CA1174697A - Catalytic dehydrohalogenation process - Google Patents
Catalytic dehydrohalogenation processInfo
- Publication number
- CA1174697A CA1174697A CA000423149A CA423149A CA1174697A CA 1174697 A CA1174697 A CA 1174697A CA 000423149 A CA000423149 A CA 000423149A CA 423149 A CA423149 A CA 423149A CA 1174697 A CA1174697 A CA 1174697A
- Authority
- CA
- Canada
- Prior art keywords
- reactor
- zeolite
- catalyst
- cracking
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 13
- 238000006704 dehydrohalogenation reaction Methods 0.000 title description 4
- 230000003197 catalytic effect Effects 0.000 title description 2
- 239000010457 zeolite Substances 0.000 claims abstract description 14
- 229920006395 saturated elastomer Polymers 0.000 claims abstract description 4
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims description 14
- 229910021536 Zeolite Inorganic materials 0.000 claims description 12
- 238000007033 dehydrochlorination reaction Methods 0.000 claims description 9
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 claims 1
- 239000007792 gaseous phase Substances 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 22
- 239000003054 catalyst Substances 0.000 description 18
- 238000005336 cracking Methods 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 238000001354 calcination Methods 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- UKDOTCFNLHHKOF-FGRDZWBJSA-N (z)-1-chloroprop-1-ene;(z)-1,2-dichloroethene Chemical group C\C=C/Cl.Cl\C=C/Cl UKDOTCFNLHHKOF-FGRDZWBJSA-N 0.000 description 2
- CFXQEHVMCRXUSD-UHFFFAOYSA-N 1,2,3-Trichloropropane Chemical compound ClCC(Cl)CCl CFXQEHVMCRXUSD-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 150000001768 cations Chemical group 0.000 description 2
- 239000000571 coke Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- PQBOTZNYFQWRHU-UHFFFAOYSA-N 1,2-dichlorobutane Chemical compound CCC(Cl)CCl PQBOTZNYFQWRHU-UHFFFAOYSA-N 0.000 description 1
- YHRUOJUYPBUZOS-UHFFFAOYSA-N 1,3-dichloropropane Chemical compound ClCCCCl YHRUOJUYPBUZOS-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010037544 Purging Diseases 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- 229910010066 TiC14 Inorganic materials 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000004939 coking Methods 0.000 description 1
- 229910002026 crystalline silica Inorganic materials 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 239000012013 faujasite Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000008246 gaseous mixture Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical group [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- ULYZAYCEDJDHCC-UHFFFAOYSA-N isopropyl chloride Chemical compound CC(C)Cl ULYZAYCEDJDHCC-UHFFFAOYSA-N 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- NBRKLOOSMBRFMH-UHFFFAOYSA-N tert-butyl chloride Chemical compound CC(C)(C)Cl NBRKLOOSMBRFMH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/25—Preparation of halogenated hydrocarbons by splitting-off hydrogen halides from halogenated hydrocarbons
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C1/00—Preparation of hydrocarbons from one or more compounds, none of them being a hydrocarbon
- C07C1/26—Preparation of hydrocarbons from one or more compounds, none of them being a hydrocarbon starting from organic compounds containing only halogen atoms as hetero-atoms
- C07C1/30—Preparation of hydrocarbons from one or more compounds, none of them being a hydrocarbon starting from organic compounds containing only halogen atoms as hetero-atoms by splitting-off the elements of hydrogen halide from a single molecule
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2529/00—Catalysts comprising molecular sieves
- C07C2529/03—Catalysts comprising molecular sieves not having base-exchange properties
- C07C2529/035—Crystalline silica polymorphs, e.g. silicalites
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2529/00—Catalysts comprising molecular sieves
- C07C2529/04—Catalysts comprising molecular sieves having base-exchange properties, e.g. crystalline zeolites, pillared clays
- C07C2529/06—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof
- C07C2529/40—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof of the pentasil type, e.g. types ZSM-5, ZSM-8 or ZSM-11
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/357,508 US4384159A (en) | 1982-03-12 | 1982-03-12 | Catalytic dehydrohalogenation process |
| US357,508 | 1982-03-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1174697A true CA1174697A (en) | 1984-09-18 |
Family
ID=23405924
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000423149A Expired CA1174697A (en) | 1982-03-12 | 1983-03-09 | Catalytic dehydrohalogenation process |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4384159A (enExample) |
| EP (1) | EP0089579B1 (enExample) |
| JP (1) | JPS58167526A (enExample) |
| AU (1) | AU557361B2 (enExample) |
| BR (1) | BR8301299A (enExample) |
| CA (1) | CA1174697A (enExample) |
| DE (1) | DE3360643D1 (enExample) |
| ES (1) | ES520511A0 (enExample) |
| NO (1) | NO157413C (enExample) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4814527A (en) * | 1982-10-18 | 1989-03-21 | The Dow Chemical Company | Catalytic process for ethylene dichloride |
| US4910176A (en) * | 1982-10-18 | 1990-03-20 | The Dow Chemical Company | Catalytic process for ethylene dichloride |
| US4654449A (en) * | 1982-12-09 | 1987-03-31 | Mobil Oil Corporation | Formation of halogenated hydrocarbons from hydrocarbons |
| GB8410479D0 (en) * | 1984-04-24 | 1984-05-31 | British Petroleum Co Plc | Conversion process |
| US5008225A (en) * | 1984-05-24 | 1991-04-16 | The B. F. Goodrich Company | Catalytic dehydrohalogenation catalyst |
| US4795843A (en) * | 1985-08-26 | 1989-01-03 | Uop Inc. | Conversion of methane into larger organic hydrocarbons |
| JP2715525B2 (ja) * | 1988-12-12 | 1998-02-18 | 東ソー株式会社 | 脱ハロゲン化水素方法 |
| US5107061A (en) * | 1990-04-06 | 1992-04-21 | Exxon Chemical Patents Inc. | Removal of organochlorides from hydrocarbon feed streams |
| US5001293A (en) * | 1990-04-25 | 1991-03-19 | Amoco Corporation | Halocarbon conversion |
| US5276240A (en) * | 1991-10-18 | 1994-01-04 | Board Of Regents, The University Of Texas System | Catalytic hydrodehalogenation of polyhalogenated hydrocarbons |
| EP0565789B1 (en) * | 1992-04-15 | 1998-09-16 | Evc Technology Ag | Production of vinyl chloride by catalytic dehydrohalogenation |
| US5430215A (en) * | 1994-04-14 | 1995-07-04 | The Dow Chemical Company | Selective hydrodechlorination of 1,2,3-trichloropropane to produce propylene |
| EP0981394A1 (de) * | 1997-04-30 | 2000-03-01 | Patric Wedlich | Verfharen zum abbau von halogenierten kohlenwasserstoffen |
| US7838708B2 (en) | 2001-06-20 | 2010-11-23 | Grt, Inc. | Hydrocarbon conversion process improvements |
| US20050171393A1 (en) | 2003-07-15 | 2005-08-04 | Lorkovic Ivan M. | Hydrocarbon synthesis |
| MXPA06000470A (es) | 2003-07-15 | 2006-08-23 | Grt Inc | Sintesis de hidrocarburos. |
| US7244867B2 (en) | 2004-04-16 | 2007-07-17 | Marathon Oil Company | Process for converting gaseous alkanes to liquid hydrocarbons |
| US20060100469A1 (en) | 2004-04-16 | 2006-05-11 | Waycuilis John J | Process for converting gaseous alkanes to olefins and liquid hydrocarbons |
| US8173851B2 (en) | 2004-04-16 | 2012-05-08 | Marathon Gtf Technology, Ltd. | Processes for converting gaseous alkanes to liquid hydrocarbons |
| US8642822B2 (en) | 2004-04-16 | 2014-02-04 | Marathon Gtf Technology, Ltd. | Processes for converting gaseous alkanes to liquid hydrocarbons using microchannel reactor |
| US20080275284A1 (en) | 2004-04-16 | 2008-11-06 | Marathon Oil Company | Process for converting gaseous alkanes to liquid hydrocarbons |
| US7674941B2 (en) | 2004-04-16 | 2010-03-09 | Marathon Gtf Technology, Ltd. | Processes for converting gaseous alkanes to liquid hydrocarbons |
| UA95943C2 (ru) | 2006-02-03 | 2011-09-26 | ДжиАрТи, ИНК. | Отделение легких газов от галогенов |
| AU2007215476B2 (en) | 2006-02-03 | 2011-11-10 | Grt, Inc. | Continuous process for converting natural gas to liquid hydrocarbons |
| KR101056616B1 (ko) * | 2006-11-07 | 2011-08-11 | 주식회사 엘지화학 | 1,2-디클로로에탄의 촉매 분해반응에 의한 염화비닐의 제조방법 |
| KR20100027141A (ko) | 2007-05-24 | 2010-03-10 | 지알티, 인코포레이티드 | 가역적으로 할로겐화수소를 흡수 및 방출할 수 있는 존 반응기 |
| RU2338736C1 (ru) * | 2007-06-09 | 2008-11-20 | Общество с ограниченной ответственностью "Научно-исследовательский инженерный центр "Синтез" (ООО НИИЦ "Синтез") | Способ получения винилхлорида и каталитическая система для его осуществления |
| US8282810B2 (en) | 2008-06-13 | 2012-10-09 | Marathon Gtf Technology, Ltd. | Bromine-based method and system for converting gaseous alkanes to liquid hydrocarbons using electrolysis for bromine recovery |
| KR101740419B1 (ko) | 2008-07-18 | 2017-05-26 | 지알티, 인코포레이티드 | 천연 가스를 액체 탄화수소로 변환시키는 연속 공정 |
| US8206676B2 (en) * | 2009-04-15 | 2012-06-26 | Air Products And Chemicals, Inc. | Method for making a chlorosilane |
| WO2010151342A1 (en) * | 2009-06-26 | 2010-12-29 | Dow Agrosciences, Llc | Selective dehydrohalogenation of tertiary halogenated hydrocarbons and removal of tertiary halogenated hydrocarbon impurities |
| US8198495B2 (en) | 2010-03-02 | 2012-06-12 | Marathon Gtf Technology, Ltd. | Processes and systems for the staged synthesis of alkyl bromides |
| US8367884B2 (en) | 2010-03-02 | 2013-02-05 | Marathon Gtf Technology, Ltd. | Processes and systems for the staged synthesis of alkyl bromides |
| US8815050B2 (en) | 2011-03-22 | 2014-08-26 | Marathon Gtf Technology, Ltd. | Processes and systems for drying liquid bromine |
| US8436220B2 (en) | 2011-06-10 | 2013-05-07 | Marathon Gtf Technology, Ltd. | Processes and systems for demethanization of brominated hydrocarbons |
| US8829256B2 (en) | 2011-06-30 | 2014-09-09 | Gtc Technology Us, Llc | Processes and systems for fractionation of brominated hydrocarbons in the conversion of natural gas to liquid hydrocarbons |
| US8802908B2 (en) | 2011-10-21 | 2014-08-12 | Marathon Gtf Technology, Ltd. | Processes and systems for separate, parallel methane and higher alkanes' bromination |
| US9193641B2 (en) | 2011-12-16 | 2015-11-24 | Gtc Technology Us, Llc | Processes and systems for conversion of alkyl bromides to higher molecular weight hydrocarbons in circulating catalyst reactor-regenerator systems |
| US9169168B2 (en) * | 2013-04-10 | 2015-10-27 | John E. Stauffer | Process for producing ethylene by chlorination of ethane and dehydrochlorination of ethyl chloride |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA774158A (en) * | 1967-12-19 | British Hydrocarbon Chemicals Limited | Process for the production of olefines by the dehydrochlorination of alkyl chlorides | |
| GB991303A (en) * | 1962-07-26 | 1965-05-05 | British Hydrocarbon Chem Ltd | The production of olefines by the dehydrochlorination of alkyl chlorides |
| NL295852A (enExample) * | 1962-07-26 | 1900-01-01 | ||
| GB1152021A (en) * | 1965-08-30 | 1969-05-14 | Pullman Inc | Dehydrohalogenation Process |
| US3702886A (en) * | 1969-10-10 | 1972-11-14 | Mobil Oil Corp | Crystalline zeolite zsm-5 and method of preparing the same |
| GB1249622A (en) * | 1970-02-04 | 1971-10-13 | Marathon Oil Co | Preparation of polyolefinic compounds |
| US3896182A (en) * | 1971-07-06 | 1975-07-22 | Bp Chem Int Ltd | Process for preparing vinyl chloride by the pyrolysis of 1,2-dichloro-ethane |
| US4061724A (en) * | 1975-09-22 | 1977-12-06 | Union Carbide Corporation | Crystalline silica |
| AR219135A1 (es) * | 1977-11-18 | 1980-07-31 | Goodrich Co B F | Procedimiento para producir cloruro de vinilo |
| JPS55130923A (en) * | 1979-03-30 | 1980-10-11 | Mitsubishi Heavy Ind Ltd | Condensation of methyl chloride through dehydrochlorination |
-
1982
- 1982-03-12 US US06/357,508 patent/US4384159A/en not_active Expired - Lifetime
-
1983
- 1983-03-09 CA CA000423149A patent/CA1174697A/en not_active Expired
- 1983-03-10 AU AU12331/83A patent/AU557361B2/en not_active Ceased
- 1983-03-11 DE DE8383102417T patent/DE3360643D1/de not_active Expired
- 1983-03-11 NO NO830860A patent/NO157413C/no unknown
- 1983-03-11 EP EP83102417A patent/EP0089579B1/en not_active Expired
- 1983-03-11 BR BR8301299A patent/BR8301299A/pt not_active IP Right Cessation
- 1983-03-11 ES ES520511A patent/ES520511A0/es active Granted
- 1983-03-11 JP JP58039331A patent/JPS58167526A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4384159A (en) | 1983-05-17 |
| NO157413B (no) | 1987-12-07 |
| AU557361B2 (en) | 1986-12-18 |
| EP0089579B1 (en) | 1985-08-28 |
| JPH0352451B2 (enExample) | 1991-08-12 |
| ES8500877A1 (es) | 1984-11-01 |
| JPS58167526A (ja) | 1983-10-03 |
| EP0089579A1 (en) | 1983-09-28 |
| NO830860L (no) | 1983-09-13 |
| ES520511A0 (es) | 1984-11-01 |
| DE3360643D1 (en) | 1985-10-03 |
| AU1233183A (en) | 1983-09-15 |
| NO157413C (no) | 1988-03-16 |
| BR8301299A (pt) | 1983-11-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1174697A (en) | Catalytic dehydrohalogenation process | |
| CA1236123A (en) | Conversions of low molecular weight hydrocarbons to higher molecular weight hydrocarbons using a metal- containing catalyst | |
| US5382741A (en) | Process for the production of mono-olefins | |
| US4709108A (en) | Conversions of low molecular weight hydrocarbons to higher molecular weight hydrocarbons using a metal compound-containing catalyst | |
| US4704493A (en) | Conversions of low molecular weight hydrocarbons to higher molecular weight hydrocarbons using a metal compound-containing catalyst (II-A) | |
| US4734537A (en) | Conversions of low molecular weight hydrocarbons to higher molecular weight hydrocarbons using a metal compound-containing catalyst | |
| US4704487A (en) | Conversions of low molecular weight hydrocarbons to higher molecular weight hydrocarbons using a metal compound-containing catalyst (IV-B) | |
| US4704488A (en) | Conversions of low molecular weight hydrocarbons to higher molecular weight hydrocarbons using a metal compound-containing catalyst (111-A) | |
| US4814538A (en) | Enhancing the reaction rate in high temperature, high space velocity catalytic conversion of methane to higher molecular weight hydrocarbons | |
| US4814533A (en) | Enhancing the production of aromatics in high temperature, high space velocity catalytic conversion of lower molecular weight hydrocarbons to higher molecular weight hydrocarbons | |
| US4814534A (en) | Addition of hydrogen and C2 to C4 hydrocarbons to the feed gas in the catalytic conversion of methane to higher molecular weight hydrocarbons | |
| GB2148934A (en) | Catalytic production of higher molecular weight hydrocarbons | |
| GB2191212A (en) | Integrated process for the production of liquid hydrocarbons from methane | |
| US3907917A (en) | Isoprene production | |
| CA2526539A1 (en) | Process for the production of olefins | |
| EP0113657B1 (en) | Hydrocarbon cracking process | |
| JPH0344059B2 (enExample) | ||
| US4423024A (en) | Selective conversion of chlorinated alkanes to hydrogen chloride and carbon dioxide | |
| US5008225A (en) | Catalytic dehydrohalogenation catalyst | |
| EP0002021A1 (en) | Catalytic dehydrohalogenation process | |
| US4745235A (en) | Organic fluorides from fluoroformic esters | |
| EP0662938A1 (en) | Process for converting 1,1,1,2-tetrachloroethane to vinylidene chloride | |
| CA1216273A (en) | Catalytic process for ethylene dichloride | |
| CA1244481A (en) | Catalytic dehydrohalogenation process | |
| US4206188A (en) | Removal of acetylene from HCl streams |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEC | Expiry (correction) | ||
| MKEX | Expiry |