CA1145871A - Process for preparing aqueous emulsions of copolymers of n-methylol derivatives - Google Patents
Process for preparing aqueous emulsions of copolymers of n-methylol derivativesInfo
- Publication number
- CA1145871A CA1145871A CA000337321A CA337321A CA1145871A CA 1145871 A CA1145871 A CA 1145871A CA 000337321 A CA000337321 A CA 000337321A CA 337321 A CA337321 A CA 337321A CA 1145871 A CA1145871 A CA 1145871A
- Authority
- CA
- Canada
- Prior art keywords
- weight
- parts
- alkyl
- monomer
- temperature
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001577 copolymer Polymers 0.000 title claims abstract description 37
- 239000000839 emulsion Substances 0.000 title claims abstract description 8
- 238000004519 manufacturing process Methods 0.000 title description 3
- 239000000178 monomer Substances 0.000 claims abstract description 60
- 238000000034 method Methods 0.000 claims abstract description 50
- 230000008569 process Effects 0.000 claims abstract description 35
- 238000006116 polymerization reaction Methods 0.000 claims abstract description 24
- 238000002360 preparation method Methods 0.000 claims abstract description 15
- 230000000379 polymerizing effect Effects 0.000 claims abstract description 7
- 229910052799 carbon Inorganic materials 0.000 claims abstract 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 48
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 30
- -1 alkyl methacrylates Chemical class 0.000 claims description 23
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 18
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 claims description 16
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 14
- 239000004094 surface-active agent Substances 0.000 claims description 14
- FXDQRDVXOHKKEV-UHFFFAOYSA-N CC(C)COC=C(CO)C(N)=O Chemical compound CC(C)COC=C(CO)C(N)=O FXDQRDVXOHKKEV-UHFFFAOYSA-N 0.000 claims description 10
- 239000003999 initiator Substances 0.000 claims description 10
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 9
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 8
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 claims description 8
- 150000002978 peroxides Chemical class 0.000 claims description 8
- 239000004160 Ammonium persulphate Substances 0.000 claims description 7
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 claims description 7
- 235000019395 ammonium persulphate Nutrition 0.000 claims description 7
- 239000003638 chemical reducing agent Substances 0.000 claims description 7
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 6
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 claims description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 6
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 5
- 150000005215 alkyl ethers Chemical class 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- CNCOEDDPFOAUMB-UHFFFAOYSA-N N-Methylolacrylamide Chemical compound OCNC(=O)C=C CNCOEDDPFOAUMB-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- DNTMQTKDNSEIFO-UHFFFAOYSA-N n-(hydroxymethyl)-2-methylprop-2-enamide Chemical compound CC(=C)C(=O)NCO DNTMQTKDNSEIFO-UHFFFAOYSA-N 0.000 claims description 4
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical class S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- 229920002818 (Hydroxyethyl)methacrylate Polymers 0.000 claims description 3
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 claims description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 3
- 239000005977 Ethylene Substances 0.000 claims description 3
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical class CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 125000005250 alkyl acrylate group Chemical group 0.000 claims description 3
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 claims description 3
- 150000002170 ethers Chemical class 0.000 claims description 3
- 150000002432 hydroperoxides Chemical class 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- 150000001451 organic peroxides Chemical class 0.000 claims description 3
- 150000004965 peroxy acids Chemical class 0.000 claims description 3
- 229920001567 vinyl ester resin Polymers 0.000 claims description 3
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 claims description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 claims description 2
- 229910001413 alkali metal ion Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 claims description 2
- 239000012736 aqueous medium Substances 0.000 claims description 2
- QJQZEJFUIOWFMS-UHFFFAOYSA-N formaldehyde;sulfanediol Chemical compound O=C.OSO QJQZEJFUIOWFMS-UHFFFAOYSA-N 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- OFDICTXLSQYXTF-UHFFFAOYSA-N 4-hydroxy-2-methyl-n-(2-methylpropoxy)but-2-enamide Chemical compound CC(C)CONC(=O)C(C)=CCO OFDICTXLSQYXTF-UHFFFAOYSA-N 0.000 claims 1
- NHRVDGVVAWHMDO-UHFFFAOYSA-N CCCCOC(CO)=C(C)C(N)=O Chemical compound CCCCOC(CO)=C(C)C(N)=O NHRVDGVVAWHMDO-UHFFFAOYSA-N 0.000 claims 1
- VMYXVJASSBAHHD-UHFFFAOYSA-N CCCCOC=C(CO)C(N)=O Chemical compound CCCCOC=C(CO)C(N)=O VMYXVJASSBAHHD-UHFFFAOYSA-N 0.000 claims 1
- BAPJBEWLBFYGME-UHFFFAOYSA-N acrylic acid methyl ester Natural products COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 claims 1
- 210000003298 dental enamel Anatomy 0.000 abstract description 15
- 238000009833 condensation Methods 0.000 abstract description 8
- 230000005494 condensation Effects 0.000 abstract description 8
- 125000000524 functional group Chemical group 0.000 abstract description 5
- 230000002028 premature Effects 0.000 abstract description 5
- 229920001187 thermosetting polymer Polymers 0.000 abstract description 4
- 230000006872 improvement Effects 0.000 abstract description 2
- 239000000376 reactant Substances 0.000 abstract 2
- 229920000126 latex Polymers 0.000 description 33
- 239000008367 deionised water Substances 0.000 description 29
- 239000004816 latex Substances 0.000 description 26
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 20
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 19
- 239000000203 mixture Substances 0.000 description 18
- 229910021641 deionized water Inorganic materials 0.000 description 16
- 238000007792 addition Methods 0.000 description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 12
- 238000000576 coating method Methods 0.000 description 12
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 10
- 239000004615 ingredient Substances 0.000 description 10
- 229920003270 Cymel® Polymers 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000011248 coating agent Substances 0.000 description 9
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 7
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 7
- 229960002887 deanol Drugs 0.000 description 7
- 239000012972 dimethylethanolamine Substances 0.000 description 7
- 238000009472 formulation Methods 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 6
- 229920000877 Melamine resin Polymers 0.000 description 6
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- XYXNTHIYBIDHGM-UHFFFAOYSA-N ammonium thiosulfate Chemical compound [NH4+].[NH4+].[O-]S([O-])(=O)=S XYXNTHIYBIDHGM-UHFFFAOYSA-N 0.000 description 4
- ZETCGWYACBNPIH-UHFFFAOYSA-N azane;sulfurous acid Chemical compound N.OS(O)=O ZETCGWYACBNPIH-UHFFFAOYSA-N 0.000 description 4
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 4
- 239000003973 paint Substances 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000000908 ammonium hydroxide Substances 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000008199 coating composition Substances 0.000 description 3
- 238000004132 cross linking Methods 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- KZCOBXFFBQJQHH-UHFFFAOYSA-N octane-1-thiol Chemical compound CCCCCCCCS KZCOBXFFBQJQHH-UHFFFAOYSA-N 0.000 description 3
- 239000012966 redox initiator Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- GNSFRPWPOGYVLO-UHFFFAOYSA-N 3-hydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCO GNSFRPWPOGYVLO-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 229920006243 acrylic copolymer Polymers 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000003863 ammonium salts Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- 235000013361 beverage Nutrition 0.000 description 2
- ZQMIGQNCOMNODD-UHFFFAOYSA-N diacetyl peroxide Chemical compound CC(=O)OOC(C)=O ZQMIGQNCOMNODD-UHFFFAOYSA-N 0.000 description 2
- 238000005530 etching Methods 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical compound O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- ARZLUCYKIWYSHR-UHFFFAOYSA-N hydroxymethoxymethanol Chemical group OCOCO ARZLUCYKIWYSHR-UHFFFAOYSA-N 0.000 description 2
- 238000007654 immersion Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- TWXDDNPPQUTEOV-FVGYRXGTSA-N methamphetamine hydrochloride Chemical compound Cl.CN[C@@H](C)CC1=CC=CC=C1 TWXDDNPPQUTEOV-FVGYRXGTSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000004576 sand Substances 0.000 description 2
- 229910001415 sodium ion Inorganic materials 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- PCJGHYSTCBLKIA-UHFFFAOYSA-N (1-acetylcyclohexyl)sulfonyloxy 1-acetylcyclohexane-1-sulfonate Chemical compound C1CCCCC1(C(C)=O)S(=O)(=O)OOS(=O)(=O)C1(C(=O)C)CCCCC1 PCJGHYSTCBLKIA-UHFFFAOYSA-N 0.000 description 1
- WRXCBRHBHGNNQA-UHFFFAOYSA-N (2,4-dichlorobenzoyl) 2,4-dichlorobenzenecarboperoxoate Chemical compound ClC1=CC(Cl)=CC=C1C(=O)OOC(=O)C1=CC=C(Cl)C=C1Cl WRXCBRHBHGNNQA-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- WDQMWEYDKDCEHT-UHFFFAOYSA-N 2-ethylhexyl 2-methylprop-2-enoate Chemical compound CCCCC(CC)COC(=O)C(C)=C WDQMWEYDKDCEHT-UHFFFAOYSA-N 0.000 description 1
- KTOQRRDVVIDEAA-UHFFFAOYSA-N 2-methylpropane Chemical group [CH2]C(C)C KTOQRRDVVIDEAA-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- MLSUZVRUIHFFTA-UHFFFAOYSA-N 4-hydroxy-2-methyl-3-(2-methylpropoxy)but-2-enamide Chemical compound CC(C)COC(CO)=C(C)C(N)=O MLSUZVRUIHFFTA-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- YIVJZNGAASQVEM-UHFFFAOYSA-N Lauroyl peroxide Chemical compound CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC YIVJZNGAASQVEM-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000012644 addition polymerization Methods 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000005011 alkyl ether group Chemical group 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 210000001217 buttock Anatomy 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- GWXLDORMOJMVQZ-UHFFFAOYSA-N cerium Chemical compound [Ce] GWXLDORMOJMVQZ-UHFFFAOYSA-N 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 1
- 239000012969 di-tertiary-butyl peroxide Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- IMBKASBLAKCLEM-UHFFFAOYSA-L ferrous ammonium sulfate (anhydrous) Chemical compound [NH4+].[NH4+].[Fe+2].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O IMBKASBLAKCLEM-UHFFFAOYSA-L 0.000 description 1
- 239000011790 ferrous sulphate Substances 0.000 description 1
- 235000003891 ferrous sulphate Nutrition 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000009477 glass transition Effects 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 229960000443 hydrochloric acid Drugs 0.000 description 1
- 235000011167 hydrochloric acid Nutrition 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 125000006606 n-butoxy group Chemical group 0.000 description 1
- NZHTWZIZOOIBMU-UHFFFAOYSA-N n-butoxy-4-hydroxy-2-methylbut-2-enamide Chemical compound CCCCONC(=O)C(C)=CCO NZHTWZIZOOIBMU-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 230000006911 nucleation Effects 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical compound O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 229960005335 propanol Drugs 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- QEGWXXRNPXRLHH-UHFFFAOYSA-N triazine;1,3,5-triazine-2,4,6-triamine Chemical compound C1=CN=NN=C1.NC1=NC(N)=NC(N)=N1 QEGWXXRNPXRLHH-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2/00—Processes of polymerisation
- C08F2/12—Polymerisation in non-solvents
- C08F2/16—Aqueous medium
- C08F2/22—Emulsion polymerisation
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F246/00—Copolymers in which the nature of only the monomers in minority is defined
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Paints Or Removers (AREA)
- Polymerisation Methods In General (AREA)
- Polymerization Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7841770 | 1978-10-24 | ||
| GB41770/78 | 1978-10-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1145871A true CA1145871A (en) | 1983-05-03 |
Family
ID=10500554
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000337321A Expired CA1145871A (en) | 1978-10-24 | 1979-10-10 | Process for preparing aqueous emulsions of copolymers of n-methylol derivatives |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4305859A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5565209A (cg-RX-API-DMAC10.html) |
| AU (1) | AU525388B2 (cg-RX-API-DMAC10.html) |
| BE (1) | BE879575A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1145871A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2943030A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2439793A1 (cg-RX-API-DMAC10.html) |
| IT (1) | IT1207274B (cg-RX-API-DMAC10.html) |
| MX (1) | MX152295A (cg-RX-API-DMAC10.html) |
| NZ (1) | NZ191816A (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA795542B (cg-RX-API-DMAC10.html) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI832883L (fi) * | 1982-08-12 | 1984-02-13 | Scm Corp | Vattenhaltig sjaelvhaerdbar polymerblandning |
| US4447065A (en) * | 1983-02-28 | 1984-05-08 | The General Tire & Rubber Company | Sealing strip |
| US4503173A (en) * | 1983-12-19 | 1985-03-05 | Scm Corporation | Self-curing water dispersed polymer blends |
| US5053448A (en) * | 1989-07-21 | 1991-10-01 | S. C. Johnson & Son, Inc. | Polymeric thickener and methods of producing the same |
| US5232972A (en) * | 1989-08-31 | 1993-08-03 | Bridgestone Corporation | Adhesive composition |
| CA2065100A1 (en) * | 1991-04-05 | 1992-10-06 | Masami Uemae | Aqueous dispersion of acrylic polymer |
| DE4206766A1 (de) * | 1991-11-21 | 1993-09-09 | Basf Ag | Schlagzaeh modifizierte thermoplastische formmasse |
| US5266628A (en) * | 1992-03-31 | 1993-11-30 | Ppg Industries, Inc. | Water based coating composition with improved process resistance |
| US5636895A (en) * | 1992-10-27 | 1997-06-10 | Toyoda Gosei Co., Ltd. | Seal structure for weather strip |
| DE69420378T2 (de) * | 1993-12-23 | 1999-12-30 | Nitto Denko Corp., Ibaraki | Verfahren zur Herstellung einer wässrigen Dispersion eines Acrylpolymeren, Acrylpolymer so hergestellt, und druckempfindlicher Klebstoff, der dieses Polymer enthält |
| US5800873A (en) * | 1994-10-03 | 1998-09-01 | Basf Lacke+Farben Ag | Process for the production of sealed packaging containers and the use of a sealing coating for coating plastics films |
| US7189787B2 (en) | 2003-04-02 | 2007-03-13 | Valspar Sourcing, Inc. | Aqueous dispersions and coatings |
| US7270937B2 (en) * | 2003-10-17 | 2007-09-18 | Hynix Semiconductor Inc. | Over-coating composition for photoresist and process for forming photoresist pattern using the same |
| EP2420542B2 (en) | 2004-10-20 | 2018-09-19 | Valspar Sourcing, Inc. | Article and method of coating |
| KR101440645B1 (ko) | 2006-09-19 | 2014-09-22 | 발스파 소싱 인코포레이티드 | 식품 및 음료의 코팅된 용기, 그의 코팅 방법 및 코팅 조성물 |
| BRPI1005952A2 (pt) | 2009-02-24 | 2016-02-10 | Akzo Nobel Coatings Int Bv | emulsões de látex e composições de revestimento formadas a partir de emulsões de látex, método para o revestimento de uma lata ou embalagem, lata ou embalagem, emulsão de látex preparada por um método, composição para revestimento preparada para um método |
| US8747979B2 (en) | 2009-07-17 | 2014-06-10 | Valspar Sourcing, Inc. | Coating compositions and articles coated therewith |
| WO2015002958A1 (en) | 2013-07-02 | 2015-01-08 | Valspar Sourcing, Inc. | Coating compositions for packaging articles such as food and beverage containers |
| EP3016988B2 (en) | 2013-07-02 | 2025-07-16 | Swimc Llc | Coating compositions for packaging articles such as food and beverage containers |
| PL3741818T5 (pl) | 2014-12-24 | 2025-07-28 | Swimc Llc | Kompozycje powłokowe do wyrobów opakowaniowych, takich jak pojemniki na żywność i napoje |
| AU2015371311B2 (en) | 2014-12-24 | 2020-07-16 | Swimc Llc | Styrene-free coating compositions for packaging articles such as food and beverage containers |
| US11981822B2 (en) | 2014-12-24 | 2024-05-14 | Swimc Llc | Crosslinked coating compositions for packaging articles such as food and beverage containers |
| US11059989B2 (en) | 2017-06-30 | 2021-07-13 | Valspar Sourcing, Inc. | Crosslinked coating compositions for packaging articles such as food and beverage containers |
| AR108133A1 (es) | 2016-04-15 | 2018-07-18 | Valspar Sourcing Inc | Composiciones de revestimiento que contienen copolímeros libres de estireno |
| MY198353A (en) | 2016-10-19 | 2023-08-28 | Swimc Llc | Acrylic Polymers And Compositions Containing Such Polymers |
| WO2019046700A1 (en) | 2017-09-01 | 2019-03-07 | Swimc Llc | MULTI-STAGE POLYMER LATEX, COATING COMPOSITIONS CONTAINING SUCH LATEX, AND ARTICLES THEREOF |
| MX2020002307A (es) | 2017-09-01 | 2020-09-10 | Swimc Llc | Látexes poliméricos de múltiples etapas, composiciones de recubrimiento que contienen tales látexes y artículos recubiertos con estos. |
| CN113072901A (zh) * | 2021-04-12 | 2021-07-06 | 东莞市冠力胶业有限公司 | 一种吸塑卡纸用水性胶水 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE539963A (cg-RX-API-DMAC10.html) * | 1954-07-23 | |||
| US3247139A (en) * | 1962-01-02 | 1966-04-19 | Pittsburgh Plate Glass Co | Interpolymers of etherified aldehydemodified carboxylic acid amides |
| GB1252153A (cg-RX-API-DMAC10.html) * | 1968-04-30 | 1971-11-03 | ||
| US3970628A (en) * | 1972-07-14 | 1976-07-20 | Canadian Industries, Ltd. | Aqueous dispersions of thermosettable synthetic addition polymers with 1,2-epoxy resin plasticizer |
| US3882070A (en) * | 1973-05-23 | 1975-05-06 | Arco Polymers Inc | Persulfate stabilized latices |
| US3845066A (en) * | 1973-10-01 | 1974-10-29 | Du Pont | Aqueous based thermosetting acrylamide-acrylic copolymer coating composition |
| US3865772A (en) * | 1973-12-05 | 1975-02-11 | Dart Ind Inc | Polymerization process |
| US4097438A (en) * | 1974-05-16 | 1978-06-27 | Ppg Industries, Inc. | Water-based liners for beverage containers |
| US4125696A (en) * | 1977-01-06 | 1978-11-14 | Pennwalt Corporation | Polymerization process using di-t-butyl diperoxycarbonate as a finishing catalyst |
-
1979
- 1979-10-10 CA CA000337321A patent/CA1145871A/en not_active Expired
- 1979-10-10 NZ NZ191816A patent/NZ191816A/xx unknown
- 1979-10-17 ZA ZA00795542A patent/ZA795542B/xx unknown
- 1979-10-18 AU AU51899/79A patent/AU525388B2/en not_active Ceased
- 1979-10-22 BE BE0/197775A patent/BE879575A/fr not_active IP Right Cessation
- 1979-10-23 US US06/087,570 patent/US4305859A/en not_active Expired - Lifetime
- 1979-10-23 FR FR7926264A patent/FR2439793A1/fr active Granted
- 1979-10-23 MX MX179736A patent/MX152295A/es unknown
- 1979-10-24 JP JP13652079A patent/JPS5565209A/ja active Granted
- 1979-10-24 DE DE19792943030 patent/DE2943030A1/de active Granted
- 1979-10-24 IT IT7926748A patent/IT1207274B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| AU525388B2 (en) | 1982-11-04 |
| DE2943030C2 (cg-RX-API-DMAC10.html) | 1989-01-19 |
| IT7926748A0 (it) | 1979-10-24 |
| AU5189979A (en) | 1980-05-01 |
| JPS6327368B2 (cg-RX-API-DMAC10.html) | 1988-06-02 |
| ZA795542B (en) | 1980-10-29 |
| MX152295A (es) | 1985-06-24 |
| JPS5565209A (en) | 1980-05-16 |
| IT1207274B (it) | 1989-05-17 |
| DE2943030A1 (de) | 1980-05-08 |
| BE879575A (fr) | 1980-04-22 |
| NZ191816A (en) | 1981-03-16 |
| FR2439793A1 (fr) | 1980-05-23 |
| FR2439793B1 (cg-RX-API-DMAC10.html) | 1983-06-03 |
| US4305859A (en) | 1981-12-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1145871A (en) | Process for preparing aqueous emulsions of copolymers of n-methylol derivatives | |
| US4560714A (en) | Water-swellable crosslinked polymeric microgel particles and aqueous dispersions of organic film-forming resins containing the same | |
| CA1223395A (en) | Water-swellable crosslinked polymeric microgel particles and aqueous dispersions of organic film- forming resins containing the same | |
| US5266361A (en) | Preparation of a multilayer coating | |
| US4539348A (en) | Water-swellable crosslinked polymeric microgel particles and aqueous dispersions of organic film-forming resins containing the same | |
| US5714539A (en) | Polymeric surfactant and latex made therefrom | |
| CA1116773A (en) | Surfactant-free polymer emulsion coating composition and two-stage method for preparing same | |
| US4139514A (en) | Aqueous vehicles | |
| US3919154A (en) | Aqueous coating composition of acrylic polymer latex, acrylic polymer solution and aminoplast and method of making | |
| US4567246A (en) | Water-swellable crosslinked polymeric microgel particles and aqueous dispersions of organic film-forming resins containing the same | |
| CA1102028A (en) | Hybrid water-based enamels with partially crosslinked latexes | |
| CN108250347B (zh) | 一种耐盐雾的磷酸酯改性丙烯酸核壳乳液 | |
| US3926888A (en) | Method of making aqueous coating compositions of acrylic polymer latex, acrylic polymer solution, aminoplast and acrylic stabilizer polymer | |
| EP0728779A2 (en) | Aqueous polymer dispersions | |
| US4380601A (en) | Thermosetting catonic acrylic latices and their use in coating compositions | |
| CN109679468A (zh) | 一种水性聚酯-丙烯酸树脂杂化体及制备方法 | |
| GB1574721A (en) | Process for preparing aqueous copolymer emulsions | |
| CN111807961B (zh) | 一种兼具快干和长适用期的高羟基丙烯酸乳液及其合成方法 | |
| CN112266677A (zh) | 一种羟基丙烯酸分散体和丙烯酸防腐涂料 | |
| US4749735A (en) | Binders for aqueous, physically drying anticorrosion coatings based on a polymer dispersion containing a monoalkyl phosphate | |
| US6930143B2 (en) | Acrylic latex composition | |
| US4546014A (en) | Water-swellable crosslinked polymeric microgel particles and aqueous dispersions of organic film-forming resins containing the same | |
| US5275847A (en) | Process for producing a multi-layer coating using aqueous coating compound aqueous coating compounds | |
| US4399254A (en) | Cationic latices useful for thermoplastic and thermosetting applications | |
| GB2034334A (en) | Process for preparing emulsions of copolymers containing N- methylol or N-methylol ether groups |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |