CA1216841A - Cephalosporin derivatives, their production and use - Google Patents
Cephalosporin derivatives, their production and useInfo
- Publication number
 - CA1216841A CA1216841A CA000455316A CA455316A CA1216841A CA 1216841 A CA1216841 A CA 1216841A CA 000455316 A CA000455316 A CA 000455316A CA 455316 A CA455316 A CA 455316A CA 1216841 A CA1216841 A CA 1216841A
 - Authority
 - CA
 - Canada
 - Prior art keywords
 - compound
 - methyl
 - ceph
 - aminothiazol
 - dimethylaminoethyl
 - Prior art date
 - Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
 - Expired
 
Links
- 238000004519 manufacturing process Methods 0.000 title abstract description 7
 - 229930186147 Cephalosporin Natural products 0.000 title abstract description 5
 - 229940124587 cephalosporin Drugs 0.000 title abstract description 5
 - 150000001780 cephalosporins Chemical class 0.000 title abstract description 4
 - 150000001875 compounds Chemical class 0.000 claims abstract description 117
 - 150000003839 salts Chemical class 0.000 claims abstract description 59
 - 238000000034 method Methods 0.000 claims abstract description 53
 - 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 11
 - 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 claims abstract description 9
 - 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims abstract description 9
 - 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims abstract description 8
 - 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims abstract description 8
 - 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 claims abstract description 5
 - 125000003342 alkenyl group Chemical group 0.000 claims abstract description 5
 - 125000000217 alkyl group Chemical group 0.000 claims abstract description 4
 - 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 claims abstract 5
 - 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims abstract 5
 - -1 acetoxy, acetoacetoxy Chemical group 0.000 claims description 111
 - 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 37
 - 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 36
 - 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 34
 - VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 14
 - UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 12
 - 239000000126 substance Substances 0.000 claims description 8
 - XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 6
 - 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 claims description 5
 - 125000005916 2-methylpentyl group Chemical group 0.000 claims description 5
 - IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 claims description 4
 - ODDAWJGQWOGBCX-UHFFFAOYSA-N 1-[2-(dimethylazaniumyl)ethyl]tetrazole-5-thiolate Chemical compound CN(C)CCN1N=NN=C1S ODDAWJGQWOGBCX-UHFFFAOYSA-N 0.000 claims description 4
 - 229910052736 halogen Inorganic materials 0.000 claims description 4
 - 150000002367 halogens Chemical class 0.000 claims description 4
 - CSXCEQPWXHUSIX-UHFFFAOYSA-N pentan-2-yl hydrogen carbonate Chemical compound CCCC(C)OC(O)=O CSXCEQPWXHUSIX-UHFFFAOYSA-N 0.000 claims description 4
 - DYCLHZPOADTVKK-UHFFFAOYSA-N 2-(2-azaniumyl-1,3-thiazol-4-yl)acetate Chemical compound NC1=NC(CC(O)=O)=CS1 DYCLHZPOADTVKK-UHFFFAOYSA-N 0.000 claims description 3
 - WSHVQVCBPLNREW-UHFFFAOYSA-N 4-chloro-3-oxobutanoyl chloride Chemical compound ClCC(=O)CC(Cl)=O WSHVQVCBPLNREW-UHFFFAOYSA-N 0.000 claims description 2
 - ORZQEPREONWGPN-UHFFFAOYSA-N 1-iodoethyl 3-methylbutyl carbonate Chemical compound CC(C)CCOC(=O)OC(C)I ORZQEPREONWGPN-UHFFFAOYSA-N 0.000 claims 1
 - HINNIHUYTFHPOO-UHFFFAOYSA-N 2,2-dimethylpropyl 1-iodoethyl carbonate Chemical compound CC(I)OC(=O)OCC(C)(C)C HINNIHUYTFHPOO-UHFFFAOYSA-N 0.000 claims 1
 - 125000004299 tetrazol-5-yl group Chemical group [H]N1N=NC(*)=N1 0.000 claims 1
 - 239000003242 anti bacterial agent Substances 0.000 abstract 1
 - 229940088710 antibiotic agent Drugs 0.000 abstract 1
 - YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 54
 - 238000006243 chemical reaction Methods 0.000 description 39
 - 239000002904 solvent Substances 0.000 description 29
 - XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 28
 - ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 28
 - WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 27
 - 239000000203 mixture Substances 0.000 description 27
 - CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 21
 - IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 16
 - ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
 - 239000002253 acid Substances 0.000 description 15
 - FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 15
 - 239000000243 solution Substances 0.000 description 15
 - HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
 - FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 14
 - XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
 - 238000003756 stirring Methods 0.000 description 13
 - JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
 - UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 11
 - 150000002148 esters Chemical group 0.000 description 11
 - 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 11
 - 239000012044 organic layer Substances 0.000 description 11
 - WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
 - 239000002585 base Substances 0.000 description 10
 - 229940093499 ethyl acetate Drugs 0.000 description 10
 - 238000001914 filtration Methods 0.000 description 9
 - LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
 - CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
 - 125000003277 amino group Chemical group 0.000 description 8
 - 238000000921 elemental analysis Methods 0.000 description 8
 - 239000005457 ice water Substances 0.000 description 8
 - ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 7
 - ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 7
 - 239000000460 chlorine Substances 0.000 description 7
 - 229910052801 chlorine Inorganic materials 0.000 description 7
 - 229910052740 iodine Inorganic materials 0.000 description 7
 - 239000011630 iodine Substances 0.000 description 7
 - 239000010410 layer Substances 0.000 description 7
 - 239000000047 product Substances 0.000 description 7
 - 229920006395 saturated elastomer Polymers 0.000 description 7
 - 239000011780 sodium chloride Substances 0.000 description 7
 - 241000894007 species Species 0.000 description 7
 - OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
 - CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
 - RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 6
 - 238000010521 absorption reaction Methods 0.000 description 6
 - 125000004442 acylamino group Chemical group 0.000 description 6
 - 239000003795 chemical substances by application Substances 0.000 description 6
 - KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
 - 238000005886 esterification reaction Methods 0.000 description 6
 - 125000005843 halogen group Chemical group 0.000 description 6
 - HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
 - BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
 - 239000000843 powder Substances 0.000 description 6
 - 125000006239 protecting group Chemical group 0.000 description 6
 - UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
 - 239000011541 reaction mixture Substances 0.000 description 6
 - 239000007858 starting material Substances 0.000 description 6
 - OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 5
 - FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 5
 - JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 5
 - 229910052783 alkali metal Inorganic materials 0.000 description 5
 - 239000002244 precipitate Substances 0.000 description 5
 - 230000035484 reaction time Effects 0.000 description 5
 - 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
 - 235000017557 sodium bicarbonate Nutrition 0.000 description 5
 - 235000009518 sodium iodide Nutrition 0.000 description 5
 - 229940086542 triethylamine Drugs 0.000 description 5
 - RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
 - NAJMIVLMDLWNRF-UHFFFAOYSA-N 2-methylbutyl hydrogen carbonate Chemical compound CCC(C)COC(O)=O NAJMIVLMDLWNRF-UHFFFAOYSA-N 0.000 description 4
 - CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 4
 - 241000894006 Bacteria Species 0.000 description 4
 - WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
 - ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
 - RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
 - IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 4
 - MHABMANUFPZXEB-UHFFFAOYSA-N O-demethyl-aloesaponarin I Natural products O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=C(O)C(C(O)=O)=C2C MHABMANUFPZXEB-UHFFFAOYSA-N 0.000 description 4
 - ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
 - QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
 - 150000008065 acid anhydrides Chemical class 0.000 description 4
 - 239000007864 aqueous solution Substances 0.000 description 4
 - GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
 - 229910052794 bromium Inorganic materials 0.000 description 4
 - 238000001816 cooling Methods 0.000 description 4
 - 239000000706 filtrate Substances 0.000 description 4
 - 239000008187 granular material Substances 0.000 description 4
 - 239000011591 potassium Substances 0.000 description 4
 - 229910052700 potassium Inorganic materials 0.000 description 4
 - 229960003975 potassium Drugs 0.000 description 4
 - ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
 - QPRQEDXDYOZYLA-UHFFFAOYSA-N 2-methylbutan-1-ol Chemical compound CCC(C)CO QPRQEDXDYOZYLA-UHFFFAOYSA-N 0.000 description 3
 - QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
 - GSNUFIFRDBKVIE-UHFFFAOYSA-N DMF Natural products CC1=CC=C(C)O1 GSNUFIFRDBKVIE-UHFFFAOYSA-N 0.000 description 3
 - QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
 - DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
 - KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
 - DBTDEFJAFBUGPP-UHFFFAOYSA-N Methanethial Chemical compound S=C DBTDEFJAFBUGPP-UHFFFAOYSA-N 0.000 description 3
 - 241000699666 Mus <mouse, genus> Species 0.000 description 3
 - MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
 - KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
 - OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
 - HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
 - FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 3
 - 229910000288 alkali metal carbonate Inorganic materials 0.000 description 3
 - 150000008041 alkali metal carbonates Chemical class 0.000 description 3
 - 150000001408 amides Chemical class 0.000 description 3
 - 230000015572 biosynthetic process Effects 0.000 description 3
 - 238000009835 boiling Methods 0.000 description 3
 - 239000001913 cellulose Substances 0.000 description 3
 - 229920002678 cellulose Polymers 0.000 description 3
 - QOPVNWQGBQYBBP-UHFFFAOYSA-N chloroethyl chloroformate Chemical compound CC(Cl)OC(Cl)=O QOPVNWQGBQYBBP-UHFFFAOYSA-N 0.000 description 3
 - 150000004820 halides Chemical class 0.000 description 3
 - 150000008282 halocarbons Chemical class 0.000 description 3
 - GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
 - 239000012442 inert solvent Substances 0.000 description 3
 - 238000002329 infrared spectrum Methods 0.000 description 3
 - 235000019359 magnesium stearate Nutrition 0.000 description 3
 - 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
 - 150000007524 organic acids Chemical class 0.000 description 3
 - 229910000027 potassium carbonate Inorganic materials 0.000 description 3
 - 235000011181 potassium carbonates Nutrition 0.000 description 3
 - 239000011734 sodium Substances 0.000 description 3
 - 229910052708 sodium Inorganic materials 0.000 description 3
 - 229910000029 sodium carbonate Inorganic materials 0.000 description 3
 - 239000011975 tartaric acid Substances 0.000 description 3
 - 235000002906 tartaric acid Nutrition 0.000 description 3
 - 150000003512 tertiary amines Chemical class 0.000 description 3
 - QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 2
 - BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 2
 - WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical group ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
 - HXQQJHHWWNVMJS-UHFFFAOYSA-N 2,4-dimethylpentan-3-yl hydrogen carbonate Chemical compound CC(C)C(C(C)C)OC(O)=O HXQQJHHWWNVMJS-UHFFFAOYSA-N 0.000 description 2
 - 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
 - VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
 - FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
 - VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
 - AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
 - LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
 - NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
 - 241000588770 Proteus mirabilis Species 0.000 description 2
 - IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 2
 - PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
 - 229920002472 Starch Polymers 0.000 description 2
 - KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
 - 150000007513 acids Chemical class 0.000 description 2
 - 125000002252 acyl group Chemical group 0.000 description 2
 - 238000005917 acylation reaction Methods 0.000 description 2
 - 150000001340 alkali metals Chemical class 0.000 description 2
 - BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
 - HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 2
 - 230000000844 anti-bacterial effect Effects 0.000 description 2
 - 239000011668 ascorbic acid Substances 0.000 description 2
 - 235000010323 ascorbic acid Nutrition 0.000 description 2
 - 229960005070 ascorbic acid Drugs 0.000 description 2
 - WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
 - 239000008280 blood Substances 0.000 description 2
 - 210000004369 blood Anatomy 0.000 description 2
 - KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 2
 - 239000002775 capsule Substances 0.000 description 2
 - 229910052799 carbon Inorganic materials 0.000 description 2
 - 239000003054 catalyst Substances 0.000 description 2
 - 239000007795 chemical reaction product Substances 0.000 description 2
 - 125000001309 chloro group Chemical group Cl* 0.000 description 2
 - 238000004587 chromatography analysis Methods 0.000 description 2
 - 235000015165 citric acid Nutrition 0.000 description 2
 - UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 2
 - 238000004440 column chromatography Methods 0.000 description 2
 - 238000002425 crystallisation Methods 0.000 description 2
 - 230000008025 crystallization Effects 0.000 description 2
 - 239000012458 free base Substances 0.000 description 2
 - 210000001035 gastrointestinal tract Anatomy 0.000 description 2
 - 238000002955 isolation Methods 0.000 description 2
 - 239000000314 lubricant Substances 0.000 description 2
 - 239000001630 malic acid Substances 0.000 description 2
 - 235000011090 malic acid Nutrition 0.000 description 2
 - 229960002510 mandelic acid Drugs 0.000 description 2
 - 150000007522 mineralic acids Chemical class 0.000 description 2
 - 150000002825 nitriles Chemical class 0.000 description 2
 - 229910052757 nitrogen Inorganic materials 0.000 description 2
 - 230000003287 optical effect Effects 0.000 description 2
 - 238000010979 pH adjustment Methods 0.000 description 2
 - UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
 - XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
 - SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
 - 235000015497 potassium bicarbonate Nutrition 0.000 description 2
 - 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
 - 239000011736 potassium bicarbonate Substances 0.000 description 2
 - TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
 - 229940086066 potassium hydrogencarbonate Drugs 0.000 description 2
 - 239000000376 reactant Substances 0.000 description 2
 - 239000007787 solid Substances 0.000 description 2
 - 238000000638 solvent extraction Methods 0.000 description 2
 - 239000008107 starch Substances 0.000 description 2
 - 235000019698 starch Nutrition 0.000 description 2
 - 125000001424 substituent group Chemical group 0.000 description 2
 - GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 2
 - 239000000454 talc Substances 0.000 description 2
 - 229910052623 talc Inorganic materials 0.000 description 2
 - JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
 - VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
 - GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
 - FZEVMBJWXHDLDB-ZCFIWIBFSA-N (6r)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical compound S1CC=CN2C(=O)C[C@H]21 FZEVMBJWXHDLDB-ZCFIWIBFSA-N 0.000 description 1
 - CFGDUGSIBUXRMR-UHFFFAOYSA-N 1,2-dihydropyrrol-2-ide Chemical class C=1C=[C-]NC=1 CFGDUGSIBUXRMR-UHFFFAOYSA-N 0.000 description 1
 - RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical group NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
 - MYMALJRSNVUBAI-UHFFFAOYSA-N 1,3-thiazol-4-imine Chemical compound N=C1CSC=N1 MYMALJRSNVUBAI-UHFFFAOYSA-N 0.000 description 1
 - FAJZEYVYKWLEDI-UHFFFAOYSA-N 1-chloroethyl 2-methylbutyl carbonate Chemical compound CCC(C)COC(=O)OC(C)Cl FAJZEYVYKWLEDI-UHFFFAOYSA-N 0.000 description 1
 - KBVARVHDKVJZDQ-UHFFFAOYSA-N 1-chloroethyl 3-methylbut-3-enyl carbonate Chemical compound CC(Cl)OC(=O)OCCC(C)=C KBVARVHDKVJZDQ-UHFFFAOYSA-N 0.000 description 1
 - 125000006219 1-ethylpentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
 - 125000006048 1-methyl-2-pentenyl group Chemical group 0.000 description 1
 - 125000006030 1-methyl-3-butenyl group Chemical group 0.000 description 1
 - 125000006052 1-methyl-3-pentenyl group Chemical group 0.000 description 1
 - XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 1
 - QOUXALMWSBWSDJ-UHFFFAOYSA-N 2,2-dimethylpropyl hydrogen carbonate Chemical compound CC(C)(C)COC(O)=O QOUXALMWSBWSDJ-UHFFFAOYSA-N 0.000 description 1
 - ZEWJJZKVQOMYKJ-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)acetic acid;hydrochloride Chemical compound Cl.NC1=NC(CC(O)=O)=CS1 ZEWJJZKVQOMYKJ-UHFFFAOYSA-N 0.000 description 1
 - PTTPXKJBFFKCEK-UHFFFAOYSA-N 2-Methyl-4-heptanone Chemical compound CC(C)CC(=O)CC(C)C PTTPXKJBFFKCEK-UHFFFAOYSA-N 0.000 description 1
 - NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
 - 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
 - VJODQAKRUSRKOG-UHFFFAOYSA-N 2-ethylbutyl hydrogen carbonate Chemical compound CCC(CC)COC(O)=O VJODQAKRUSRKOG-UHFFFAOYSA-N 0.000 description 1
 - 125000006026 2-methyl-1-butenyl group Chemical group 0.000 description 1
 - 125000006045 2-methyl-1-pentenyl group Chemical group 0.000 description 1
 - 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
 - 125000006029 2-methyl-2-butenyl group Chemical group 0.000 description 1
 - 125000006049 2-methyl-2-pentenyl group Chemical group 0.000 description 1
 - 125000006031 2-methyl-3-butenyl group Chemical group 0.000 description 1
 - 125000006053 2-methyl-3-pentenyl group Chemical group 0.000 description 1
 - 125000006056 2-methyl-4-pentenyl group Chemical group 0.000 description 1
 - XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 1
 - 125000003229 2-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
 - BODDYKBORCLDDS-UHFFFAOYSA-N 2-methylpentyl hydrogen carbonate Chemical compound CCCC(C)COC(O)=O BODDYKBORCLDDS-UHFFFAOYSA-N 0.000 description 1
 - QRAFJHXNLQTXQW-UHFFFAOYSA-M 2-methylpropyl carbonate Chemical compound CC(C)COC([O-])=O QRAFJHXNLQTXQW-UHFFFAOYSA-M 0.000 description 1
 - QRAFJHXNLQTXQW-UHFFFAOYSA-N 2-methylpropyl hydrogen carbonate Chemical compound CC(C)COC(O)=O QRAFJHXNLQTXQW-UHFFFAOYSA-N 0.000 description 1
 - 125000006024 2-pentenyl group Chemical group 0.000 description 1
 - 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
 - 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
 - 125000004337 3-ethylpentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
 - 125000006046 3-methyl-1-pentenyl group Chemical group 0.000 description 1
 - 125000006050 3-methyl-2-pentenyl group Chemical group 0.000 description 1
 - 125000006032 3-methyl-3-butenyl group Chemical group 0.000 description 1
 - 125000006054 3-methyl-3-pentenyl group Chemical group 0.000 description 1
 - 125000006057 3-methyl-4-pentenyl group Chemical group 0.000 description 1
 - YNTJDKGLKYKGJK-UHFFFAOYSA-N 3-methylbut-3-enyl hydrogen carbonate Chemical compound CC(=C)CCOC(O)=O YNTJDKGLKYKGJK-UHFFFAOYSA-N 0.000 description 1
 - YSJUCRQFZUWVDM-UHFFFAOYSA-N 3-methylbutyl hydrogen carbonate Chemical compound CC(C)CCOC(O)=O YSJUCRQFZUWVDM-UHFFFAOYSA-N 0.000 description 1
 - 125000003469 3-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
 - 125000005917 3-methylpentyl group Chemical group 0.000 description 1
 - HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 1
 - 125000006047 4-methyl-1-pentenyl group Chemical group 0.000 description 1
 - 125000006051 4-methyl-2-pentenyl group Chemical group 0.000 description 1
 - 125000003119 4-methyl-3-pentenyl group Chemical group [H]\C(=C(/C([H])([H])[H])C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
 - XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
 - QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
 - GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
 - IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
 - 239000005711 Benzoic acid Substances 0.000 description 1
 - BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
 - CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
 - OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
 - OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
 - BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
 - 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
 - QYQDKDWGWDOFFU-IUODEOHRSA-N Cefotiam Chemical compound CN(C)CCN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CC=3N=C(N)SC=3)[C@H]2SC1 QYQDKDWGWDOFFU-IUODEOHRSA-N 0.000 description 1
 - 229940126062 Compound A Drugs 0.000 description 1
 - GKQLYSROISKDLL-UHFFFAOYSA-N EEDQ Chemical compound C1=CC=C2N(C(=O)OCC)C(OCC)C=CC2=C1 GKQLYSROISKDLL-UHFFFAOYSA-N 0.000 description 1
 - 102000004190 Enzymes Human genes 0.000 description 1
 - 108090000790 Enzymes Proteins 0.000 description 1
 - 241000588724 Escherichia coli Species 0.000 description 1
 - 241000192125 Firmicutes Species 0.000 description 1
 - 229920000084 Gum arabic Polymers 0.000 description 1
 - NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
 - 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
 - 241000588747 Klebsiella pneumoniae Species 0.000 description 1
 - GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
 - WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
 - FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
 - 241001465754 Metazoa Species 0.000 description 1
 - 241000588772 Morganella morganii Species 0.000 description 1
 - 241000699670 Mus sp. Species 0.000 description 1
 - GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
 - MJGJPHUUDJCUEC-UHFFFAOYSA-N OC(=O)C[Ca] Chemical compound OC(=O)C[Ca] MJGJPHUUDJCUEC-UHFFFAOYSA-N 0.000 description 1
 - 229930182555 Penicillin Natural products 0.000 description 1
 - 241000588767 Proteus vulgaris Species 0.000 description 1
 - 241000978776 Senegalia senegal Species 0.000 description 1
 - 241000191967 Staphylococcus aureus Species 0.000 description 1
 - 239000000205 acacia gum Substances 0.000 description 1
 - 235000010489 acacia gum Nutrition 0.000 description 1
 - 235000011054 acetic acid Nutrition 0.000 description 1
 - 125000001931 aliphatic group Chemical group 0.000 description 1
 - 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
 - 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
 - 150000001342 alkaline earth metals Chemical class 0.000 description 1
 - 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
 - 150000001412 amines Chemical class 0.000 description 1
 - 150000003863 ammonium salts Chemical class 0.000 description 1
 - 238000004458 analytical method Methods 0.000 description 1
 - 125000003118 aryl group Chemical group 0.000 description 1
 - 238000003556 assay Methods 0.000 description 1
 - 235000010233 benzoic acid Nutrition 0.000 description 1
 - 229960004365 benzoic acid Drugs 0.000 description 1
 - YXIWHUQXZSMYRE-UHFFFAOYSA-N benzothiazolyl mercaptan Natural products C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 1
 - 239000011230 binding agent Substances 0.000 description 1
 - 230000003115 biocidal effect Effects 0.000 description 1
 - 239000011575 calcium Substances 0.000 description 1
 - 229910052791 calcium Inorganic materials 0.000 description 1
 - 229910000019 calcium carbonate Inorganic materials 0.000 description 1
 - 239000001506 calcium phosphate Substances 0.000 description 1
 - 229910000389 calcium phosphate Inorganic materials 0.000 description 1
 - 235000011010 calcium phosphates Nutrition 0.000 description 1
 - 150000001721 carbon Chemical group 0.000 description 1
 - 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
 - 239000001768 carboxy methyl cellulose Substances 0.000 description 1
 - 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
 - 150000007942 carboxylates Chemical class 0.000 description 1
 - 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
 - 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
 - 229960001242 cefotiam Drugs 0.000 description 1
 - 150000001782 cephems Chemical class 0.000 description 1
 - 239000003153 chemical reaction reagent Substances 0.000 description 1
 - 238000002512 chemotherapy Methods 0.000 description 1
 - 230000008878 coupling Effects 0.000 description 1
 - 238000010168 coupling process Methods 0.000 description 1
 - 238000005859 coupling reaction Methods 0.000 description 1
 - 230000020176 deacylation Effects 0.000 description 1
 - 238000005947 deacylation reaction Methods 0.000 description 1
 - 239000002274 desiccant Substances 0.000 description 1
 - WASQWSOJHCZDFK-UHFFFAOYSA-N diketene Chemical compound C=C1CC(=O)O1 WASQWSOJHCZDFK-UHFFFAOYSA-N 0.000 description 1
 - HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 1
 - 229910001873 dinitrogen Inorganic materials 0.000 description 1
 - 238000004821 distillation Methods 0.000 description 1
 - 239000002552 dosage form Substances 0.000 description 1
 - 230000000694 effects Effects 0.000 description 1
 - 238000010828 elution Methods 0.000 description 1
 - 125000004185 ester group Chemical group 0.000 description 1
 - 230000032050 esterification Effects 0.000 description 1
 - 150000002170 ethers Chemical class 0.000 description 1
 - LBAQSKZHMLAFHH-UHFFFAOYSA-N ethoxyethane;hydron;chloride Chemical compound Cl.CCOCC LBAQSKZHMLAFHH-UHFFFAOYSA-N 0.000 description 1
 - RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
 - 125000004494 ethyl ester group Chemical group 0.000 description 1
 - WMYNMYVRWWCRPS-UHFFFAOYSA-N ethynoxyethane Chemical group CCOC#C WMYNMYVRWWCRPS-UHFFFAOYSA-N 0.000 description 1
 - 238000000605 extraction Methods 0.000 description 1
 - 230000002349 favourable effect Effects 0.000 description 1
 - 238000009472 formulation Methods 0.000 description 1
 - 239000001530 fumaric acid Substances 0.000 description 1
 - 229960002598 fumaric acid Drugs 0.000 description 1
 - 229940093915 gynecological organic acid Drugs 0.000 description 1
 - 125000006038 hexenyl group Chemical group 0.000 description 1
 - IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
 - 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
 - RCCPEORTSYDPMB-UHFFFAOYSA-N hydroxy benzenecarboximidothioate Chemical class OSC(=N)C1=CC=CC=C1 RCCPEORTSYDPMB-UHFFFAOYSA-N 0.000 description 1
 - 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
 - 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
 - 208000015181 infectious disease Diseases 0.000 description 1
 - 150000002500 ions Chemical class 0.000 description 1
 - 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
 - 150000002576 ketones Chemical class 0.000 description 1
 - 239000008101 lactose Substances 0.000 description 1
 - 239000007788 liquid Substances 0.000 description 1
 - 229910052744 lithium Inorganic materials 0.000 description 1
 - 239000011777 magnesium Substances 0.000 description 1
 - 229910052749 magnesium Inorganic materials 0.000 description 1
 - 235000001055 magnesium Nutrition 0.000 description 1
 - 229960003390 magnesium sulfate Drugs 0.000 description 1
 - 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
 - 235000019341 magnesium sulphate Nutrition 0.000 description 1
 - 229940091250 magnesium supplement Drugs 0.000 description 1
 - VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
 - 239000011976 maleic acid Substances 0.000 description 1
 - 229940098779 methanesulfonic acid Drugs 0.000 description 1
 - 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
 - 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
 - 229910017604 nitric acid Inorganic materials 0.000 description 1
 - 231100000252 nontoxic Toxicity 0.000 description 1
 - 230000003000 nontoxic effect Effects 0.000 description 1
 - 235000005985 organic acids Nutrition 0.000 description 1
 - 235000006408 oxalic acid Nutrition 0.000 description 1
 - 150000002960 penicillins Chemical class 0.000 description 1
 - LCLOXRAKDJBSMN-UHFFFAOYSA-N pentyl hydrogen carbonate Chemical compound CCCCCOC(O)=O LCLOXRAKDJBSMN-UHFFFAOYSA-N 0.000 description 1
 - 239000000546 pharmaceutical excipient Substances 0.000 description 1
 - 239000000825 pharmaceutical preparation Substances 0.000 description 1
 - 239000003444 phase transfer catalyst Substances 0.000 description 1
 - 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
 - IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
 - 230000036470 plasma concentration Effects 0.000 description 1
 - 235000011056 potassium acetate Nutrition 0.000 description 1
 - 230000003389 potentiating effect Effects 0.000 description 1
 - 238000001556 precipitation Methods 0.000 description 1
 - 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
 - 238000012545 processing Methods 0.000 description 1
 - 230000001737 promoting effect Effects 0.000 description 1
 - BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
 - FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
 - 229940007042 proteus vulgaris Drugs 0.000 description 1
 - 238000000746 purification Methods 0.000 description 1
 - 238000001953 recrystallisation Methods 0.000 description 1
 - 230000000241 respiratory effect Effects 0.000 description 1
 - AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
 - 235000019345 sodium thiosulphate Nutrition 0.000 description 1
 - 230000006641 stabilisation Effects 0.000 description 1
 - 238000011105 stabilization Methods 0.000 description 1
 - 238000007920 subcutaneous administration Methods 0.000 description 1
 - HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
 - 150000003462 sulfoxides Chemical class 0.000 description 1
 - YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
 - 230000001988 toxicity Effects 0.000 description 1
 - 231100000419 toxicity Toxicity 0.000 description 1
 - 230000009466 transformation Effects 0.000 description 1
 - QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
 - YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
 - 229960004319 trichloroacetic acid Drugs 0.000 description 1
 - 208000019206 urinary tract infection Diseases 0.000 description 1
 - 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
 - 229920002554 vinyl polymer Polymers 0.000 description 1
 
Classifications
- 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07D—HETEROCYCLIC COMPOUNDS
 - C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
 - C07D501/14—Compounds having a nitrogen atom directly attached in position 7
 - C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
 - C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
 - C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
 - C07D501/38—Methylene radicals, substituted by nitrogen atoms; Lactams thereof with the 2-carboxyl group; Methylene radicals substituted by nitrogen-containing hetero rings attached by the ring nitrogen atom; Quaternary compounds thereof
 
 - 
        
- A—HUMAN NECESSITIES
 - A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
 - A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
 - A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
 - A61P31/04—Antibacterial agents
 
 - 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
 - C07C68/00—Preparation of esters of carbonic or haloformic acids
 - C07C68/02—Preparation of esters of carbonic or haloformic acids from phosgene or haloformates
 
 - 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07D—HETEROCYCLIC COMPOUNDS
 - C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
 - C07D501/14—Compounds having a nitrogen atom directly attached in position 7
 - C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
 - C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
 - C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
 - C07D501/36—Methylene radicals, substituted by sulfur atoms
 
 
Landscapes
- Chemical & Material Sciences (AREA)
 - Organic Chemistry (AREA)
 - Health & Medical Sciences (AREA)
 - Chemical Kinetics & Catalysis (AREA)
 - Life Sciences & Earth Sciences (AREA)
 - General Chemical & Material Sciences (AREA)
 - Medicinal Chemistry (AREA)
 - Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
 - Communicable Diseases (AREA)
 - Pharmacology & Pharmacy (AREA)
 - Oncology (AREA)
 - Animal Behavior & Ethology (AREA)
 - General Health & Medical Sciences (AREA)
 - Public Health (AREA)
 - Veterinary Medicine (AREA)
 - Cephalosporin Compounds (AREA)
 - Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
 
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title | 
|---|---|---|---|
| JP99211/83 | 1983-06-02 | ||
| JP58099211A JPS59225191A (ja) | 1983-06-02 | 1983-06-02 | 経口用セフアロスポリン誘導体 | 
Publications (1)
| Publication Number | Publication Date | 
|---|---|
| CA1216841A true CA1216841A (en) | 1987-01-20 | 
Family
ID=14241316
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date | 
|---|---|---|---|
| CA000455316A Expired CA1216841A (en) | 1983-06-02 | 1984-05-29 | Cephalosporin derivatives, their production and use | 
Country Status (5)
| Country | Link | 
|---|---|
| US (1) | US4755598A (en, 2012) | 
| EP (1) | EP0128028A3 (en, 2012) | 
| JP (1) | JPS59225191A (en, 2012) | 
| KR (1) | KR850000454A (en, 2012) | 
| CA (1) | CA1216841A (en, 2012) | 
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| US4914091A (en) * | 1984-04-02 | 1990-04-03 | American Cyanamid Company | Esters of cephalosporin derivitives | 
| JPS60224693A (ja) * | 1984-04-20 | 1985-11-09 | Takeda Chem Ind Ltd | セフアロスポリンエステル誘導体 | 
| FR2573756B1 (fr) * | 1984-11-23 | 1987-01-16 | Poudres & Explosifs Ste Nale | Procede de preparation des carbonates de bromo-1 ethyle et d'hydrocarbyle et nouveaux carbonates de bromo-1 ethyle et d'hydrocarbyle | 
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| GB1425933A (en) * | 1972-03-13 | 1976-02-25 | Astra Laekemedel Ab | Cephalosporins | 
| NZ176206A (en) * | 1973-12-25 | 1978-03-06 | Takeda Chemical Industries Ltd | Cephalosporins | 
| JPS5321192A (en) * | 1976-08-10 | 1978-02-27 | Takeda Chem Ind Ltd | Cephalosporin derivatives and their preparation | 
| US4189479A (en) * | 1977-12-22 | 1980-02-19 | Takeda Chemical Industries, Ltd. | Cephalosporin esters | 
| JPS5777690A (en) * | 1980-10-31 | 1982-05-15 | Takeda Chem Ind Ltd | Cephalosporin derivative | 
| JPS58189186A (ja) * | 1982-04-30 | 1983-11-04 | Takeda Chem Ind Ltd | セフアロスポリン誘導体 | 
| JPS5989691A (ja) * | 1982-11-15 | 1984-05-23 | Takeda Chem Ind Ltd | セフアロスポリンエステル | 
- 
        1983
        
- 1983-06-02 JP JP58099211A patent/JPS59225191A/ja active Granted
 
 - 
        1984
        
- 1984-04-03 KR KR1019840003077A patent/KR850000454A/ko not_active Withdrawn
 - 1984-05-29 CA CA000455316A patent/CA1216841A/en not_active Expired
 - 1984-06-01 US US06/616,260 patent/US4755598A/en not_active Expired - Fee Related
 - 1984-06-01 EP EP84303703A patent/EP0128028A3/en not_active Ceased
 
 
Also Published As
| Publication number | Publication date | 
|---|---|
| JPH0526793B2 (en, 2012) | 1993-04-19 | 
| US4755598A (en) | 1988-07-05 | 
| EP0128028A3 (en) | 1985-05-15 | 
| JPS59225191A (ja) | 1984-12-18 | 
| KR850000454A (ko) | 1985-02-27 | 
| EP0128028A2 (en) | 1984-12-12 | 
Similar Documents
| Publication | Publication Date | Title | 
|---|---|---|
| JPS6229436B2 (en, 2012) | ||
| US5081116A (en) | Cephalosporin derivatives | |
| US4866055A (en) | Cephalosporin derivatives and their crystalline derivatives | |
| JP2867192B2 (ja) | 7−アシル−3−置換カルバモイルオキシセフェム化合物及びその製造法 | |
| EP0115770B2 (en) | Thiazole Derivatives | |
| CA1216841A (en) | Cephalosporin derivatives, their production and use | |
| EP0093548B1 (en) | Cephalosporin derivatives | |
| HU190166B (en) | Process for producing 7-substituted 3-vinyl-3-cepheme-derivatives | |
| US5120841A (en) | Cephalosporin ester derivatives | |
| US5389625A (en) | Cephalosporin compounds | |
| CA1215355A (en) | Cephalosporin esters, their production and use | |
| US3850916A (en) | 7-amino-3-(s-(1,2,3-triazole-5-yl)-thiomethyl)-3-cephem-4-carboxylic acid and salts thereof | |
| EP0304036A2 (en) | 3-(substituted)propenyl-7-(aminothiazolylacetamido)ceph-3-em-4-carboxylic acids and esters thereof | |
| US4797395A (en) | 1-Acyloxyalkyl esters of cephalosporin | |
| EP0109294A2 (en) | Cephalosporin esters | |
| JP2867438B2 (ja) | セファロスポリン化合物の製造法 | |
| EP0300423A2 (en) | Cephalosporin compound, method of its production and composition for prevention and treatment of bacterial infectious diseases | |
| JPH0257071B2 (en, 2012) | ||
| JPH0454675B2 (en, 2012) | ||
| JPH0526794B2 (en, 2012) | ||
| JPH05306288A (ja) | セフェムエステル化合物の結晶 | |
| HU197579B (en) | Process for production of derivatives of cefem carbonic acid | |
| NO883287L (no) | Cefalosporiner. | |
| JPH02306979A (ja) | セフェム誘導体 | |
| JPS6067482A (ja) | セフアロスポリンエステル | 
Legal Events
| Date | Code | Title | Description | 
|---|---|---|---|
| MKEX | Expiry |