CA1152501A - Separation of fructose from a mixture of sugars - Google Patents
Separation of fructose from a mixture of sugarsInfo
- Publication number
- CA1152501A CA1152501A CA000246239A CA246239A CA1152501A CA 1152501 A CA1152501 A CA 1152501A CA 000246239 A CA000246239 A CA 000246239A CA 246239 A CA246239 A CA 246239A CA 1152501 A CA1152501 A CA 1152501A
- Authority
- CA
- Canada
- Prior art keywords
- fructose
- mixture
- glucose
- silicate
- sugars
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000005715 Fructose Substances 0.000 title claims abstract description 79
- 229930091371 Fructose Natural products 0.000 title claims abstract description 78
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 title claims abstract description 77
- 235000000346 sugar Nutrition 0.000 title claims abstract description 32
- 239000000203 mixture Substances 0.000 title claims abstract description 28
- 150000008163 sugars Chemical class 0.000 title claims abstract description 27
- 238000000926 separation method Methods 0.000 title claims description 30
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims abstract description 40
- 229910000323 aluminium silicate Inorganic materials 0.000 claims abstract description 29
- 239000007864 aqueous solution Substances 0.000 claims abstract description 12
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 claims description 50
- 239000008103 glucose Substances 0.000 claims description 50
- 238000000034 method Methods 0.000 claims description 31
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 claims description 27
- 229910021536 Zeolite Inorganic materials 0.000 claims description 18
- 239000010457 zeolite Substances 0.000 claims description 18
- 150000001768 cations Chemical class 0.000 claims description 16
- 239000003463 adsorbent Substances 0.000 claims description 9
- 239000012013 faujasite Substances 0.000 claims description 9
- 239000011734 sodium Substances 0.000 claims description 9
- 239000011148 porous material Substances 0.000 claims description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 7
- 229910052788 barium Inorganic materials 0.000 claims description 7
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 7
- 229910052708 sodium Inorganic materials 0.000 claims description 7
- 239000000243 solution Substances 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 238000001179 sorption measurement Methods 0.000 claims description 6
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 6
- 229910052712 strontium Inorganic materials 0.000 claims description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 239000011575 calcium Substances 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 125000002091 cationic group Chemical group 0.000 claims description 3
- 229910052680 mordenite Inorganic materials 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- 229930006000 Sucrose Natural products 0.000 claims description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- 229910052793 cadmium Inorganic materials 0.000 claims description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000010949 copper Substances 0.000 claims description 2
- 235000021433 fructose syrup Nutrition 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 238000006317 isomerization reaction Methods 0.000 claims description 2
- 239000011133 lead Substances 0.000 claims description 2
- 229910052709 silver Inorganic materials 0.000 claims description 2
- 239000004332 silver Substances 0.000 claims description 2
- 239000005720 sucrose Substances 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 239000011701 zinc Substances 0.000 claims description 2
- 208000007976 Ketosis Diseases 0.000 claims 1
- MNQZXJOMYWMBOU-UHFFFAOYSA-N glyceraldehyde Chemical compound OCC(O)C=O MNQZXJOMYWMBOU-UHFFFAOYSA-N 0.000 claims 1
- 230000007062 hydrolysis Effects 0.000 claims 1
- 238000006460 hydrolysis reaction Methods 0.000 claims 1
- 150000002584 ketoses Chemical class 0.000 claims 1
- 239000002245 particle Substances 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 238000005342 ion exchange Methods 0.000 description 7
- 150000002482 oligosaccharides Chemical class 0.000 description 7
- 229920001542 oligosaccharide Polymers 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 229910000503 Na-aluminosilicate Inorganic materials 0.000 description 3
- SXQXMCWCWVCFPC-UHFFFAOYSA-N aluminum;potassium;dioxido(oxo)silane Chemical compound [Al+3].[K+].[O-][Si]([O-])=O.[O-][Si]([O-])=O SXQXMCWCWVCFPC-UHFFFAOYSA-N 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 239000000429 sodium aluminium silicate Substances 0.000 description 3
- 235000012217 sodium aluminium silicate Nutrition 0.000 description 3
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000003957 anion exchange resin Substances 0.000 description 2
- 239000000404 calcium aluminium silicate Substances 0.000 description 2
- 235000012215 calcium aluminium silicate Nutrition 0.000 description 2
- WNCYAPRTYDMSFP-UHFFFAOYSA-N calcium aluminosilicate Chemical compound [Al+3].[Al+3].[Ca+2].[O-][Si]([O-])=O.[O-][Si]([O-])=O.[O-][Si]([O-])=O.[O-][Si]([O-])=O WNCYAPRTYDMSFP-UHFFFAOYSA-N 0.000 description 2
- 229940078583 calcium aluminosilicate Drugs 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- OWEGMIWEEQEYGQ-UHFFFAOYSA-N 100676-05-9 Natural products OC1C(O)C(O)C(CO)OC1OCC1C(O)C(O)C(O)C(OC2C(OC(O)C(O)C2O)CO)O1 OWEGMIWEEQEYGQ-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- LKDRXBCSQODPBY-JDJSBBGDSA-N D-allulose Chemical compound OCC1(O)OC[C@@H](O)[C@@H](O)[C@H]1O LKDRXBCSQODPBY-JDJSBBGDSA-N 0.000 description 1
- WQZGKKKJIJFFOK-QTVWNMPRSA-N D-mannopyranose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-QTVWNMPRSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-PICCSMPSSA-N Maltose Natural products O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-PICCSMPSSA-N 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-O Methylammonium ion Chemical compound [NH3+]C BAVYZALUXZFZLV-UHFFFAOYSA-O 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical group OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QUYVBRFLSA-N beta-maltose Chemical compound OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O GUBGYTABKSRVRQ-QUYVBRFLSA-N 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical group OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- JDHDCOAJLPVAMC-BAOOBMCLSA-N calcium;(3s,4r,5r)-1,3,4,5,6-pentahydroxyhexan-2-one Chemical compound [Ca].OC[C@@H](O)[C@@H](O)[C@H](O)C(=O)CO JDHDCOAJLPVAMC-BAOOBMCLSA-N 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000003795 desorption Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 150000002016 disaccharides Chemical class 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000000727 fraction Substances 0.000 description 1
- BJHIKXHVCXFQLS-UYFOZJQFSA-N fructose group Chemical group OCC(=O)[C@@H](O)[C@H](O)[C@H](O)CO BJHIKXHVCXFQLS-UYFOZJQFSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine group Chemical group NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C13—SUGAR INDUSTRY
- C13B—PRODUCTION OF SUCROSE; APPARATUS SPECIALLY ADAPTED THEREFOR
- C13B20/00—Purification of sugar juices
- C13B20/14—Purification of sugar juices using ion-exchange materials
- C13B20/148—Purification of sugar juices using ion-exchange materials for fractionating, adsorption or ion exclusion processes combined with elution or desorption of a sugar fraction
-
- C—CHEMISTRY; METALLURGY
- C13—SUGAR INDUSTRY
- C13K—SACCHARIDES OBTAINED FROM NATURAL SOURCES OR BY HYDROLYSIS OF NATURALLY OCCURRING DISACCHARIDES, OLIGOSACCHARIDES OR POLYSACCHARIDES
- C13K11/00—Fructose
-
- C—CHEMISTRY; METALLURGY
- C13—SUGAR INDUSTRY
- C13K—SACCHARIDES OBTAINED FROM NATURAL SOURCES OR BY HYDROLYSIS OF NATURALLY OCCURRING DISACCHARIDES, OLIGOSACCHARIDES OR POLYSACCHARIDES
- C13K3/00—Invert sugar; Separation of glucose or fructose from invert sugar
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- Organic Chemistry (AREA)
- Analytical Chemistry (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
- Treatment Of Liquids With Adsorbents In General (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP20892/75 | 1975-02-21 | ||
| JP50020892A JPS51110048A (en) | 1975-02-21 | 1975-02-21 | Toruino bunrihoho |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1152501A true CA1152501A (en) | 1983-08-23 |
Family
ID=12039860
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000246239A Expired CA1152501A (en) | 1975-02-21 | 1976-02-20 | Separation of fructose from a mixture of sugars |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US4014711A (en:Method) |
| JP (1) | JPS51110048A (en:Method) |
| CA (1) | CA1152501A (en:Method) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6036280B2 (ja) * | 1975-06-17 | 1985-08-19 | 東レ株式会社 | 糖類の分離方法 |
| US4226977A (en) * | 1976-05-27 | 1980-10-07 | Uop Inc. | Process for separating a ketose from an aldose by selective adsorption |
| US4483980A (en) * | 1976-05-27 | 1984-11-20 | Uop Inc. | Process for separating glucose from polysaccharides by selective adsorption |
| US4373025A (en) * | 1976-05-27 | 1983-02-08 | Uop Inc. | Process for the isomerization of glucose |
| US4340724A (en) * | 1976-05-27 | 1982-07-20 | Uop Inc. | Process for separating a ketose from an aldose by selective adsorption |
| US4349668A (en) * | 1976-05-27 | 1982-09-14 | Uop Inc. | Process for separating glucose from fructose by selective adsorption |
| US4358322A (en) * | 1976-05-27 | 1982-11-09 | Uop Inc. | Process for separating a ketose from an aldose by selective adsorption |
| FI772313A7 (en:Method) * | 1976-08-02 | 1978-02-03 | Uop Inc | |
| MD60C2 (ro) * | 1976-08-24 | 1994-11-30 | Toray Industries Inc. | Procedeu de separare a fructozei din amestecul de fructoză şi glucoză |
| JPS5326336A (en) * | 1976-08-24 | 1978-03-11 | Toray Industries | Method of fractional absorption for saccharides |
| JPS53104744A (en) * | 1977-02-20 | 1978-09-12 | Hiromu Kubota | Separation of fructose and glucose |
| US4226639A (en) * | 1979-05-25 | 1980-10-07 | Uop Inc. | Silica guard bed for adsorbent used in an aqueous system |
| US4238243A (en) * | 1979-05-29 | 1980-12-09 | Uop Inc. | Technique to reduce the zeolite molecular sieve solubility in an aqueous system |
| US4295994A (en) * | 1979-06-15 | 1981-10-20 | Uop Inc. | Cellulose acetate butyrate bound zeolite adsorbents |
| US4248737A (en) * | 1979-06-15 | 1981-02-03 | Uop Inc. | Technique to reduce the zeolite molecular sieve solubility in an aqueous system |
| US4298501A (en) * | 1979-06-15 | 1981-11-03 | Uop Inc. | Technique to reduce the zeolite molecular sieve solubility in an aqueous system |
| US4431456A (en) * | 1979-06-15 | 1984-02-14 | Uop Inc. | Technique to reduce the zeolite molecular sieve solubility in an aqueous system |
| US4345946A (en) * | 1979-09-14 | 1982-08-24 | Uop Inc. | Process for use of a zeolite molecular sieve adsorbent in an aqueous system |
| US4287001A (en) * | 1980-02-25 | 1981-09-01 | Uop Inc. | Esterified aluminosilicate adsorbent as for resolution of sugar components |
| US4363672A (en) * | 1980-04-11 | 1982-12-14 | Uop Inc. | Separation process using cellulose acetate butyrate bound zeolite adsorbents |
| US4333769A (en) * | 1980-05-02 | 1982-06-08 | Uop Inc. | Technique to reduce the zeolite molecular sieve solubility in an aqueous system |
| US4442285A (en) * | 1980-10-17 | 1984-04-10 | Uop Inc. | Process for separating glucose from fructose by selective adsorption |
| US4333768A (en) * | 1980-12-18 | 1982-06-08 | Uop Inc. | Technique to reduce the zeolite molecular sieve solubility in an aqueous system |
| US4325742A (en) * | 1981-02-05 | 1982-04-20 | Uop Inc. | Rare earth cation exchanged adsorbents for carbohydrate separations |
| DE3148603C1 (de) * | 1981-12-09 | 1983-07-21 | Kali-Chemie Ag, 3000 Hannover | Verfahren und Anlage zur Herstellung von Isomerose |
| US4405377A (en) * | 1982-02-10 | 1983-09-20 | Uop Inc. | Process for the separation of monosaccharides |
| JPS5956162A (ja) * | 1982-09-24 | 1984-03-31 | Hitachi Chem Co Ltd | カラム充てん剤およびその製造法 |
| US4591388A (en) * | 1982-12-30 | 1986-05-27 | Union Carbide Corporation | Separation of arabinose by selective adsorption on zeolitic molecular sieves |
| USRE33105E (en) * | 1982-12-30 | 1989-10-31 | Uop | Separation of mannose by selective adsorption on zeolitic molecular sieves |
| US4471114A (en) * | 1982-12-30 | 1984-09-11 | Union Carbide Corporation | Separation of mannose by selective adsorption on zeolitic molecular sieves |
| US4516566A (en) * | 1982-12-30 | 1985-05-14 | Union Carbide Corporation | Separation of arabinose by selective adsorption on zeolitic molecular sieves |
| US4572742A (en) * | 1983-09-28 | 1986-02-25 | The Graver Company | Precoat filter and method for neutralizing sugar syrups |
| US4822492A (en) * | 1984-09-28 | 1989-04-18 | Uop | Latex polymer bonded crystalline molecular sieves |
| US4735193A (en) * | 1985-02-08 | 1988-04-05 | Uop Inc. | Separation of a monosaccharide with mixed matrix membranes |
| US4692514A (en) * | 1985-12-20 | 1987-09-08 | Uop Inc. | Process for separating ketoses from alkaline- or pyridine-catalyzed isomerization products |
| US4880920A (en) * | 1985-12-20 | 1989-11-14 | Uop | Process for separating ketoses from alkaline-or pyridine-catalyzed isomerization products |
| US4707190A (en) * | 1986-09-02 | 1987-11-17 | Uop Inc. | Process for separating maltose from mixtures of maltose, glucose and other saccharides |
| FR2727968A1 (fr) * | 1994-12-07 | 1996-06-14 | Agrichimie Sa | Procede de preparation en continu d'une solution de cetose par isomerisation d'aldose, et installation de mise en oeuvre |
| US5800624A (en) * | 1996-10-22 | 1998-09-01 | University Of Notre Dame | Membrane process for separating carbohydrates |
| IL207945A0 (en) | 2010-09-02 | 2010-12-30 | Robert Jansen | Method for the production of carbohydrates |
| US20170342511A1 (en) * | 2014-12-09 | 2017-11-30 | Bioecon International Holding N.V. | Process for the isolation of monosaccharides |
| FR3097855B1 (fr) | 2019-06-28 | 2021-07-23 | Ifp Energies Now | Séparation en phase liquide des sucres de deuxième génération par adsorption sur zéolithe de type FAU de ratio atomique Si/Al inférieur à 1,5 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2522797A (en) * | 1943-10-30 | 1950-09-19 | Lewis A Paley | Method of purifying sugar juice |
| US2522022A (en) * | 1945-11-17 | 1950-09-12 | American Cyanamid Co | Sugar purification process |
| US3044904A (en) * | 1960-02-15 | 1962-07-17 | Central Aguirre Sugar Company | Separation of dextrose and levulose |
| US3044905A (en) * | 1960-02-15 | 1962-07-17 | Dow Chemical Co | Separation of fructose from glucose using cation exchange resin salts |
| US3416961A (en) * | 1964-01-07 | 1968-12-17 | Colonial Sugar Refining Co | Process for the separation of fructose and glucose |
| DE1567325C3 (de) * | 1965-08-05 | 1975-06-19 | Boehringer Mannheim Gmbh, 6800 Mannheim | Verfahren zur Gewinnung reiner Fructose und Glucose aus Saccharose bzw Saccharosehaitigen Invertzuckern |
| US3666647A (en) * | 1969-02-17 | 1972-05-30 | Tetsujiro Kubo | Separation of fructose and glucose |
| JPS5339492B1 (en:Method) * | 1970-02-06 | 1978-10-21 | ||
| US3785864A (en) * | 1970-07-23 | 1974-01-15 | Boehringer Mannheim Gmbh | Process for the chromatographic separation of multi-component mixtures containing glucose |
| US3692582A (en) * | 1970-07-31 | 1972-09-19 | Suomen Sokeri Oy | Procedure for the separation of fructose from the glucose of invert sugar |
| JPS5420578B1 (en:Method) * | 1970-12-09 | 1979-07-24 | ||
| US3784409A (en) * | 1971-06-01 | 1974-01-08 | Standard Brands Inc | Process for purifying glucose syrups containing fructose |
| DE2229208A1 (de) * | 1972-06-15 | 1974-01-03 | Boehringer Mannheim Gmbh | Verfahren zur trennung von zuckern |
-
1975
- 1975-02-21 JP JP50020892A patent/JPS51110048A/ja active Granted
-
1976
- 1976-02-18 US US05/658,910 patent/US4014711A/en not_active Expired - Lifetime
- 1976-02-20 CA CA000246239A patent/CA1152501A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS51110048A (en) | 1976-09-29 |
| US4014711A (en) | 1977-03-29 |
| JPS5515200B2 (en:Method) | 1980-04-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1152501A (en) | Separation of fructose from a mixture of sugars | |
| EP0115631B1 (en) | Separation of mannose by selective adsorption on zeolitic molecular sieves | |
| US4516566A (en) | Separation of arabinose by selective adsorption on zeolitic molecular sieves | |
| US4692514A (en) | Process for separating ketoses from alkaline- or pyridine-catalyzed isomerization products | |
| US4238243A (en) | Technique to reduce the zeolite molecular sieve solubility in an aqueous system | |
| US4295994A (en) | Cellulose acetate butyrate bound zeolite adsorbents | |
| US4372876A (en) | Zeolite molecular sieve adsorbent for an aqueous system | |
| US4373025A (en) | Process for the isomerization of glucose | |
| US4857642A (en) | Process for separating arabinose from a mixture of other aldoses | |
| US4405377A (en) | Process for the separation of monosaccharides | |
| US4316819A (en) | Technique to reduce the zeolite molecular sieve solubility in an aqueous system | |
| US4226639A (en) | Silica guard bed for adsorbent used in an aqueous system | |
| US4345946A (en) | Process for use of a zeolite molecular sieve adsorbent in an aqueous system | |
| US4880920A (en) | Process for separating ketoses from alkaline-or pyridine-catalyzed isomerization products | |
| US4910336A (en) | Process for separating phenylalanine from salts | |
| US4664718A (en) | Process for separating arabinose from a pentose/hexose mixture | |
| US4996380A (en) | Process for extracting meta-dichlorobenzene from isomer mixtures with mixed alkali metal exchanged X zeolite adsorbents | |
| US4394178A (en) | Bulk lactulose/lactose separation by selective adsorption on zeolitic molecular sieves | |
| GB1585369A (en) | Process for separating a monosaccharide from an oligosaccharide by selective adsorption | |
| US4325742A (en) | Rare earth cation exchanged adsorbents for carbohydrate separations | |
| US4287001A (en) | Esterified aluminosilicate adsorbent as for resolution of sugar components | |
| US4591388A (en) | Separation of arabinose by selective adsorption on zeolitic molecular sieves | |
| US4483980A (en) | Process for separating glucose from polysaccharides by selective adsorption | |
| US4363672A (en) | Separation process using cellulose acetate butyrate bound zeolite adsorbents | |
| CA1292988C (en) | Process for separating psicose from another ketose |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |