CA1224591A - Copolyestercarbonate resins - Google Patents
Copolyestercarbonate resinsInfo
- Publication number
- CA1224591A CA1224591A CA000468034A CA468034A CA1224591A CA 1224591 A CA1224591 A CA 1224591A CA 000468034 A CA000468034 A CA 000468034A CA 468034 A CA468034 A CA 468034A CA 1224591 A CA1224591 A CA 1224591A
- Authority
- CA
- Canada
- Prior art keywords
- radicals
- resin
- represented
- divalent
- aromatic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920005989 resin Polymers 0.000 title claims abstract description 70
- 239000011347 resin Substances 0.000 title claims abstract description 70
- -1 aliphatic diols Chemical class 0.000 claims abstract description 138
- 125000003118 aryl group Chemical group 0.000 claims abstract description 27
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims abstract description 24
- 150000002148 esters Chemical class 0.000 claims abstract description 22
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims abstract description 15
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims abstract description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims abstract description 12
- 239000002243 precursor Substances 0.000 claims abstract description 12
- 150000004820 halides Chemical class 0.000 claims abstract description 11
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims abstract description 9
- 230000001747 exhibiting effect Effects 0.000 claims abstract description 7
- 229920001169 thermoplastic Polymers 0.000 claims abstract description 5
- 239000004416 thermosoftening plastic Substances 0.000 claims abstract description 5
- 150000002009 diols Chemical class 0.000 claims abstract 3
- 150000003254 radicals Chemical class 0.000 claims description 34
- 239000004215 Carbon black (E152) Substances 0.000 claims description 24
- 229930195733 hydrocarbon Natural products 0.000 claims description 24
- 229910052736 halogen Inorganic materials 0.000 claims description 16
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 15
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical group ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 5
- 150000002989 phenols Chemical class 0.000 claims description 5
- 239000000047 product Substances 0.000 claims description 4
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 claims description 3
- 125000001118 alkylidene group Chemical group 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims 3
- 125000000217 alkyl group Chemical group 0.000 claims 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 2
- 229910052794 bromium Inorganic materials 0.000 claims 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims 1
- 150000005840 aryl radicals Chemical class 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 241000125205 Anethum Species 0.000 description 31
- 125000004432 carbon atom Chemical group C* 0.000 description 24
- 238000000034 method Methods 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 14
- 239000002253 acid Substances 0.000 description 14
- 229920000642 polymer Polymers 0.000 description 14
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 229920000180 alkyd Polymers 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 125000001931 aliphatic group Chemical group 0.000 description 10
- 235000018936 Vitellaria paradoxa Nutrition 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- FJKROLUGYXJWQN-UHFFFAOYSA-M 4-hydroxybenzoate Chemical compound OC1=CC=C(C([O-])=O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-M 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- 229940106691 bisphenol a Drugs 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 239000000376 reactant Substances 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- 229920000515 polycarbonate Polymers 0.000 description 5
- 239000004417 polycarbonate Substances 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 230000011514 reflex Effects 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000008367 deionised water Substances 0.000 description 3
- 229910021641 deionized water Inorganic materials 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- QGNLHMKIGMZKJX-UHFFFAOYSA-N 3-chloro-4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C(Cl)=C1 QGNLHMKIGMZKJX-UHFFFAOYSA-N 0.000 description 2
- XSAVLGOTFYRGCX-UHFFFAOYSA-N 3-ethyl-4-hydroxybenzoic acid Chemical compound CCC1=CC(C(O)=O)=CC=C1O XSAVLGOTFYRGCX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 240000002132 Beaucarnea recurvata Species 0.000 description 2
- 208000003251 Pruritus Diseases 0.000 description 2
- 239000000370 acceptor Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 125000005587 carbonate group Chemical group 0.000 description 2
- 150000007942 carboxylates Chemical group 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 2
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- HCNHNBLSNVSJTJ-UHFFFAOYSA-N 1,1-Bis(4-hydroxyphenyl)ethane Chemical compound C=1C=C(O)C=CC=1C(C)C1=CC=C(O)C=C1 HCNHNBLSNVSJTJ-UHFFFAOYSA-N 0.000 description 1
- AEQDJSLRWYMAQI-UHFFFAOYSA-N 2,3,9,10-tetramethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline Chemical compound C1CN2CC(C(=C(OC)C=C3)OC)=C3CC2C2=C1C=C(OC)C(OC)=C2 AEQDJSLRWYMAQI-UHFFFAOYSA-N 0.000 description 1
- HWBOPRGVRAEEKO-UHFFFAOYSA-N 2-[(2-carboxy-5-hydroxyphenyl)methyl]-4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1CC1=CC(O)=CC=C1C(O)=O HWBOPRGVRAEEKO-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- DNUYOWCKBJFOGS-UHFFFAOYSA-N 2-[[10-(2,2-dicarboxyethyl)anthracen-9-yl]methyl]propanedioic acid Chemical compound C1=CC=C2C(CC(C(=O)O)C(O)=O)=C(C=CC=C3)C3=C(CC(C(O)=O)C(O)=O)C2=C1 DNUYOWCKBJFOGS-UHFFFAOYSA-N 0.000 description 1
- HQWMAOQEDASZEY-UHFFFAOYSA-N 2-chloro-4-[2-(3-chloro-4-hydroxy-5-methylphenyl)propan-2-yl]-6-methylphenol Chemical compound ClC1=C(O)C(C)=CC(C(C)(C)C=2C=C(Cl)C(O)=C(C)C=2)=C1 HQWMAOQEDASZEY-UHFFFAOYSA-N 0.000 description 1
- WJQOZHYUIDYNHM-UHFFFAOYSA-N 2-tert-Butylphenol Chemical compound CC(C)(C)C1=CC=CC=C1O WJQOZHYUIDYNHM-UHFFFAOYSA-N 0.000 description 1
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 1
- RKSBPFMNOJWYSB-UHFFFAOYSA-N 3,3-Bis(4-hydroxyphenyl)pentane Chemical compound C=1C=C(O)C=CC=1C(CC)(CC)C1=CC=C(O)C=C1 RKSBPFMNOJWYSB-UHFFFAOYSA-N 0.000 description 1
- RJOLIYHZZKAIET-UHFFFAOYSA-N 3-chloro-5-hydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC(Cl)=C1 RJOLIYHZZKAIET-UHFFFAOYSA-N 0.000 description 1
- CFXOUQXGRQXUSE-UHFFFAOYSA-N 3-hydroxy-5-methylbenzoic acid Chemical compound CC1=CC(O)=CC(C(O)=O)=C1 CFXOUQXGRQXUSE-UHFFFAOYSA-N 0.000 description 1
- VWGKEVWFBOUAND-UHFFFAOYSA-N 4,4'-thiodiphenol Chemical compound C1=CC(O)=CC=C1SC1=CC=C(O)C=C1 VWGKEVWFBOUAND-UHFFFAOYSA-N 0.000 description 1
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 1
- BGKMFFFXZCKKGJ-UHFFFAOYSA-N 4-[3-(4-hydroxyphenyl)propyl]phenol Chemical compound C1=CC(O)=CC=C1CCCC1=CC=C(O)C=C1 BGKMFFFXZCKKGJ-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 241000252073 Anguilliformes Species 0.000 description 1
- SDDLEVPIDBLVHC-UHFFFAOYSA-N Bisphenol Z Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)CCCCC1 SDDLEVPIDBLVHC-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 235000012766 Cannabis sativa ssp. sativa var. sativa Nutrition 0.000 description 1
- 235000012765 Cannabis sativa ssp. sativa var. spontanea Nutrition 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 239000004866 Hashish Substances 0.000 description 1
- 241000243251 Hydra Species 0.000 description 1
- 239000004609 Impact Modifier Substances 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000282320 Panthera leo Species 0.000 description 1
- 208000037062 Polyps Diseases 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000005273 aeration Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229940027983 antiseptic and disinfectant quaternary ammonium compound Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical class ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 1
- 150000001565 benzotriazoles Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- MOIPGXQKZSZOQX-UHFFFAOYSA-N carbonyl bromide Chemical compound BrC(Br)=O MOIPGXQKZSZOQX-UHFFFAOYSA-N 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- FOTKYAAJKYLFFN-UHFFFAOYSA-N decane-1,10-diol Chemical compound OCCCCCCCCCCO FOTKYAAJKYLFFN-UHFFFAOYSA-N 0.000 description 1
- JGFBRKRYDCGYKD-UHFFFAOYSA-N dibutyl(oxo)tin Chemical compound CCCC[Sn](=O)CCCC JGFBRKRYDCGYKD-UHFFFAOYSA-N 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000009477 glass transition Effects 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000011968 lewis acid catalyst Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- IJFXRHURBJZNAO-UHFFFAOYSA-N meta--hydroxybenzoic acid Natural products OC(=O)C1=CC=CC(O)=C1 IJFXRHURBJZNAO-UHFFFAOYSA-N 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004957 naphthylene group Chemical group 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 150000008301 phosphite esters Chemical class 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 239000000176 sodium gluconate Substances 0.000 description 1
- 229940005574 sodium gluconate Drugs 0.000 description 1
- 235000012207 sodium gluconate Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000006097 ultraviolet radiation absorber Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/64—Polyesters containing both carboxylic ester groups and carbonate groups
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/562,274 US4476294A (en) | 1983-12-16 | 1983-12-16 | Copolyester-carbonate resins |
| US562,274 | 1983-12-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1224591A true CA1224591A (en) | 1987-07-21 |
Family
ID=24245569
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000468034A Expired CA1224591A (en) | 1983-12-16 | 1984-11-16 | Copolyestercarbonate resins |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4476294A (enExample) |
| EP (1) | EP0146836A3 (enExample) |
| JP (1) | JPS60168721A (enExample) |
| AU (1) | AU578643B2 (enExample) |
| CA (1) | CA1224591A (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4504649A (en) * | 1983-12-16 | 1985-03-12 | General Electric Company | Copolyester-carbonate resins |
| US4696995A (en) * | 1985-03-06 | 1987-09-29 | General Electric Company | Poly(ester-carbonates) and blends based on 3-methyl-4-hydroxy-benzoic acid |
| US4728716A (en) * | 1985-11-12 | 1988-03-01 | General Electric Company | Polycarbonate exhibiting improved impact properties containing divalent residue of polymerized alkadiene monomer |
| US4628081A (en) * | 1985-11-12 | 1986-12-09 | General Electric Company | Polycarbonate exhibiting improved impact properties |
| AU607686B2 (en) * | 1985-11-25 | 1991-03-14 | General Electric Company | Crosslinkable polycyclic polycarbonate oligomers and methods for their preparation and use |
| US5034496A (en) * | 1987-04-15 | 1991-07-23 | The Dow Chemical Company | Polycarbonate compositions |
| AU610570B2 (en) * | 1987-04-15 | 1991-05-23 | Dow Chemical Company, The | Polycarbonate compositions and process for preparing the same |
| US4923933A (en) * | 1989-01-06 | 1990-05-08 | General Electric Company | Polycarbonate/polyphthalate carbonate blends exhibiting good flame resistance |
| JPH02130912U (enExample) * | 1989-04-04 | 1990-10-30 | ||
| CA2013354A1 (en) * | 1989-07-03 | 1991-01-03 | John C. Schmidhauser | Thermoplastic polycarbonate compositions having improved oxygen barrier properties |
| US5110897A (en) * | 1989-07-03 | 1992-05-05 | General Electric Company | Thermoplastic polycarbonate composition having improved oxygen barrier properties from diester diol |
| JP4792202B2 (ja) * | 2004-03-03 | 2011-10-12 | 出光興産株式会社 | ポリカーボネート共重合体、ポリカーボネート共重合体組成物及びそれらからなる光学成形品 |
| CA2777234C (en) | 2009-10-11 | 2019-02-26 | Rutgers, The State University Of New Jersey | Biocompatible polymers for medical devices |
| US11472918B2 (en) | 2012-02-03 | 2022-10-18 | Rutgers, The State University Of New Jersey | Polymeric biomaterials derived from phenolic monomers and their medical uses |
| EP3312155B1 (en) | 2012-02-03 | 2020-08-05 | Rutgers, The State University of New Jersey | Polymeric biomaterials derived from phenolic monomers and their medical uses |
| AU2015370426B2 (en) * | 2014-12-23 | 2019-09-12 | Rutgers, The State University Of New Jersey | Biocompatible iodinated diphenol monomers and polymers |
| US10774030B2 (en) * | 2014-12-23 | 2020-09-15 | Rutgers, The State University Of New Jersey | Polymeric biomaterials derived from phenolic monomers and their medical uses |
| JP7558855B2 (ja) * | 2021-03-19 | 2024-10-01 | 上野製薬株式会社 | ビス(4-ヒドロキシ安息香酸)1,4-シクロヘキサンジイルビスメチレンの精製方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE570530A (enExample) * | 1957-08-22 | |||
| GB906790A (en) * | 1957-11-22 | 1962-09-26 | Columbia Southern Chem Corp | Polycarbonates derived from diepoxy compounds |
| CH421517A (de) * | 1960-12-06 | 1966-09-30 | Inventa Ag | Verfahren zur Herstellung hochmolekularer linearer Kopolyester |
| DE2704315C3 (de) * | 1976-02-12 | 1981-04-30 | Teijin Ltd., Osaka | Aromatische Polyestercarbonate, Verfahren zu ihrer Herstellung und deren Verwendung |
| US4381358A (en) * | 1981-10-16 | 1983-04-26 | General Electric Co. | Copolyester-carbonates containing aliphatic diol co-monomers |
| US4504649A (en) * | 1983-12-16 | 1985-03-12 | General Electric Company | Copolyester-carbonate resins |
| US4487917A (en) * | 1983-12-21 | 1984-12-11 | General Electric Company | Copolyester-carbonate resins exhibiting improved processability |
-
1983
- 1983-12-16 US US06/562,274 patent/US4476294A/en not_active Expired - Lifetime
-
1984
- 1984-11-16 CA CA000468034A patent/CA1224591A/en not_active Expired
- 1984-12-04 EP EP84114753A patent/EP0146836A3/en not_active Withdrawn
- 1984-12-12 AU AU36588/84A patent/AU578643B2/en not_active Ceased
- 1984-12-13 JP JP59261919A patent/JPS60168721A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| AU3658884A (en) | 1985-06-20 |
| AU578643B2 (en) | 1988-11-03 |
| JPS60168721A (ja) | 1985-09-02 |
| JPS6411210B2 (enExample) | 1989-02-23 |
| US4476294A (en) | 1984-10-09 |
| EP0146836A3 (en) | 1987-01-14 |
| EP0146836A2 (en) | 1985-07-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1224591A (en) | Copolyestercarbonate resins | |
| US4469861A (en) | Polycarbonate composition from branched chain dihydric phenol | |
| US4487896A (en) | Copolyester-carbonate compositions exhibiting improved processability | |
| KR940010012B1 (ko) | 코폴리에스테르 카보네이트의 제조방법 | |
| CA1224592A (en) | Copolyestercarbonate resins exhibiting improved processability | |
| EP0219294A1 (en) | Triphenol and polycarbonate polymer prepared therefrom | |
| CA1226088A (en) | Polycarbonates of spiro dihydric phenols | |
| EP0313852A2 (en) | Aromatic polyester-polyorganosiloxane block copolymer | |
| US4381358A (en) | Copolyester-carbonates containing aliphatic diol co-monomers | |
| CA1224589A (en) | Copolyestercarbonate resins | |
| US4960863A (en) | Polycarbonate cross-linked resin | |
| EP0166834A1 (en) | Polycarbonates exhibiting improved heat resistance | |
| US5494997A (en) | Preparation of by the bischloroformate process of soft segment polycarbonate | |
| US4535143A (en) | Process for the preparation of copolycarbonates of sulfonyl diphenol | |
| JPS62223222A (ja) | 熱可塑性ポリエステル―カーボネート樹脂 | |
| US5312890A (en) | Polycarbonate compositions comprising bisphosphine oxide monomer | |
| JPH0579097B2 (enExample) | ||
| US4306055A (en) | Polycarbonates having sulfur-containing phenolic diols incorporated therein | |
| US4608430A (en) | Polycarbonate exhibiting improved heat resistance from diphenol containing disubstituted phenylene radical | |
| JPH07292095A (ja) | 芳香族ポリカーボネート樹脂の改質法 | |
| US5128437A (en) | Polycarbonate from bi(tetrahydrofuran)di phenol | |
| US4605726A (en) | Polyestercarbonate from spiro dihydric phenol | |
| US4547564A (en) | Polyester carbonate from branched chain alkylidene dihydric phenol | |
| US4526956A (en) | Copolyester-carbonates exhibiting improved processability | |
| EP0362659A2 (en) | Spirobindindane copolysiloxanecarbonates and method for their preparation |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |