CA1158426A - Razor blade assembly with movable cover cap - Google Patents
Razor blade assembly with movable cover capInfo
- Publication number
- CA1158426A CA1158426A CA000367781A CA367781A CA1158426A CA 1158426 A CA1158426 A CA 1158426A CA 000367781 A CA000367781 A CA 000367781A CA 367781 A CA367781 A CA 367781A CA 1158426 A CA1158426 A CA 1158426A
- Authority
- CA
- Canada
- Prior art keywords
- cap
- blade
- seat member
- razor
- seat
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000000295 complement effect Effects 0.000 claims description 8
- 230000033001 locomotion Effects 0.000 claims description 8
- 125000006850 spacer group Chemical group 0.000 claims description 8
- 239000004033 plastic Substances 0.000 claims description 7
- 230000008093 supporting effect Effects 0.000 claims description 7
- 238000000465 moulding Methods 0.000 claims description 3
- 239000000463 material Substances 0.000 claims 1
- 238000000926 separation method Methods 0.000 claims 1
- 230000001681 protective effect Effects 0.000 description 9
- 230000000712 assembly Effects 0.000 description 3
- 238000000429 assembly Methods 0.000 description 3
- 238000000034 method Methods 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- ODPOAESBSUKMHD-UHFFFAOYSA-L 6,7-dihydrodipyrido[1,2-b:1',2'-e]pyrazine-5,8-diium;dibromide Chemical compound [Br-].[Br-].C1=CC=[N+]2CC[N+]3=CC=CC=C3C2=C1 ODPOAESBSUKMHD-UHFFFAOYSA-L 0.000 description 1
- 239000005630 Diquat Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 210000003414 extremity Anatomy 0.000 description 1
- 210000005224 forefinger Anatomy 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000002991 molded plastic Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 210000003813 thumb Anatomy 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B26—HAND CUTTING TOOLS; CUTTING; SEVERING
- B26B—HAND-HELD CUTTING TOOLS NOT OTHERWISE PROVIDED FOR
- B26B29/00—Guards or sheaths or guides for hand cutting tools; Arrangements for guiding hand cutting tools
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Forests & Forestry (AREA)
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Dry Shavers And Clippers (AREA)
- Knives (AREA)
- Cosmetics (AREA)
- Scissors And Nippers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/108,747 US4328615A (en) | 1979-12-31 | 1979-12-31 | Razor blade assembly with movable cover cap |
| US108,747 | 1979-12-31 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1158426A true CA1158426A (en) | 1983-12-13 |
Family
ID=22323821
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000367781A Expired CA1158426A (en) | 1979-12-31 | 1980-12-31 | Razor blade assembly with movable cover cap |
| CA000532554A Expired CA1227629B (en) | 1979-12-31 | 1987-03-19 | Razor blade assembly with removable cover cap |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000532554A Expired CA1227629B (en) | 1979-12-31 | 1987-03-19 | Razor blade assembly with removable cover cap |
Country Status (11)
| Country | Link |
|---|---|
| US (2) | US4328615A (enFirst) |
| JP (2) | JPS56116485A (enFirst) |
| AU (1) | AU542024B2 (enFirst) |
| BE (1) | BE886921A (enFirst) |
| BR (1) | BR8008607A (enFirst) |
| CA (2) | CA1158426A (enFirst) |
| DE (2) | DE3049488C2 (enFirst) |
| FR (1) | FR2472448B1 (enFirst) |
| GB (1) | GB2066131B (enFirst) |
| NL (1) | NL177471C (enFirst) |
| SE (1) | SE8008949L (enFirst) |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4425705A (en) * | 1981-06-19 | 1984-01-17 | Warner-Lambert Company | Razor with lever operated blade cover |
| EP0074814A3 (en) * | 1981-09-14 | 1983-12-14 | Warner-Lambert Company | Razor blade cartridge with movable cover |
| US4395822A (en) * | 1981-10-05 | 1983-08-02 | Warner-Lambert Company | Twin blade cartridge with purging fin and cooperating slidable cover cap |
| US4476630A (en) * | 1981-12-21 | 1984-10-16 | Warner-Lambert Company | Razor with sliding blade cover |
| NZ202924A (en) * | 1982-01-27 | 1986-06-11 | Wilkinson Sword Ltd | A razor blade assembly |
| USD271531S (en) | 1982-02-05 | 1983-11-22 | Warner-Lambert Company | Disposable razor with sliding cap |
| US4453310A (en) * | 1982-03-29 | 1984-06-12 | Warner-Lambert Company | Razor with sliding cover having integral actuator |
| US4464835A (en) * | 1982-07-21 | 1984-08-14 | Warner-Lambert Company | Disposable razor |
| SE442718B (sv) * | 1983-10-05 | 1986-01-27 | Warner Lambert Co | Rakhyvelslock med ett integrerat manoverdon |
| US5012578A (en) * | 1984-03-05 | 1991-05-07 | Warner-Lambert Company | One-piece razor with hinged sliding cap |
| IL74478A (en) * | 1985-03-01 | 1988-04-29 | America Israel Blades Ltd | Razor blade unit |
| US4813131A (en) * | 1987-11-16 | 1989-03-21 | The Gillette Company | Retractable blade safety razor |
| US4985995A (en) * | 1988-09-08 | 1991-01-22 | Wilkinson Sword Gesellschaft Mit Beschrankter Haftung | Razor head, especially a razor blade unit |
| USD318143S (en) | 1989-02-06 | 1991-07-09 | E.T. Browne Drug Co., Inc. | Razor |
| DE9002710U1 (de) * | 1990-03-08 | 1991-07-11 | Wilkinson Sword GmbH, 5650 Solingen | Rasierklingeneinheit |
| USD364706S (en) | 1991-12-16 | 1995-11-28 | Sean Corcoran | Razor |
| US6026577A (en) | 1993-10-15 | 2000-02-22 | Warner-Lambert Company | Disposable razor with removable razor head |
| USD365419S (en) | 1994-07-07 | 1995-12-19 | Feather Safety Razor Co., Ltd. | Razor handle |
| US6161287A (en) * | 1998-04-24 | 2000-12-19 | The Gillette Company | Razor blade system |
| USD416646S (en) | 1998-10-15 | 1999-11-16 | Pinchuk Rene C | Handle for shaving apparatus |
| US6167625B1 (en) | 1999-05-18 | 2001-01-02 | Warner-Lambert Company | Shaving implement |
| USD490569S1 (en) | 2001-12-06 | 2004-05-25 | American Safety Razor Company | Razor cartridge overcap |
| USD509322S1 (en) | 2004-06-09 | 2005-09-06 | American Safety Razor Company | Razor with protective cap |
| USD509025S1 (en) | 2004-06-09 | 2005-08-30 | American Safety Razor Company | Razor |
| USD527491S1 (en) | 2004-06-09 | 2006-08-29 | American Safety Razor Company | Razor lube bar |
| US20090172958A1 (en) * | 2008-01-08 | 2009-07-09 | Prudden Jr John | Pivot inhibiting razor storage case |
| US20090172957A1 (en) * | 2008-01-08 | 2009-07-09 | Prudden Jr John | Pivot inhibiting protective razor cover |
| USD616148S1 (en) | 2009-05-21 | 2010-05-18 | American Safety Razor | Razor protector |
| USD619300S1 (en) | 2009-05-21 | 2010-07-06 | Ubs Ag, Stamford Branch | Razor protector |
| USD616149S1 (en) | 2009-09-28 | 2010-05-18 | American Safety Razor | Razor cartridge protector |
| USD625883S1 (en) | 2009-11-30 | 2010-10-19 | American Safety Razor | Razor cartridge |
| USD629969S1 (en) | 2010-05-11 | 2010-12-28 | American Safety Razor | Razor cartridge protector |
| USD633253S1 (en) | 2010-06-23 | 2011-02-22 | American Safety Razor | Razor cartridge |
| USD648075S1 (en) | 2010-07-07 | 2011-11-01 | American Safety Razor | Razor cartridge |
| USD640415S1 (en) | 2010-07-07 | 2011-06-21 | American Safety Razor | Razor cartridge |
| USD643976S1 (en) | 2010-10-19 | 2011-08-23 | American Safety Razor | Razor cartridge |
| USD643977S1 (en) | 2010-10-19 | 2011-08-23 | American Safety Razor | Razor cartridge |
| US8931379B2 (en) | 2012-10-17 | 2015-01-13 | David L. Allyn | Methods and devices for safely handling a razor blade |
| US10406704B2 (en) * | 2014-10-06 | 2019-09-10 | OneBlade, Inc. | Razor apparatus and shaving system |
| KR102351072B1 (ko) * | 2014-12-10 | 2022-01-13 | 빅-비올렉스 에스아 | 날 유닛과 피부 접촉 부재를 포함하는 면도날 조립체 및 면도기 손잡이와 이러한 면도날 조립체를 포함하는 면도기 |
| ES2884302T3 (es) * | 2016-10-25 | 2021-12-10 | Oneblade Inc | Aparato de afeitar de hoja individual |
| US10538005B2 (en) | 2016-10-25 | 2020-01-21 | OneBlade, Inc. | Single-blade razor apparatus |
| CA3043524C (en) * | 2016-11-14 | 2022-04-12 | Accutec Blades, Inc. | Double edged blade grip assembly |
| USD948123S1 (en) * | 2020-09-15 | 2022-04-05 | Kai R&D Center Co., Ltd. | Razor blade |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1287338A (en) * | 1917-03-30 | 1918-12-10 | Frederick Bunnell King | Safety-razor. |
| DE471590C (de) * | 1927-06-21 | 1929-02-15 | Willi Rosenbaum | Rasierhobel mit umschaltbarer, vielschneidiger Flachklinge |
| US2122263A (en) * | 1936-03-23 | 1938-06-28 | Briggs Mfg Co | Guard for scraper devices |
| US2580142A (en) * | 1947-11-13 | 1951-12-25 | Alfred L Ruff | Cutting and scraping tool |
| US2576618A (en) * | 1948-03-12 | 1951-11-27 | Cutter Corp | Handle type hair trimmer |
| US2744319A (en) * | 1952-01-17 | 1956-05-08 | Bertram S Cutler | Safety razor and blade assembly |
| US3289295A (en) * | 1962-09-21 | 1966-12-06 | Tornvall Anton Evert | Adjustable hair-trimming device |
| US3172202A (en) * | 1963-09-19 | 1965-03-09 | Claude W Sooter | Protective cover for safety razor |
| CH475074A (fr) * | 1967-05-31 | 1969-07-15 | Werding Winfried | Rasoir |
| GB1261380A (en) * | 1968-05-10 | 1972-01-26 | Wilhelm Gumbmann | Hair cutting device |
| US3492722A (en) * | 1969-01-16 | 1970-02-03 | Fredda F S Sieve | Disposable razor and case |
| US3646672A (en) * | 1970-04-20 | 1972-03-07 | Philip Morris Inc | Adjustable folding razor |
| US3703764A (en) * | 1971-03-15 | 1972-11-28 | Gillette Co | Razor blade assembly |
| US3783510A (en) * | 1971-10-22 | 1974-01-08 | Warner Lambert Co | Razor having tandemly mounted blades bonded in a disposable cartridge |
| US3754325A (en) * | 1972-05-24 | 1973-08-28 | E Tornvall | Hair trimming device |
| BE797511A (fr) * | 1973-03-29 | 1973-07-16 | Org Europeene De Rech | Systeme de mesure d'attitude de satellite |
| ATA469575A (de) * | 1974-06-26 | 1977-10-15 | Liedtke Christa | Haarschneidegerat |
| US4037321A (en) * | 1976-11-11 | 1977-07-26 | Philip Morris Incorporated | Double edge blade razor |
| JPS54378A (en) * | 1977-05-31 | 1979-01-05 | Nakanishi Kinzoku Kogyo Kk | Conveyor device |
| JPS588864B2 (ja) * | 1979-02-19 | 1983-02-17 | 株式会社貝印刃物開発センター | かみそり |
-
1979
- 1979-12-31 US US06/108,747 patent/US4328615A/en not_active Expired - Lifetime
-
1980
- 1980-12-05 NL NLAANVRAGE8006641,A patent/NL177471C/xx not_active IP Right Cessation
- 1980-12-18 AU AU65536/80A patent/AU542024B2/en not_active Expired
- 1980-12-18 SE SE8008949A patent/SE8008949L/ unknown
- 1980-12-23 GB GB8041188A patent/GB2066131B/en not_active Expired
- 1980-12-27 JP JP18944580A patent/JPS56116485A/ja active Pending
- 1980-12-30 BE BE0/203369A patent/BE886921A/fr not_active IP Right Cessation
- 1980-12-30 FR FR8027750A patent/FR2472448B1/fr not_active Expired
- 1980-12-30 DE DE3049488A patent/DE3049488C2/de not_active Expired
- 1980-12-30 BR BR8008607A patent/BR8008607A/pt unknown
- 1980-12-30 DE DE8034837U patent/DE8034837U1/de not_active Expired
- 1980-12-31 CA CA000367781A patent/CA1158426A/en not_active Expired
-
1982
- 1982-03-18 US US06/359,341 patent/US4443938A/en not_active Ceased
-
1984
- 1984-05-01 JP JP1984064676U patent/JPS59176464U/ja active Granted
-
1987
- 1987-03-19 CA CA000532554A patent/CA1227629B/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2472448A1 (fr) | 1981-07-03 |
| NL177471C (nl) | 1985-10-01 |
| US4443938A (en) | 1984-04-24 |
| JPS56116485A (en) | 1981-09-12 |
| GB2066131B (en) | 1983-05-18 |
| DE3049488C2 (de) | 1986-02-27 |
| BE886921A (fr) | 1981-04-16 |
| AU542024B2 (en) | 1985-01-31 |
| NL177471B (nl) | 1985-05-01 |
| JPS6112940Y2 (enFirst) | 1986-04-22 |
| GB2066131A (en) | 1981-07-08 |
| FR2472448B1 (fr) | 1986-04-25 |
| AU6553680A (en) | 1981-07-09 |
| BR8008607A (pt) | 1981-07-28 |
| DE8034837U1 (de) | 1986-12-11 |
| US4328615A (en) | 1982-05-11 |
| CA1227629B (en) | 1987-10-06 |
| NL8006641A (nl) | 1981-08-03 |
| SE8008949L (sv) | 1981-07-01 |
| DE3049488A1 (de) | 1981-10-08 |
| JPS59176464U (ja) | 1984-11-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1158426A (en) | Razor blade assembly with movable cover cap | |
| US4257160A (en) | Two-bladed safety razor | |
| US4777722A (en) | Combination overcover for safety razor | |
| EP0198854B1 (en) | A razor blade assembly | |
| US4063354A (en) | Shaving unit | |
| US5890296A (en) | Razor handle | |
| US5319853A (en) | Scraper | |
| US5855071A (en) | Razor handle | |
| US4308663A (en) | Razor handle with latch for pivotable cartridge | |
| EP1024931B1 (en) | Razor blade cartridge with lubricating flow paths | |
| EP3322566B1 (en) | A protector for a razor cartridge, a shaving assembly, a wet shaving razor and a method of using such a wet shaving razor | |
| US4047296A (en) | Two-edge shaving blade unit having anti-clogging means | |
| US5161307A (en) | Razor head, especially razor blade unit, of a wet razor | |
| US4715120A (en) | Razors, and shaving units for razors | |
| CA1220021A (en) | Razors and shaving units for razors | |
| US20040181954A1 (en) | Shaving implement having improved pivot axis location | |
| WO2006036591A1 (en) | Shaving implement employing discrete cartridge sections | |
| WO2012028171A1 (en) | Protective cover for razor cartridge | |
| CA2221439A1 (en) | Razor head with moveable blade package | |
| JPH07506503A (ja) | 安全カミソリ | |
| GB2086298A (en) | Safety razors | |
| CA2391520A1 (en) | Shaving implement having static and dynamic blades | |
| EP0287387B1 (en) | Razor head | |
| USRE32367E (en) | Disposable razor with sliding cap | |
| US4180907A (en) | Razor with trap door feature for making blade change |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MZSU | Surrender | ||
| MZSU | Surrender |
Effective date: 19871006 |