CA1134856A - Process for preparing terephthalic acid - Google Patents
Process for preparing terephthalic acidInfo
- Publication number
- CA1134856A CA1134856A CA000338017A CA338017A CA1134856A CA 1134856 A CA1134856 A CA 1134856A CA 000338017 A CA000338017 A CA 000338017A CA 338017 A CA338017 A CA 338017A CA 1134856 A CA1134856 A CA 1134856A
- Authority
- CA
- Canada
- Prior art keywords
- reaction zone
- terephthalic acid
- oxidation
- xylene
- temperature
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title claims abstract description 98
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 11
- 238000006243 chemical reaction Methods 0.000 claims abstract description 69
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 claims abstract description 66
- 238000007254 oxidation reaction Methods 0.000 claims abstract description 57
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims abstract description 48
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims abstract description 20
- 229910001882 dioxygen Inorganic materials 0.000 claims abstract description 20
- 239000011541 reaction mixture Substances 0.000 claims abstract description 18
- 239000002904 solvent Substances 0.000 claims abstract description 18
- 239000003054 catalyst Substances 0.000 claims abstract description 14
- 239000007788 liquid Substances 0.000 claims abstract description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 6
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 6
- 238000000926 separation method Methods 0.000 claims abstract description 6
- 229910001385 heavy metal Inorganic materials 0.000 claims abstract description 5
- 238000002425 crystallisation Methods 0.000 claims abstract description 4
- 230000008025 crystallization Effects 0.000 claims abstract description 4
- 238000000034 method Methods 0.000 claims description 38
- 230000003647 oxidation Effects 0.000 claims description 26
- 239000002002 slurry Substances 0.000 claims description 18
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 239000013078 crystal Substances 0.000 claims description 7
- 239000000543 intermediate Substances 0.000 claims description 6
- 239000012452 mother liquor Substances 0.000 claims description 6
- 238000002485 combustion reaction Methods 0.000 abstract description 6
- 238000002360 preparation method Methods 0.000 abstract description 5
- 230000001590 oxidative effect Effects 0.000 abstract description 3
- 239000000047 product Substances 0.000 description 17
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 8
- 230000000052 comparative effect Effects 0.000 description 6
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 229910017052 cobalt Inorganic materials 0.000 description 4
- 239000010941 cobalt Substances 0.000 description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 229920000728 polyester Polymers 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- -1 bromine compound Chemical class 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000000356 contaminant Substances 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 229940011182 cobalt acetate Drugs 0.000 description 2
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 2
- BZRRQSJJPUGBAA-UHFFFAOYSA-L cobalt(ii) bromide Chemical compound Br[Co]Br BZRRQSJJPUGBAA-UHFFFAOYSA-L 0.000 description 2
- RJYMRRJVDRJMJW-UHFFFAOYSA-L dibromomanganese Chemical compound Br[Mn]Br RJYMRRJVDRJMJW-UHFFFAOYSA-L 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- MVEOHWRUBFWKJY-UHFFFAOYSA-N 7-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(O)=CC=C21 MVEOHWRUBFWKJY-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241001237728 Precis Species 0.000 description 1
- 241000011102 Thera Species 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 150000001869 cobalt compounds Chemical class 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 229940071125 manganese acetate Drugs 0.000 description 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 1
- SGGOJYZMTYGPCH-UHFFFAOYSA-L manganese(2+);naphthalene-2-carboxylate Chemical compound [Mn+2].C1=CC=CC2=CC(C(=O)[O-])=CC=C21.C1=CC=CC2=CC(C(=O)[O-])=CC=C21 SGGOJYZMTYGPCH-UHFFFAOYSA-L 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- NQLVQOSNDJXLKG-UHFFFAOYSA-N prosulfocarb Chemical compound CCCN(CCC)C(=O)SCC1=CC=CC=C1 NQLVQOSNDJXLKG-UHFFFAOYSA-N 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/21—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen
- C07C51/255—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting
- C07C51/265—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting having alkyl side chains which are oxidised to carboxyl groups
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/52—Improvements relating to the production of bulk chemicals using catalysts, e.g. selective catalysts
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP12870978A JPS5555138A (en) | 1978-10-19 | 1978-10-19 | Preparation of highly pure terephthalic acid |
| JP128,709/78 | 1978-10-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1134856A true CA1134856A (en) | 1982-11-02 |
Family
ID=14991482
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000338017A Expired CA1134856A (en) | 1978-10-19 | 1979-10-19 | Process for preparing terephthalic acid |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4286101A (enExample) |
| JP (1) | JPS5555138A (enExample) |
| BE (1) | BE879530A (enExample) |
| BR (1) | BR7906733A (enExample) |
| CA (1) | CA1134856A (enExample) |
| DE (1) | DE2942375C2 (enExample) |
| FR (1) | FR2439178B1 (enExample) |
| GB (1) | GB2032920B (enExample) |
| IT (1) | IT1125526B (enExample) |
| NL (1) | NL7907615A (enExample) |
| PT (1) | PT70326A (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS57188543A (en) * | 1981-05-13 | 1982-11-19 | Mitsubishi Chem Ind Ltd | Preparation of terephthalic acid |
| JPS59104345A (ja) * | 1982-12-03 | 1984-06-16 | Kuraray Yuka Kk | 直接重合用に適したテレフタル酸の製造方法 |
| JPS59106435A (ja) * | 1982-12-10 | 1984-06-20 | Mitsubishi Chem Ind Ltd | 高純度テレフタル酸の製法 |
| KR900700803A (ko) * | 1988-03-25 | 1990-08-17 | 랄프 챨스 메더스트 | 회전축용 밀봉체 |
| JP2504545B2 (ja) * | 1988-11-15 | 1996-06-05 | 三菱化学株式会社 | テレフタル酸の製造法 |
| KR970000136B1 (ko) * | 1993-09-28 | 1997-01-04 | 브이.피. 유리예프 | 고순도 벤젠디카르복실산 이성질체의 제조방법 |
| US5936041A (en) * | 1994-06-17 | 1999-08-10 | Exxon Chemical Patents Inc | Dispersant additives and process |
| US5767311A (en) * | 1995-06-07 | 1998-06-16 | Glitsch International, Inc. | Method and apparatus for preparing purified terephtalic acid |
| US6013835A (en) * | 1995-06-07 | 2000-01-11 | Hfm International, Inc. | Method and apparatus for preparing purified terephthalic acid |
| US5929274A (en) * | 1995-06-07 | 1999-07-27 | Hfm International, Inc. | Method to reduce carboxybenzaldehyde isomers in terephthalic acid or isophthalic acid |
| US6054610A (en) * | 1995-06-07 | 2000-04-25 | Hfm International, Inc. | Method and apparatus for preparing purified terephthalic acid and isophthalic acid from mixed xylenes |
| DE10040827A1 (de) * | 2000-08-21 | 2002-03-07 | Basf Ag | Verfahren zur Herstellung von Phthalsäureanhydrid |
| RU2254324C2 (ru) * | 2003-07-08 | 2005-06-20 | Общество с ограниченной ответственностью "Научно-исследовательский и производственный центр "ВНИПИМ-ТОС" | Непрерывный способ получения высокочистой терефталевой кислоты |
| US20050283022A1 (en) * | 2004-06-18 | 2005-12-22 | Sheppard Ronald B | Filtrate preparation process for terephthalic acid filtrate treatment |
| DE602006016083D1 (de) | 2005-03-21 | 2010-09-23 | Bp Corp North America Inc | Verfahren und vorrichtung zur herstellung reiner formen von aromatischen carboxyl-säuren |
| US7432395B2 (en) * | 2005-05-19 | 2008-10-07 | Eastman Chemical Company | Enriched carboxylic acid composition |
| US20060264662A1 (en) * | 2005-05-19 | 2006-11-23 | Gibson Philip E | Esterification of an enriched composition |
| US7884231B2 (en) * | 2005-05-19 | 2011-02-08 | Eastman Chemical Company | Process to produce an enriched composition |
| US20060264664A1 (en) * | 2005-05-19 | 2006-11-23 | Parker Kenny R | Esterification of an exchange solvent enriched composition |
| US7880031B2 (en) * | 2005-05-19 | 2011-02-01 | Eastman Chemical Company | Process to produce an enrichment feed |
| US7557243B2 (en) | 2005-05-19 | 2009-07-07 | Eastman Chemical Company | Enriched terephthalic acid composition |
| US7741516B2 (en) * | 2005-05-19 | 2010-06-22 | Eastman Chemical Company | Process to enrich a carboxylic acid composition |
| US7897809B2 (en) * | 2005-05-19 | 2011-03-01 | Eastman Chemical Company | Process to produce an enrichment feed |
| US7919652B2 (en) * | 2005-05-19 | 2011-04-05 | Eastman Chemical Company | Process to produce an enriched composition through the use of a catalyst removal zone and an enrichment zone |
| US7304178B2 (en) * | 2005-05-19 | 2007-12-04 | Eastman Chemical Company | Enriched isophthalic acid composition |
| US7834208B2 (en) * | 2005-05-19 | 2010-11-16 | Eastman Chemical Company | Process to produce a post catalyst removal composition |
| US20060264656A1 (en) * | 2005-05-19 | 2006-11-23 | Fujitsu Limited | Enrichment process using compounds useful in a polyester process |
| US20070179312A1 (en) * | 2006-02-02 | 2007-08-02 | O'meadhra Ruairi Seosamh | Process for the purification of a crude carboxylic axid slurry |
| US7326808B2 (en) | 2006-03-01 | 2008-02-05 | Eastman Chemical Company | Polycarboxylic acid production system employing cooled mother liquor from oxidative digestion as feed to impurity purge system |
| US20070208194A1 (en) | 2006-03-01 | 2007-09-06 | Woodruff Thomas E | Oxidation system with sidedraw secondary reactor |
| US7420082B2 (en) * | 2006-03-01 | 2008-09-02 | Eastman Chemical Company | Polycarboxylic acid production system employing hot liquor removal downstream of oxidative digestion |
| US7772424B2 (en) | 2006-03-01 | 2010-08-10 | Eastman Chemical Company | Polycarboxylic acid production system employing enhanced evaporative concentration downstream of oxidative digestion |
| US7326807B2 (en) | 2006-03-01 | 2008-02-05 | Eastman Chemical Company | Polycarboxylic acid production system with enhanced heating for oxidative digestion |
| US7888529B2 (en) * | 2006-03-01 | 2011-02-15 | Eastman Chemical Company | Process to produce a post catalyst removal composition |
| US7501537B2 (en) | 2006-03-01 | 2009-03-10 | Eastman Chemical Company | Polycarboxylic acid production system employing oxidative digestion with reduced or eliminated upstream liquor exchange |
| US7393973B2 (en) | 2006-03-01 | 2008-07-01 | Eastman Chemical Company | Polycarboxylic acid production system with enhanced residence time distribution for oxidative digestion |
| US7816556B2 (en) * | 2006-03-01 | 2010-10-19 | Eastman Chemical Company | Polycarboxylic acid production system employing enhanced multistage oxidative digestion |
| US8614350B2 (en) | 2008-01-15 | 2013-12-24 | Eastman Chemical Company | Carboxylic acid production process employing solvent from esterification of lignocellulosic material |
| US8455680B2 (en) | 2008-01-15 | 2013-06-04 | Eastman Chemical Company | Carboxylic acid production process employing solvent from esterification of lignocellulosic material |
| CN101531588B (zh) * | 2008-03-13 | 2016-02-24 | 周向进 | 一种新的精对苯二甲酸的制造方法 |
| WO2015094911A1 (en) | 2013-12-18 | 2015-06-25 | Bp Corporation North America Inc. | Improved process and apparatus for manufacturing aromatic carboxylic acids |
| WO2022054841A1 (ja) * | 2020-09-11 | 2022-03-17 | 株式会社日本触媒 | 化合物の製造方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3092658A (en) * | 1957-08-12 | 1963-06-04 | Standard Oil Co | Continuous system for oxidizing substituted aromatic hydrocarbons and producing carboxylic acids |
| US3089907A (en) * | 1958-04-21 | 1963-05-14 | Mid Century Corp | Pressure controlled liquid phase oxidation process for aromatic acid production |
| FR1272209A (fr) * | 1960-10-14 | 1961-09-22 | Standard Oil Co | Perfectionnements apportés à la production en continu d'acides carboxyliques par oxydation |
| GB983677A (en) * | 1962-04-27 | 1965-02-17 | Mitsui Petrochemical Ind | A process for the preparation of terephthalic acid having extremely high purity |
| JPS5518698B1 (enExample) * | 1971-04-03 | 1980-05-21 | ||
| JPS5139642A (ja) * | 1974-09-30 | 1976-04-02 | Matsuyama Sekyu Kagaku Kk | Kojundoterefutarusanno renzokutekiseizohoho |
| JPS5278846A (en) * | 1975-12-25 | 1977-07-02 | Matsuyama Sekyu Kagaku Kk | Continuous production of high purity telephthalic acid |
| JPS5289637A (en) * | 1976-01-19 | 1977-07-27 | Mitsubishi Chem Ind Ltd | Preparation of terephthalic acid for direct polymerization |
| PL102150B1 (pl) * | 1976-07-29 | 1979-03-31 | Inst Ciezkiej Syntezy Orga | A method oxidizing p-xylene and methyl p-toluylate |
| JPS5949212B2 (ja) * | 1976-09-16 | 1984-12-01 | 三菱化学株式会社 | テレフタル酸の製造法 |
-
1978
- 1978-10-19 JP JP12870978A patent/JPS5555138A/ja active Granted
-
1979
- 1979-10-01 GB GB7934000A patent/GB2032920B/en not_active Expired
- 1979-10-12 US US06/084,153 patent/US4286101A/en not_active Expired - Lifetime
- 1979-10-15 NL NL7907615A patent/NL7907615A/nl not_active Application Discontinuation
- 1979-10-17 PT PT70326A patent/PT70326A/pt unknown
- 1979-10-18 BR BR7906733A patent/BR7906733A/pt not_active IP Right Cessation
- 1979-10-18 FR FR7925951A patent/FR2439178B1/fr not_active Expired
- 1979-10-19 CA CA000338017A patent/CA1134856A/en not_active Expired
- 1979-10-19 IT IT26657/79A patent/IT1125526B/it active
- 1979-10-19 DE DE2942375A patent/DE2942375C2/de not_active Expired
- 1979-10-19 BE BE0/197739A patent/BE879530A/fr not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE2942375A1 (de) | 1980-04-30 |
| JPS5555138A (en) | 1980-04-22 |
| NL7907615A (nl) | 1980-04-22 |
| BE879530A (fr) | 1980-04-21 |
| PT70326A (en) | 1979-11-01 |
| IT1125526B (it) | 1986-05-14 |
| FR2439178B1 (fr) | 1985-09-27 |
| JPS6247864B2 (enExample) | 1987-10-09 |
| GB2032920A (en) | 1980-05-14 |
| FR2439178A1 (fr) | 1980-05-16 |
| DE2942375C2 (de) | 1984-01-12 |
| GB2032920B (en) | 1983-01-12 |
| IT7926657A0 (it) | 1979-10-19 |
| US4286101A (en) | 1981-08-25 |
| BR7906733A (pt) | 1980-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1134856A (en) | Process for preparing terephthalic acid | |
| US4356319A (en) | Method of recovering in active form the catalyst for the terephthalic acid synthesis | |
| CA2128719C (en) | Production method of high purity isomers of benzenedicarboxylic acids | |
| EP1214285B1 (en) | Process for producing pure terephthalic acid with improved recovery of precursors, solvent and methyl acetate | |
| US6153790A (en) | Method to produce aromatic dicarboxylic acids using cobalt and zirconium catalysts | |
| US7074954B2 (en) | Process for the oxidative purification of terephthalic acid | |
| US5705682A (en) | Process for producing highly pure terephthalic acid | |
| US20040215036A1 (en) | Method for heating a crude carboxylic acid slurry in a post oxidation zone by the addition of steam | |
| CA2480597A1 (en) | Method of removing iron contaminants from liquid streams during the manufacture and/or purification of aromatic acids | |
| CA2315151A1 (en) | Method to produce aromatic carboxylic acids | |
| US4241220A (en) | Process for producing terephthalic acid | |
| JP2001226315A (ja) | テレフタル酸の製造方法 | |
| ZA200100138B (en) | Method for recovering methyl acetate and residual acetic acid in the production of pure terephthalic acid. | |
| US4992579A (en) | Process for the production of trimellitic acid | |
| US4587350A (en) | Process for the production of trimellitic anhydride | |
| EP0872470A3 (en) | Process for producing 2,6-naphthalenedicarboxyl acid | |
| EP1104396B1 (en) | Method for recovering methyl acetate and residual acetic acid in the production of pure terephthalic acid | |
| EP0083224A1 (en) | Process for producing aromatic polycarboxylic acid with high purity | |
| US4764639A (en) | Process for the production of trimellitic acid | |
| US4797497A (en) | Trimellitic anhydride purification process | |
| US6160159A (en) | Preparation of dimethyl terephthalate via the air oxidation of p-tolualdehyde | |
| US4845275A (en) | Trimellitic acid process | |
| US4754062A (en) | Iron-enhanced selectivity of heavy metal-bromine catalysis in the oxidation of polyalkylaromatics | |
| KR20030033958A (ko) | 고순도 나프탈렌디카복실산의 제조방법 | |
| US4259522A (en) | Process for the production of isophtahalic acid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |