CA1220888A - Water-curable, silane modified chlorosulfonated olefinic polymers and a process for the preparation thereof - Google Patents
Water-curable, silane modified chlorosulfonated olefinic polymers and a process for the preparation thereofInfo
- Publication number
- CA1220888A CA1220888A CA000456148A CA456148A CA1220888A CA 1220888 A CA1220888 A CA 1220888A CA 000456148 A CA000456148 A CA 000456148A CA 456148 A CA456148 A CA 456148A CA 1220888 A CA1220888 A CA 1220888A
- Authority
- CA
- Canada
- Prior art keywords
- silane
- polymer
- hydrogen
- weight
- curable
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000642 polymer Polymers 0.000 title claims abstract description 79
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 title claims abstract description 40
- 229910000077 silane Inorganic materials 0.000 title claims abstract description 40
- 238000000034 method Methods 0.000 title claims abstract description 10
- 238000002360 preparation method Methods 0.000 title abstract description 5
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 23
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 22
- 239000011593 sulfur Substances 0.000 claims abstract description 22
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 15
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 14
- 239000001301 oxygen Substances 0.000 claims abstract description 14
- 125000004122 cyclic group Chemical group 0.000 claims abstract description 10
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims abstract description 5
- -1 organo titanate Chemical compound 0.000 claims description 44
- 239000000203 mixture Substances 0.000 claims description 28
- 239000004215 Carbon black (E152) Substances 0.000 claims description 24
- 229930195733 hydrocarbon Natural products 0.000 claims description 24
- 239000001257 hydrogen Substances 0.000 claims description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 239000003707 silyl modified polymer Substances 0.000 claims description 17
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 150000002431 hydrogen Chemical group 0.000 claims description 9
- 229910052757 nitrogen Chemical group 0.000 claims description 8
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical group CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 claims description 8
- HQYALQRYBUJWDH-UHFFFAOYSA-N trimethoxy(propyl)silane Chemical compound CCC[Si](OC)(OC)OC HQYALQRYBUJWDH-UHFFFAOYSA-N 0.000 claims description 6
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 4
- 239000005977 Ethylene Substances 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 229920000800 acrylic rubber Polymers 0.000 claims description 3
- 239000004711 α-olefin Substances 0.000 claims description 3
- 229920002681 hypalon Polymers 0.000 claims 3
- 125000003545 alkoxy group Chemical group 0.000 claims 2
- 125000002947 alkylene group Chemical group 0.000 claims 2
- 239000000126 substance Substances 0.000 abstract description 3
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 abstract description 2
- 239000002904 solvent Substances 0.000 abstract description 2
- 238000005299 abrasion Methods 0.000 abstract 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 10
- 239000003054 catalyst Substances 0.000 description 10
- 239000000460 chlorine Substances 0.000 description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 8
- 229960005419 nitrogen Drugs 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 150000001993 dienes Chemical class 0.000 description 5
- 150000004756 silanes Chemical class 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- OSVXSBDYLRYLIG-UHFFFAOYSA-N chlorine dioxide Inorganic materials O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 description 4
- 235000019398 chlorine dioxide Nutrition 0.000 description 4
- 238000004132 cross linking Methods 0.000 description 4
- 229910001873 dinitrogen Inorganic materials 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical group [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 3
- 125000005250 alkyl acrylate group Chemical group 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- SBRXLTRZCJVAPH-UHFFFAOYSA-N ethyl(trimethoxy)silane Chemical compound CC[Si](OC)(OC)OC SBRXLTRZCJVAPH-UHFFFAOYSA-N 0.000 description 3
- 229910000856 hastalloy Inorganic materials 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 150000005673 monoalkenes Chemical class 0.000 description 3
- 125000000962 organic group Chemical group 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 3
- 239000010936 titanium Substances 0.000 description 3
- 229910052719 titanium Inorganic materials 0.000 description 3
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 239000012975 dibutyltin dilaurate Substances 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000000395 magnesium oxide Substances 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- SCPYDCQAZCOKTP-UHFFFAOYSA-N silanol Chemical compound [SiH3]O SCPYDCQAZCOKTP-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- HYBLFDUGSBOMPI-BQYQJAHWSA-N (4e)-octa-1,4-diene Chemical compound CCC\C=C\CC=C HYBLFDUGSBOMPI-BQYQJAHWSA-N 0.000 description 1
- RYSXWUYLAWPLES-MTOQALJVSA-N (Z)-4-hydroxypent-3-en-2-one titanium Chemical compound [Ti].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O RYSXWUYLAWPLES-MTOQALJVSA-N 0.000 description 1
- PRBHEGAFLDMLAL-UHFFFAOYSA-N 1,5-Hexadiene Natural products CC=CCC=C PRBHEGAFLDMLAL-UHFFFAOYSA-N 0.000 description 1
- KTZVZZJJVJQZHV-UHFFFAOYSA-N 1-chloro-4-ethenylbenzene Chemical compound ClC1=CC=C(C=C)C=C1 KTZVZZJJVJQZHV-UHFFFAOYSA-N 0.000 description 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- IHEDBVUTTQXGSJ-UHFFFAOYSA-M 2-[bis(2-oxidoethyl)amino]ethanolate;titanium(4+);hydroxide Chemical compound [OH-].[Ti+4].[O-]CCN(CC[O-])CC[O-] IHEDBVUTTQXGSJ-UHFFFAOYSA-M 0.000 description 1
- WHBAYNMEIXUTJV-UHFFFAOYSA-N 2-chloroethyl prop-2-enoate Chemical compound ClCCOC(=O)C=C WHBAYNMEIXUTJV-UHFFFAOYSA-N 0.000 description 1
- AIFLGMNWQFPTAJ-UHFFFAOYSA-J 2-hydroxypropanoate;titanium(4+) Chemical compound [Ti+4].CC(O)C([O-])=O.CC(O)C([O-])=O.CC(O)C([O-])=O.CC(O)C([O-])=O AIFLGMNWQFPTAJ-UHFFFAOYSA-J 0.000 description 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000004709 Chlorinated polyethylene Substances 0.000 description 1
- 102100024133 Coiled-coil domain-containing protein 50 Human genes 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 101000910772 Homo sapiens Coiled-coil domain-containing protein 50 Proteins 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 1
- NBJODVYWAQLZOC-UHFFFAOYSA-L [dibutyl(octanoyloxy)stannyl] octanoate Chemical compound CCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCC NBJODVYWAQLZOC-UHFFFAOYSA-L 0.000 description 1
- 150000001253 acrylic acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001341 alkaline earth metal compounds Chemical class 0.000 description 1
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical compound C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- 150000001361 allenes Chemical class 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 229940058905 antimony compound for treatment of leishmaniasis and trypanosomiasis Drugs 0.000 description 1
- 150000001463 antimony compounds Chemical class 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 235000011116 calcium hydroxide Nutrition 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 229940095643 calcium hydroxide Drugs 0.000 description 1
- KIZFHUJKFSNWKO-UHFFFAOYSA-M calcium monohydroxide Chemical compound [Ca]O KIZFHUJKFSNWKO-UHFFFAOYSA-M 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 125000005587 carbonate group Chemical group 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 125000002933 cyclohexyloxy group Chemical group C1(CCCCC1)O* 0.000 description 1
- WHHGLZMJPXIBIX-UHFFFAOYSA-N decabromodiphenyl ether Chemical compound BrC1=C(Br)C(Br)=C(Br)C(Br)=C1OC1=C(Br)C(Br)=C(Br)C(Br)=C1Br WHHGLZMJPXIBIX-UHFFFAOYSA-N 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- PBZROIMXDZTJDF-UHFFFAOYSA-N hepta-1,6-dien-4-one Chemical compound C=CCC(=O)CC=C PBZROIMXDZTJDF-UHFFFAOYSA-N 0.000 description 1
- PYGSKMBEVAICCR-UHFFFAOYSA-N hexa-1,5-diene Chemical compound C=CCCC=C PYGSKMBEVAICCR-UHFFFAOYSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- DRRZZMBHJXLZRS-UHFFFAOYSA-N n-[3-[dimethoxy(methyl)silyl]propyl]cyclohexanamine Chemical compound CO[Si](C)(OC)CCCNC1CCCCC1 DRRZZMBHJXLZRS-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- QYZLKGVUSQXAMU-UHFFFAOYSA-N penta-1,4-diene Chemical compound C=CCC=C QYZLKGVUSQXAMU-UHFFFAOYSA-N 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- ISXSCDLOGDJUNJ-UHFFFAOYSA-N tert-butyl prop-2-enoate Chemical compound CC(C)(C)OC(=O)C=C ISXSCDLOGDJUNJ-UHFFFAOYSA-N 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- YBNLWIZAWPBUKQ-UHFFFAOYSA-N trichloro(trichloromethylsulfonyl)methane Chemical compound ClC(Cl)(Cl)S(=O)(=O)C(Cl)(Cl)Cl YBNLWIZAWPBUKQ-UHFFFAOYSA-N 0.000 description 1
- DENFJSAFJTVPJR-UHFFFAOYSA-N triethoxy(ethyl)silane Chemical compound CCO[Si](CC)(OCC)OCC DENFJSAFJTVPJR-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- FUSUHKVFWTUUBE-UHFFFAOYSA-N vinyl methyl ketone Natural products CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/42—Introducing metal atoms or metal-containing groups
Landscapes
- Chemical & Material Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US501,301 | 1983-06-10 | ||
| US06/501,301 US4493924A (en) | 1983-06-10 | 1983-06-10 | Water-curable, silane modified chlorosulfonated olefinic polymers and a process for the preparation thereof |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1220888A true CA1220888A (en) | 1987-04-21 |
Family
ID=23992966
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000456148A Expired CA1220888A (en) | 1983-06-10 | 1984-06-08 | Water-curable, silane modified chlorosulfonated olefinic polymers and a process for the preparation thereof |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4493924A (enExample) |
| EP (1) | EP0131745B1 (enExample) |
| JP (3) | JPS6069147A (enExample) |
| AT (1) | ATE41665T1 (enExample) |
| CA (1) | CA1220888A (enExample) |
| DE (1) | DE3477384D1 (enExample) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4493924A (en) * | 1983-06-10 | 1985-01-15 | Union Carbide Corporation | Water-curable, silane modified chlorosulfonated olefinic polymers and a process for the preparation thereof |
| DE3573794D1 (en) * | 1984-08-06 | 1989-11-23 | Fujikura Ltd | Silane-crosslinkable halogenated polymer composition and process of crosslinking the same |
| FR2618152B1 (fr) * | 1987-07-16 | 1992-02-28 | Filergie Sa | Procede de reticulation de polyolefines halogenees |
| GB2212503B (en) * | 1987-11-16 | 1991-11-20 | Kansai Paint Co Ltd | Composition curable at low temperature |
| US5210150A (en) * | 1991-11-22 | 1993-05-11 | E. I. Du Pont De Nemours And Company | Moisture-curable melt-processible ethylene copolymer adhesives |
| US5605937A (en) * | 1994-09-30 | 1997-02-25 | Knaus; Dennis A. | Moldable thermoplastic polymer foam beads |
| US5814693A (en) * | 1996-02-01 | 1998-09-29 | Forty Ten, L.L.C. | Coatings for concrete containment structures |
| US6967261B1 (en) | 2001-12-28 | 2005-11-22 | Kimberly-Clark Worldwide | Bandage, methods of producing and using same |
| JP4426318B2 (ja) * | 2002-04-08 | 2010-03-03 | 株式会社カネカ | 末端にエポキシ基および/またはオキセタン基含有ケイ素基を有する有機重合体およびその製造方法 |
| US6822135B2 (en) * | 2002-07-26 | 2004-11-23 | Kimberly-Clark Worldwide, Inc. | Fluid storage material including particles secured with a crosslinkable binder composition and method of making same |
| US6808801B2 (en) | 2002-07-26 | 2004-10-26 | Kimberly-Clark Worldwide, Inc. | Absorbent article with self-forming absorbent binder layer |
| US6887961B2 (en) * | 2002-07-26 | 2005-05-03 | Kimberly-Clark Worldwide, Inc. | Absorbent binder composition and method of making it |
| US6737491B2 (en) | 2002-07-26 | 2004-05-18 | Kimberly-Clark Worldwide, Inc. | Absorbent binder composition and method of making same |
| US6964803B2 (en) | 2002-07-26 | 2005-11-15 | Kimberly-Clark Worldwide, Inc. | Absorbent structures with selectively placed flexible absorbent binder |
| US7205259B2 (en) * | 2002-07-26 | 2007-04-17 | Kimberly-Clark Worldwide, Inc. | Absorbent binder desiccant composition and articles incorporating it |
| JP4564921B2 (ja) | 2002-07-26 | 2010-10-20 | キンバリー クラーク ワールドワイド インコーポレイテッド | 吸収性バインダの組成、その製造方法、及びこれを組み入れた物品 |
| US7115321B2 (en) * | 2002-07-26 | 2006-10-03 | Kimberly-Clark Worldwide, Inc. | Absorbent binder coating |
| US7378566B2 (en) * | 2002-12-13 | 2008-05-27 | Kimberly-Clark Worldwide, Inc. | Absorbent core including folded substrate |
| US7294591B2 (en) * | 2002-12-13 | 2007-11-13 | Kimberly-Clark Worldwide, Inc. | Absorbent composite including a folded substrate and an absorbent adhesive composition |
| US20050186427A1 (en) * | 2004-02-19 | 2005-08-25 | The Procter & Gamble Company | Lubricious coated applicator |
| US20070083175A1 (en) * | 2005-10-11 | 2007-04-12 | Kimberly-Clark Worldwide, Inc. | Transparent/translucent absorbent composites and articles |
| US20070129697A1 (en) * | 2005-12-02 | 2007-06-07 | Soerens Dave A | Articles comprising flexible superabsorbent binder polymer composition |
| US7619131B2 (en) * | 2005-12-02 | 2009-11-17 | Kimberly-Clark Worldwide, Inc. | Articles comprising transparent/translucent polymer composition |
| US7335713B2 (en) | 2005-12-02 | 2008-02-26 | Stockhausen, Inc. | Method for preparing a flexible superabsorbent binder polymer composition |
| US7312286B2 (en) * | 2005-12-02 | 2007-12-25 | Stockhausen, Inc. | Flexible superabsorbent binder polymer composition |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3398045A (en) * | 1963-01-02 | 1968-08-20 | Exxon Research Engineering Co | Bonding rubbery polyolefins to organic materials |
| US3441545A (en) * | 1963-11-01 | 1969-04-29 | Du Pont | Modification of olefin-carboxylic acid halide copolymers |
| GB1084071A (enExample) * | 1964-04-27 | |||
| US3408420A (en) * | 1964-04-30 | 1968-10-29 | Du Pont | Silane-modified olefinic copolymers |
| US3366612A (en) * | 1965-07-13 | 1968-01-30 | Exxon Research Engineering Co | Moisture curable one component mastic or castable rubber formed by the reaction between a halogenated butyl rubber and a silane containing a functional group and hydrolyzable substituents |
| DE1243677B (de) * | 1965-08-03 | 1967-07-06 | Esso A G | Verfahren zur Herstellung von Sulfonsaeureestern |
| BE794718Q (fr) * | 1968-12-20 | 1973-05-16 | Dow Corning Ltd | Procede de reticulation d'olefines |
| JPS5144966B2 (enExample) * | 1972-05-19 | 1976-12-01 | ||
| US4291136A (en) * | 1978-03-31 | 1981-09-22 | Union Carbide Corporation | Water-curable silane modified alkylene alkylacrylate copolymer and a process for its production |
| US4328323A (en) * | 1979-08-29 | 1982-05-04 | Union Carbide Corporation | Production of silane modified copolymers of alkylene-alkyl acrylates |
| US4343917A (en) * | 1979-08-29 | 1982-08-10 | Union Carbide Corporation | Water curable, amino silane modified alkylene-alkyl acrylate copolymers |
| JPS56167739A (en) * | 1980-05-28 | 1981-12-23 | Fujikura Ltd | Crosslinking method of polychloroprene |
| JPS578203A (en) * | 1980-06-18 | 1982-01-16 | Fujikura Ltd | Crosslinking of chlorinated polyethylene |
| JPS5728107A (en) * | 1980-07-26 | 1982-02-15 | Fujikura Ltd | Crosslinking of chlorosulfonated polyethylene |
| JPS5796049A (en) * | 1980-12-05 | 1982-06-15 | Fujikura Ltd | Low-temperature curing (vulcanizing) method of halogen-containing polymer and crosslinkable halogen-containing polymeric composition used therefor |
| JPS59118390A (ja) * | 1982-12-23 | 1984-07-09 | 三菱電機株式会社 | 物品把持方法 |
| US4493924A (en) * | 1983-06-10 | 1985-01-15 | Union Carbide Corporation | Water-curable, silane modified chlorosulfonated olefinic polymers and a process for the preparation thereof |
-
1983
- 1983-06-10 US US06/501,301 patent/US4493924A/en not_active Expired - Fee Related
-
1984
- 1984-06-08 DE DE8484106611T patent/DE3477384D1/de not_active Expired
- 1984-06-08 CA CA000456148A patent/CA1220888A/en not_active Expired
- 1984-06-08 EP EP84106611A patent/EP0131745B1/en not_active Expired
- 1984-06-08 AT AT84106611T patent/ATE41665T1/de not_active IP Right Cessation
- 1984-06-11 JP JP59118390A patent/JPS6069147A/ja active Granted
-
1988
- 1988-04-11 JP JP63087433A patent/JPS63264605A/ja active Granted
- 1988-12-08 JP JP63309008A patent/JPH01252647A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPH01252647A (ja) | 1989-10-09 |
| JPH0432084B2 (enExample) | 1992-05-28 |
| EP0131745A3 (en) | 1986-07-16 |
| JPH0130858B2 (enExample) | 1989-06-22 |
| JPS63264605A (ja) | 1988-11-01 |
| EP0131745B1 (en) | 1989-03-22 |
| JPH0432105B2 (enExample) | 1992-05-28 |
| DE3477384D1 (en) | 1989-04-27 |
| ATE41665T1 (de) | 1989-04-15 |
| EP0131745A2 (en) | 1985-01-23 |
| JPS6069147A (ja) | 1985-04-19 |
| US4493924A (en) | 1985-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1220888A (en) | Water-curable, silane modified chlorosulfonated olefinic polymers and a process for the preparation thereof | |
| CA1232394A (en) | Production of water-curable, silane modified thermoplastic polymers | |
| EP0073027B1 (en) | Masterbatch composition comprising a matrix having a polysiloxane dispersed therein and a method for the preparation thereof | |
| EP0049155B1 (en) | Production of silane modified copolymers of alkylene-alkyl acrylates, polysiloxanes having combined therein organo titanates used in their production, process for producing such polysiloxanes, and electrical conductors insulated by cured silane modified copolymers | |
| US4434272A (en) | Water-curable, silane modified alkyl acrylate copolymers and a process for the preparation thereof | |
| US4446279A (en) | Compositions based on a polysiloxane and an organo titanate and the use thereof in the preparation of water curable, silane modified alkylene-alkyl acrylate copolymers | |
| EP0150773B1 (en) | Water curable, azide sulfonyl silane modified ethylene polymers | |
| EP0106062B1 (en) | Polysiloxanes and the use thereof in the production of silane modified alkylene-alkyl acrylate copolymers | |
| US4440907A (en) | Process of producing a water-curable, silane modified alkylene-alkyl acrylate copolymer by reacting an alkylene-alkyl acrylate copolymer with a polysiloxane predispersed in a thermoplastic resin matrix | |
| EP0169069B1 (en) | Polymer composition | |
| EP0093806A1 (en) | Compositions based on water-curable, silane modified copolymers of alkylene-alkyl acrylates | |
| CA1282522C (en) | Scorch resistant compositions based on water-curable thermoplastic polymers having hydrolyzable, pendant silane moieties, and organo titanates | |
| US4959413A (en) | Crosslinkable polymers | |
| US4593072A (en) | Relatively water-stable compositions based on thermoplastic polymers containing pendant silane moieties | |
| EP0150774B1 (en) | Water curable, azide sulfonyl silane modified, alkylene acrylate copolymers | |
| EP0131949B1 (en) | Preparation of highly elastomeric ethylene-acrylic ester copolymers | |
| US4717753A (en) | Chlorosulfonated alkylene-alkyl acrylate copolymers | |
| CA1186437A (en) | Production of silane modified copolymers of alkylene- alkyl acrylates, polysiloxanes having combined therein organo titanates and the use thereof in the production of silane modified copolymers of alkylene- alkyl acrylates | |
| JPS6218577B2 (enExample) | ||
| CA1177195A (en) | Compositions based on water-curable silane modified copolymers of alkylene-alkyl acrylates | |
| JPS6310605A (ja) | 水架橋可能なハロゲン含有重合体の製造方法 | |
| NO821247L (no) | Preparat basert paa vannbare silanmodifiserte kopolymere av alkylen-alkylakrylater |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |