CA1208359A - Magnetoresistive head - Google Patents
Magnetoresistive headInfo
- Publication number
- CA1208359A CA1208359A CA000445306A CA445306A CA1208359A CA 1208359 A CA1208359 A CA 1208359A CA 000445306 A CA000445306 A CA 000445306A CA 445306 A CA445306 A CA 445306A CA 1208359 A CA1208359 A CA 1208359A
- Authority
- CA
- Canada
- Prior art keywords
- equipotential
- strip
- leg
- disposed
- edge
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000005291 magnetic effect Effects 0.000 claims abstract description 54
- 238000001514 detection method Methods 0.000 claims abstract description 14
- 230000001154 acute effect Effects 0.000 claims description 5
- 230000008859 change Effects 0.000 claims description 5
- 229910052729 chemical element Inorganic materials 0.000 claims description 4
- 239000013598 vector Substances 0.000 description 30
- 239000000306 component Substances 0.000 description 10
- 230000000694 effects Effects 0.000 description 8
- 230000005415 magnetization Effects 0.000 description 8
- 230000005330 Barkhausen effect Effects 0.000 description 5
- 230000004907 flux Effects 0.000 description 5
- 230000004044 response Effects 0.000 description 5
- 230000005381 magnetic domain Effects 0.000 description 3
- 230000005389 magnetism Effects 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 229910001030 Iron–nickel alloy Inorganic materials 0.000 description 1
- 241000251131 Sphyrna Species 0.000 description 1
- 230000005347 demagnetization Effects 0.000 description 1
- 230000005294 ferromagnetic effect Effects 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229910000889 permalloy Inorganic materials 0.000 description 1
- QHGVXILFMXYDRS-UHFFFAOYSA-N pyraclofos Chemical compound C1=C(OP(=O)(OCC)SCCC)C=NN1C1=CC=C(Cl)C=C1 QHGVXILFMXYDRS-UHFFFAOYSA-N 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B5/00—Recording by magnetisation or demagnetisation of a record carrier; Reproducing by magnetic means; Record carriers therefor
- G11B5/127—Structure or manufacture of heads, e.g. inductive
- G11B5/33—Structure or manufacture of flux-sensitive heads, i.e. for reproduction only; Combination of such heads with means for recording or erasing only
- G11B5/39—Structure or manufacture of flux-sensitive heads, i.e. for reproduction only; Combination of such heads with means for recording or erasing only using magneto-resistive devices or effects
- G11B5/3903—Structure or manufacture of flux-sensitive heads, i.e. for reproduction only; Combination of such heads with means for recording or erasing only using magneto-resistive devices or effects using magnetic thin film layers or their effects, the films being part of integrated structures
- G11B5/398—Specially shaped layers
- G11B5/3987—Specially shaped layers with provision for closing the magnetic flux during operation
Landscapes
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Magnetic Heads (AREA)
- Measuring Magnetic Variables (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US457,830 | 1983-01-14 | ||
| US06/457,830 US4535375A (en) | 1983-01-14 | 1983-01-14 | Magnetoresistive head |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1208359A true CA1208359A (en) | 1986-07-22 |
Family
ID=23818230
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000445306A Expired CA1208359A (en) | 1983-01-14 | 1984-01-13 | Magnetoresistive head |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4535375A (enExample) |
| JP (1) | JPS59129922A (enExample) |
| AU (2) | AU560700B2 (enExample) |
| CA (1) | CA1208359A (enExample) |
| DE (1) | DE3342511A1 (enExample) |
| FR (1) | FR2539542B1 (enExample) |
| GB (2) | GB2134307B (enExample) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3390321T1 (de) * | 1982-11-11 | 1985-01-24 | Matsushita Electric Industrial Co., Ltd., Kadoma, Osaka | Dünnfilm-Magnetkopf |
| US4663685A (en) * | 1985-08-15 | 1987-05-05 | International Business Machines | Magnetoresistive read transducer having patterned longitudinal bias |
| US4713708A (en) * | 1986-10-31 | 1987-12-15 | International Business Machines | Magnetoresistive read transducer |
| US4771349A (en) * | 1986-10-31 | 1988-09-13 | International Business Machine Corporation | Magnetoresistive read transducer |
| US4821133A (en) * | 1987-02-17 | 1989-04-11 | Magnetic Peripherals, Inc. | Bottleneck magnetoresistive element |
| JPS63202979A (ja) * | 1987-02-18 | 1988-08-22 | Alps Electric Co Ltd | エンコ−ダ用磁気センサ |
| US5159511A (en) * | 1987-04-01 | 1992-10-27 | Digital Equipment Corporation | Biasing conductor for MR head |
| US4885649A (en) * | 1987-04-01 | 1989-12-05 | Digital Equipment Corporation | Thin film head having a magneto-restrictive read element |
| US4860138A (en) * | 1987-11-12 | 1989-08-22 | International Business Machines Corp. | Differentially sensitive single track read/write head design with improved biasing |
| JPH0216475A (ja) * | 1988-07-04 | 1990-01-19 | Sharp Corp | 超電導磁気測定装置 |
| US4899240A (en) * | 1988-07-28 | 1990-02-06 | Eastman Kodak Company | Biasing for a UMR head |
| US4903158A (en) * | 1988-07-28 | 1990-02-20 | Eastman Kodak Company | MR head with complementary easy axis permanent magnet |
| CA1334447C (en) * | 1988-08-03 | 1995-02-14 | Digital Equipment Corporation | Perpendicular anisotropy in thin film devices |
| US5085935A (en) * | 1988-08-03 | 1992-02-04 | Digital Equipment Corporation | Flux spreading thin film magnetic devices |
| US5089334A (en) * | 1988-08-03 | 1992-02-18 | Digital Equipment Corporation | Flux spreading thin film magnetic devices |
| US5428893A (en) * | 1989-06-02 | 1995-07-04 | Quantum Corporation | Method of making a transducer with improved inductive coupling |
| US5311386A (en) * | 1989-06-02 | 1994-05-10 | Digital Equipment Corporation | Transducer with improved inductive coupling |
| US5195005A (en) * | 1989-06-02 | 1993-03-16 | Digital Equipment Corporation | Tranducer with improved inductive coupling |
| US5184267A (en) * | 1989-06-02 | 1993-02-02 | Digital Equipment Corporation | Transducer with improved inductive coupling |
| US5107385A (en) * | 1989-11-16 | 1992-04-21 | Applied Magnetics Corporation | Read head assembly for multiple-width tracks |
| US5155642A (en) * | 1989-11-29 | 1992-10-13 | International Business Machines Corporation | Anisotropy configuration for longitudinally constrained magnetoresistive transducers |
| US5065094A (en) * | 1990-08-07 | 1991-11-12 | Seagate Technology, Inc. | Two terminal magnetoresistive sensor having DC blocking capacitor |
| DE69126082T2 (de) * | 1990-09-27 | 1997-10-02 | Toshiba Kawasaki Kk | Magnetischer Kopf |
| EP0551603B1 (en) * | 1991-12-05 | 1998-12-02 | Matsushita Electric Industrial Co., Ltd. | Magneto-resistive head |
| US5331496A (en) * | 1992-02-14 | 1994-07-19 | Digital Equipment Corporation | Thin-film magnetic transducer with a multitude of magnetic flux interactions |
| US5260652A (en) * | 1992-03-25 | 1993-11-09 | Seagate Technology, Inc. | Magnetoresistive sensor with electrical contacts having variable resistive regions for enhanced sensor sensitivity |
| JPH077196A (ja) * | 1992-12-29 | 1995-01-10 | Eastman Kodak Co | 磁界センサ及び磁界検知方法 |
| US5604651A (en) * | 1994-02-23 | 1997-02-18 | Applied Magentics Corporation | Read head with 4-point magnetoresistive sensing |
| US5654854A (en) * | 1995-11-30 | 1997-08-05 | Quantum Corporation | Longitudinally biased magnetoresistive sensor having a concave shaped active region to reduce Barkhausen noise by achieving a substantially single magnetic domain state |
| EP0889460B1 (en) * | 1997-07-04 | 2003-09-24 | STMicroelectronics S.r.l. | An electromagnetic head with magnetoresistive means connected to a magnetic core |
| US7672080B1 (en) * | 2006-09-15 | 2010-03-02 | Western Digital (Fremont), Llc | Laminated perpendicular writer head including amorphous metal |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3405355A (en) * | 1965-02-26 | 1968-10-08 | Navy Usa | Thin film magnetoresistance magnetometer having a current path etched at an angle tothe axes of magnetization |
| US3493694A (en) * | 1966-01-19 | 1970-02-03 | Ampex | Magnetoresistive head |
| FR2165206A5 (enExample) * | 1971-12-22 | 1973-08-03 | Cii | |
| JPS49110318A (enExample) * | 1973-02-20 | 1974-10-21 | ||
| US3860965A (en) * | 1973-10-04 | 1975-01-14 | Ibm | Magnetoresistive read head assembly having matched elements for common mode rejection |
| NL164410C (nl) * | 1974-04-01 | 1980-12-15 | Philips Nv | Magnetoweerstand magneetkop. |
| US4052748A (en) * | 1974-04-01 | 1977-10-04 | U.S. Philips Corporation | Magnetoresistive magnetic head |
| GB1545295A (en) * | 1975-04-14 | 1979-05-10 | Philips Electronic Associated | Magnetoresistive read head |
| NL168981C (nl) * | 1975-04-15 | 1982-05-17 | Philips Nv | Magnetoweerstand leeskop. |
| US4012781A (en) * | 1975-08-14 | 1977-03-15 | International Business Machines Corporation | Magnetoresistive read head assembly for servo operation |
| US3979775A (en) * | 1975-09-08 | 1976-09-07 | International Business Machines Corporation | Magnetoresistive multitransducer assembly with compensation elements for thermal drift and bias balancing |
| US4048557A (en) * | 1975-11-17 | 1977-09-13 | Rockwell International Corporation | Planar magnetoresistance thin film probe for magnetic field alignment |
| US4103315A (en) * | 1977-06-24 | 1978-07-25 | International Business Machines Corporation | Antiferromagnetic-ferromagnetic exchange bias films |
| US4141051A (en) * | 1977-10-11 | 1979-02-20 | U.S. Philips Corporation | Variable dynamic range magneto-resistive head |
| CA1137627A (en) * | 1978-04-25 | 1982-12-14 | Wilhelmus J. Van Gestel | Magnetoresistive head |
| NL7804377A (nl) * | 1978-04-25 | 1979-10-29 | Philips Nv | Magnetoweerstandkop. |
| FR2455330A1 (fr) * | 1979-04-25 | 1980-11-21 | Cii Honeywell Bull | Dispositif magnetique de transduction a magnetoresistances |
| JPS56143514A (en) * | 1980-04-08 | 1981-11-09 | Fujitsu Ltd | Magnetic head |
| JPS56165925A (en) * | 1980-05-27 | 1981-12-19 | Mitsubishi Electric Corp | Magnetoresistance effect type head |
| JPS5736428A (ja) * | 1980-08-11 | 1982-02-27 | Hitachi Ltd | Jikiteikohetsudo |
| JPS584992A (ja) * | 1981-07-01 | 1983-01-12 | Hitachi Ltd | 磁気電気変換素子 |
| JPS59121616A (ja) * | 1982-12-28 | 1984-07-13 | Fujitsu Ltd | 磁気ヘツド |
-
1983
- 1983-01-14 US US06/457,830 patent/US4535375A/en not_active Expired - Lifetime
- 1983-11-24 DE DE19833342511 patent/DE3342511A1/de active Granted
- 1983-11-24 GB GB08331327A patent/GB2134307B/en not_active Expired
- 1983-12-01 AU AU21874/83A patent/AU560700B2/en not_active Ceased
- 1983-12-20 JP JP58240773A patent/JPS59129922A/ja active Granted
-
1984
- 1984-01-13 CA CA000445306A patent/CA1208359A/en not_active Expired
- 1984-01-13 FR FR8400519A patent/FR2539542B1/fr not_active Expired - Fee Related
-
1985
- 1985-09-02 GB GB8521771A patent/GB2162359A/en not_active Withdrawn
-
1987
- 1987-02-18 AU AU69015/87A patent/AU6901587A/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| JPS59129922A (ja) | 1984-07-26 |
| DE3342511C2 (enExample) | 1992-05-21 |
| GB2134307B (en) | 1986-03-19 |
| FR2539542B1 (fr) | 1994-04-29 |
| GB2134307A (en) | 1984-08-08 |
| JPH0339324B2 (enExample) | 1991-06-13 |
| GB8521771D0 (en) | 1985-10-09 |
| AU2187483A (en) | 1984-07-19 |
| AU560700B2 (en) | 1987-04-16 |
| FR2539542A1 (fr) | 1984-07-20 |
| DE3342511A1 (de) | 1984-07-19 |
| GB2162359B (enExample) | |
| AU6901587A (en) | 1987-05-14 |
| US4535375A (en) | 1985-08-13 |
| GB2162359A (en) | 1986-01-29 |
| GB8331327D0 (en) | 1984-01-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1208359A (en) | Magnetoresistive head | |
| US5084794A (en) | Shorted dual element magnetoresistive reproduce head exhibiting high density signal amplification | |
| US5818685A (en) | CIP GMR sensor coupled to biasing magnet with spacer therebetween | |
| US7477490B2 (en) | Single sensor element that is naturally differentiated | |
| US4803580A (en) | Double-gap magnetoresistive head having an elongated central write/shield pole completely shielding the magnetoresistive sensor strip in the read gap | |
| US5731937A (en) | Giant magnetoresistive transducer with increased output signal | |
| US4967298A (en) | Magnetic head with magnetoresistive sensor, inductive write head, and shield | |
| US4891725A (en) | Magnetoresistive sensor having antiferromagnetic exchange-biased ends | |
| US4841398A (en) | Non linear magnetoresistive sensor | |
| US4649447A (en) | Combed MR sensor | |
| JPH0439738B2 (enExample) | ||
| CN1008668B (zh) | 磁阻读出传感器 | |
| US20110051294A1 (en) | Non rectangular reader for ultra high density magnetic recording | |
| KR19980024093A (ko) | 강화된 자기저항을 갖는 스핀 밸브 센서 | |
| US4122505A (en) | Magneto-resistive reading head with suppression of thermal noise | |
| US20110050211A1 (en) | Trapezoidal reader for ultra high density magnetic recording | |
| US5260652A (en) | Magnetoresistive sensor with electrical contacts having variable resistive regions for enhanced sensor sensitivity | |
| US4851944A (en) | Ganged MR head sensor | |
| US6222702B1 (en) | Magnetic read element shield having dimensions that minimize domain wall movement | |
| US4580175A (en) | Endless, folded magnetoresistive head | |
| US4141051A (en) | Variable dynamic range magneto-resistive head | |
| EP0789250A2 (en) | Thin film giant magnetoresistive cip transducer with flux guide yoke structure | |
| GB2169434A (en) | Magnetoresistive sensors | |
| EP0755048B1 (en) | Magnetoresistive recording head | |
| Indeck et al. | Measurements of surface magnetic fields of perpendicular and longitudinal magnetic recorded transitions using a magnetoresistive transducer |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |