CA1128502A - Process for preparing ergot derivatives - Google Patents
Process for preparing ergot derivativesInfo
- Publication number
- CA1128502A CA1128502A CA335,276A CA335276A CA1128502A CA 1128502 A CA1128502 A CA 1128502A CA 335276 A CA335276 A CA 335276A CA 1128502 A CA1128502 A CA 1128502A
- Authority
- CA
- Canada
- Prior art keywords
- beta
- group
- methyl
- sodium
- tosyloxymethylergoline
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000000034 method Methods 0.000 claims abstract description 68
- 150000001875 compounds Chemical class 0.000 claims abstract description 45
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 25
- -1 4-methyl-1-piperazinyl group Chemical group 0.000 claims abstract description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 19
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 12
- 125000003277 amino group Chemical group 0.000 claims abstract description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 9
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 4
- 239000001257 hydrogen Substances 0.000 claims abstract description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 4
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims abstract description 4
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims abstract description 4
- 238000002360 preparation method Methods 0.000 claims abstract description 4
- 125000002252 acyl group Chemical group 0.000 claims abstract description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 3
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims abstract description 3
- 125000005843 halogen group Chemical group 0.000 claims abstract description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 claims abstract description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 3
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims abstract 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims abstract 2
- 229940080818 propionamide Drugs 0.000 claims description 22
- FTKKVFLCGMOENE-UHFFFAOYSA-N 2-cyanoacetamide;sodium Chemical compound [Na].NC(=O)CC#N FTKKVFLCGMOENE-UHFFFAOYSA-N 0.000 claims description 9
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 claims description 9
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 claims description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 7
- 229910052708 sodium Inorganic materials 0.000 claims description 7
- 239000011734 sodium Substances 0.000 claims description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 4
- 238000009833 condensation Methods 0.000 claims description 4
- 230000005494 condensation Effects 0.000 claims description 4
- 229960001760 dimethyl sulfoxide Drugs 0.000 claims description 4
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 claims description 4
- 239000000741 silica gel Substances 0.000 claims description 4
- 229910002027 silica gel Inorganic materials 0.000 claims description 4
- YTGIQYRSOCZCBD-UHFFFAOYSA-N n-benzyl-2-cyanoacetamide;sodium Chemical compound [Na].N#CCC(=O)NCC1=CC=CC=C1 YTGIQYRSOCZCBD-UHFFFAOYSA-N 0.000 claims description 3
- 239000003880 polar aprotic solvent Substances 0.000 claims description 3
- 235000009518 sodium iodide Nutrition 0.000 claims description 3
- MQVIPHXXVANHEO-UHFFFAOYSA-N 2-cyano-n-phenylacetamide;sodium Chemical compound [Na].N#CCC(=O)NC1=CC=CC=C1 MQVIPHXXVANHEO-UHFFFAOYSA-N 0.000 claims description 2
- KAZWWRZKQWHDOD-UHFFFAOYSA-N 2-methylsulfonyl-1-pyrrolidin-1-ylethanone;sodium Chemical compound [Na].CS(=O)(=O)CC(=O)N1CCCC1 KAZWWRZKQWHDOD-UHFFFAOYSA-N 0.000 claims description 2
- FXRWADXORZQOGL-UHFFFAOYSA-N 3-morpholin-4-yl-3-oxopropanenitrile;sodium Chemical compound [Na].N#CCC(=O)N1CCOCC1 FXRWADXORZQOGL-UHFFFAOYSA-N 0.000 claims description 2
- LQSXKWKNDWKEHE-UHFFFAOYSA-N 3-oxobutanamide;sodium Chemical compound [Na].CC(=O)CC(N)=O LQSXKWKNDWKEHE-UHFFFAOYSA-N 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 238000004587 chromatography analysis Methods 0.000 claims description 2
- CXDGRSYTPLHQMC-UHFFFAOYSA-N ethyl 2-cyanoacetate;sodium Chemical compound [Na].CCOC(=O)CC#N CXDGRSYTPLHQMC-UHFFFAOYSA-N 0.000 claims description 2
- 159000000011 group IA salts Chemical class 0.000 claims description 2
- RXBXBSUDSAFBAT-UHFFFAOYSA-N n-(2-phenylethylsulfonyl)acetamide;sodium Chemical compound [Na].CC(=O)NS(=O)(=O)CCC1=CC=CC=C1 RXBXBSUDSAFBAT-UHFFFAOYSA-N 0.000 claims description 2
- TUPAJLBHVACGLV-UHFFFAOYSA-N propylsulfonyl acetate;sodium Chemical compound [Na].CCCS(=O)(=O)OC(C)=O TUPAJLBHVACGLV-UHFFFAOYSA-N 0.000 claims description 2
- ZMGRMOMYXWGAAE-UHFFFAOYSA-N sodium;ethyl 3-oxobutanoate Chemical compound [Na+].CCOC(=O)[CH-]C(C)=O ZMGRMOMYXWGAAE-UHFFFAOYSA-N 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 30
- YQTYYPJNYHFSFX-UHFFFAOYSA-N 2-cyano-n-ethylacetamide;sodium Chemical compound [Na].CCNC(=O)CC#N YQTYYPJNYHFSFX-UHFFFAOYSA-N 0.000 claims 2
- YESYWKRHMFUAAC-UHFFFAOYSA-N 3-oxo-3-pyrrolidin-1-ylpropanenitrile;sodium Chemical compound [Na].N#CCC(=O)N1CCCC1 YESYWKRHMFUAAC-UHFFFAOYSA-N 0.000 claims 2
- SAZUOPMLTNMKOK-UHFFFAOYSA-N 2-cyano-2-phenylacetamide;sodium Chemical compound [Na].NC(=O)C(C#N)C1=CC=CC=C1 SAZUOPMLTNMKOK-UHFFFAOYSA-N 0.000 claims 1
- LSBJEYPWMVTHRT-UHFFFAOYSA-N 2-cyanobutanamide;sodium Chemical compound [Na].CCC(C#N)C(N)=O LSBJEYPWMVTHRT-UHFFFAOYSA-N 0.000 claims 1
- ZBLUAVADFAWYLL-UHFFFAOYSA-N 2-methylsulfonylacetamide Chemical compound CS(=O)(=O)CC(N)=O ZBLUAVADFAWYLL-UHFFFAOYSA-N 0.000 claims 1
- GXFCXERZQZJTCZ-UHFFFAOYSA-N 3-oxo-3-piperidin-1-ylpropanenitrile;sodium Chemical compound [Na].N#CCC(=O)N1CCCCC1 GXFCXERZQZJTCZ-UHFFFAOYSA-N 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- XSBOOIFPDDTOMH-UHFFFAOYSA-N pentane-2,4-dione;sodium Chemical compound [Na].CC(=O)CC(C)=O XSBOOIFPDDTOMH-UHFFFAOYSA-N 0.000 claims 1
- 238000000746 purification Methods 0.000 claims 1
- 239000002904 solvent Substances 0.000 claims 1
- 239000002220 antihypertensive agent Substances 0.000 abstract description 4
- 230000000694 effects Effects 0.000 abstract description 4
- 229940030600 antihypertensive agent Drugs 0.000 abstract description 3
- 231100001274 therapeutic index Toxicity 0.000 abstract description 2
- 230000001747 exhibiting effect Effects 0.000 abstract 1
- RPTUSVTUFVMDQK-UHFFFAOYSA-N Hidralazin Chemical compound C1=CC=C2C(NN)=NN=CC2=C1 RPTUSVTUFVMDQK-UHFFFAOYSA-N 0.000 description 10
- 231100000111 LD50 Toxicity 0.000 description 6
- 229960002474 hydralazine Drugs 0.000 description 5
- 241000700159 Rattus Species 0.000 description 4
- 230000036772 blood pressure Effects 0.000 description 4
- AWFDCTXCTHGORH-HGHGUNKESA-N 6-[4-[(6ar,9r,10ar)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carbonyl]piperazin-1-yl]-1-methylpyridin-2-one Chemical class O=C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(Br)=C(C=34)C2)C1)C)N(CC1)CCN1C1=CC=CC(=O)N1C AWFDCTXCTHGORH-HGHGUNKESA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- 229940083181 centrally acting adntiadrenergic agent methyldopa Drugs 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 231100000419 toxicity Toxicity 0.000 description 3
- 230000001988 toxicity Effects 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 206010020772 Hypertension Diseases 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- CJCSPKMFHVPWAR-JTQLQIEISA-N alpha-methyl-L-dopa Chemical compound OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 CJCSPKMFHVPWAR-JTQLQIEISA-N 0.000 description 2
- 230000003276 anti-hypertensive effect Effects 0.000 description 2
- 230000002496 gastric effect Effects 0.000 description 2
- 229920000669 heparin Polymers 0.000 description 2
- 230000001631 hypertensive effect Effects 0.000 description 2
- 125000004674 methylcarbonyl group Chemical group CC(=O)* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- ZTHRQJQJODGZHV-UHFFFAOYSA-N n-phenylpropanamide Chemical compound CCC(=O)NC1=CC=CC=C1 ZTHRQJQJODGZHV-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- QBCXAYMPEKGCSW-UHFFFAOYSA-N 1-acetylpyrrolidine-2-carbonitrile;sodium Chemical compound [Na].CC(=O)N1CCCC1C#N QBCXAYMPEKGCSW-UHFFFAOYSA-N 0.000 description 1
- VARXTXAOJGBDDV-UHFFFAOYSA-N 2-cyano-n-ethylacetamide Chemical compound CCNC(=O)CC#N VARXTXAOJGBDDV-UHFFFAOYSA-N 0.000 description 1
- DOZZSWAOPDYVLH-UHFFFAOYSA-N 2-phenylpropanamide Chemical compound NC(=O)C(C)C1=CC=CC=C1 DOZZSWAOPDYVLH-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 1
- AUZPMUJGZZSMCP-UHFFFAOYSA-N 3-morpholin-4-yl-3-oxopropanenitrile Chemical compound N#CCC(=O)N1CCOCC1 AUZPMUJGZZSMCP-UHFFFAOYSA-N 0.000 description 1
- USQCUKQZXOWUDF-YWZLYKJASA-N 6-chloro-n-[(3s)-1-[(2s)-1-(4-methyl-5-oxo-1,4-diazepan-1-yl)-1-oxopropan-2-yl]-2-oxopyrrolidin-3-yl]naphthalene-2-sulfonamide Chemical compound O=C([C@@H](N1C([C@@H](NS(=O)(=O)C=2C=C3C=CC(Cl)=CC3=CC=2)CC1)=O)C)N1CCN(C)C(=O)CC1 USQCUKQZXOWUDF-YWZLYKJASA-N 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- ZTHYODDOHIVTJV-UHFFFAOYSA-N Propyl gallate Chemical compound CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 ZTHYODDOHIVTJV-UHFFFAOYSA-N 0.000 description 1
- 206010043087 Tachyphylaxis Diseases 0.000 description 1
- QLPJYLNMWHFQIE-UHFFFAOYSA-N [Na].CC(=O)N1CCCCC1C#N Chemical compound [Na].CC(=O)N1CCCCC1C#N QLPJYLNMWHFQIE-UHFFFAOYSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000001785 acacia senegal l. willd gum Substances 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000001949 anaesthesia Methods 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229940127088 antihypertensive drug Drugs 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 210000001168 carotid artery common Anatomy 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- DGJMPUGMZIKDRO-UHFFFAOYSA-N cyanoacetamide Chemical compound NC(=O)CC#N DGJMPUGMZIKDRO-UHFFFAOYSA-N 0.000 description 1
- 238000002224 dissection Methods 0.000 description 1
- 238000001647 drug administration Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000003304 gavage Methods 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- WXKAZJLVVMZFBX-UHFFFAOYSA-N n-ethyl-2-methylsulfonylacetamide;sodium Chemical compound [Na].CCNC(=O)CS(C)(=O)=O WXKAZJLVVMZFBX-UHFFFAOYSA-N 0.000 description 1
- ABMDIECEEGFXNC-UHFFFAOYSA-N n-ethylpropanamide Chemical compound CCNC(=O)CC ABMDIECEEGFXNC-UHFFFAOYSA-N 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 230000002980 postoperative effect Effects 0.000 description 1
- 238000011699 spontaneously hypertensive rat Methods 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 210000003437 trachea Anatomy 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Cardiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Heart & Thoracic Surgery (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Saccharide Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7836080 | 1978-09-08 | ||
| GB36080/78 | 1978-09-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1128502A true CA1128502A (en) | 1982-07-27 |
Family
ID=10499526
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA335,276A Expired CA1128502A (en) | 1978-09-08 | 1979-09-07 | Process for preparing ergot derivatives |
Country Status (17)
| Country | Link |
|---|---|
| US (2) | US4252941A (https=) |
| EP (1) | EP0008802B1 (https=) |
| JP (1) | JPS5589282A (https=) |
| AT (1) | ATE1354T1 (https=) |
| AU (1) | AU526764B2 (https=) |
| CA (1) | CA1128502A (https=) |
| CS (1) | CS208135B2 (https=) |
| DE (1) | DE2963371D1 (https=) |
| DK (1) | DK148419C (https=) |
| FI (1) | FI66613C (https=) |
| GR (1) | GR71867B (https=) |
| HU (1) | HU179450B (https=) |
| IE (1) | IE48550B1 (https=) |
| IL (1) | IL58182A (https=) |
| SU (1) | SU906377A3 (https=) |
| YU (1) | YU41347B (https=) |
| ZA (1) | ZA794682B (https=) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU526764B2 (en) * | 1978-09-08 | 1983-01-27 | Farmitalia Carlo Erba S.P.A. | Ergoline derivatives |
| DE3020895A1 (de) * | 1979-06-12 | 1980-12-18 | Sandoz Ag | Ergopeptinderivate, verfahren zu deren herstellung sowie diese ergopeptinderivate enthaltende pharmazeutischen zusammensetzungen |
| GB2120242A (en) * | 1982-04-30 | 1983-11-30 | Erba Farmitalia | Ergoline derivatives |
| GB8318790D0 (en) * | 1983-07-12 | 1983-08-10 | Erba Farmitalia | Anorexigenic ergot derivatives |
| GB8501078D0 (en) * | 1985-01-16 | 1985-02-20 | Erba Farmitalia | Piperazin-1-yl-ergo-line derivatives |
| GB2173189B (en) * | 1985-02-21 | 1988-04-27 | Maruko Pharmaceutical Co | Ergoline derivatives and salts thereof and pharmaceutical compositions thereof |
| US4801712A (en) * | 1985-06-24 | 1989-01-31 | Eli Lilly And Company | 2-Alkyl(or phenyl)thio-6-n-alkylergolines are dopamine D-1 antagonists without D-2 agonist activity |
| US4704396A (en) * | 1985-12-20 | 1987-11-03 | Eli Lilly And Company | Phenacyl esters of 1-substituted-6-(substituted and unsubstituted) dihydrolysergic acids useful as 5HT receptor antagonists |
| JPH04106090U (ja) * | 1991-02-27 | 1992-09-11 | 河西工業株式会社 | エンジンルーム用インシユレータ |
| EP4155306A1 (en) | 2021-01-15 | 2023-03-29 | Beckley Psytech Limited | Neuroactive ergoline analogue |
| US12534441B2 (en) | 2021-01-15 | 2026-01-27 | Beckley Psytech Limited | Tryptamine analogues |
| US11312684B1 (en) | 2021-02-10 | 2022-04-26 | Eleusis Therapeutics Us, Inc. | Pharmaceutically acceptable salts of psilocin and uses thereof |
| US12264131B2 (en) | 2022-08-19 | 2025-04-01 | Beckley Psytech Limited | Pharmaceutically acceptable salts and compositions thereof |
| US12246005B2 (en) | 2023-06-13 | 2025-03-11 | Beckley Psytech Limited | 5-methoxy-n,n-dimethyltryptamine (5-MeO-DMT) formulations |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR206772A1 (es) * | 1972-07-21 | 1976-08-23 | Lilly Co Eli | Procedimiento para preparar una nueva d-2-halo-6-metil-8-ciano(carboxamido)metil ergolina |
| CH605936A5 (en) * | 1974-07-19 | 1978-10-13 | Sandoz Ag | 8-Alpha-(Amino-or cyanomethyl)-ergoline derivs |
| CS177530B1 (en) * | 1974-07-19 | 1977-07-29 | Miroslav Semonsky | New nbeta-substituted derivatives of b-beta-aminoethyl-ergoline-i their salts and methods for the production thereof |
| US3985752A (en) * | 1974-12-06 | 1976-10-12 | Eli Lilly And Company | 6-Methyl-8-(substituted) methylergolines |
| GB1513322A (en) * | 1976-01-09 | 1978-06-07 | Farmaceutici Italia | Heterocyclic ergoline derivatives |
| GB1555751A (en) * | 1977-02-02 | 1979-11-14 | Farmaceutici Italia | Ergoline deritatives |
| AU526764B2 (en) * | 1978-09-08 | 1983-01-27 | Farmitalia Carlo Erba S.P.A. | Ergoline derivatives |
-
1979
- 1979-09-03 AU AU50455/79A patent/AU526764B2/en not_active Ceased
- 1979-09-04 US US06/072,289 patent/US4252941A/en not_active Expired - Lifetime
- 1979-09-04 GR GR59959A patent/GR71867B/el unknown
- 1979-09-05 ZA ZA00794682A patent/ZA794682B/xx unknown
- 1979-09-05 IL IL58182A patent/IL58182A/xx unknown
- 1979-09-06 SU SU792807706A patent/SU906377A3/ru active
- 1979-09-06 HU HU79EA197A patent/HU179450B/hu not_active IP Right Cessation
- 1979-09-07 JP JP11436879A patent/JPS5589282A/ja active Granted
- 1979-09-07 AT AT79103357T patent/ATE1354T1/de not_active IP Right Cessation
- 1979-09-07 DE DE7979103357T patent/DE2963371D1/de not_active Expired
- 1979-09-07 CA CA335,276A patent/CA1128502A/en not_active Expired
- 1979-09-07 IE IE1705/79A patent/IE48550B1/en unknown
- 1979-09-07 FI FI792776A patent/FI66613C/fi not_active IP Right Cessation
- 1979-09-07 CS CS796080A patent/CS208135B2/cs unknown
- 1979-09-07 YU YU2174/79A patent/YU41347B/xx unknown
- 1979-09-07 EP EP79103357A patent/EP0008802B1/en not_active Expired
- 1979-09-07 DK DK375279A patent/DK148419C/da not_active IP Right Cessation
-
1980
- 1980-09-19 US US06/188,620 patent/US4321381A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FI66613C (fi) | 1984-11-12 |
| FI792776A7 (fi) | 1980-03-09 |
| SU906377A3 (ru) | 1982-02-15 |
| EP0008802B1 (en) | 1982-07-21 |
| AU526764B2 (en) | 1983-01-27 |
| CS208135B2 (en) | 1981-08-31 |
| GR71867B (https=) | 1983-07-07 |
| EP0008802A1 (en) | 1980-03-19 |
| JPS5589282A (en) | 1980-07-05 |
| AU5045579A (en) | 1980-03-13 |
| HU179450B (en) | 1982-10-28 |
| FI66613B (fi) | 1984-07-31 |
| YU217479A (en) | 1983-02-28 |
| US4321381A (en) | 1982-03-23 |
| DK375279A (da) | 1980-03-09 |
| ATE1354T1 (de) | 1982-08-15 |
| ZA794682B (en) | 1980-11-26 |
| YU41347B (en) | 1987-02-28 |
| IE48550B1 (en) | 1985-03-06 |
| DK148419C (da) | 1985-12-09 |
| DK148419B (da) | 1985-07-01 |
| IL58182A (en) | 1983-07-31 |
| US4252941A (en) | 1981-02-24 |
| IE791705L (en) | 1980-03-08 |
| JPS6221792B2 (https=) | 1987-05-14 |
| DE2963371D1 (en) | 1982-09-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1128502A (en) | Process for preparing ergot derivatives | |
| SU1584750A3 (ru) | Способ получени производных 3(2Н)-пиридазинона | |
| US3995039A (en) | Pyrazolo [1,5-a] [1,3,5] triazines | |
| SU1436872A3 (ru) | Способ получени производных пиримидина | |
| RU2094430C1 (ru) | Акрилоилзамещенные производные пиррола и их фармацевтически приемлемые кислотно-аддитивные соли, фармацевтическая композиция на их основе и способ их получения | |
| CA1304379C (en) | Dihydropyridine-5-phosphonic acid cyclic propylene ester | |
| EP0178189B1 (en) | Pyridazinone derivatives, their preparation and use | |
| US4271164A (en) | 6-Substituted-arylpyrido[2,3-d]pyrimidin-7-amines and derivatives | |
| CA1056823A (en) | Nucleoside compounds | |
| US4224322A (en) | 3-Amino-4-phenyl-6-thiomorpholino-1H-pyrazolo-[3,4-b]pyridines and salts thereof | |
| KR860001865B1 (ko) | 2'-데옥시-5-치환 우리딘 유도체의 제조방법 | |
| SU1342416A3 (ru) | Способ получени производных пиридазинона или их водорастворимых солей с фармацевтически приемлемой кислотой | |
| US3824271A (en) | 3-alkyl-3-(benzoyl)propionitriles | |
| CA1156656A (en) | Process for the preparation of pyrimidyl-chinazolines | |
| US4530842A (en) | 2(1H)-pyridinone derivatives, their preparation and pharmaceutical compositions containing them | |
| CA1228069A (en) | 6-(4-aminophenyl)3-(2h) pyridazinone compounds | |
| DK169818B1 (da) | Ergolinderivater, fremgangsmåde til fremstilling deraf, samt farmaceutisk præparat indeholdende disse | |
| KR0139201B1 (ko) | 아미노벤젠술폰산 유도체 | |
| KR860000103B1 (ko) | 3'-치환-5'-(2-아미노-4-피리딜)-1', 2', 4'-트리아졸류의 제조 방법 | |
| EP0124208B1 (en) | Quinoline derivatives | |
| US4136190A (en) | 4,4-dimethyl-3,5-pyrrolidinediones | |
| EP0179428A2 (en) | Indoleacetic acid derivative and a pharmaceutical preparation | |
| US4801588A (en) | Tetracyclic indole derivatives for treating hypertension | |
| EP0131301A2 (en) | Anorexigenic ergot derivatives | |
| JP2875605B2 (ja) | 3―エキソメチレンピロロ[2,1―b]チアゾール誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |