CA1146582A - Halogenated esters - Google Patents
Halogenated estersInfo
- Publication number
- CA1146582A CA1146582A CA000366436A CA366436A CA1146582A CA 1146582 A CA1146582 A CA 1146582A CA 000366436 A CA000366436 A CA 000366436A CA 366436 A CA366436 A CA 366436A CA 1146582 A CA1146582 A CA 1146582A
- Authority
- CA
- Canada
- Prior art keywords
- chloro
- product
- compound
- alcohol
- infra red
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000002148 esters Chemical class 0.000 title abstract description 9
- 150000001875 compounds Chemical class 0.000 claims abstract description 97
- 238000000034 method Methods 0.000 claims abstract description 26
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 12
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 7
- 239000001257 hydrogen Substances 0.000 claims abstract description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000005864 Sulphur Chemical group 0.000 claims abstract description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000001589 carboacyl group Chemical group 0.000 claims abstract description 5
- 239000001301 oxygen Substances 0.000 claims abstract description 5
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims abstract description 4
- 150000002431 hydrogen Chemical group 0.000 claims abstract description 3
- 125000004970 halomethyl group Chemical group 0.000 claims abstract 3
- -1 ethoxy, methoxy Chemical group 0.000 claims description 59
- 241000607479 Yersinia pestis Species 0.000 claims description 33
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 20
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 241000238631 Hexapoda Species 0.000 claims description 9
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 239000002689 soil Substances 0.000 claims description 5
- 125000005336 allyloxy group Chemical group 0.000 claims description 4
- 125000001246 bromo group Chemical group Br* 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 1
- 239000002917 insecticide Substances 0.000 abstract description 8
- 235000019445 benzyl alcohol Nutrition 0.000 abstract description 4
- 150000003938 benzyl alcohols Chemical class 0.000 abstract description 3
- 230000032050 esterification Effects 0.000 abstract description 2
- 238000005886 esterification reaction Methods 0.000 abstract description 2
- 125000001475 halogen functional group Chemical group 0.000 abstract description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 abstract 1
- 239000000047 product Substances 0.000 description 109
- 239000000203 mixture Substances 0.000 description 77
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 71
- 239000007788 liquid Substances 0.000 description 63
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 40
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 39
- 235000019441 ethanol Nutrition 0.000 description 38
- 239000000243 solution Substances 0.000 description 36
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 34
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- 238000002360 preparation method Methods 0.000 description 30
- 239000000460 chlorine Substances 0.000 description 25
- 238000001704 evaporation Methods 0.000 description 23
- 230000008020 evaporation Effects 0.000 description 22
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 20
- 235000019341 magnesium sulphate Nutrition 0.000 description 20
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- 239000002904 solvent Substances 0.000 description 16
- 239000004480 active ingredient Substances 0.000 description 15
- SPVZAYWHHVLPBN-HYXAFXHYSA-N 3-[(z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)C(\C=C(/Cl)C(F)(F)F)C1C(O)=O SPVZAYWHHVLPBN-HYXAFXHYSA-N 0.000 description 14
- 239000002253 acid Substances 0.000 description 12
- 229940057995 liquid paraffin Drugs 0.000 description 12
- QYYFWXPWSMGWNM-UHFFFAOYSA-N 2,2-dimethyl-3-(2,3,3,3-tetrafluoroprop-1-enyl)cyclopropane-1-carboxylic acid Chemical compound CC1(C)C(C=C(F)C(F)(F)F)C1C(O)=O QYYFWXPWSMGWNM-UHFFFAOYSA-N 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 11
- 239000000284 extract Substances 0.000 description 11
- 239000008187 granular material Substances 0.000 description 11
- 238000010992 reflux Methods 0.000 description 11
- GJEGXOUIWJIPTB-UHFFFAOYSA-N (2,3,5,6-tetrafluoro-4-methoxyphenyl)methanol Chemical compound COC1=C(F)C(F)=C(CO)C(F)=C1F GJEGXOUIWJIPTB-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 101150041968 CDC13 gene Proteins 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 7
- 230000000749 insecticidal effect Effects 0.000 description 7
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 7
- 239000011369 resultant mixture Substances 0.000 description 7
- PJCSTULKVNHEGW-UHFFFAOYSA-N (2,3,5,6-tetrafluoro-4-methylphenyl)methanol Chemical compound CC1=C(F)C(F)=C(CO)C(F)=C1F PJCSTULKVNHEGW-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 6
- 238000007792 addition Methods 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 6
- 239000012280 lithium aluminium hydride Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- WVOWUXMUMXPKPI-UHFFFAOYSA-N (2,3,5,6-tetrafluoro-4-prop-2-enylphenyl)methanol Chemical compound OCC1=C(F)C(F)=C(CC=C)C(F)=C1F WVOWUXMUMXPKPI-UHFFFAOYSA-N 0.000 description 5
- SDXUIOOHCIQXRP-UHFFFAOYSA-N 1,2,4,5-tetrafluorobenzene Chemical compound FC1=CC(F)=C(F)C=C1F SDXUIOOHCIQXRP-UHFFFAOYSA-N 0.000 description 5
- LLMLSUSAKZVFOA-UHFFFAOYSA-N 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(O)=O LLMLSUSAKZVFOA-UHFFFAOYSA-N 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 230000000875 corresponding effect Effects 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- OZJPNJZIKNAPEJ-UHFFFAOYSA-N 2-[(2,3,4,5,6-pentafluorophenyl)methoxy]oxane Chemical compound O1C(CCCC1)OCC1=C(C(=C(C(=C1F)F)F)F)F OZJPNJZIKNAPEJ-UHFFFAOYSA-N 0.000 description 4
- SPVZAYWHHVLPBN-UHFFFAOYSA-N 3-(2-chloro-3,3,3-trifluoroprop-1-en-1-yl)-2,2-dimethylcyclopropanecarboxylic acid Chemical compound CC1(C)C(C=C(Cl)C(F)(F)F)C1C(O)=O SPVZAYWHHVLPBN-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- 238000004566 IR spectroscopy Methods 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000002316 fumigant Substances 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 229910052744 lithium Inorganic materials 0.000 description 4
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- AGWVQASYTKCTCC-UHFFFAOYSA-N (2,3,5,6-tetrafluorophenyl)methanol Chemical compound OCC1=C(F)C(F)=CC(F)=C1F AGWVQASYTKCTCC-UHFFFAOYSA-N 0.000 description 3
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 3
- CZXXZRIHUHYXIQ-UHFFFAOYSA-N 1-bromo-2,3,4,6-tetrafluoro-5-methylbenzene Chemical compound CC1=C(F)C(F)=C(F)C(Br)=C1F CZXXZRIHUHYXIQ-UHFFFAOYSA-N 0.000 description 3
- PGJYYCIOYBZTPU-UHFFFAOYSA-N 2,3,4,5,6-pentafluorobenzyl alcohol Chemical compound OCC1=C(F)C(F)=C(F)C(F)=C1F PGJYYCIOYBZTPU-UHFFFAOYSA-N 0.000 description 3
- DMQAMZJLEIINMT-UHFFFAOYSA-N 2,3,4,6-tetrafluoro-5-methylbenzaldehyde Chemical compound CC1=C(F)C(F)=C(F)C(C=O)=C1F DMQAMZJLEIINMT-UHFFFAOYSA-N 0.000 description 3
- SJZATRRXUILGHH-UHFFFAOYSA-N 2,4,6-trifluorobenzoic acid Chemical compound OC(=O)C1=C(F)C=C(F)C=C1F SJZATRRXUILGHH-UHFFFAOYSA-N 0.000 description 3
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical compound O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 241000489975 Diabrotica Species 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 239000012300 argon atmosphere Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229950011148 cyclopropane Drugs 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 150000008423 fluorobenzenes Chemical class 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 235000011167 hydrochloric acid Nutrition 0.000 description 3
- 229960000443 hydrochloric acid Drugs 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- RDAIRQLEVUNMTA-UHFFFAOYSA-N methyl 2,4,6-trifluorobenzoate Chemical compound COC(=O)C1=C(F)C=C(F)C=C1F RDAIRQLEVUNMTA-UHFFFAOYSA-N 0.000 description 3
- JUYBUWPEAIKESH-UHFFFAOYSA-N methyl 2,6-difluoro-4-methoxybenzoate Chemical compound COC(=O)C1=C(F)C=C(OC)C=C1F JUYBUWPEAIKESH-UHFFFAOYSA-N 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- DNADCLCZOWRDMK-UHFFFAOYSA-N (2,3,5,6-tetrafluoro-4-methylphenyl)methyl 2,2-dimethyl-3-(2,3,3,3-tetrafluoroprop-1-enyl)cyclopropane-1-carboxylate Chemical compound FC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)C)F)F)(C)C)C(F)(F)F DNADCLCZOWRDMK-UHFFFAOYSA-N 0.000 description 2
- XZXUXOWJHHKKFH-UHFFFAOYSA-N (4-amino-2,3,5,6-tetrafluorophenyl)methyl 2,2-dimethyl-3-(2,3,3,3-tetrafluoroprop-1-enyl)cyclopropane-1-carboxylate Chemical compound CC1(C)C(C=C(F)C(F)(F)F)C1C(=O)OCC1=C(F)C(F)=C(N)C(F)=C1F XZXUXOWJHHKKFH-UHFFFAOYSA-N 0.000 description 2
- FYGHSUNMUKGBRK-UHFFFAOYSA-N 1,2,3-trimethylbenzene Chemical compound CC1=CC=CC(C)=C1C FYGHSUNMUKGBRK-UHFFFAOYSA-N 0.000 description 2
- POMGTQLCZJZYAM-UHFFFAOYSA-N 1,2,4,5-tetrafluoro-3-methylbenzene Chemical compound CC1=C(F)C(F)=CC(F)=C1F POMGTQLCZJZYAM-UHFFFAOYSA-N 0.000 description 2
- CQPIMIJDRWLFGV-UHFFFAOYSA-N 1,3-difluoro-5-prop-2-enylbenzene Chemical compound FC1=CC(F)=CC(CC=C)=C1 CQPIMIJDRWLFGV-UHFFFAOYSA-N 0.000 description 2
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 2
- COOULIOYEXBFDT-UHFFFAOYSA-N 2,3,5,6-tetrafluoro-4-methylbenzoic acid Chemical compound CC1=C(F)C(F)=C(C(O)=O)C(F)=C1F COOULIOYEXBFDT-UHFFFAOYSA-N 0.000 description 2
- INABVTWXXDFTOB-UHFFFAOYSA-N 2,3,5,6-tetrafluoro-4-prop-2-enylbenzoic acid Chemical compound OC(=O)C1=C(F)C(F)=C(CC=C)C(F)=C1F INABVTWXXDFTOB-UHFFFAOYSA-N 0.000 description 2
- AQKOFEIHSLXLCD-UHFFFAOYSA-N 2,3,5,6-tetrafluoro-4-propylbenzoic acid Chemical compound CCCC1=C(F)C(F)=C(C(O)=O)C(F)=C1F AQKOFEIHSLXLCD-UHFFFAOYSA-N 0.000 description 2
- NQRVFQWBISDGIN-UHFFFAOYSA-N 2-[(2,3,5,6-tetrafluorophenyl)methoxy]oxane Chemical compound FC1=CC(F)=C(F)C(COC2OCCCC2)=C1F NQRVFQWBISDGIN-UHFFFAOYSA-N 0.000 description 2
- FCEJHXZLFNQOGX-UHFFFAOYSA-N 2-[(4-ethylsulfanyl-2,3,5,6-tetrafluorophenyl)methoxy]oxane Chemical compound FC1=C(F)C(SCC)=C(F)C(F)=C1COC1OCCCC1 FCEJHXZLFNQOGX-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- MDIQXIJPQWLFSD-UHFFFAOYSA-N 3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)C(C=C(Br)Br)C1C(O)=O MDIQXIJPQWLFSD-UHFFFAOYSA-N 0.000 description 2
- SLBRVTYGFQJTND-UHFFFAOYSA-N 3-ethyl-1,2,4,5-tetrafluorobenzene Chemical compound CCC1=C(F)C(F)=CC(F)=C1F SLBRVTYGFQJTND-UHFFFAOYSA-N 0.000 description 2
- IESIHRVVKSZFFF-UHFFFAOYSA-N 4-benzyl-2,3,5,6-tetrafluorobenzoic acid Chemical compound FC1=C(F)C(C(=O)O)=C(F)C(F)=C1CC1=CC=CC=C1 IESIHRVVKSZFFF-UHFFFAOYSA-N 0.000 description 2
- XTAWIGQMVROGCZ-UHFFFAOYSA-N 4-ethyl-2,3,5,6-tetrafluorobenzoic acid Chemical compound CCC1=C(F)C(F)=C(C(O)=O)C(F)=C1F XTAWIGQMVROGCZ-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- 241000218473 Agrotis Species 0.000 description 2
- 241001124076 Aphididae Species 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- KFKLDBSGRRAYLP-UHFFFAOYSA-N ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)OC)F)F)(C)C)C(F)(F)F Chemical compound ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)OC)F)F)(C)C)C(F)(F)F KFKLDBSGRRAYLP-UHFFFAOYSA-N 0.000 description 2
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 2
- 241000255925 Diptera Species 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 241000258937 Hemiptera Species 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 206010061217 Infestation Diseases 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- 241000256259 Noctuidae Species 0.000 description 2
- 241001608567 Phaedon cochleariae Species 0.000 description 2
- 241001481703 Rhipicephalus <genus> Species 0.000 description 2
- 241000256250 Spodoptera littoralis Species 0.000 description 2
- 241001454293 Tetranychus urticae Species 0.000 description 2
- 239000001089 [(2R)-oxolan-2-yl]methanol Substances 0.000 description 2
- ZEEBGORNQSEQBE-UHFFFAOYSA-N [2-(3-phenylphenoxy)-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound C1(=CC(=CC=C1)OC1=NC(=CC(=C1)CN)C(F)(F)F)C1=CC=CC=C1 ZEEBGORNQSEQBE-UHFFFAOYSA-N 0.000 description 2
- 230000000895 acaricidal effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 150000001559 benzoic acids Chemical class 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical class OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- XJUJXVATKIRSAM-UHFFFAOYSA-N fluoro(phenyl)methanol Chemical class OC(F)C1=CC=CC=C1 XJUJXVATKIRSAM-UHFFFAOYSA-N 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000002524 organometallic group Chemical group 0.000 description 2
- 230000000361 pesticidal effect Effects 0.000 description 2
- 238000004237 preparative chromatography Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- BSYVTEYKTMYBMK-UHFFFAOYSA-N tetrahydrofurfuryl alcohol Chemical compound OCC1CCCO1 BSYVTEYKTMYBMK-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- WYKFZJYASXRDRY-UHFFFAOYSA-N (2,3,4,5-tetrafluoro-6-methylphenyl)methyl 3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1=C(F)C(F)=C(F)C(F)=C1COC(=O)C1C(C)(C)C1C=C(Cl)C(F)(F)F WYKFZJYASXRDRY-UHFFFAOYSA-N 0.000 description 1
- HLUZGUMMQYQHKJ-UHFFFAOYSA-N (2,3,4,5-tetrafluorophenyl)methanol Chemical compound OCC1=CC(F)=C(F)C(F)=C1F HLUZGUMMQYQHKJ-UHFFFAOYSA-N 0.000 description 1
- FYVCZBOXTIRVSH-UHFFFAOYSA-N (2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl 2,2-dimethyl-3-(2,3,3,3-tetrafluoroprop-1-enyl)cyclopropane-1-carboxylate Chemical compound FC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)OC)F)F)(C)C)C(F)(F)F FYVCZBOXTIRVSH-UHFFFAOYSA-N 0.000 description 1
- WYPSWMAHRRKNQR-UHFFFAOYSA-N (2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound FC1=C(F)C(OC)=C(F)C(F)=C1COC(=O)C1C(C)(C)C1C=C(Cl)Cl WYPSWMAHRRKNQR-UHFFFAOYSA-N 0.000 description 1
- HICIEVJLTZQJMI-UHFFFAOYSA-N (2,3,5,6-tetrafluoro-4-methylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound FC1=C(F)C(C)=C(F)C(F)=C1COC(=O)C1C(C)(C)C1C=C(Cl)Cl HICIEVJLTZQJMI-UHFFFAOYSA-N 0.000 description 1
- ZFHGXWPMULPQSE-UHFFFAOYSA-N (2,3,5,6-tetrafluoro-4-methylphenyl)methyl 3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound FC1=C(F)C(C)=C(F)C(F)=C1COC(=O)C1C(C)(C)C1C=C(Cl)C(F)(F)F ZFHGXWPMULPQSE-UHFFFAOYSA-N 0.000 description 1
- LOGIHEKXJKHXEC-UHFFFAOYSA-N (3,5-difluorophenyl)methanol Chemical compound OCC1=CC(F)=CC(F)=C1 LOGIHEKXJKHXEC-UHFFFAOYSA-N 0.000 description 1
- RILXHKAQBJGRQC-UHFFFAOYSA-N (4-acetamido-2,3,5,6-tetrafluorophenyl)methyl 2,2-dimethyl-3-(2,3,3,3-tetrafluoroprop-1-enyl)cyclopropane-1-carboxylate Chemical compound FC1=C(F)C(NC(=O)C)=C(F)C(F)=C1COC(=O)C1C(C)(C)C1C=C(F)C(F)(F)F RILXHKAQBJGRQC-UHFFFAOYSA-N 0.000 description 1
- YRZALYJBPQYQJG-UHFFFAOYSA-N (4-ethylsulfanyl-2,3,5,6-tetrafluorophenyl)methyl 3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound FC1=C(F)C(SCC)=C(F)C(F)=C1COC(=O)C1C(C)(C)C1C=C(Cl)C(F)(F)F YRZALYJBPQYQJG-UHFFFAOYSA-N 0.000 description 1
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- HFUCBJBAWSVVBF-UHFFFAOYSA-N 1,2,3,4-tetrafluoro-5,6-dimethylbenzene Chemical group CC1=C(C)C(F)=C(F)C(F)=C1F HFUCBJBAWSVVBF-UHFFFAOYSA-N 0.000 description 1
- SOZFIIXUNAKEJP-UHFFFAOYSA-N 1,2,3,4-tetrafluorobenzene Chemical compound FC1=CC=C(F)C(F)=C1F SOZFIIXUNAKEJP-UHFFFAOYSA-N 0.000 description 1
- SFKJHVUNOACDHB-UHFFFAOYSA-N 1,2,4,5-tetrafluoro-3-propylbenzene Chemical compound CCCC1=C(F)C(F)=CC(F)=C1F SFKJHVUNOACDHB-UHFFFAOYSA-N 0.000 description 1
- FBWPVXMXVCITCU-UHFFFAOYSA-N 1,2,4,5-tetrafluoro-5,6-dimethylcyclohexa-1,3-diene Chemical group CC1C(F)=C(F)C=C(F)C1(C)F FBWPVXMXVCITCU-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- JXUKFFRPLNTYIV-UHFFFAOYSA-N 1,3,5-trifluorobenzene Chemical compound FC1=CC(F)=CC(F)=C1 JXUKFFRPLNTYIV-UHFFFAOYSA-N 0.000 description 1
- UCWKDDQEZQRGDR-UHFFFAOYSA-N 1,3-dibromo-2,4,5,6-tetrafluorobenzene Chemical compound FC1=C(F)C(Br)=C(F)C(Br)=C1F UCWKDDQEZQRGDR-UHFFFAOYSA-N 0.000 description 1
- JHLKSIOJYMGSMB-UHFFFAOYSA-N 1-bromo-3,5-difluorobenzene Chemical compound FC1=CC(F)=CC(Br)=C1 JHLKSIOJYMGSMB-UHFFFAOYSA-N 0.000 description 1
- LOYZVRIHVZEDMW-UHFFFAOYSA-N 1-bromo-3-methylbut-2-ene Chemical compound CC(C)=CCBr LOYZVRIHVZEDMW-UHFFFAOYSA-N 0.000 description 1
- NUYXDKVYLYROIE-UHFFFAOYSA-N 2,2-dimethyl-1-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]-3-(2,3,3,3-tetrafluoroprop-1-enyl)cyclopropane-1-carboxylic acid Chemical compound CC1(C(C1(CC2=C(C(=C(C(=C2F)F)OC)F)F)C(=O)O)C=C(C(F)(F)F)F)C NUYXDKVYLYROIE-UHFFFAOYSA-N 0.000 description 1
- JKNZPDHVRYPABM-UHFFFAOYSA-N 2,3,4,5-tetrafluoro-6-methylbenzoic acid Chemical compound CC1=C(F)C(F)=C(F)C(F)=C1C(O)=O JKNZPDHVRYPABM-UHFFFAOYSA-N 0.000 description 1
- KVLBXIOFJUWSJQ-UHFFFAOYSA-N 2,3,5,6-tetrafluorobenzoic acid Chemical compound OC(=O)C1=C(F)C(F)=CC(F)=C1F KVLBXIOFJUWSJQ-UHFFFAOYSA-N 0.000 description 1
- VEQMUQZKBLIXLT-UHFFFAOYSA-N 2,3-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1C(C)C1C(O)=O VEQMUQZKBLIXLT-UHFFFAOYSA-N 0.000 description 1
- SIFIJQFBERMWMU-UHFFFAOYSA-N 2,4,6-trifluorobenzoyl chloride Chemical compound FC1=CC(F)=C(C(Cl)=O)C(F)=C1 SIFIJQFBERMWMU-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- MTGNPOWULYVPKZ-UHFFFAOYSA-N 2-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methoxy]oxane Chemical compound FC1=C(F)C(OC)=C(F)C(F)=C1COC1OCCCC1 MTGNPOWULYVPKZ-UHFFFAOYSA-N 0.000 description 1
- ITPMNELRRAFOSZ-UHFFFAOYSA-N 2-[(3,5-difluorophenyl)methoxy]oxane Chemical compound FC1=CC(F)=CC(COC2OCCCC2)=C1 ITPMNELRRAFOSZ-UHFFFAOYSA-N 0.000 description 1
- NSPHBOCGYFNGDD-UHFFFAOYSA-N 2-[(4-but-3-enyl-2,4,5,6-tetrafluorocyclohexa-1,5-dien-1-yl)methoxy]oxane Chemical compound FC1=C(F)C(F)(CCC=C)CC(F)=C1COC1OCCCC1 NSPHBOCGYFNGDD-UHFFFAOYSA-N 0.000 description 1
- FHDQCARGRNPMCI-UHFFFAOYSA-N 2-[[2,3,5,6-tetrafluoro-4-(3-methylbut-2-enyl)phenyl]methoxy]oxane Chemical compound FC1=C(F)C(CC=C(C)C)=C(F)C(F)=C1COC1OCCCC1 FHDQCARGRNPMCI-UHFFFAOYSA-N 0.000 description 1
- LEHNQGSPRXHYRT-UHFFFAOYSA-N 2-dodecyl-1h-imidazole Chemical compound CCCCCCCCCCCCC1=NC=CN1 LEHNQGSPRXHYRT-UHFFFAOYSA-N 0.000 description 1
- CBQDTCDOVVBGMN-UHFFFAOYSA-N 2-methyl-3-octylphenol Chemical compound CCCCCCCCC1=CC=CC(O)=C1C CBQDTCDOVVBGMN-UHFFFAOYSA-N 0.000 description 1
- DUIOKRXOKLLURE-UHFFFAOYSA-N 2-octylphenol Chemical compound CCCCCCCCC1=CC=CC=C1O DUIOKRXOKLLURE-UHFFFAOYSA-N 0.000 description 1
- LLMLSUSAKZVFOA-UHFFFAOYSA-M 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)C(C=C(Cl)Cl)C1C([O-])=O LLMLSUSAKZVFOA-UHFFFAOYSA-M 0.000 description 1
- WTNSXWSOTDBWOR-UHFFFAOYSA-N 4-amino-2,3,5,6-tetrafluorobenzoic acid Chemical compound NC1=C(F)C(F)=C(C(O)=O)C(F)=C1F WTNSXWSOTDBWOR-UHFFFAOYSA-N 0.000 description 1
- VSBPRBXTUAKKSY-UHFFFAOYSA-N 5-(5-methyl-1,3-dioxan-4-yl)-1,3-benzodioxole Chemical compound CC1COCOC1C1=CC=C(OCO2)C2=C1 VSBPRBXTUAKKSY-UHFFFAOYSA-N 0.000 description 1
- 241000238876 Acari Species 0.000 description 1
- 241000256118 Aedes aegypti Species 0.000 description 1
- 241001136249 Agriotes lineatus Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000238679 Amblyomma Species 0.000 description 1
- 241001414827 Aonidiella Species 0.000 description 1
- 241001425390 Aphis fabae Species 0.000 description 1
- 241000239290 Araneae Species 0.000 description 1
- 241000238657 Blattella germanica Species 0.000 description 1
- 241001674044 Blattodea Species 0.000 description 1
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 1
- VRSKDHFNUPKSBZ-UHFFFAOYSA-N C(CCC)[Li].CC=1C(=C(C=O)C(=C(C1F)F)F)F Chemical compound C(CCC)[Li].CC=1C(=C(C=O)C(=C(C1F)F)F)F VRSKDHFNUPKSBZ-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- XLOPRKKSAJMMEW-SFYZADRCSA-N Chrysanthemic acid Natural products CC(C)=C[C@@H]1[C@@H](C(O)=O)C1(C)C XLOPRKKSAJMMEW-SFYZADRCSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- DXCLWQDRWMTSKM-UHFFFAOYSA-N ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)CC)F)F)(C)C)C(F)(F)F Chemical compound ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)CC)F)F)(C)C)C(F)(F)F DXCLWQDRWMTSKM-UHFFFAOYSA-N 0.000 description 1
- PYADVQCFUANPQQ-UHFFFAOYSA-N ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)CC1=CC=CC=C1)F)F)(C)C)C(F)(F)F Chemical compound ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)CC1=CC=CC=C1)F)F)(C)C)C(F)(F)F PYADVQCFUANPQQ-UHFFFAOYSA-N 0.000 description 1
- KBYZXUCMHLLCHJ-UHFFFAOYSA-N ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)CC=C(C)C)F)F)(C)C)C(F)(F)F Chemical compound ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)CC=C(C)C)F)F)(C)C)C(F)(F)F KBYZXUCMHLLCHJ-UHFFFAOYSA-N 0.000 description 1
- ZJFZRIBVEVGADA-UHFFFAOYSA-N ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)CC=CC)F)F)(C)C)C(F)(F)F Chemical compound ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)CC=CC)F)F)(C)C)C(F)(F)F ZJFZRIBVEVGADA-UHFFFAOYSA-N 0.000 description 1
- DAWWXKPWAOUMGV-UHFFFAOYSA-N ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)CCC)F)F)(C)C)C(F)(F)F Chemical compound ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)CCC)F)F)(C)C)C(F)(F)F DAWWXKPWAOUMGV-UHFFFAOYSA-N 0.000 description 1
- AQMWNSAEBOPMQZ-UHFFFAOYSA-N ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)CCCC)F)F)(C)C)C(F)(F)F Chemical compound ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)CCCC)F)F)(C)C)C(F)(F)F AQMWNSAEBOPMQZ-UHFFFAOYSA-N 0.000 description 1
- IXRKUKQSCZQBGF-UHFFFAOYSA-N ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)F)C)F)(C)C)C(F)(F)F Chemical compound ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)F)C)F)(C)C)C(F)(F)F IXRKUKQSCZQBGF-UHFFFAOYSA-N 0.000 description 1
- BKZYFRKMBCWCFC-UHFFFAOYSA-N ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)F)C)F)(C)C)Cl Chemical compound ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)F)C)F)(C)C)Cl BKZYFRKMBCWCFC-UHFFFAOYSA-N 0.000 description 1
- YIBCTSKRHIWLNO-UHFFFAOYSA-N ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)OCC)F)F)(C)C)C(F)(F)F Chemical compound ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)OCC)F)F)(C)C)C(F)(F)F YIBCTSKRHIWLNO-UHFFFAOYSA-N 0.000 description 1
- JDTROVPYOAXAGU-UHFFFAOYSA-N ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)OCC)F)F)(C)C)Cl Chemical compound ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)OCC)F)F)(C)C)Cl JDTROVPYOAXAGU-UHFFFAOYSA-N 0.000 description 1
- LAKMWUITYZPJSU-UHFFFAOYSA-N ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)S(=O)(=O)CC)F)F)(C)C)C(F)(F)F Chemical compound ClC(=CC1C(C1C(=O)OCC1=C(C(=C(C(=C1F)F)S(=O)(=O)CC)F)F)(C)C)C(F)(F)F LAKMWUITYZPJSU-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- 241001127120 Dysdercus fasciatus Species 0.000 description 1
- 101100506034 Fibrobacter succinogenes (strain ATCC 19169 / S85) cel-3 gene Proteins 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241001466042 Fulgoromorpha Species 0.000 description 1
- 241000256257 Heliothis Species 0.000 description 1
- 241000238681 Ixodes Species 0.000 description 1
- 229910010082 LiAlH Inorganic materials 0.000 description 1
- 229910010084 LiAlH4 Inorganic materials 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical class [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241000736227 Lucilia sericata Species 0.000 description 1
- 241000171274 Megoura Species 0.000 description 1
- 241000257159 Musca domestica Species 0.000 description 1
- 241000257226 Muscidae Species 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 229910018954 NaNH2 Inorganic materials 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- RMULMTLUVKEBJA-UHFFFAOYSA-N O1C(CCCC1)OCC1=C(C(=C(C(=C1F)F)S(=O)(=O)CC)F)F Chemical compound O1C(CCCC1)OCC1=C(C(=C(C(=C1F)F)S(=O)(=O)CC)F)F RMULMTLUVKEBJA-UHFFFAOYSA-N 0.000 description 1
- 241000238814 Orthoptera Species 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 241000255969 Pieris brassicae Species 0.000 description 1
- 241000500437 Plutella xylostella Species 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000004141 Sodium laurylsulphate Substances 0.000 description 1
- 241000256248 Spodoptera Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- DWLJBPZTTRVYGJ-UHFFFAOYSA-L [Mg+2].[Br-].[Br-].FC1=CC(F)=C(F)C(Br)=C1F Chemical compound [Mg+2].[Br-].[Br-].FC1=CC(F)=C(F)C(Br)=C1F DWLJBPZTTRVYGJ-UHFFFAOYSA-L 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- RMRFFCXPLWYOOY-UHFFFAOYSA-N allyl radical Chemical compound [CH2]C=C RMRFFCXPLWYOOY-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229920005550 ammonium lignosulfonate Polymers 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000002824 aphicidal effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- JIJAYWGYIDJVJI-UHFFFAOYSA-N butyl naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)OCCCC)=CC=CC2=C1 JIJAYWGYIDJVJI-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- 210000000234 capsid Anatomy 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 235000012730 carminic acid Nutrition 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- XLOPRKKSAJMMEW-UHFFFAOYSA-N chrysanthemic acid Chemical compound CC(C)=CC1C(C(O)=O)C1(C)C XLOPRKKSAJMMEW-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000001942 cyclopropanes Chemical class 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 235000005489 dwarf bean Nutrition 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 238000003197 gene knockdown Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 125000006277 halobenzyl group Chemical group 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 230000001418 larval effect Effects 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- ITNVWQNWHXEMNS-UHFFFAOYSA-N methanolate;titanium(4+) Chemical compound [Ti+4].[O-]C.[O-]C.[O-]C.[O-]C ITNVWQNWHXEMNS-UHFFFAOYSA-N 0.000 description 1
- JIKUXBYRTXDNIY-UHFFFAOYSA-N n-methyl-n-phenylformamide Chemical compound O=CN(C)C1=CC=CC=C1 JIKUXBYRTXDNIY-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 230000005180 public health Effects 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- HFQQZARZPUDIFP-UHFFFAOYSA-M sodium;2-dodecylbenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O HFQQZARZPUDIFP-UHFFFAOYSA-M 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 150000003608 titanium Chemical class 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- UBOXGVDOUJQMTN-UHFFFAOYSA-N trichloroethylene Natural products ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 231100000925 very toxic Toxicity 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N53/00—Biocides, pest repellants or attractants, or plant growth regulators containing cyclopropane carboxylic acids or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/26—Preparation of halogenated hydrocarbons by reactions involving an increase in the number of carbon atoms in the skeleton
- C07C17/263—Preparation of halogenated hydrocarbons by reactions involving an increase in the number of carbon atoms in the skeleton by condensation reactions
- C07C17/2632—Preparation of halogenated hydrocarbons by reactions involving an increase in the number of carbon atoms in the skeleton by condensation reactions involving an organo-magnesium compound, e.g. Grignard synthesis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/26—Preparation of halogenated hydrocarbons by reactions involving an increase in the number of carbon atoms in the skeleton
- C07C17/263—Preparation of halogenated hydrocarbons by reactions involving an increase in the number of carbon atoms in the skeleton by condensation reactions
- C07C17/269—Preparation of halogenated hydrocarbons by reactions involving an increase in the number of carbon atoms in the skeleton by condensation reactions of only halogenated hydrocarbons
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/09—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by hydrolysis
- C07C29/10—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by hydrolysis of ethers, including cyclic ethers, e.g. oxiranes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/14—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of a —CHO group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/147—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of carboxylic acids or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/23—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing hydroxy or O-metal groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/55—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C63/00—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings
- C07C63/68—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings containing halogen
- C07C63/70—Monocarboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C63/00—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings
- C07C63/68—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings containing halogen
- C07C63/72—Polycyclic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C63/00—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings
- C07C63/68—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings containing halogen
- C07C63/74—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings containing halogen having unsaturation outside the aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/74—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring
- C07C69/743—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring of acids with a three-membered ring and with unsaturation outside the ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/02—Systems containing only non-condensed rings with a three-membered ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA000402850A CA1181768A (en) | 1979-12-21 | 1982-05-12 | Halogenated esters |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7944151 | 1979-12-21 | ||
| GB7944151 | 1979-12-21 |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000402850A Division CA1181768A (en) | 1979-12-21 | 1982-05-12 | Halogenated esters |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1146582A true CA1146582A (en) | 1983-05-17 |
Family
ID=10510012
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000366436A Expired CA1146582A (en) | 1979-12-21 | 1980-12-09 | Halogenated esters |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4405640A (enEXAMPLES) |
| EP (1) | EP0031199B1 (enEXAMPLES) |
| JP (3) | JPS5697251A (enEXAMPLES) |
| AU (2) | AU537917B2 (enEXAMPLES) |
| CA (1) | CA1146582A (enEXAMPLES) |
| DE (1) | DE3065914D1 (enEXAMPLES) |
| ES (1) | ES8200858A1 (enEXAMPLES) |
| GB (1) | GB2066810A (enEXAMPLES) |
| HU (2) | HU184360B (enEXAMPLES) |
| IL (1) | IL61652A (enEXAMPLES) |
| MW (1) | MW5280A1 (enEXAMPLES) |
| MY (1) | MY8500983A (enEXAMPLES) |
| NL (1) | NL971015I2 (enEXAMPLES) |
| NZ (1) | NZ195659A (enEXAMPLES) |
| PH (3) | PH17344A (enEXAMPLES) |
| ZA (1) | ZA807427B (enEXAMPLES) |
| ZM (1) | ZM11180A1 (enEXAMPLES) |
| ZW (1) | ZW29880A1 (enEXAMPLES) |
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3127752A1 (de) * | 1981-07-14 | 1983-02-03 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von permethrinsaeurementhylester |
| GB2106390A (en) * | 1981-08-27 | 1983-04-13 | Ici Plc | Combating soil-dwelling insect pests |
| EP0074132B1 (en) * | 1981-08-31 | 1986-04-30 | Shell Internationale Researchmaatschappij B.V. | Protection of crops against soil pests employing an alkylbenzyl cyclopropane carboxylate, novel cyclopropane carboxylates, and compositions containing them |
| US4778822A (en) * | 1982-05-21 | 1988-10-18 | Imperial Chemical Industries Plc | Insecticidally active ester |
| DE3318572A1 (de) * | 1982-05-25 | 1983-12-01 | National Research Development Corp., London | Neue pestizide und verfahren zu ihrer herstellung |
| FR2531948B1 (fr) * | 1982-06-28 | 1986-05-09 | Nat Res Dev | Pesticide et procedes pour sa preparation et pour son utilisation |
| GB2130198B (en) * | 1982-07-29 | 1986-10-15 | Nat Res Dev | Pesticidal cyclopropane carboxylic acid esters |
| US4542142A (en) * | 1982-11-22 | 1985-09-17 | Roussel Uclaf | Insecticidal cyclopropane carboxylic acid derivatives with 3-unsaturated-side chain |
| GB8403548D0 (en) * | 1984-02-10 | 1984-03-14 | Ici Plc | Chemical process |
| US4758590A (en) * | 1984-03-14 | 1988-07-19 | Fmc Corporation | Method for control of soil-borne insects |
| DE3513978A1 (de) * | 1985-04-18 | 1986-10-30 | Bayer Ag, 5090 Leverkusen | Vinylcyclopropancarbonsaeureester |
| HUT41236A (en) * | 1984-10-10 | 1987-04-28 | Fmc Corp | Process for extermination of soil-insects |
| GB8505819D0 (en) * | 1985-03-06 | 1985-04-11 | Ici Plc | Fluorobenzyl esters |
| DE3522623A1 (de) * | 1985-06-25 | 1987-01-08 | Bayer Ag | Tetramethylcyclopropancarbonsaeureester |
| GB8522656D0 (en) * | 1985-09-13 | 1985-10-16 | Ici Plc | Fluoro alcohols |
| GB8626520D0 (en) * | 1986-11-06 | 1986-12-10 | Ici Plc | Halogenated esters |
| GB8629806D0 (en) * | 1986-12-12 | 1987-01-21 | Ici Plc | Fluorobenzyl esters |
| FR2610624B1 (fr) * | 1987-02-06 | 1989-06-09 | Roussel Uclaf | Nouveaux esters d'acides cyclopropanecarboxyliques apparentes a l'acide pyrethrique, leur procede de preparation et leur application a la lutte contre les parasites |
| DE3705224A1 (de) * | 1987-02-19 | 1988-09-01 | Bayer Ag | (+)1r-trans-2,2-dimethyl-3-(2,2-dichlorvinyl) -cyclopropancarbonsaeure-2,3,5,6- tetrafluorbenzylester |
| DE3710668A1 (de) * | 1987-03-31 | 1988-10-13 | Basf Lacke & Farben | Haertbare zusammensetzung auf basis verzweigter acrylate mit carboxylgruppen und/oder verzweigter acrylate mit epoxidgruppen sowie aminoplastharzen |
| DE3714602A1 (de) * | 1987-05-01 | 1988-11-10 | Bayer Ag | Verfahren zur herstellung von 2,3,5,6-tetrafluor-benzyl-alkoholen |
| DE3718527A1 (de) * | 1987-06-03 | 1988-12-15 | Basf Ag | Verfahren zur herstellung von 2(5h)-furanonen |
| GB8718620D0 (en) * | 1987-08-06 | 1987-09-09 | Ici Plc | Insecticide compounds |
| DE3820895A1 (de) * | 1988-06-21 | 1989-12-28 | Basf Ag | Pyrethroide, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von schaedlingen |
| FR2641275B1 (fr) * | 1988-12-29 | 1991-10-11 | Roussel Uclaf | Nouveaux derives fluores de l'acide 3-ethenyl 2,2-dimethyl cyclopropane carboxylique, leur procede de preparation et leur application comme pesticides |
| FR2678609B1 (fr) * | 1991-07-04 | 1994-08-26 | Roussel Uclaf | Nouveaux esters pyrethrinouides de l'alcool 4-amino 2,3,5,6-tetrafluorophenyl methylique, leur procede de preparation et leur application comme pesticides. |
| FR2708930B1 (fr) * | 1993-08-10 | 1995-09-08 | Roussel Uclaf | Nouveaux esters dérivés de l'acide 2,2-diméthyl 3-(3,3,3-trifluoro-1-propényl) cyclopropane carboxylique, leur procédé de préparation et leur application comme pesticides. |
| RU2168492C2 (ru) * | 1995-02-07 | 2001-06-10 | Дайнихон Дзотугику Ко., Лтд. | Новые производные сложных эфиров карбоновых кислот, способ их получения, содержащие их инсектициды |
| US5876739A (en) * | 1996-06-13 | 1999-03-02 | Novartis Ag | Insecticidal seed coating |
| US5849320A (en) * | 1996-06-13 | 1998-12-15 | Novartis Corporation | Insecticidal seed coating |
| MY118214A (en) | 1998-02-26 | 2004-09-30 | Sumitomo Chemical Co | Ester of 2,2-dimethyl-cyclopropanecarboxylic acid and their use as pesticides |
| JPH11335331A (ja) * | 1998-05-22 | 1999-12-07 | Sumitomo Chem Co Ltd | ピレスロイド化合物および該化合物を含有する害虫防除剤 |
| JP2000007508A (ja) * | 1998-06-26 | 2000-01-11 | Sumitomo Chem Co Ltd | 害虫忌避剤 |
| CN1176055C (zh) * | 1999-12-02 | 2004-11-17 | 住友化学工业株式会社 | 4-甲氧基甲基-2,3,5,6-四氟代苯甲醇的生产方法 |
| KR100638133B1 (ko) * | 1999-12-23 | 2006-10-24 | 스미또모 가가꾸 가부시끼가이샤 | 시클로프로판카르복실산 에스테르 화합물 |
| GB0017617D0 (en) * | 2000-07-18 | 2000-09-06 | Zeneca Ltd | Chemical process |
| GB0026349D0 (en) | 2000-10-27 | 2000-12-13 | Zeneca Ltd | Chemical process |
| GB0026348D0 (en) | 2000-10-27 | 2000-12-13 | Zeneca Ltd | Chemical process |
| DK1941798T3 (da) * | 2004-12-17 | 2012-08-27 | Devgen Nv | Nematicide præparater |
| WO2006137348A2 (en) | 2005-06-22 | 2006-12-28 | Showa Denko K.K. | Production process of nucleus-halogenated methylbenzyl alcohol |
| CN100358858C (zh) * | 2005-11-01 | 2008-01-02 | 天津大学 | 七氟菊酯的制备方法 |
| JP5526472B2 (ja) * | 2007-02-28 | 2014-06-18 | 住友化学株式会社 | エステル化合物及びその用途 |
| JP5012095B2 (ja) * | 2007-03-07 | 2012-08-29 | 住友化学株式会社 | エステル化合物およびその用途 |
| DE102007045953B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| GB0808767D0 (en) * | 2008-05-14 | 2008-06-18 | Syngenta Ltd | Process |
| CN101638367B (zh) * | 2008-07-28 | 2011-02-02 | 常州康美化工有限公司 | 由七氟菊酯衍生的拟除虫菊酯化合物 |
| EP2227951A1 (de) | 2009-01-23 | 2010-09-15 | Bayer CropScience AG | Verwendung von Enaminocarbonylverbindungen zur Bekämpfung von durch Insekten übertragenen Viren |
| CN102020564A (zh) * | 2009-09-17 | 2011-04-20 | 上海生农生化制品有限公司 | 一种带炔键的含氟环丙烷羧酸酯及其制备方法和用途 |
| US8822533B1 (en) * | 2011-07-13 | 2014-09-02 | The United States Of America, As Represented By The Secretary Of Agriculture | Methods and compositions for repelling and/or killing insects |
| CN103168793B (zh) * | 2011-12-26 | 2015-04-08 | 江苏扬农化工股份有限公司 | 一种含有氯氟醚菊酯的复配杀虫组合物及其应用 |
| CN103168791B (zh) * | 2011-12-26 | 2015-04-08 | 江苏扬农化工股份有限公司 | 一种含有氯氟醚菊酯的复配杀虫组合物及其应用 |
| CN103168792B (zh) * | 2011-12-26 | 2015-04-08 | 江苏扬农化工股份有限公司 | 含有氯氟醚菊酯的复配杀虫组合物及其应用 |
| CN103371168B (zh) * | 2012-04-28 | 2017-02-22 | 马国丰 | 一种高效杀虫剂组合物 |
| CN102807468B (zh) * | 2012-07-19 | 2014-12-10 | 烟台万润精细化工股份有限公司 | 一种丙基邻氟苯类化合物的制备方法 |
| AU2017203635B2 (en) * | 2017-05-30 | 2022-02-03 | Rotam Agrochem International Company Limited | A novel crystalline form of tefluthrin, a process for its preparation and use of the same |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE660565A (enEXAMPLES) | 1963-03-18 | |||
| BE786808A (fr) | 1971-07-28 | 1973-01-29 | Johnson & Son Inc S C | Chrysanthemumates de benzyle |
| US4024163A (en) * | 1972-05-25 | 1977-05-17 | National Research Development Corporation | Insecticides |
| JPS5813522B2 (ja) * | 1974-10-24 | 1983-03-14 | 住友化学工業株式会社 | 新しいシクロプロパンカルボン酸エステルを含有する殺虫、殺ダニ剤 |
| US4183950A (en) * | 1976-12-22 | 1980-01-15 | Bayer Aktiengesellschaft | Combating arthropods with 2,2-dimethyl-3-vinyl-cyclopropane carboxylic acid esters of halogenated benzyl alcohols |
| DE2709264C3 (de) * | 1977-03-03 | 1982-01-21 | Bayer Ag, 5090 Leverkusen | Substituierte Phenoxybenzyloxycarbonylderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide und Akarizide sowie neue Zwischenprodukte |
| DE2721185A1 (de) * | 1977-05-11 | 1978-11-16 | Bayer Ag | Verfahren zur herstellung von substituierten vinylcyclopropancarbonsaeurebenzylestern |
| US4243677A (en) * | 1978-01-20 | 1981-01-06 | Fmc Corporation | Insecticidal perhaloalkylvinylcyclopropanecarboxylates |
| DE2810634A1 (de) * | 1978-03-11 | 1979-09-20 | Bayer Ag | Pentafluorbenzyloxycarbonylderivate, verfahren zu ihrer herstellung und ihre verwendung als insektizide und akarizide |
| DE2831193A1 (de) * | 1978-07-15 | 1980-01-24 | Bayer Ag | Fluoralkenylsubstituierte cyclopropancarbonsaeureester und ihre verwendung als insektizide |
-
1980
- 1980-11-20 DE DE8080304158T patent/DE3065914D1/de not_active Expired
- 1980-11-20 EP EP80304158A patent/EP0031199B1/en not_active Expired
- 1980-11-20 GB GB8037257A patent/GB2066810A/en not_active Withdrawn
- 1980-11-26 NZ NZ195659A patent/NZ195659A/xx unknown
- 1980-11-27 ZA ZA00807427A patent/ZA807427B/xx unknown
- 1980-11-28 AU AU64917/80A patent/AU537917B2/en not_active Expired
- 1980-12-01 US US06/211,943 patent/US4405640A/en not_active Expired - Lifetime
- 1980-12-02 ZW ZW298/80A patent/ZW29880A1/xx unknown
- 1980-12-05 PH PH24954A patent/PH17344A/en unknown
- 1980-12-05 IL IL61652A patent/IL61652A/xx not_active IP Right Cessation
- 1980-12-09 CA CA000366436A patent/CA1146582A/en not_active Expired
- 1980-12-11 MW MW52/80A patent/MW5280A1/xx unknown
- 1980-12-12 ZM ZM111/80A patent/ZM11180A1/xx unknown
- 1980-12-17 HU HU803022A patent/HU184360B/hu unknown
- 1980-12-17 HU HU834528A patent/HU187100B/hu unknown
- 1980-12-19 ES ES497979A patent/ES8200858A1/es not_active Expired
- 1980-12-20 JP JP17973280A patent/JPS5697251A/ja active Granted
-
1982
- 1982-05-05 PH PH27239A patent/PH19496A/en unknown
-
1984
- 1984-02-17 PH PH30263A patent/PH19397A/en unknown
- 1984-05-04 AU AU27715/84A patent/AU545220B2/en not_active Expired
-
1985
- 1985-12-30 MY MY983/85A patent/MY8500983A/xx unknown
-
1988
- 1988-02-12 JP JP63030689A patent/JPS63239247A/ja active Granted
- 1988-10-19 JP JP63261688A patent/JPH02125A/ja active Granted
-
1997
- 1997-07-10 NL NL971015C patent/NL971015I2/nl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0120143B2 (enEXAMPLES) | 1989-04-14 |
| GB2066810A (en) | 1981-07-15 |
| IL61652A (en) | 1990-02-09 |
| EP0031199A1 (en) | 1981-07-01 |
| NZ195659A (en) | 1983-12-16 |
| MW5280A1 (en) | 1982-08-11 |
| JPH046694B2 (enEXAMPLES) | 1992-02-06 |
| US4405640A (en) | 1983-09-20 |
| NL971015I2 (nl) | 1997-11-03 |
| ZA807427B (en) | 1981-11-25 |
| AU545220B2 (en) | 1985-07-04 |
| JPH02125A (ja) | 1990-01-05 |
| DE3065914D1 (en) | 1984-01-19 |
| AU537917B2 (en) | 1984-07-19 |
| MY8500983A (en) | 1985-12-31 |
| HU184360B (en) | 1984-08-28 |
| ZM11180A1 (en) | 1981-09-21 |
| AU6491780A (en) | 1981-06-25 |
| AU2771584A (en) | 1984-08-30 |
| PH19397A (en) | 1986-04-10 |
| JPS63239247A (ja) | 1988-10-05 |
| IL61652A0 (en) | 1981-01-30 |
| PH19496A (en) | 1986-05-14 |
| ES497979A0 (es) | 1981-11-16 |
| HU187100B (en) | 1985-11-28 |
| NL971015I1 (nl) | 1997-09-01 |
| ZW29880A1 (en) | 1982-06-30 |
| ES8200858A1 (es) | 1981-11-16 |
| EP0031199B1 (en) | 1983-12-14 |
| JPS5697251A (en) | 1981-08-05 |
| PH17344A (en) | 1984-08-01 |
| JPH0212942B2 (enEXAMPLES) | 1990-03-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1146582A (en) | Halogenated esters | |
| US4551546A (en) | Halogenated esters | |
| US4370346A (en) | Halogenated esters | |
| US4183948A (en) | Halogenated esters | |
| EP0016513B1 (en) | Esters of halogenated substituted cyclopropanoic acids, their preparation and use as insecticides | |
| EP0054360B1 (en) | Fluorobenzyl cyclopropane carboxylates, their preparation, compositions comprising them and their use as insecticides | |
| EP0196156B1 (en) | Fluorobenzyl esters | |
| GB2097384A (en) | Fluorinated benzyl esters of tetramethylcyclopropane carboxylic acid | |
| US4283414A (en) | Pesticidal fluorinated esters of the pyrethrin or pyrethroid type | |
| US5017606A (en) | Fluorobenzyl esters | |
| EP0010879B1 (en) | Halogenated esters of cyclopropane acids, their preparation, compositions and use as pesticides | |
| CA1181768A (en) | Halogenated esters | |
| AP97A (en) | Fluorobenzyl esters. | |
| CA1293261C (en) | Halogenated esters | |
| US4378316A (en) | Halogenated esters | |
| HU182507B (en) | Insecticide compositions containing cyclopropane-carboxylic acid halo-aenzyl esters and process for preparing the active substances | |
| GB2062620A (en) | Haloalkyl cyclopropane carboxylic acid derivatives | |
| CA1111434A (en) | Preparation of insecticides and acaricides | |
| KR810000386B1 (ko) | 싸이클로 프로판 유도체의 제조방법 | |
| JPS6221776B2 (enEXAMPLES) | ||
| JPH0120133B2 (enEXAMPLES) | ||
| GB1601344A (en) | Halogenated cyclopropane esters useful as insecticides and intermediates therefor | |
| IE46643B1 (en) | Insecticidal esters of 2,2-dimethylcyclopropane carboxylic acids and intermediates therefor |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |