dsm Ip Assets B.V. | Acrylic polymer |
| WO2011128327A1 (en) | 2010-04-13 | 2011-10-20 | Basf Se | Deodorization of polymer compositions |
| US8211987B2 (en) | 2010-04-13 | 2012-07-03 | Basf Se | Deodorization of polymer compositions |
| JP5967381B2 (ja) | 2010-12-02 | 2016-08-10 | ディーエスエム アイピー アセッツ ビー.ブイ. | アクリル系ポリマー |
| WO2014161817A1 (de) | 2013-04-03 | 2014-10-09 | Basf Se | Verfahren zur reduzierung der restmonomerenmenge in einer wässrigen polymerisatdispersion |
| EP2965785A1 (en) | 2014-07-11 | 2016-01-13 | DSM IP Assets B.V. | Novel use |
| CN111491964A (zh) | 2017-12-22 | 2020-08-04 | 帝斯曼知识产权资产管理有限公司 | 粘合剂组合物及其在3d打印中的用途 |
| US12281071B2 (en) | 2022-07-22 | 2025-04-22 | T.En Process Technology, Inc. | Systems and methods for enhancing the recovery of styrene |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3583967A (en) * | 1968-12-06 | 1971-06-08 | Kao Corp | Method for obtaining polymer from polymer solution |
| US3534009A (en) * | 1969-01-29 | 1970-10-13 | Du Pont | Method for reducing residual vinyl acetate monomer |
| JPS5111878A (en) * | 1974-07-19 | 1976-01-30 | Kureha Chemical Ind Co Ltd | Ratetsukusuyori mihannomonomaano jokyohoho |
| NO752264L (enExample) * | 1974-08-29 | 1976-03-02 | Huels Chemische Werke Ag | |
| DD132588A1 (de) * | 1977-08-11 | 1978-10-11 | Dirk Wulff | Verfahren zur herstellung von vinylchloridpolymeren mit geringem rest-vinylchloridgehalt |
| JPS5437988A (en) * | 1977-08-31 | 1979-03-20 | Komatsu Ltd | Method and apparatus of grinding a crank shaft |
| US4251412A (en) * | 1978-11-01 | 1981-02-17 | The B. F. Goodrich Company | Reducing residual acrylonitrile in water dispersions of acrylonitrile polymers with amine |
| US4272425A (en) * | 1979-10-26 | 1981-06-09 | The B. F. Goodrich Company | Treating dispersions of acrylonitrile polymers |
| DE3006172A1 (de) * | 1980-02-19 | 1981-08-20 | Röhm GmbH, 6100 Darmstadt | Verfahren zur herstellung rest-acrylnitril-armer polymerisat-dispersionen |
| US4278582A (en) * | 1980-02-25 | 1981-07-14 | The B. F. Goodrich Company | Removal of residual acrylonitrile monomer |
-
1984
- 1984-04-10 US US06/598,927 patent/US4529753A/en not_active Expired - Fee Related
-
1985
- 1985-03-14 CA CA000476520A patent/CA1229947A/en not_active Expired
- 1985-04-04 AU AU40880/85A patent/AU577363B2/en not_active Ceased
- 1985-04-04 DE DE8585302414T patent/DE3565682D1/de not_active Expired
- 1985-04-04 NL NL8501008A patent/NL8501008A/nl active Search and Examination
- 1985-04-04 EP EP85302414A patent/EP0158523B2/en not_active Expired
- 1985-04-05 FR FR8505276A patent/FR2562545B1/fr not_active Expired
- 1985-04-09 BR BR8501656A patent/BR8501656A/pt not_active IP Right Cessation
- 1985-04-09 FI FI851399A patent/FI82062C/fi not_active IP Right Cessation
- 1985-04-09 JP JP60075249A patent/JPS60229902A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| BR8501656A (pt) | 1985-12-10 |
| FI82062B (fi) | 1990-09-28 |
| FI851399A0 (fi) | 1985-04-09 |
| EP0158523A3 (en) | 1986-03-19 |
| FI851399L (fi) | 1985-10-11 |
| FR2562545B1 (fr) | 1987-07-10 |
| NL8501008A (nl) | 1985-11-01 |
| FI82062C (fi) | 1991-01-10 |
| AU4088085A (en) | 1985-10-17 |
| DE3565682D1 (en) | 1988-11-24 |
| EP0158523B2 (en) | 1992-11-25 |
| EP0158523B1 (en) | 1988-10-19 |
| AU577363B2 (en) | 1988-09-22 |
| JPH0344561B2 (enExample) | 1991-07-08 |
| EP0158523A2 (en) | 1985-10-16 |
| US4529753A (en) | 1985-07-16 |
| FR2562545A1 (fr) | 1985-10-11 |
| JPS60229902A (ja) | 1985-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1229947A (en) | Chemical/steam stripping | |
| US4301264A (en) | Emulsion polymerization process | |
| US5721310A (en) | Low VOC emulsion | |
| JP3557592B2 (ja) | ジエン系単量体のラジカル重合反応の脱活性化法 | |
| US4196272A (en) | Continuous process for the preparation of an acrylic acid-methyl acrylate copolymer in a tubular reactor | |
| KR970703373A (ko) | 중합체 수분산액의 제조 방법(Method of Producing an Aqueous Polymer Dispersion) | |
| US4272425A (en) | Treating dispersions of acrylonitrile polymers | |
| CA1120624A (en) | Reducing residual acrylonitrile in water dispersions of acrylonitrile polymers | |
| EP0677535A1 (en) | Shortstopping of free radical polymerizations | |
| EP0000419A1 (en) | Process for preparing copolymers, and products fully or partly made of these copolymers. | |
| US2451180A (en) | Catalysts for the polymerization of butadiene-1,3 hydrocarbons | |
| US4255307A (en) | Reducing residual acrylonitrile in water dispersions of acrylonitrile polymers with alkali or ammonium sulfite | |
| GB944266A (en) | Process for the production of acrylonitrile copolymers | |
| US4396740A (en) | Scavenging of residual acrylonitrile monomer in ABS latex | |
| US4163089A (en) | Method of polymerizing acrylonitrile with certain acidic monomers | |
| US3099650A (en) | Process for preparing liquid polymers and copolymers with reduced modifier levels | |
| GB933484A (en) | A process for the polymerisation of acrylonitrile | |
| CN85101585A (zh) | 化学的/蒸汽汽提 | |
| DE2543144A1 (de) | Verfahren zur regelung der freiradikalischen blockpolymerisation von vinylchloridmonomeren | |
| US4079101A (en) | Diolefin polymerization process in the presence of seed polymers | |
| EP0065078B1 (en) | A process for improving the polymerizability of acrylonitrile, acrylamide, acrylic acid and mixtures thereof | |
| JPH06298862A (ja) | p−ヒドロキシスチレン重合体の製造方法 | |
| EP0404453B1 (en) | Dimer reduction | |
| GB959234A (en) | Process for the production of acrylonitrile polymers | |
| GB920391A (en) | Process for purifying unreacted monomers |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |