CA1124711A - Process for the preparation of steroids - Google Patents
Process for the preparation of steroidsInfo
- Publication number
- CA1124711A CA1124711A CA340,967A CA340967A CA1124711A CA 1124711 A CA1124711 A CA 1124711A CA 340967 A CA340967 A CA 340967A CA 1124711 A CA1124711 A CA 1124711A
- Authority
- CA
- Canada
- Prior art keywords
- process according
- formula
- solution
- hydrogen
- moles
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 16
- 238000002360 preparation method Methods 0.000 title claims abstract description 10
- 150000003431 steroids Chemical class 0.000 title claims abstract description 9
- 239000000725 suspension Substances 0.000 claims abstract description 11
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 57
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 44
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 16
- 239000003795 chemical substances by application Substances 0.000 claims description 16
- 125000005270 trialkylamine group Chemical group 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 claims description 10
- 239000011230 binding agent Substances 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 238000003756 stirring Methods 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 150000001340 alkali metals Chemical class 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 239000000460 chlorine Chemical group 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- 238000002955 isolation Methods 0.000 claims description 5
- 238000007864 suspending Methods 0.000 claims description 5
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 239000012429 reaction media Substances 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052731 fluorine Chemical group 0.000 claims description 3
- 239000011737 fluorine Chemical group 0.000 claims description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 3
- 229930195734 saturated hydrocarbon Natural products 0.000 claims description 3
- 125000002345 steroid group Chemical group 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 abstract description 9
- 238000003786 synthesis reaction Methods 0.000 abstract description 9
- 239000000543 intermediate Substances 0.000 abstract 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 abstract 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 239000000047 product Substances 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- -1 ethoxyphenyl Chemical group 0.000 description 8
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 230000014509 gene expression Effects 0.000 description 5
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 150000007970 thio esters Chemical class 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical group CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- JHSXHKMJBWOMRU-UHFFFAOYSA-N 2,2-dimethylpropanethioic s-acid Chemical compound CC(C)(C)C(S)=O JHSXHKMJBWOMRU-UHFFFAOYSA-N 0.000 description 2
- RJKFOVLPORLFTN-LEKSSAKUSA-N Progesterone Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)C)[C@@]1(C)CC2 RJKFOVLPORLFTN-LEKSSAKUSA-N 0.000 description 2
- 159000000032 aromatic acids Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- SYVFBJQHOGXAMY-XUCMERPOSA-N (8s,9s,10r,13s,14s,17s)-10,13-dimethyl-17-propanoyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)CC)[C@@]1(C)CC2 SYVFBJQHOGXAMY-XUCMERPOSA-N 0.000 description 1
- YJESALUAHUVISI-UHFFFAOYSA-N 3,5-dimethylhexan-2-one Chemical compound CC(C)CC(C)C(C)=O YJESALUAHUVISI-UHFFFAOYSA-N 0.000 description 1
- LBVWMBBKFFQMRX-UHFFFAOYSA-N 4-chlorobenzenecarbothioic s-acid Chemical class SC(=O)C1=CC=C(Cl)C=C1 LBVWMBBKFFQMRX-UHFFFAOYSA-N 0.000 description 1
- PEQZEAWOMNXGCD-UHFFFAOYSA-N 4-fluorobenzenecarbothioic s-acid Chemical compound FC1=CC=C(C(S)=O)C=C1 PEQZEAWOMNXGCD-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- QIEPWCSVQYUPIY-LEKSSAKUSA-N Delta(1)-progesterone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)C)[C@@]1(C)CC2 QIEPWCSVQYUPIY-LEKSSAKUSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical compound CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- QAYZSLLQFKPMNQ-UHFFFAOYSA-M [Na+].CC(C)(C)C([O-])=S Chemical compound [Na+].CC(C)(C)C([O-])=S QAYZSLLQFKPMNQ-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 1
- UIJGNTRUPZPVNG-UHFFFAOYSA-N benzenecarbothioic s-acid Chemical compound SC(=O)C1=CC=CC=C1 UIJGNTRUPZPVNG-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000006473 carboxylation reaction Methods 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- KCCRAAQDMFFCJS-UHFFFAOYSA-N decanethioic s-acid Chemical compound CCCCCCCCCC(S)=O KCCRAAQDMFFCJS-UHFFFAOYSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000012156 elution solvent Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- IZDROVVXIHRYMH-UHFFFAOYSA-N methanesulfonic anhydride Chemical compound CS(=O)(=O)OS(C)(=O)=O IZDROVVXIHRYMH-UHFFFAOYSA-N 0.000 description 1
- XZPUTNZHTQVTHG-UHFFFAOYSA-N nonanethioic s-acid Chemical compound CCCCCCCCC(O)=S XZPUTNZHTQVTHG-UHFFFAOYSA-N 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- RJKFOVLPORLFTN-UHFFFAOYSA-N progesterone acetate Natural products C1CC2=CC(=O)CCC2(C)C2C1C1CCC(C(=O)C)C1(C)CC2 RJKFOVLPORLFTN-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000003566 thiocarboxylic acids Chemical class 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07J—STEROIDS
- C07J31/00—Normal steroids containing one or more sulfur atoms not belonging to a hetero ring
- C07J31/006—Normal steroids containing one or more sulfur atoms not belonging to a hetero ring not covered by C07J31/003
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Steroid Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7833959A FR2442856A1 (fr) | 1978-12-01 | 1978-12-01 | Procede de preparation de steroides |
| FR7833959 | 1978-12-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1124711A true CA1124711A (en) | 1982-06-01 |
Family
ID=9215594
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA340,967A Expired CA1124711A (en) | 1978-12-01 | 1979-11-30 | Process for the preparation of steroids |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4269778A (enExample) |
| JP (1) | JPS5858359B2 (enExample) |
| AT (1) | AT370740B (enExample) |
| AU (1) | AU526109B2 (enExample) |
| BE (1) | BE880343A (enExample) |
| CA (1) | CA1124711A (enExample) |
| CH (1) | CH648329A5 (enExample) |
| DE (1) | DE2948142C2 (enExample) |
| DK (1) | DK160281C (enExample) |
| ES (1) | ES486325A1 (enExample) |
| FI (1) | FI67859C (enExample) |
| FR (1) | FR2442856A1 (enExample) |
| GB (1) | GB2037290B (enExample) |
| GR (1) | GR63585B (enExample) |
| HU (1) | HU180951B (enExample) |
| IL (1) | IL58778A (enExample) |
| IT (1) | IT1124356B (enExample) |
| NL (1) | NL7908634A (enExample) |
| PT (1) | PT70458A (enExample) |
| SE (1) | SE441833B (enExample) |
| YU (1) | YU40766B (enExample) |
| ZA (1) | ZA796226B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2510582B1 (fr) * | 1981-07-30 | 1986-05-30 | Sipsy | Steroides esterifies en la position 17 et thio-esterifies en la position 21, leur procede de preparation et leur application comme medicament |
| FR2529894B2 (fr) * | 1981-07-30 | 1986-07-25 | Jouveinal | Steroides esterifies en la position 17 et thio-esterifies en la position 21 et leur application comme medicament |
| FI80790C (fi) * | 1988-02-22 | 1990-07-10 | Matti Henttinen | Foerfarande och anordning foer bestaemning av ett spaors laege. |
| US5439901A (en) * | 1993-07-23 | 1995-08-08 | The Procter & Gamble Company | Cyproterone thiopivalate |
| US5344651A (en) * | 1993-07-23 | 1994-09-06 | The Procter & Gamble Company | Cyproterone acetate thioacetate |
| IES960231A2 (en) * | 1996-03-20 | 1996-07-24 | Losbanos Ltd | Manufacture of steroids |
| ES2716401T3 (es) * | 2013-09-25 | 2019-06-12 | H4 Pharma | Procedimiento de síntesis de una sal mineral del ácido piválico como producto intermedio |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1187M (fr) * | 1961-03-17 | 1962-03-19 | Roussel Uclaf | Nouveau médicament notamment pour le traitement des manifestations inflammatoires d'origine rhumatismale arthritique ou infectieuse. |
| CH566349A5 (enExample) * | 1969-12-24 | 1975-09-15 | Ciba Geigy Ag | |
| US3803133A (en) * | 1972-12-15 | 1974-04-09 | Squibb & Sons Inc | 21-sulfinyl steroids |
| FR2231374B1 (enExample) * | 1973-05-30 | 1976-10-22 | Jouveinal Sa |
-
1978
- 1978-12-01 FR FR7833959A patent/FR2442856A1/fr active Granted
-
1979
- 1979-11-15 PT PT70458A patent/PT70458A/pt unknown
- 1979-11-19 ZA ZA00796226A patent/ZA796226B/xx unknown
- 1979-11-20 US US06/096,153 patent/US4269778A/en not_active Expired - Lifetime
- 1979-11-22 AU AU53116/79A patent/AU526109B2/en not_active Expired
- 1979-11-22 GR GR60575A patent/GR63585B/el unknown
- 1979-11-22 IL IL58778A patent/IL58778A/xx unknown
- 1979-11-23 FI FI793683A patent/FI67859C/fi not_active IP Right Cessation
- 1979-11-23 IT IT12840/79A patent/IT1124356B/it active
- 1979-11-26 ES ES486325A patent/ES486325A1/es not_active Expired
- 1979-11-27 YU YU2901/79A patent/YU40766B/xx unknown
- 1979-11-28 NL NL7908634A patent/NL7908634A/nl active Search and Examination
- 1979-11-29 DE DE2948142A patent/DE2948142C2/de not_active Expired
- 1979-11-29 BE BE6/47023A patent/BE880343A/fr not_active IP Right Cessation
- 1979-11-29 SE SE7909852A patent/SE441833B/sv not_active IP Right Cessation
- 1979-11-29 CH CH10632/79A patent/CH648329A5/fr not_active IP Right Cessation
- 1979-11-30 CA CA340,967A patent/CA1124711A/en not_active Expired
- 1979-11-30 AT AT0760479A patent/AT370740B/de not_active IP Right Cessation
- 1979-11-30 HU HU79SI1732A patent/HU180951B/hu unknown
- 1979-11-30 GB GB7941360A patent/GB2037290B/en not_active Expired
- 1979-11-30 DK DK511279A patent/DK160281C/da active
- 1979-12-01 JP JP54154995A patent/JPS5858359B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK160281B (da) | 1991-02-18 |
| FR2442856A1 (fr) | 1980-06-27 |
| GB2037290B (en) | 1983-02-09 |
| AU5311679A (en) | 1980-06-05 |
| BE880343A (fr) | 1980-05-29 |
| IT7912840A0 (it) | 1979-11-23 |
| DE2948142A1 (de) | 1980-06-04 |
| GR63585B (en) | 1979-11-23 |
| FI67859B (fi) | 1985-02-28 |
| NL7908634A (nl) | 1980-06-03 |
| YU290179A (en) | 1983-01-21 |
| GB2037290A (en) | 1980-07-09 |
| IL58778A0 (en) | 1980-02-29 |
| US4269778A (en) | 1981-05-26 |
| ZA796226B (en) | 1981-06-24 |
| DK160281C (da) | 1991-07-29 |
| DK511279A (da) | 1980-06-02 |
| JPS5579399A (en) | 1980-06-14 |
| ES486325A1 (es) | 1980-06-16 |
| FI793683A7 (fi) | 1980-06-02 |
| AT370740B (de) | 1983-04-25 |
| YU40766B (en) | 1986-06-30 |
| SE441833B (sv) | 1985-11-11 |
| CH648329A5 (fr) | 1985-03-15 |
| ATA760479A (de) | 1982-09-15 |
| IL58778A (en) | 1982-11-30 |
| AU526109B2 (en) | 1982-12-16 |
| PT70458A (fr) | 1979-12-01 |
| FR2442856B1 (enExample) | 1981-05-22 |
| IT1124356B (it) | 1986-05-07 |
| HU180951B (en) | 1983-05-30 |
| SE7909852L (sv) | 1980-06-02 |
| FI67859C (fi) | 1985-06-10 |
| DE2948142C2 (de) | 1982-06-24 |
| JPS5858359B2 (ja) | 1983-12-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP6511346B2 (ja) | ハロゲン化環式化合物の合成方法 | |
| CA1124711A (en) | Process for the preparation of steroids | |
| SU679146A3 (ru) | Способ получени производных фузидиновой кислоты или их солей | |
| RS51551B (sr) | Sinteza estara tiofenkarboksilne kiseline za proizvodnju soli ranelinske kiseline | |
| GB2094794A (en) | Processes for preparing 2- substituted hydroxyimino-2-(5- amino-1,2,4-thiadiazol-3-yl)acetic acid or its salt, and intermediates thereof | |
| EP0036636B1 (en) | A method and intermediates for preparing 3,3'-azo-bis-(6-hydroxy benzoic acid) | |
| JP2688712B2 (ja) | ハロゲン置換キノリン誘導体の製造法 | |
| JP2016084348A (ja) | ジフルオロアルキルベンゼン誘導体およびその製造方法 | |
| US6462195B1 (en) | Methods for highly selectively o-alkylating amide compounds with the use of copper salts | |
| EP0990651B1 (en) | Process for producing 5-trifluoromethyluracil derivatives | |
| US5550237A (en) | Process for the preparation of carboxyarenesulfonic acids and their carboxylic acid derivatives | |
| US4650902A (en) | 2-ketosulfonamides and process for their preparation | |
| US20230322671A1 (en) | Pyrrolinone compound and method for preparing the same | |
| KR830002060B1 (ko) | 스테로이드의 제조방법 | |
| GB1579192A (en) | Thiophen compounds and their manfacture | |
| HU196582B (en) | Process for separating racem mixtures of optically active alpha-naphthyl-propionic acids | |
| EP0424921B1 (en) | Process for preparing 21-desoxyprednisolone 17-esters | |
| PL111162B1 (en) | Method of producing s-triethylophosphinogold 2,3,4,6-tetra-o-acetylo-beta-d-glycopyranosylothiol-1-ane | |
| US4368328A (en) | Process for preparing alkylthiobenzimidazoles | |
| US5643438A (en) | Process for the preparation of substituted diamino-dicarboxylic acid derivatives | |
| SI7912901A8 (sl) | Postopek za pridobivanje derivatov 17-hidroksi-4-pregnena visoke čistoče | |
| US7351836B2 (en) | Method of preparing 4-(imidazol-1-yl)benzenesulphonamide derivatives | |
| EP0162404B1 (en) | Process for preparing 2-alkyl-5-haloacetylbenzenesulfonamide | |
| PL197892B1 (pl) | Sposób wytwarzania pochodnych kwasu tiobarbiturowego | |
| JPH08208594A (ja) | 塩化メチルを用いてアリールスルフィン酸をメチル化することによるメチルスルホニル芳香族化合物の製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |