CA1136137A - Aniline derivatives - Google Patents
Aniline derivativesInfo
- Publication number
- CA1136137A CA1136137A CA000300476A CA300476A CA1136137A CA 1136137 A CA1136137 A CA 1136137A CA 000300476 A CA000300476 A CA 000300476A CA 300476 A CA300476 A CA 300476A CA 1136137 A CA1136137 A CA 1136137A
- Authority
- CA
- Canada
- Prior art keywords
- group
- formula
- chloro
- compound
- carboxamido
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000002490 anilino group Chemical class [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 103
- 238000000034 method Methods 0.000 claims abstract description 83
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 34
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 27
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 27
- 239000000460 chlorine Substances 0.000 claims abstract description 27
- 150000003839 salts Chemical class 0.000 claims abstract description 23
- 125000003277 amino group Chemical group 0.000 claims abstract description 22
- 238000002360 preparation method Methods 0.000 claims abstract description 20
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 18
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 17
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 9
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 7
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 6
- 125000001153 fluoro group Chemical group F* 0.000 claims abstract description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 5
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims abstract description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims abstract description 5
- 150000001204 N-oxides Chemical class 0.000 claims abstract description 5
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 5
- 239000011737 fluorine Substances 0.000 claims abstract description 5
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims abstract 4
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 claims description 28
- 238000006243 chemical reaction Methods 0.000 claims description 23
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 21
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 19
- 239000002904 solvent Substances 0.000 claims description 19
- 239000000126 substance Substances 0.000 claims description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- -1 amino, acetylamino Chemical group 0.000 claims description 12
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 10
- 239000004202 carbamide Substances 0.000 claims description 10
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 9
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- XAHLYBZLHNHUJQ-UHFFFAOYSA-N 1-benzyl-n-(5-chloro-2-methoxyphenyl)piperidine-4-carboxamide Chemical compound COC1=CC=C(Cl)C=C1NC(=O)C1CCN(CC=2C=CC=CC=2)CC1 XAHLYBZLHNHUJQ-UHFFFAOYSA-N 0.000 claims description 6
- JRNJPYKJAIDHOP-UHFFFAOYSA-N 1-benzyl-n-(5-chloro-2-methoxyphenyl)pyridin-1-ium-4-carboxamide;chloride Chemical compound [Cl-].COC1=CC=C(Cl)C=C1NC(=O)C(C=C1)=CC=[N+]1CC1=CC=CC=C1 JRNJPYKJAIDHOP-UHFFFAOYSA-N 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- NBRTWKNQYCHEIN-UHFFFAOYSA-N n-(4-acetamido-5-chloro-2-methoxyphenyl)-4-benzylpiperazine-1-carboxamide Chemical compound COC1=CC(NC(C)=O)=C(Cl)C=C1NC(=O)N1CCN(CC=2C=CC=CC=2)CC1 NBRTWKNQYCHEIN-UHFFFAOYSA-N 0.000 claims description 5
- SPCRVWLCXMVUBE-UHFFFAOYSA-N n-(5-chloro-2-methoxy-4-nitrophenyl)piperidine-4-carboxamide Chemical compound COC1=CC([N+]([O-])=O)=C(Cl)C=C1NC(=O)C1CCNCC1 SPCRVWLCXMVUBE-UHFFFAOYSA-N 0.000 claims description 5
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 4
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 4
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- BIHFZEJBJUJZFV-UHFFFAOYSA-N n-(4-amino-5-chloro-2-methoxyphenyl)-4-benzylpiperazine-1-carboxamide Chemical compound COC1=CC(N)=C(Cl)C=C1NC(=O)N1CCN(CC=2C=CC=CC=2)CC1 BIHFZEJBJUJZFV-UHFFFAOYSA-N 0.000 claims description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 4
- WBSMIPLNPSCJFS-UHFFFAOYSA-N 5-chloro-2-methoxyaniline Chemical compound COC1=CC=C(Cl)C=C1N WBSMIPLNPSCJFS-UHFFFAOYSA-N 0.000 claims description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 claims description 3
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 claims description 2
- YUBDLZGUSSWQSS-UHFFFAOYSA-N 1-benzylpiperidin-4-amine Chemical compound C1CC(N)CCN1CC1=CC=CC=C1 YUBDLZGUSSWQSS-UHFFFAOYSA-N 0.000 claims description 2
- ZMVSVQMWFTZSJQ-UHFFFAOYSA-N 1-benzylpiperidine-4-carboxylic acid Chemical compound C1CC(C(=O)O)CCN1CC1=CC=CC=C1 ZMVSVQMWFTZSJQ-UHFFFAOYSA-N 0.000 claims description 2
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 claims description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 claims description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- 230000020176 deacylation Effects 0.000 claims description 2
- 238000005947 deacylation reaction Methods 0.000 claims description 2
- 238000006460 hydrolysis reaction Methods 0.000 claims description 2
- SSLSTGAIHLCJQK-UHFFFAOYSA-N n-(5-chloro-2-methoxyphenyl)-1-[(4-chlorophenyl)methyl]piperidine-4-carboxamide Chemical compound COC1=CC=C(Cl)C=C1NC(=O)C1CCN(CC=2C=CC(Cl)=CC=2)CC1 SSLSTGAIHLCJQK-UHFFFAOYSA-N 0.000 claims description 2
- 230000000802 nitrating effect Effects 0.000 claims description 2
- 239000012038 nucleophile Substances 0.000 claims description 2
- 239000000376 reactant Substances 0.000 claims 21
- SKGHABNHBHWRQM-UHFFFAOYSA-N n-(5-chloro-2-methoxy-4-nitrophenyl)-1-[(4-methoxyphenyl)methyl]piperidine-4-carboxamide Chemical compound C1=CC(OC)=CC=C1CN1CCC(C(=O)NC=2C(=CC(=C(Cl)C=2)[N+]([O-])=O)OC)CC1 SKGHABNHBHWRQM-UHFFFAOYSA-N 0.000 claims 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- IQXXEPZFOOTTBA-UHFFFAOYSA-N 1-benzylpiperazine Chemical compound C=1C=CC=CC=1CN1CCNCC1 IQXXEPZFOOTTBA-UHFFFAOYSA-N 0.000 claims 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 229910008066 SnC12 Inorganic materials 0.000 claims 1
- 230000007062 hydrolysis Effects 0.000 claims 1
- 230000002936 tranquilizing effect Effects 0.000 abstract description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 66
- 239000000243 solution Substances 0.000 description 37
- 239000000203 mixture Substances 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 13
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- FNIOHKVYTWOWKM-UHFFFAOYSA-N 4-acetamido-5-chloro-2-methoxybenzoyl azide Chemical compound COC1=CC(NC(C)=O)=C(Cl)C=C1C(=O)N=[N+]=[N-] FNIOHKVYTWOWKM-UHFFFAOYSA-N 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- 235000011054 acetic acid Nutrition 0.000 description 6
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 6
- 235000011167 hydrochloric acid Nutrition 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- REUWUKCZROEOOZ-UHFFFAOYSA-N 1-benzyl-N-(5-chloro-2-methoxy-4-nitrophenyl)piperidine-4-carboxamide Chemical compound ClC1=CC(=C(C=C1[N+](=O)[O-])OC)NC(=O)C1CCN(CC1)CC1=CC=CC=C1 REUWUKCZROEOOZ-UHFFFAOYSA-N 0.000 description 5
- 101150041968 CDC13 gene Proteins 0.000 description 5
- 206010042008 Stereotypy Diseases 0.000 description 5
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- QYRFJLLXPINATB-UHFFFAOYSA-N hydron;2,4,5,6-tetrafluorobenzene-1,3-diamine;dichloride Chemical class Cl.Cl.NC1=C(F)C(N)=C(F)C(F)=C1F QYRFJLLXPINATB-UHFFFAOYSA-N 0.000 description 5
- 150000002513 isocyanates Chemical class 0.000 description 5
- 125000003386 piperidinyl group Chemical group 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 4
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 3
- KWTSXDURSIMDCE-QMMMGPOBSA-N (S)-amphetamine Chemical compound C[C@H](N)CC1=CC=CC=C1 KWTSXDURSIMDCE-QMMMGPOBSA-N 0.000 description 3
- YBCOOGQGBVDQSB-UHFFFAOYSA-N 4-acetamido-5-chloro-2-methoxybenzoyl chloride Chemical compound COC1=CC(NC(C)=O)=C(Cl)C=C1C(Cl)=O YBCOOGQGBVDQSB-UHFFFAOYSA-N 0.000 description 3
- 208000009132 Catalepsy Diseases 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 206010047853 Waxy flexibility Diseases 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 3
- 229940025084 amphetamine Drugs 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 230000006698 induction Effects 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000001119 stannous chloride Substances 0.000 description 3
- 235000011150 stannous chloride Nutrition 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- BNUHAJGCKIQFGE-UHFFFAOYSA-N Nitroanisol Chemical compound COC1=CC=C([N+]([O-])=O)C=C1 BNUHAJGCKIQFGE-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229960001076 chlorpromazine Drugs 0.000 description 2
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 229960003878 haloperidol Drugs 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- CIOOCLHMBKBLRB-UHFFFAOYSA-N n-(4-amino-5-chloro-2-methoxyphenyl)-1-benzylpiperidine-4-carboxamide Chemical compound COC1=CC(N)=C(Cl)C=C1NC(=O)C1CCN(CC=2C=CC=CC=2)CC1 CIOOCLHMBKBLRB-UHFFFAOYSA-N 0.000 description 2
- KUDPGZONDFORKU-UHFFFAOYSA-N n-chloroaniline Chemical class ClNC1=CC=CC=C1 KUDPGZONDFORKU-UHFFFAOYSA-N 0.000 description 2
- 230000000701 neuroleptic effect Effects 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 238000006396 nitration reaction Methods 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 2
- GNPSDJOWGWWXSS-UHFFFAOYSA-M 1-benzylpyridin-1-ium;chloride Chemical compound [Cl-].C=1C=CC=C[N+]=1CC1=CC=CC=C1 GNPSDJOWGWWXSS-UHFFFAOYSA-M 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 239000004150 EU approved colour Substances 0.000 description 1
- 101100295741 Gallus gallus COR4 gene Chemical group 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical compound NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000004141 Sodium laurylsulphate Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 150000001243 acetic acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- ITJBFERTVKTDLC-UHFFFAOYSA-N anisole hydrochloride Chemical compound C1(=CC=CC=C1)OC.Cl.C1(=CC=CC=C1)OC ITJBFERTVKTDLC-UHFFFAOYSA-N 0.000 description 1
- SKFFBLHFAMMHFE-UHFFFAOYSA-N anisole;dihydrochloride Chemical compound Cl.Cl.COC1=CC=CC=C1 SKFFBLHFAMMHFE-UHFFFAOYSA-N 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000000561 anti-psychotic effect Effects 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000007963 capsule composition Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- QTCANKDTWWSCMR-UHFFFAOYSA-N costic aldehyde Natural products C1CCC(=C)C2CC(C(=C)C=O)CCC21C QTCANKDTWWSCMR-UHFFFAOYSA-N 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 230000030136 gastric emptying Effects 0.000 description 1
- 210000005095 gastrointestinal system Anatomy 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000007972 injectable composition Substances 0.000 description 1
- ISTFUJWTQAMRGA-UHFFFAOYSA-N iso-beta-costal Natural products C1C(C(=C)C=O)CCC2(C)CCCC(C)=C21 ISTFUJWTQAMRGA-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- TTWJBBZEZQICBI-UHFFFAOYSA-N metoclopramide Chemical compound CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC TTWJBBZEZQICBI-UHFFFAOYSA-N 0.000 description 1
- 229960004503 metoclopramide Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000036651 mood Effects 0.000 description 1
- PUAXOMDNTGEJLE-UHFFFAOYSA-N n-(4-amino-5-chloro-2-methoxyphenyl)-1-(2-phenylethyl)piperidine-4-carboxamide Chemical compound COC1=CC(N)=C(Cl)C=C1NC(=O)C1CCN(CCC=2C=CC=CC=2)CC1 PUAXOMDNTGEJLE-UHFFFAOYSA-N 0.000 description 1
- SOTMPDFATFMZOR-UHFFFAOYSA-N n-(4-amino-5-chloro-2-methoxyphenyl)-1-(4-methoxyphenyl)piperidine-4-carboxamide Chemical compound C1=CC(OC)=CC=C1N1CCC(C(=O)NC=2C(=CC(N)=C(Cl)C=2)OC)CC1 SOTMPDFATFMZOR-UHFFFAOYSA-N 0.000 description 1
- YJSJGXWWTONSEJ-UHFFFAOYSA-N n-(4-amino-5-chloro-2-methoxyphenyl)-1-(4-methylphenyl)piperidine-4-carboxamide Chemical compound COC1=CC(N)=C(Cl)C=C1NC(=O)C1CCN(C=2C=CC(C)=CC=2)CC1 YJSJGXWWTONSEJ-UHFFFAOYSA-N 0.000 description 1
- NTODPRRAULLKAO-UHFFFAOYSA-N n-(4-amino-5-chloro-2-methoxyphenyl)-1-[(4-chlorophenyl)methyl]piperidine-4-carboxamide Chemical compound COC1=CC(N)=C(Cl)C=C1NC(=O)C1CCN(CC=2C=CC(Cl)=CC=2)CC1 NTODPRRAULLKAO-UHFFFAOYSA-N 0.000 description 1
- NSWYMTOMHQOHER-UHFFFAOYSA-N n-(4-amino-5-chloro-2-methoxyphenyl)-1-benzylpiperidine-4-carboxamide;hydrochloride Chemical compound Cl.COC1=CC(N)=C(Cl)C=C1NC(=O)C1CCN(CC=2C=CC=CC=2)CC1 NSWYMTOMHQOHER-UHFFFAOYSA-N 0.000 description 1
- DBUZNXJVCBJPTE-UHFFFAOYSA-N n-(5-chloro-2-methoxyphenyl)piperidine-4-carboxamide Chemical compound COC1=CC=C(Cl)C=C1NC(=O)C1CCNCC1 DBUZNXJVCBJPTE-UHFFFAOYSA-N 0.000 description 1
- NCUHDZYHZGTHRZ-UHFFFAOYSA-N n-(5-chloro-2-methoxyphenyl)pyridine-4-carboxamide Chemical compound COC1=CC=C(Cl)C=C1NC(=O)C1=CC=NC=C1 NCUHDZYHZGTHRZ-UHFFFAOYSA-N 0.000 description 1
- UXHMCSIJCCFQOZ-UHFFFAOYSA-N n-(5-chloro-2-methoxyphenyl)pyridine-4-carboxamide;hydrochloride Chemical compound Cl.COC1=CC=C(Cl)C=C1NC(=O)C1=CC=NC=C1 UXHMCSIJCCFQOZ-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- 229940006093 opthalmologic coloring agent diagnostic Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000012070 reactive reagent Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000003204 tranquilizing agent Substances 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
- C07D295/215—Radicals derived from nitrogen analogues of carbonic acid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/18—Antipsychotics, i.e. neuroleptics; Drugs for mania or schizophrenia
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/56—Nitrogen atoms
- C07D211/58—Nitrogen atoms attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/60—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D211/62—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Psychiatry (AREA)
- Pharmacology & Pharmacy (AREA)
- Biomedical Technology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Hydrogenated Pyridines (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB16765/77 | 1977-04-22 | ||
| GB16765/77A GB1561023A (en) | 1977-04-22 | 1977-04-22 | 2-methoxy - 5 - chloro aniline derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1136137A true CA1136137A (en) | 1982-11-23 |
Family
ID=10083254
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000300476A Expired CA1136137A (en) | 1977-04-22 | 1978-04-05 | Aniline derivatives |
Country Status (15)
| Country | Link |
|---|---|
| US (3) | US4223034A (OSRAM) |
| JP (1) | JPS53132533A (OSRAM) |
| AU (1) | AU518729B2 (OSRAM) |
| BE (1) | BE866057A (OSRAM) |
| CA (1) | CA1136137A (OSRAM) |
| DE (1) | DE2816884A1 (OSRAM) |
| DK (1) | DK172578A (OSRAM) |
| ES (4) | ES469008A1 (OSRAM) |
| FR (1) | FR2387955A1 (OSRAM) |
| GB (1) | GB1561023A (OSRAM) |
| IE (1) | IE46802B1 (OSRAM) |
| IL (1) | IL54438A (OSRAM) |
| NL (1) | NL7804203A (OSRAM) |
| SE (1) | SE7804483L (OSRAM) |
| ZA (1) | ZA781831B (OSRAM) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE431092B (sv) * | 1979-07-10 | 1984-01-16 | Thuresson Af Ekenstam Bo | Terapeutiskt aktiva, substituerade piperidinkarboxianilider |
| IL61972A0 (en) * | 1980-01-30 | 1981-02-27 | Beecham Group Ltd | Azabicyclic compounds,their preparation and pharmaceutical compositions containing them |
| PL128409B1 (en) | 1980-03-01 | 1984-01-31 | Wyeth John & Brother Ltd | Process for preparing novel derivatives of piperidine |
| ZA815668B (en) * | 1980-09-04 | 1982-08-25 | Westinghouse Brake & Signal | Swinging plug door |
| EP0047620B1 (en) * | 1980-09-10 | 1985-03-13 | Beecham Group Plc | Aryl diazabicyclyl amides, a process for their preparation and use |
| US4409225A (en) * | 1981-03-16 | 1983-10-11 | Beecham Group Limited | Substituted benzamides |
| US4585774A (en) * | 1981-05-08 | 1986-04-29 | Otsuka Pharmaceutical Co., Ltd. | Aniline derivatives and cardiotonic composition |
| GB8517854D0 (en) * | 1985-07-15 | 1985-08-21 | Roussell Lab Ltd | Chemical compounds |
| EP0343307A1 (en) * | 1988-05-26 | 1989-11-29 | Fabrica Espanola De Productos Quimicos Y Farmaceuticos, S.A. | 4-Piperidinealkanamine derivatives |
| EP0968200A1 (en) * | 1997-02-24 | 2000-01-05 | ZymoGenetics, Inc. | Calcitonin mimetics |
| FR2821356A1 (fr) * | 2001-02-23 | 2002-08-30 | Cerep | Nouveaux derives d'arylcarbamates et d'arylurees, preparations et utilisations |
| ATE440835T1 (de) | 2003-03-06 | 2009-09-15 | Glaxo Group Ltd | Heterozyklische harnstoff-derivate für die behandlung von schmerzen. |
| WO2004078744A2 (en) | 2003-03-07 | 2004-09-16 | Glaxo Group Limited | Urea derivatives and their use as vanilloid receptor antagonists in the treatment of pain |
| GB0305426D0 (en) * | 2003-03-08 | 2003-04-16 | Glaxo Group Ltd | Novel compounds |
| GB0319150D0 (en) * | 2003-08-14 | 2003-09-17 | Glaxo Group Ltd | Novel compounds |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1445672A1 (de) * | 1962-08-09 | 1968-12-12 | Degussa | Verfahren zur Herstellung neuer 2-Aryl-alkyl-1-Basen |
| DE1189553B (de) * | 1962-08-09 | 1965-03-25 | Degussa | Verfahren zur Herstellung von racemischen und optisch aktiven Piperazinderivaten |
| US3576810A (en) * | 1968-06-20 | 1971-04-27 | Robins Co Inc A H | 1-substituted-3-(-4)-aroylpiperidines |
| US3856857A (en) * | 1970-02-13 | 1974-12-24 | En Nom Collectif Science Union | Amino acids and their derivatives |
| US3647877A (en) * | 1970-04-13 | 1972-03-07 | Mead Johnson & Co | Aminopropionanilides |
| GB1459506A (en) * | 1974-02-18 | 1976-12-22 | Wyeth John & Brother Ltd | Piperidine derivatives |
| GB1458898A (en) * | 1974-03-18 | 1976-12-15 | Science Union & Cie | Ortho alkoxyanilides a process for their preparation and pharmaceutical compositions containing them |
| AR216043A1 (es) * | 1974-03-21 | 1979-11-30 | Anphar Sa | Procedimiento para la preparacion de 1-derivados de benzoilamino-4-piperidina y sus sales fisiologicamente aceptables |
| JPS518283A (en) * | 1974-07-09 | 1976-01-23 | Kyorin Seiyaku Kk | 11 * 33 fuenirupuropiru * 44 karubamoirupiperajinjudotaino seizoho |
| JPS5152176A (OSRAM) * | 1974-10-12 | 1976-05-08 | Yoshitomi Pharmaceutical | |
| GB1520584A (en) * | 1975-04-02 | 1978-08-09 | Yamanouchi Pharma Co Ltd | 2 - alkoxy - 5 substituted benzamide derivatives and their use in pharmaceutical compositions |
| GB1498884A (en) * | 1975-04-15 | 1978-01-25 | Wyeth John & Brother Ltd | Aminoacetamide-pyridyl-tetrahydropyridyl and-piperidyl derivatives |
-
1977
- 1977-04-22 GB GB16765/77A patent/GB1561023A/en not_active Expired
-
1978
- 1978-03-30 ZA ZA00781831A patent/ZA781831B/xx unknown
- 1978-04-03 IL IL54438A patent/IL54438A/xx unknown
- 1978-04-05 CA CA000300476A patent/CA1136137A/en not_active Expired
- 1978-04-10 US US05/894,942 patent/US4223034A/en not_active Expired - Lifetime
- 1978-04-17 BE BE186853A patent/BE866057A/xx unknown
- 1978-04-17 AU AU35169/78A patent/AU518729B2/en not_active Expired
- 1978-04-18 FR FR7811309A patent/FR2387955A1/fr active Granted
- 1978-04-18 DE DE19782816884 patent/DE2816884A1/de not_active Withdrawn
- 1978-04-19 SE SE7804483A patent/SE7804483L/xx unknown
- 1978-04-20 DK DK172578A patent/DK172578A/da not_active IP Right Cessation
- 1978-04-20 ES ES469008A patent/ES469008A1/es not_active Expired
- 1978-04-20 NL NL7804203A patent/NL7804203A/xx not_active Application Discontinuation
- 1978-04-21 JP JP4763078A patent/JPS53132533A/ja active Pending
- 1978-04-21 IE IE791/78A patent/IE46802B1/en unknown
-
1979
- 1979-01-15 ES ES476863A patent/ES476863A1/es not_active Expired
- 1979-01-15 ES ES476862A patent/ES476862A1/es not_active Expired
- 1979-01-15 ES ES476864A patent/ES476864A1/es not_active Expired
-
1980
- 1980-05-12 US US06/148,778 patent/US4331816A/en not_active Expired - Lifetime
- 1980-05-12 US US06/149,182 patent/US4329344A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US4329344A (en) | 1982-05-11 |
| FR2387955A1 (fr) | 1978-11-17 |
| IE780791L (en) | 1978-10-22 |
| BE866057A (fr) | 1978-10-17 |
| DE2816884A1 (de) | 1978-11-02 |
| ES469008A1 (es) | 1979-09-01 |
| AU3516978A (en) | 1979-10-25 |
| IL54438A (en) | 1981-10-30 |
| GB1561023A (en) | 1980-02-13 |
| ES476862A1 (es) | 1979-06-01 |
| US4223034A (en) | 1980-09-16 |
| FR2387955B1 (OSRAM) | 1982-05-14 |
| AU518729B2 (en) | 1981-10-15 |
| IL54438A0 (en) | 1978-07-31 |
| IE46802B1 (en) | 1983-09-21 |
| US4331816A (en) | 1982-05-25 |
| ES476863A1 (es) | 1979-06-01 |
| DK172578A (da) | 1978-10-23 |
| NL7804203A (nl) | 1978-10-24 |
| SE7804483L (sv) | 1978-10-23 |
| ZA781831B (en) | 1979-03-28 |
| ES476864A1 (es) | 1980-06-16 |
| JPS53132533A (en) | 1978-11-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1136137A (en) | Aniline derivatives | |
| Boido et al. | Synthesis and preliminary pharmacological evaluation of some cytisine derivatives | |
| CA2158457C (en) | Naphthalene derivatives | |
| WO2003028728A1 (en) | 4-(4-substituted piperazinyl-1yl)-butylcarboxamides as d3 dopamine subtype selective ligands | |
| SK106395A3 (en) | Treating and treatment or prevention of mental diseases | |
| IE911683A1 (en) | "New aminopiperidine, aminopyrrolidine and aminoperhydroazepine compounds processes for the preparation thereof and pharmaceutical compositions containing them" | |
| RS20050805A (sr) | Piperidinil-i piperazinil- alkilkarbamatski derivati, dobijanje i njihova terapeutska primena | |
| EP0100200A1 (en) | 2-Substituted 4-amino-6,7-dimethoxyquinolines | |
| CA1143734A (en) | 8-arylalkyl-3-phenyl-3-nortropanols, their acid addition salts, medicaments containing the same and processes for the preparation thereof | |
| US7538111B2 (en) | Benzenesulphonamide derivatives, method for production and use thereof for treatment of pain | |
| WO1997041108A1 (en) | Substituted piperazines and piperidines as central nervous system agents | |
| US7271168B2 (en) | Piperazine derivatives having SST1 antagonistic activity | |
| IE910747A1 (en) | Derivatives of 4-(aminomethyl)-piperidine, their preparation¹and their therapeutic application | |
| EP0737678B1 (en) | 4-Indolylpiperazinyl derivatives | |
| JPH02138266A (ja) | 6‐フェニル‐3‐(ピペラジニルアルキル)‐2,4(1h,3h)‐ピリミジンジオン誘導体 | |
| CA2384018C (en) | Muscarinic antagonists | |
| CA1096870A (en) | 4-quinolylamino-benzamide compounds | |
| NZ286340A (en) | Amides of 2-(4-indolyl piperazia-1-yl)-1-ph-enyl (and bemzyl)ethyl amine derivatives with various (cyclo) alkane carboxylic acids; pharmaceutical compositions | |
| JPH05117243A (ja) | 2−アミノピリミジン−4−カルボキサミド誘導体、その製造と治療における応用 | |
| KR19990044563A (ko) | 신경이완제인 3베타-아미노 아자바이시클로 옥탄 또는 노난의 나프타미드 유도체 | |
| CA1094070A (en) | 1-phenyl-piperazine derivatives | |
| US4160766A (en) | Amino containing benzazepines | |
| US20020058811A1 (en) | Naphthalene derivatives | |
| SK64492A3 (en) | Piperazine derivatives, method of production and pharmaceutical compound containing them | |
| HK1010102B (en) | 4-indolylpiperazinyl derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |