CA1128528A - Hydroxyethyl-azole compounds, their production and their medicinal use - Google Patents
Hydroxyethyl-azole compounds, their production and their medicinal useInfo
- Publication number
- CA1128528A CA1128528A CA340,547A CA340547A CA1128528A CA 1128528 A CA1128528 A CA 1128528A CA 340547 A CA340547 A CA 340547A CA 1128528 A CA1128528 A CA 1128528A
- Authority
- CA
- Canada
- Prior art keywords
- denotes
- process according
- phenyl
- chlorine
- imidazol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- XBVPIPOORLGFGK-UHFFFAOYSA-N 2-(1h-pyrrol-2-yl)ethanol Chemical class OCCC1=CC=CN1 XBVPIPOORLGFGK-UHFFFAOYSA-N 0.000 title abstract description 8
- 239000000460 chlorine Substances 0.000 claims abstract description 74
- 238000000034 method Methods 0.000 claims abstract description 42
- -1 polymethylene Polymers 0.000 claims abstract description 41
- 150000001875 compounds Chemical class 0.000 claims abstract description 33
- 125000001309 chloro group Chemical group Cl* 0.000 claims abstract description 28
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 26
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 22
- 239000011737 fluorine Chemical group 0.000 claims abstract description 14
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 14
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims abstract description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 11
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 10
- 125000005843 halogen group Chemical group 0.000 claims abstract description 9
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 8
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 8
- 125000001624 naphthyl group Chemical group 0.000 claims abstract description 8
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 4
- 239000001257 hydrogen Substances 0.000 claims abstract description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 3
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 claims abstract description 3
- 239000003085 diluting agent Substances 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 19
- 238000006243 chemical reaction Methods 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 12
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical group [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims description 10
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims description 10
- 239000011230 binding agent Substances 0.000 claims description 7
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 7
- TWHMHPRBRHRBOC-UHFFFAOYSA-N 2-ethyl-1h-pyrrol-3-ol Chemical compound CCC=1NC=CC=1O TWHMHPRBRHRBOC-UHFFFAOYSA-N 0.000 claims description 6
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 5
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 4
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical group 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- SWSIKJHQXQBBGI-UHFFFAOYSA-N 1-phenyl-2-(1h-pyrrol-2-yl)ethanone Chemical compound C=1C=CC=CC=1C(=O)CC1=CC=CN1 SWSIKJHQXQBBGI-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- 150000003852 triazoles Chemical class 0.000 claims description 2
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 claims 7
- 125000003626 1,2,4-triazol-1-yl group Chemical group [*]N1N=C([H])N=C1[H] 0.000 claims 3
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims 3
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 claims 1
- 239000002585 base Substances 0.000 claims 1
- PTTVRIGSUJQBPB-UHFFFAOYSA-N fluorocyclohexatriene Chemical compound FC1=CC=C=C[CH]1 PTTVRIGSUJQBPB-UHFFFAOYSA-N 0.000 claims 1
- 125000004436 sodium atom Chemical group 0.000 claims 1
- 238000002360 preparation method Methods 0.000 abstract description 7
- 239000003429 antifungal agent Substances 0.000 abstract description 2
- 239000003814 drug Substances 0.000 description 17
- 239000000203 mixture Substances 0.000 description 17
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N EtOH Substances CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- 239000000243 solution Substances 0.000 description 11
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 208000015181 infectious disease Diseases 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- 239000004480 active ingredient Substances 0.000 description 8
- 235000019441 ethanol Nutrition 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 230000001857 anti-mycotic effect Effects 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000002775 capsule Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000008194 pharmaceutical composition Substances 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000002543 antimycotic Substances 0.000 description 4
- 230000000875 corresponding effect Effects 0.000 description 4
- 239000008298 dragée Substances 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 4
- 239000006187 pill Substances 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- HUKAJTVPPFWWQL-UHFFFAOYSA-N 1,3-di(imidazol-1-yl)propan-2-one Chemical compound C1=CN=CN1CC(=O)CN1C=CN=C1 HUKAJTVPPFWWQL-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- 208000002474 Tinea Diseases 0.000 description 3
- 241000223238 Trichophyton Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000003851 azoles Chemical class 0.000 description 3
- 235000012216 bentonite Nutrition 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000001427 coherent effect Effects 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 230000001681 protective effect Effects 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- DZZSMYSBOSSZIQ-UHFFFAOYSA-N 2-chloro-1-(4-chlorophenyl)-1-[4-(2-chlorophenyl)phenyl]ethanol Chemical compound C=1C=C(C=2C(=CC=CC=2)Cl)C=CC=1C(CCl)(O)C1=CC=C(Cl)C=C1 DZZSMYSBOSSZIQ-UHFFFAOYSA-N 0.000 description 2
- 241001480043 Arthrodermataceae Species 0.000 description 2
- 241000335423 Blastomyces Species 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- 206010012504 Dermatophytosis Diseases 0.000 description 2
- 241001480036 Epidermophyton floccosum Species 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 241000233866 Fungi Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241001460074 Microsporum distortum Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 230000000845 anti-microbial effect Effects 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 244000052616 bacterial pathogen Species 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- SESFRYSPDFLNCH-UHFFFAOYSA-N benzyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 230000037304 dermatophytes Effects 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000007937 lozenge Substances 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L magnesium chloride Substances [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 229910001629 magnesium chloride Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- 229940058015 1,3-butylene glycol Drugs 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- VYJCIBDUEOPFQW-UHFFFAOYSA-N 1-(2-chloro-4-cyclopentylphenyl)-2-imidazol-1-ylethanone Chemical compound ClC1=CC(C2CCCC2)=CC=C1C(=O)CN1C=CN=C1 VYJCIBDUEOPFQW-UHFFFAOYSA-N 0.000 description 1
- ZKLFDYQDFFSXAW-UHFFFAOYSA-N 1-(3-chlorophenyl)-2-imidazol-1-yl-1-(4-phenylphenyl)ethanol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1C(C=1C=C(Cl)C=CC=1)(O)CN1C=CN=C1 ZKLFDYQDFFSXAW-UHFFFAOYSA-N 0.000 description 1
- KRBHMEBUABSRHU-UHFFFAOYSA-N 1-(4-chloro-3-cyclohexylphenyl)-2-imidazol-1-ylethanone Chemical compound ClC1=CC=C(C(=O)CN2C=NC=C2)C=C1C1CCCCC1 KRBHMEBUABSRHU-UHFFFAOYSA-N 0.000 description 1
- WKYKHEYKUXMJCD-UHFFFAOYSA-N 1-(4-chlorophenyl)-1-[4-(2-chlorophenyl)phenyl]-2-(1,2,4-triazol-1-yl)ethanol Chemical compound C=1C=C(Cl)C=CC=1C(C=1C=CC(=CC=1)C=1C(=CC=CC=1)Cl)(O)CN1C=NC=N1 WKYKHEYKUXMJCD-UHFFFAOYSA-N 0.000 description 1
- RQAAKNPVKMLUSL-UHFFFAOYSA-N 1-(4-cycloheptylphenyl)-2-imidazol-1-ylethanone Chemical compound C=1C=C(C2CCCCCC2)C=CC=1C(=O)CN1C=CN=C1 RQAAKNPVKMLUSL-UHFFFAOYSA-N 0.000 description 1
- YAEMCNDAIHEJGL-UHFFFAOYSA-N 1-(4-cyclohexylphenyl)-2-imidazol-1-ylethanone Chemical compound C=1C=C(C2CCCCC2)C=CC=1C(=O)CN1C=CN=C1 YAEMCNDAIHEJGL-UHFFFAOYSA-N 0.000 description 1
- GSCZIAAVNALXDU-UHFFFAOYSA-N 1-(4-cyclopentyl-2-fluorophenyl)-2-imidazol-1-ylethanone Chemical compound FC1=CC(C2CCCC2)=CC=C1C(=O)CN1C=CN=C1 GSCZIAAVNALXDU-UHFFFAOYSA-N 0.000 description 1
- XUDIDEPBYWUBFA-UHFFFAOYSA-N 1-(4-cyclopentyl-2-methylphenyl)-2-imidazol-1-ylethanone Chemical compound CC1=CC(C2CCCC2)=CC=C1C(=O)CN1C=CN=C1 XUDIDEPBYWUBFA-UHFFFAOYSA-N 0.000 description 1
- KSNUHSFHNLROID-UHFFFAOYSA-N 1-(4-cyclopentylphenyl)-2-imidazol-1-ylethanone Chemical compound C=1C=C(C2CCCC2)C=CC=1C(=O)CN1C=CN=C1 KSNUHSFHNLROID-UHFFFAOYSA-N 0.000 description 1
- HJYJZVGZXUVWBN-UHFFFAOYSA-N 1-[4-(3-bromocyclohexyl)phenyl]-2-imidazol-1-ylethanone Chemical compound C1C(Br)CCCC1C1=CC=C(C(=O)CN2C=NC=C2)C=C1 HJYJZVGZXUVWBN-UHFFFAOYSA-N 0.000 description 1
- NHDODQWIKUYWMW-UHFFFAOYSA-N 1-bromo-4-chlorobenzene Chemical compound ClC1=CC=C(Br)C=C1 NHDODQWIKUYWMW-UHFFFAOYSA-N 0.000 description 1
- NFDXQGNDWIPXQL-UHFFFAOYSA-N 1-cyclooctyldiazocane Chemical compound C1CCCCCCC1N1NCCCCCC1 NFDXQGNDWIPXQL-UHFFFAOYSA-N 0.000 description 1
- YNCPXBIZAPNQIJ-UHFFFAOYSA-N 1h-imidazole;sodium Chemical compound [Na].C1=CNC=N1 YNCPXBIZAPNQIJ-UHFFFAOYSA-N 0.000 description 1
- ZPNUWMKZXYQJJM-UHFFFAOYSA-N 2-chloro-1-(4-fluorophenyl)-1-(4-phenylphenyl)ethanol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1C(CCl)(O)C1=CC=C(F)C=C1 ZPNUWMKZXYQJJM-UHFFFAOYSA-N 0.000 description 1
- IQEIGQFNDLINOT-UHFFFAOYSA-N 2-chloro-1-(4-phenylphenyl)ethanone Chemical compound C1=CC(C(=O)CCl)=CC=C1C1=CC=CC=C1 IQEIGQFNDLINOT-UHFFFAOYSA-N 0.000 description 1
- GKHIODGPGFIJFZ-UHFFFAOYSA-N 2-chloro-1-[4-(2-chlorophenyl)phenyl]ethanone Chemical compound C1=CC(C(=O)CCl)=CC=C1C1=CC=CC=C1Cl GKHIODGPGFIJFZ-UHFFFAOYSA-N 0.000 description 1
- LAXBNTIAOJWAOP-UHFFFAOYSA-N 2-chlorobiphenyl Chemical group ClC1=CC=CC=C1C1=CC=CC=C1 LAXBNTIAOJWAOP-UHFFFAOYSA-N 0.000 description 1
- CTBDNAHBIPBRTI-UHFFFAOYSA-N 2-imidazol-1-yl-1-(4-phenylphenyl)ethanone Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1C(=O)CN1C=CN=C1 CTBDNAHBIPBRTI-UHFFFAOYSA-N 0.000 description 1
- JSXHJZYXDPGZIB-UHFFFAOYSA-N 2-imidazol-1-yl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone Chemical compound C=1C=C2CCCCC2=CC=1C(=O)CN1C=CN=C1 JSXHJZYXDPGZIB-UHFFFAOYSA-N 0.000 description 1
- BZIXKHNVZRARTJ-UHFFFAOYSA-N 2-imidazol-1-yl-1-[4-(1-methylcyclohexyl)phenyl]ethanone Chemical compound C=1C=C(C(=O)CN2C=NC=C2)C=CC=1C1(C)CCCCC1 BZIXKHNVZRARTJ-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 201000004384 Alopecia Diseases 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 201000002909 Aspergillosis Diseases 0.000 description 1
- 241000228212 Aspergillus Species 0.000 description 1
- 241001225321 Aspergillus fumigatus Species 0.000 description 1
- 208000036641 Aspergillus infections Diseases 0.000 description 1
- 241000228245 Aspergillus niger Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 239000004150 EU approved colour Substances 0.000 description 1
- 241001480035 Epidermophyton Species 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- BYBLEWFAAKGYCD-UHFFFAOYSA-N Miconazole Chemical compound ClC1=CC(Cl)=CC=C1COC(C=1C(=CC(Cl)=CC=1)Cl)CN1C=NC=C1 BYBLEWFAAKGYCD-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- SVYKKECYCPFKGB-UHFFFAOYSA-N N,N-dimethylcyclohexylamine Chemical compound CN(C)C1CCCCC1 SVYKKECYCPFKGB-UHFFFAOYSA-N 0.000 description 1
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 241000228143 Penicillium Species 0.000 description 1
- 241001507677 Penicillium commune Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 241001045770 Trichophyton mentagrophytes Species 0.000 description 1
- 206010067409 Trichophytosis Diseases 0.000 description 1
- 239000001089 [(2R)-oxolan-2-yl]methanol Substances 0.000 description 1
- KXCUFQNBDQIMQM-UHFFFAOYSA-M [Cl-].C1CCCC2=CC([Mg+])=CC=C21 Chemical compound [Cl-].C1CCCC2=CC([Mg+])=CC=C21 KXCUFQNBDQIMQM-UHFFFAOYSA-M 0.000 description 1
- DSTYFUTWKVNGQK-UHFFFAOYSA-M [Cl-].FC1=CC=CC(Cl)=C1[Mg+] Chemical compound [Cl-].FC1=CC=CC(Cl)=C1[Mg+] DSTYFUTWKVNGQK-UHFFFAOYSA-M 0.000 description 1
- GKTMIMPKRFNHMP-UHFFFAOYSA-M [Cl-].[Mg+]C1=CC=C(Cl)C(Cl)=C1 Chemical compound [Cl-].[Mg+]C1=CC=C(Cl)C(Cl)=C1 GKTMIMPKRFNHMP-UHFFFAOYSA-M 0.000 description 1
- QCQYNYWXPHCAAZ-UHFFFAOYSA-M [Cl-].[Mg+]C1=CC=C(Cl)C=C1 Chemical compound [Cl-].[Mg+]C1=CC=C(Cl)C=C1 QCQYNYWXPHCAAZ-UHFFFAOYSA-M 0.000 description 1
- IWJNLFUHPFRHGU-UHFFFAOYSA-M [Cl-].[Mg+]C1=CC=C(Cl)C=C1Cl Chemical compound [Cl-].[Mg+]C1=CC=C(Cl)C=C1Cl IWJNLFUHPFRHGU-UHFFFAOYSA-M 0.000 description 1
- CZTRCGMJNUHYEL-UHFFFAOYSA-M [Cl-].[Mg+]C1=CC=CC(Cl)=C1 Chemical compound [Cl-].[Mg+]C1=CC=CC(Cl)=C1 CZTRCGMJNUHYEL-UHFFFAOYSA-M 0.000 description 1
- LMWRUVZWLBOLRD-UHFFFAOYSA-M [Cl-].[Mg+]C1=CC=CC=C1Cl Chemical compound [Cl-].[Mg+]C1=CC=CC=C1Cl LMWRUVZWLBOLRD-UHFFFAOYSA-M 0.000 description 1
- VJHCJDRQFCCTHL-UHFFFAOYSA-N acetic acid 2,3,4,5,6-pentahydroxyhexanal Chemical class CC(O)=O.OCC(O)C(O)C(O)C(O)C=O VJHCJDRQFCCTHL-UHFFFAOYSA-N 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 230000000274 adsorptive effect Effects 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical group 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 229910021502 aluminium hydroxide Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- MPHPHYZQRGLTBO-UHFFFAOYSA-N apazone Chemical compound CC1=CC=C2N=C(N(C)C)N3C(=O)C(CCC)C(=O)N3C2=C1 MPHPHYZQRGLTBO-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000003974 aralkylamines Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229940091771 aspergillus fumigatus Drugs 0.000 description 1
- 125000003943 azolyl group Chemical group 0.000 description 1
- 229960002903 benzyl benzoate Drugs 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- YHNUDLCUIKMNSN-UHFFFAOYSA-N bis(1,2,4-triazol-1-yl)methanone Chemical class C1=NC=NN1C(=O)N1C=NC=N1 YHNUDLCUIKMNSN-UHFFFAOYSA-N 0.000 description 1
- KOYOTACAROXCDW-UHFFFAOYSA-N bis(1,2,4-triazol-4-yl)methanone Chemical class C1=NN=CN1C(=O)N1C=NN=C1 KOYOTACAROXCDW-UHFFFAOYSA-N 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 235000019437 butane-1,3-diol Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229940095731 candida albicans Drugs 0.000 description 1
- 201000003984 candidiasis Diseases 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000001913 cellulose Chemical class 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229940106135 cellulose Drugs 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 239000012973 diazabicyclooctane Substances 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- QVQGTNFYPJQJNM-UHFFFAOYSA-N dicyclohexylmethanamine Chemical compound C1CCCCC1C(N)C1CCCCC1 QVQGTNFYPJQJNM-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 239000010642 eucalyptus oil Substances 0.000 description 1
- 229940044949 eucalyptus oil Drugs 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229960002598 fumaric acid Drugs 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000003676 hair loss Effects 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229960000448 lactic acid Drugs 0.000 description 1
- 230000007775 late Effects 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- IWCVDCOJSPWGRW-UHFFFAOYSA-M magnesium;benzene;chloride Chemical compound [Mg+2].[Cl-].C1=CC=[C-]C=C1 IWCVDCOJSPWGRW-UHFFFAOYSA-M 0.000 description 1
- ZMPYQGQHGLLBQI-UHFFFAOYSA-M magnesium;chlorobenzene;bromide Chemical compound [Mg+2].[Br-].ClC1=CC=C[C-]=C1 ZMPYQGQHGLLBQI-UHFFFAOYSA-M 0.000 description 1
- BRKADVNLTRCLOW-UHFFFAOYSA-M magnesium;fluorobenzene;bromide Chemical compound [Mg+2].[Br-].FC1=CC=[C-]C=C1 BRKADVNLTRCLOW-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229940098895 maleic acid Drugs 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000001525 mentha piperita l. herb oil Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000003020 moisturizing effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000003605 opacifier Substances 0.000 description 1
- 229940006093 opthalmologic coloring agent diagnostic Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 235000019477 peppermint oil Nutrition 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 229960004063 propylene glycol Drugs 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 229960001367 tartaric acid Drugs 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- HLZKNKRTKFSKGZ-UHFFFAOYSA-N tetradecan-1-ol Chemical compound CCCCCCCCCCCCCCO HLZKNKRTKFSKGZ-UHFFFAOYSA-N 0.000 description 1
- BSYVTEYKTMYBMK-UHFFFAOYSA-N tetrahydrofurfuryl alcohol Chemical compound OCC1CCCO1 BSYVTEYKTMYBMK-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/36—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal
- C07C29/38—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal by reaction with aldehydes or ketones
- C07C29/40—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal by reaction with aldehydes or ketones with compounds containing carbon-to-metal bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- General Chemical & Material Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Public Health (AREA)
- Oncology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicinal Preparation (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782851116 DE2851116A1 (de) | 1978-11-25 | 1978-11-25 | Hydroxyethyl-azole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DEP2851116.2 | 1978-11-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1128528A true CA1128528A (en) | 1982-07-27 |
Family
ID=6055583
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA340,547A Expired CA1128528A (en) | 1978-11-25 | 1979-11-23 | Hydroxyethyl-azole compounds, their production and their medicinal use |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4301166A (show.php) |
| EP (1) | EP0011769B1 (show.php) |
| JP (1) | JPS5573662A (show.php) |
| AT (1) | ATE851T1 (show.php) |
| AU (1) | AU534447B2 (show.php) |
| CA (1) | CA1128528A (show.php) |
| DD (1) | DD148219A5 (show.php) |
| DE (2) | DE2851116A1 (show.php) |
| DK (1) | DK499579A (show.php) |
| ES (1) | ES486280A1 (show.php) |
| FI (1) | FI65993C (show.php) |
| HU (1) | HU179415B (show.php) |
| IE (1) | IE48881B1 (show.php) |
| IL (1) | IL58775A (show.php) |
| NO (1) | NO793674L (show.php) |
| NZ (1) | NZ192196A (show.php) |
| PH (1) | PH15562A (show.php) |
| ZA (1) | ZA796357B (show.php) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4654332A (en) * | 1979-03-07 | 1987-03-31 | Imperial Chemical Industries Plc | Heterocyclic compounds |
| US4551469A (en) * | 1979-03-07 | 1985-11-05 | Imperial Chemical Industries Plc | Antifungal triazole ethanol derivatives |
| US4927839A (en) * | 1979-03-07 | 1990-05-22 | Imperial Chemical Industries Plc | Method of preventing fungal attack on wood, hides, leather or paint films using a triazole |
| DE2912288A1 (de) * | 1979-03-28 | 1980-10-09 | Bayer Ag | Verfahren zur herstellung von hydroxyethyl-azolen |
| GB2069481B (en) * | 1980-02-13 | 1983-07-27 | Farmos Oy | Substituted imidazole derivatives |
| GB2078719B (en) * | 1980-06-02 | 1984-04-26 | Ici Ltd | Heterocyclic compounds |
| US5395942A (en) * | 1980-06-02 | 1995-03-07 | Zeneca Limited | Heterocyclic compounds |
| EP0131684B1 (en) * | 1980-08-18 | 1992-03-11 | Imperial Chemical Industries Plc | Use of triazolylethanol derivatives and their compositions as non-agricultural fungicides |
| DE3167205D1 (en) * | 1980-08-28 | 1984-12-20 | Ici Plc | Pharmaceutical compositions of fungicidal triazole derivatives |
| US4479004A (en) * | 1980-11-03 | 1984-10-23 | Janssen Pharmaceutica N.V. | 1-[2-(4-Diphenyl)-1,3-dioxolan-2-yl-methyl]-1-H-triazoles |
| DE3106635A1 (de) * | 1981-02-23 | 1982-09-09 | Bayer Ag | Antimykotisches mittel mit hoher wirkstoff-freisetzung in form von stiften |
| US5466821A (en) * | 1981-03-18 | 1995-11-14 | Zeneca Limited | Heterocyclic compounds |
| DE3111238A1 (de) * | 1981-03-21 | 1982-10-07 | Bayer Ag, 5090 Leverkusen | Substituierte triazolylmethyl-oxirane, verfahren zu ihrer herstellung sowie ihre verwendung als zwischenprodukte |
| AU8314482A (en) * | 1981-05-19 | 1982-11-25 | Imperial Chemical Industries Plc | 3-triazolyl(imidazolyl)-2,2 bis phenyl-propionamides |
| JPS5815909A (ja) * | 1981-07-22 | 1983-01-29 | Toko Yakuhin Kogyo Kk | 抗真菌外用剤 |
| DE3245504A1 (de) * | 1982-12-09 | 1984-06-14 | Bayer Ag, 5090 Leverkusen | Fungizide mittel, deren herstellung und verwendung |
| US4610716A (en) * | 1982-12-14 | 1986-09-09 | Ciba-Geigy Corporation | Fluorinated azolyl ethanol growth regulators and microbicides |
| US4624958A (en) * | 1983-04-14 | 1986-11-25 | Pfizer Inc. | Antiprotozoal 1,4-di(p-amidinophenyl)imidazoles |
| US4766140A (en) * | 1984-06-18 | 1988-08-23 | Eli Lilly And Company | Method of inhibiting aromatase |
| US4729986A (en) * | 1986-04-24 | 1988-03-08 | E. I. Du Pont De Nemours And Company | Fungicidal triazoles and imidazoles |
| US5096889A (en) * | 1987-11-09 | 1992-03-17 | Bayer Ag | Antimycotic compositions of nikkomycin compounds and azole antimycotics |
| US5006513A (en) * | 1987-11-09 | 1991-04-09 | Miles Inc. | Antimycotic compositions of nikkomycin compounds and azole antimycotica |
| US5194427A (en) * | 1987-11-09 | 1993-03-16 | Bayer Ag | Antimycotic compositions of nikkomycin compounds and azole antimycotics |
| US4914087A (en) * | 1988-02-29 | 1990-04-03 | Bayer Ag | Nikkomycin derivatives, antimycotic compositions of nikkomycin derivatives and azole antimycotics |
| US4859693A (en) * | 1988-08-10 | 1989-08-22 | E. I. Du Pont De Nemours And Company | Antiinflammatory carbinoloimidazoles |
| US5049570A (en) * | 1990-01-23 | 1991-09-17 | Du Pont Merck Pharmaceutical Company | Pyridylphenyl nitrogen heterocycle-substituted carbinols and derivatives thereof with anti-inflammatory activity |
| DE4027608A1 (de) * | 1990-08-31 | 1992-03-05 | Bayer Ag | Verfahren zur herstellung von 1-chlor-2-(1-chlor-cyclopropyl)-3-(2-chlor-phenyl)-propan-2-ol und/oder 2-(1-chlor-cyclopropyl)-2-(2-chlor-benzyl)-oxiran |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2431407C2 (de) * | 1974-06-29 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | 1,2,4-Triazol-1-yl-alkanone und -alkanole, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| GB1569267A (en) * | 1975-12-16 | 1980-06-11 | Ici Ltd | Substituted propiophenones and herbicidal and fungicidal compositions containing them |
| DE2623129C3 (de) * | 1976-05-22 | 1980-04-10 | Nordmark-Werke Gmbh, 2000 Hamburg | U-Diphenyl-3-(imidazol-l-yl) -propan-2-ole, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
-
1978
- 1978-11-25 DE DE19782851116 patent/DE2851116A1/de not_active Withdrawn
-
1979
- 1979-11-09 US US06/092,806 patent/US4301166A/en not_active Expired - Lifetime
- 1979-11-13 NO NO793674A patent/NO793674L/no unknown
- 1979-11-14 AT AT79104484T patent/ATE851T1/de not_active IP Right Cessation
- 1979-11-14 DE DE7979104484T patent/DE2962527D1/de not_active Expired
- 1979-11-14 EP EP79104484A patent/EP0011769B1/de not_active Expired
- 1979-11-21 DD DD79217044A patent/DD148219A5/de unknown
- 1979-11-22 IL IL58775A patent/IL58775A/xx unknown
- 1979-11-22 NZ NZ192196A patent/NZ192196A/xx unknown
- 1979-11-22 JP JP15080179A patent/JPS5573662A/ja active Granted
- 1979-11-23 IE IE2242/79A patent/IE48881B1/en unknown
- 1979-11-23 HU HU79BA3892A patent/HU179415B/hu not_active IP Right Cessation
- 1979-11-23 ES ES486280A patent/ES486280A1/es not_active Expired
- 1979-11-23 FI FI793689A patent/FI65993C/fi not_active IP Right Cessation
- 1979-11-23 CA CA340,547A patent/CA1128528A/en not_active Expired
- 1979-11-23 DK DK499579A patent/DK499579A/da unknown
- 1979-11-23 PH PH23325A patent/PH15562A/en unknown
- 1979-11-23 ZA ZA00796357A patent/ZA796357B/xx unknown
- 1979-11-26 AU AU53173/79A patent/AU534447B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| FI65993B (fi) | 1984-04-30 |
| DE2962527D1 (en) | 1982-05-27 |
| IE48881B1 (en) | 1985-06-12 |
| AU5317379A (en) | 1980-05-29 |
| FI793689A7 (fi) | 1980-05-26 |
| JPS5573662A (en) | 1980-06-03 |
| ATE851T1 (de) | 1982-04-15 |
| FI65993C (fi) | 1984-08-10 |
| DD148219A5 (de) | 1981-05-13 |
| DK499579A (da) | 1980-05-26 |
| JPS638939B2 (show.php) | 1988-02-25 |
| PH15562A (en) | 1983-02-11 |
| IE792242L (en) | 1980-05-25 |
| NO793674L (no) | 1980-05-28 |
| IL58775A (en) | 1984-02-29 |
| DE2851116A1 (de) | 1980-06-12 |
| US4301166A (en) | 1981-11-17 |
| EP0011769B1 (de) | 1982-04-14 |
| ZA796357B (en) | 1980-12-31 |
| NZ192196A (en) | 1981-04-24 |
| EP0011769A1 (de) | 1980-06-11 |
| ES486280A1 (es) | 1980-05-16 |
| HU179415B (en) | 1982-10-28 |
| IL58775A0 (en) | 1980-02-29 |
| AU534447B2 (en) | 1984-02-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1128528A (en) | Hydroxyethyl-azole compounds, their production and their medicinal use | |
| US4381306A (en) | Hydroxypropyl-triazole compounds, their production and their medicinal use | |
| IE53144B1 (en) | Triazole antifungal agents,processes for preparing them,and pharmaceutical compositions containing them | |
| US5011850A (en) | Substituted diazolylalkyl-carbinols, a process for their preparation and their use as antimycotic agents | |
| US4246274A (en) | Antimycotic hydroxypropyl-imidazoles | |
| GB1585940A (en) | Antimicrobial azolyl ether derivatives | |
| CA1100975A (en) | Azolyl ether derivatives and their use as fungicides | |
| US4238498A (en) | Antimycotic substituted diphenyl-imidazolyl-methanes | |
| EP0164246B1 (en) | Triazole antifungal agents | |
| EP0117100B1 (en) | Triazole antifungal agents | |
| EP0097014A2 (en) | Triazole antifungal agents | |
| US4215131A (en) | Antimicrobial agents | |
| IE57100B1 (en) | Triazole antifungal agents | |
| US4894382A (en) | Substituted 1,3-diazolyl-2-propanols and their use as antimycotic agents | |
| US4239765A (en) | Fluorenyl-azolylmethyl-carbinol compounds and their medicinal use | |
| GB1564371A (en) | Antimicrobial agents containing imidazole derivatives | |
| EP0126581B1 (en) | Antifungal triazole derivatives | |
| US5126359A (en) | Substituted bisazoles and their use as medicaments | |
| US4207328A (en) | 1-Phenoxy-2-(2,4-dichlorophenyl)-1-imidazol-1-yl-ethan-2-ones and -ols and antimycotic and fungicidal use | |
| CA1341155C (en) | Antifungal agents | |
| US4038404A (en) | 1,2,4-triazole antimycotic compositions and use thereof | |
| US4038406A (en) | 1,2,4-triazole antimycotic compositions and use thereof | |
| EP0102727B1 (en) | Chloropyridyl antifungal agents | |
| KR830002278B1 (ko) | 하이드록시프로필-트리아졸 화합물의 제조방법 | |
| US4284639A (en) | Combating fungi with 1-phenoxy-2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)-ethan-2-ones and -ols |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |