CA1123340A - Opaque toothpaste from sodium aluminosilicate and water - Google Patents
Opaque toothpaste from sodium aluminosilicate and waterInfo
- Publication number
- CA1123340A CA1123340A CA328,250A CA328250A CA1123340A CA 1123340 A CA1123340 A CA 1123340A CA 328250 A CA328250 A CA 328250A CA 1123340 A CA1123340 A CA 1123340A
- Authority
- CA
- Canada
- Prior art keywords
- toothpaste
- abrasive
- weight
- sodium
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000606 toothpaste Substances 0.000 title claims abstract description 46
- 229940034610 toothpaste Drugs 0.000 title claims abstract description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title claims abstract description 10
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 title claims abstract description 9
- 229910000503 Na-aluminosilicate Inorganic materials 0.000 title claims abstract description 8
- 239000000429 sodium aluminium silicate Substances 0.000 title claims abstract description 8
- 235000012217 sodium aluminium silicate Nutrition 0.000 title claims abstract description 8
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 claims abstract description 4
- 235000019739 Dicalciumphosphate Nutrition 0.000 claims abstract description 3
- 239000001506 calcium phosphate Substances 0.000 claims abstract description 3
- 229940038472 dicalcium phosphate Drugs 0.000 claims abstract description 3
- 229910000390 dicalcium phosphate Inorganic materials 0.000 claims abstract description 3
- 239000003082 abrasive agent Substances 0.000 claims description 10
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 5
- 239000003906 humectant Substances 0.000 claims description 3
- 150000004684 trihydrates Chemical class 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 2
- AQMNWCRSESPIJM-UHFFFAOYSA-M sodium metaphosphate Chemical compound [Na+].[O-]P(=O)=O AQMNWCRSESPIJM-UHFFFAOYSA-M 0.000 claims description 2
- 239000000203 mixture Substances 0.000 abstract description 11
- 239000003795 chemical substances by application Substances 0.000 abstract description 3
- 238000005498 polishing Methods 0.000 abstract description 3
- 230000003247 decreasing effect Effects 0.000 abstract 1
- 239000000463 material Substances 0.000 description 16
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 14
- -1 alkyl sulphoacetates Chemical class 0.000 description 10
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 7
- 235000011187 glycerol Nutrition 0.000 description 7
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 6
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 6
- 239000000600 sorbitol Substances 0.000 description 6
- 235000010356 sorbitol Nutrition 0.000 description 6
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 239000000470 constituent Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 229910000632 Alusil Inorganic materials 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 4
- 239000002253 acid Substances 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 210000003298 dental enamel Anatomy 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 239000000796 flavoring agent Substances 0.000 description 3
- 235000019634 flavors Nutrition 0.000 description 3
- 229940091249 fluoride supplement Drugs 0.000 description 3
- 239000003349 gelling agent Substances 0.000 description 3
- 235000013772 propylene glycol Nutrition 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- XGRSAFKZAGGXJV-UHFFFAOYSA-N 3-azaniumyl-3-cyclohexylpropanoate Chemical compound OC(=O)CC(N)C1CCCCC1 XGRSAFKZAGGXJV-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- 239000005696 Diammonium phosphate Substances 0.000 description 2
- 239000004150 EU approved colour Substances 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 2
- BACYUWVYYTXETD-UHFFFAOYSA-N N-Lauroylsarcosine Chemical compound CCCCCCCCCCCC(=O)N(C)CC(O)=O BACYUWVYYTXETD-UHFFFAOYSA-N 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 239000004141 Sodium laurylsulphate Substances 0.000 description 2
- 239000011149 active material Substances 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 239000004411 aluminium Substances 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- ATNHDLDRLWWWCB-AENOIHSZSA-M chlorophyll a Chemical class C1([C@@H](C(=O)OC)C(=O)C2=C3C)=C2N2C3=CC(C(CC)=C3C)=[N+]4C3=CC3=C(C=C)C(C)=C5N3[Mg-2]42[N+]2=C1[C@@H](CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C)C2=C5 ATNHDLDRLWWWCB-AENOIHSZSA-M 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 210000004268 dentin Anatomy 0.000 description 2
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 2
- 229910000388 diammonium phosphate Inorganic materials 0.000 description 2
- 235000019838 diammonium phosphate Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 210000000214 mouth Anatomy 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 229960004063 propylene glycol Drugs 0.000 description 2
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 229960004711 sodium monofluorophosphate Drugs 0.000 description 2
- YUOWTJMRMWQJDA-UHFFFAOYSA-J tin(iv) fluoride Chemical compound [F-].[F-].[F-].[F-].[Sn+4] YUOWTJMRMWQJDA-UHFFFAOYSA-J 0.000 description 2
- BHHYHSUAOQUXJK-UHFFFAOYSA-L zinc fluoride Chemical compound F[Zn]F BHHYHSUAOQUXJK-UHFFFAOYSA-L 0.000 description 2
- LDVVTQMJQSCDMK-UHFFFAOYSA-N 1,3-dihydroxypropan-2-yl formate Chemical compound OCC(CO)OC=O LDVVTQMJQSCDMK-UHFFFAOYSA-N 0.000 description 1
- MBEVSMZJMIQVBG-UHFFFAOYSA-N 2-(hydroxymethyl)guanidine Chemical compound NC(N)=NCO MBEVSMZJMIQVBG-UHFFFAOYSA-N 0.000 description 1
- LFJJOPDNPVFCNZ-UHFFFAOYSA-N 2-[hexadecanoyl(methyl)amino]acetic acid Chemical class CCCCCCCCCCCCCCCC(=O)N(C)CC(O)=O LFJJOPDNPVFCNZ-UHFFFAOYSA-N 0.000 description 1
- NGOZDSMNMIRDFP-UHFFFAOYSA-N 2-[methyl(tetradecanoyl)amino]acetic acid Chemical class CCCCCCCCCCCCCC(=O)N(C)CC(O)=O NGOZDSMNMIRDFP-UHFFFAOYSA-N 0.000 description 1
- UBLAMKHIFZBBSS-UHFFFAOYSA-N 3-Methylbutyl pentanoate Chemical compound CCCCC(=O)OCCC(C)C UBLAMKHIFZBBSS-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241000206575 Chondrus crispus Species 0.000 description 1
- 229910021593 Copper(I) fluoride Inorganic materials 0.000 description 1
- 229910021594 Copper(II) fluoride Inorganic materials 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- XSTPMJAEGUYMCA-UHFFFAOYSA-M [F-].[K+].[F-].[NH4+] Chemical compound [F-].[K+].[F-].[NH4+] XSTPMJAEGUYMCA-UHFFFAOYSA-M 0.000 description 1
- HFIGWKOFZLNOQK-UHFFFAOYSA-K [O-]P([O-])(=O)OP(=O)([O-])O.[Ca+2].[Na+] Chemical class [O-]P([O-])(=O)OP(=O)([O-])O.[Ca+2].[Na+] HFIGWKOFZLNOQK-UHFFFAOYSA-K 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- OYLGJCQECKOTOL-UHFFFAOYSA-L barium fluoride Chemical compound [F-].[F-].[Ba+2] OYLGJCQECKOTOL-UHFFFAOYSA-L 0.000 description 1
- 229910001632 barium fluoride Inorganic materials 0.000 description 1
- UREZNYTWGJKWBI-UHFFFAOYSA-M benzethonium chloride Chemical compound [Cl-].C1=CC(C(C)(C)CC(C)(C)C)=CC=C1OCCOCC[N+](C)(C)CC1=CC=CC=C1 UREZNYTWGJKWBI-UHFFFAOYSA-M 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000001609 comparable effect Effects 0.000 description 1
- GWFAVIIMQDUCRA-UHFFFAOYSA-L copper(ii) fluoride Chemical compound [F-].[F-].[Cu+2] GWFAVIIMQDUCRA-UHFFFAOYSA-L 0.000 description 1
- 239000000551 dentifrice Substances 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- JYIMWRSJCRRYNK-UHFFFAOYSA-N dialuminum;disodium;oxygen(2-);silicon(4+);hydrate Chemical compound O.[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[Na+].[Na+].[Al+3].[Al+3].[Si+4] JYIMWRSJCRRYNK-UHFFFAOYSA-N 0.000 description 1
- DGTVXEHQMSJRPE-UHFFFAOYSA-M difluorophosphinate Chemical compound [O-]P(F)(F)=O DGTVXEHQMSJRPE-UHFFFAOYSA-M 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 150000004673 fluoride salts Chemical class 0.000 description 1
- OMRRUNXAWXNVFW-UHFFFAOYSA-N fluoridochlorine Chemical compound ClF OMRRUNXAWXNVFW-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 229910001385 heavy metal Chemical class 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 229910001506 inorganic fluoride Inorganic materials 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000006353 oxyethylene group Chemical group 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical class C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 1
- 108700004121 sarkosyl Proteins 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- HFQQZARZPUDIFP-UHFFFAOYSA-M sodium;2-dodecylbenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O HFQQZARZPUDIFP-UHFFFAOYSA-M 0.000 description 1
- 239000001587 sorbitan monostearate Substances 0.000 description 1
- 235000011076 sorbitan monostearate Nutrition 0.000 description 1
- 229940035048 sorbitan monostearate Drugs 0.000 description 1
- ANOBYBYXJXCGBS-UHFFFAOYSA-L stannous fluoride Chemical compound F[Sn]F ANOBYBYXJXCGBS-UHFFFAOYSA-L 0.000 description 1
- 229960002799 stannous fluoride Drugs 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- SFVFIFLLYFPGHH-UHFFFAOYSA-M stearalkonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 SFVFIFLLYFPGHH-UHFFFAOYSA-M 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q11/00—Preparations for care of the teeth, of the oral cavity or of dentures; Dentifrices, e.g. toothpastes; Mouth rinses
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/19—Cosmetics or similar toiletry preparations characterised by the composition containing inorganic ingredients
- A61K8/26—Aluminium; Compounds thereof
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Oral & Maxillofacial Surgery (AREA)
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB24226/78 | 1978-05-30 | ||
| GB24226/78A GB1587980A (en) | 1978-05-30 | 1978-05-30 | Dentifrices |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1123340A true CA1123340A (en) | 1982-05-11 |
Family
ID=10208384
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA328,250A Expired CA1123340A (en) | 1978-05-30 | 1979-05-24 | Opaque toothpaste from sodium aluminosilicate and water |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4264579A (Direct) |
| JP (1) | JPS54157844A (Direct) |
| AT (1) | AT375015B (Direct) |
| AU (1) | AU523150B2 (Direct) |
| BE (1) | BE876612A (Direct) |
| CA (1) | CA1123340A (Direct) |
| CH (1) | CH641040A5 (Direct) |
| DE (1) | DE2918133C2 (Direct) |
| DK (1) | DK155818C (Direct) |
| FR (1) | FR2427093B1 (Direct) |
| GB (1) | GB1587980A (Direct) |
| IT (1) | IT1116875B (Direct) |
| MX (1) | MX152644A (Direct) |
| MY (1) | MY8300067A (Direct) |
| NL (1) | NL7903744A (Direct) |
| NZ (1) | NZ190241A (Direct) |
| PH (1) | PH18249A (Direct) |
| SE (1) | SE442586C (Direct) |
| ZA (1) | ZA791806B (Direct) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4425324A (en) | 1981-05-11 | 1984-01-10 | Colgate-Palmolive Company | Hazed toothpaste |
| US4356168A (en) * | 1981-05-11 | 1982-10-26 | Colgate-Palmolive Company | Opacified dental cream containing a binary fluorine-providing system |
| GB2109682B (en) * | 1981-11-19 | 1985-09-11 | Colgate Palmolive Co | Stable dentifrice |
| GB2109683B (en) * | 1981-11-19 | 1985-09-11 | Colgate Palmolive Co | Stable dentifrice |
| BR9508661A (pt) * | 1994-08-31 | 1997-12-23 | Huber Corp J M | Composições dentárias de custo efetivo contendo novos aluminosilicatos de sódio |
| US6342205B1 (en) * | 1999-10-29 | 2002-01-29 | J. M. Huber Corporation | High water content dentifrice composition and method of making the same |
| RU2153322C1 (ru) * | 1999-12-22 | 2000-07-27 | Общество с ограниченной ответственностью Институт фармацевтических реактивов "Рефарм" | Зубная паста |
| US6174515B1 (en) | 2000-06-05 | 2001-01-16 | Amway Corporation | Toothpaste composition |
| GB0400408D0 (en) * | 2004-01-09 | 2004-02-11 | Ineos Silicas Ltd | Dentifrice compositions containing zeolites |
| RU2681220C2 (ru) * | 2013-12-23 | 2019-03-05 | Колгейт-Палмолив Компани | Композиции для ухода за полостью рта со сниженным окрашиванием поверхности |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2107827B1 (Direct) * | 1970-09-21 | 1976-06-04 | Colgate Palmolive Co | |
| ZA722246B (en) * | 1971-04-30 | 1973-11-28 | Colgate Palmolive Co | Clear dentifrice |
| BE789477A (fr) * | 1971-10-01 | 1973-01-15 | Colgate Palmolive Co | Procede de fabrication de dentifrices exempts de gaz |
| US3946108A (en) * | 1971-11-26 | 1976-03-23 | Colgate-Palmolive Company | Dentifrice |
| US3929987A (en) * | 1972-07-03 | 1975-12-30 | Colgate Palmolive Co | Toothpaste |
| US3935304A (en) * | 1972-10-04 | 1976-01-27 | Colgate-Palmolive Company | Dental creams |
| US3935305A (en) * | 1972-10-04 | 1976-01-27 | Colgate-Palmolive Company | Toothpaste |
| US3944661A (en) * | 1972-12-29 | 1976-03-16 | Colgate-Palmolive Company | Dentifrices containing iridescent flakes |
| US4020154A (en) * | 1973-01-22 | 1977-04-26 | Colgate-Palmolive Company | Manufacture of gas-free dentifrice |
| US4069311A (en) * | 1974-11-04 | 1978-01-17 | Colgate Palmolive Company | Oral dentifrice containing uniform particles of speckling material |
| US4144322A (en) * | 1975-01-28 | 1979-03-13 | Colgate Palmolive Company | Reduction of abrasiveness in dentrifices |
| US4060599A (en) * | 1975-03-25 | 1977-11-29 | Colgate-Palmolive Company | Dentifrices |
| GB1476063A (en) * | 1976-01-26 | 1977-06-10 | Boots Co Ltd | Dentifrice |
| US4130636A (en) * | 1977-07-27 | 1978-12-19 | Colgate-Palmolive Company | Dentifrice |
| DE2757290A1 (de) * | 1977-12-22 | 1979-07-05 | Blendax Werke Schneider Co | Zahnpasta |
-
1978
- 1978-05-30 GB GB24226/78A patent/GB1587980A/en not_active Expired
-
1979
- 1979-04-17 ZA ZA791806A patent/ZA791806B/xx unknown
- 1979-04-20 NZ NZ190241A patent/NZ190241A/xx unknown
- 1979-05-01 AU AU46622/79A patent/AU523150B2/en not_active Ceased
- 1979-05-05 DE DE2918133A patent/DE2918133C2/de not_active Expired
- 1979-05-09 MX MX177586A patent/MX152644A/es unknown
- 1979-05-10 AT AT0347179A patent/AT375015B/de not_active IP Right Cessation
- 1979-05-11 NL NL7903744A patent/NL7903744A/xx not_active Application Discontinuation
- 1979-05-15 SE SE7904250A patent/SE442586C/sv not_active IP Right Cessation
- 1979-05-21 IT IT49107/79A patent/IT1116875B/it active
- 1979-05-24 PH PH22560A patent/PH18249A/en unknown
- 1979-05-24 CA CA328,250A patent/CA1123340A/en not_active Expired
- 1979-05-29 JP JP6670379A patent/JPS54157844A/ja active Granted
- 1979-05-29 FR FR7913641A patent/FR2427093B1/fr not_active Expired
- 1979-05-29 CH CH501579A patent/CH641040A5/de not_active IP Right Cessation
- 1979-05-29 DK DK220379A patent/DK155818C/da not_active IP Right Cessation
- 1979-05-29 BE BE0/195451A patent/BE876612A/xx not_active IP Right Cessation
- 1979-12-17 US US06/104,492 patent/US4264579A/en not_active Expired - Lifetime
-
1983
- 1983-12-30 MY MY67/83A patent/MY8300067A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2427093A1 (fr) | 1979-12-28 |
| ATA347179A (de) | 1982-07-15 |
| NZ190241A (en) | 1981-02-11 |
| PH18249A (en) | 1985-05-03 |
| JPS54157844A (en) | 1979-12-13 |
| MX152644A (es) | 1985-10-04 |
| SE442586C (sv) | 1987-11-16 |
| DK155818C (da) | 1989-10-02 |
| CH641040A5 (de) | 1984-02-15 |
| NL7903744A (nl) | 1979-12-04 |
| US4264579A (en) | 1981-04-28 |
| DK220379A (da) | 1979-12-01 |
| DE2918133A1 (de) | 1979-12-13 |
| ZA791806B (en) | 1980-11-26 |
| AU523150B2 (en) | 1982-07-15 |
| GB1587980A (en) | 1981-04-15 |
| SE7904250L (sv) | 1979-12-01 |
| BE876612A (fr) | 1979-09-17 |
| JPS635370B2 (Direct) | 1988-02-03 |
| DK155818B (da) | 1989-05-22 |
| IT1116875B (it) | 1986-02-10 |
| FR2427093B1 (fr) | 1985-08-30 |
| IT7949107A0 (it) | 1979-05-21 |
| AT375015B (de) | 1984-06-25 |
| DE2918133C2 (de) | 1982-12-02 |
| AU4662279A (en) | 1980-03-20 |
| MY8300067A (en) | 1983-12-31 |
| SE442586B (sv) | 1986-01-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0344701B1 (en) | Oral compositions | |
| US4141969A (en) | Dentifrices containing amorphous silica | |
| JP3285452B2 (ja) | 歯磨組成物 | |
| US3970747A (en) | Humectant sweetener | |
| CA1123340A (en) | Opaque toothpaste from sodium aluminosilicate and water | |
| EP0518608B1 (en) | Taste preserving, mild oral hygiene compositions | |
| US3932604A (en) | Humectant sweetener | |
| AU603600B2 (en) | Stable antiplaque dentifrice based on hexetidine, zinc ion and fluoride | |
| GB2142536A (en) | Dentifrices containing maltitol as humectant | |
| US4412983A (en) | Dentifrices containing amorphous silica | |
| CA1147265A (en) | Toothpaste | |
| US4307076A (en) | Toothpaste compositions | |
| GB1587608A (en) | Dentifrices | |
| EP0417833A1 (en) | Dentifrice compositions | |
| JP3503425B2 (ja) | 練歯磨組成物 | |
| JPH0832619B2 (ja) | 水性練歯みがき組成物 | |
| JP4257001B2 (ja) | 口腔用組成物 | |
| JP4257002B2 (ja) | 口腔用組成物 | |
| JP2777804B2 (ja) | 口腔用組成物 | |
| JP3482323B2 (ja) | 口腔用組成物 | |
| JPS58118506A (ja) | 口腔用組成物 | |
| JPS634802B2 (Direct) | ||
| KR0119569B1 (ko) | 치약 조성물 및 그의 제조방법 | |
| CA1187806A (en) | Visually clear dentifrice | |
| JPH08175944A (ja) | 口腔用組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |