CA1115705A - Process for producing substituted pyridines - Google Patents
Process for producing substituted pyridinesInfo
- Publication number
- CA1115705A CA1115705A CA288,852A CA288852A CA1115705A CA 1115705 A CA1115705 A CA 1115705A CA 288852 A CA288852 A CA 288852A CA 1115705 A CA1115705 A CA 1115705A
- Authority
- CA
- Canada
- Prior art keywords
- ketone
- process according
- phenyl
- ammonia
- catalyst
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 34
- 150000003222 pyridines Chemical class 0.000 title abstract description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims abstract description 54
- 239000003054 catalyst Substances 0.000 claims abstract description 28
- 229910021529 ammonia Inorganic materials 0.000 claims abstract description 27
- 150000002576 ketones Chemical class 0.000 claims abstract description 22
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 claims description 26
- 238000006243 chemical reaction Methods 0.000 claims description 26
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 20
- -1 aliphatic oxo compound Chemical class 0.000 claims description 17
- 239000007789 gas Substances 0.000 claims description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 14
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Substances CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 10
- OTKCEEWUXHVZQI-UHFFFAOYSA-N 1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(=O)CC1=CC=CC=C1 OTKCEEWUXHVZQI-UHFFFAOYSA-N 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 claims description 8
- 229910052782 aluminium Inorganic materials 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 230000000737 periodic effect Effects 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- WTYYKZLGTHPLPZ-UHFFFAOYSA-N 2-phenyl-1-pyridin-2-ylethanone Chemical compound C=1C=CC=NC=1C(=O)CC1=CC=CC=C1 WTYYKZLGTHPLPZ-UHFFFAOYSA-N 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000011261 inert gas Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- JLIDVCMBCGBIEY-UHFFFAOYSA-N 1-penten-3-one Chemical compound CCC(=O)C=C JLIDVCMBCGBIEY-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 claims description 4
- MLUCVPSAIODCQM-UHFFFAOYSA-N crotonaldehyde Natural products CC=CC=O MLUCVPSAIODCQM-UHFFFAOYSA-N 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000001072 heteroaryl group Chemical group 0.000 claims description 3
- LABTWGUMFABVFG-ONEGZZNKSA-N (3E)-pent-3-en-2-one Chemical compound C\C=C\C(C)=O LABTWGUMFABVFG-ONEGZZNKSA-N 0.000 claims description 2
- HXMVINSKZVYIDI-UHFFFAOYSA-N 2-phenyl-1-thiophen-2-ylethanone Chemical compound C=1C=CSC=1C(=O)CC1=CC=CC=C1 HXMVINSKZVYIDI-UHFFFAOYSA-N 0.000 claims description 2
- 239000005995 Aluminium silicate Substances 0.000 claims description 2
- STNJBCKSHOAVAJ-UHFFFAOYSA-N Methacrolein Chemical compound CC(=C)C=O STNJBCKSHOAVAJ-UHFFFAOYSA-N 0.000 claims description 2
- 229910000323 aluminium silicate Inorganic materials 0.000 claims description 2
- 235000012211 aluminium silicate Nutrition 0.000 claims description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims 3
- 229910052736 halogen Inorganic materials 0.000 claims 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 3
- PZZYQPZGQPZBDN-UHFFFAOYSA-N aluminium silicate Chemical compound O=[Al]O[Si](=O)O[Al]=O PZZYQPZGQPZBDN-UHFFFAOYSA-N 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 125000001544 thienyl group Chemical group 0.000 claims 1
- 125000004043 oxo group Chemical group O=* 0.000 abstract description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 abstract description 3
- 125000000468 ketone group Chemical group 0.000 abstract description 2
- YFKBXYGUSOXJGS-UHFFFAOYSA-N 1,3-Diphenyl-2-propanone Chemical compound C=1C=CC=CC=1CC(=O)CC1=CC=CC=C1 YFKBXYGUSOXJGS-UHFFFAOYSA-N 0.000 description 18
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 15
- ITQTTZVARXURQS-UHFFFAOYSA-N 3-methylpyridine Chemical compound CC1=CC=CN=C1 ITQTTZVARXURQS-UHFFFAOYSA-N 0.000 description 14
- 239000000126 substance Substances 0.000 description 12
- 238000009835 boiling Methods 0.000 description 10
- 239000000047 product Substances 0.000 description 9
- YIXJRHPUWRPCBB-UHFFFAOYSA-N magnesium nitrate Chemical compound [Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YIXJRHPUWRPCBB-UHFFFAOYSA-N 0.000 description 8
- VAXDNHLGUWFZSI-UHFFFAOYSA-N 2-benzyl-3-phenylpyridine Chemical compound N=1C=CC=C(C=2C=CC=CC=2)C=1CC1=CC=CC=C1 VAXDNHLGUWFZSI-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000006227 byproduct Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- WKAXDAMWMOBXMP-UHFFFAOYSA-N 2,3-diphenylpyridine Chemical compound C1=CC=CC=C1C1=CC=CN=C1C1=CC=CC=C1 WKAXDAMWMOBXMP-UHFFFAOYSA-N 0.000 description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- 239000004411 aluminium Substances 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- 229910052749 magnesium Inorganic materials 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- HJKGBRPNSJADMB-UHFFFAOYSA-N 3-phenylpyridine Chemical compound C1=CC=CC=C1C1=CC=CN=C1 HJKGBRPNSJADMB-UHFFFAOYSA-N 0.000 description 2
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- XROWMBWRMNHXMF-UHFFFAOYSA-J titanium tetrafluoride Chemical compound [F-].[F-].[F-].[F-].[Ti+4] XROWMBWRMNHXMF-UHFFFAOYSA-J 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- YFAXBCVQHGDMFU-UHFFFAOYSA-N 2-benzyl-4-methyl-3-phenylpyridine Chemical compound C=1C=CC=CC=1C=1C(C)=CC=NC=1CC1=CC=CC=C1 YFAXBCVQHGDMFU-UHFFFAOYSA-N 0.000 description 1
- CEPIHTOEZYEPGI-UHFFFAOYSA-N 2-benzyl-6-methyl-3-phenylpyridine Chemical compound C=1C=CC=CC=1CC1=NC(C)=CC=C1C1=CC=CC=C1 CEPIHTOEZYEPGI-UHFFFAOYSA-N 0.000 description 1
- HLGJCHJTVOMXBD-UHFFFAOYSA-N 3,3-diethoxy-n,n-dimethylprop-1-en-1-amine Chemical compound CCOC(OCC)C=CN(C)C HLGJCHJTVOMXBD-UHFFFAOYSA-N 0.000 description 1
- PQIYSSSTRHVOBW-UHFFFAOYSA-N 3-bromopropan-1-amine;hydron;bromide Chemical compound Br.NCCCBr PQIYSSSTRHVOBW-UHFFFAOYSA-N 0.000 description 1
- SLFQXPJDEWMICP-UHFFFAOYSA-N 4-methyl-2,3-diphenylpyridine Chemical compound C=1C=CC=CC=1C=1C(C)=CC=NC=1C1=CC=CC=C1 SLFQXPJDEWMICP-UHFFFAOYSA-N 0.000 description 1
- KVMUGKPUJQAEBH-UHFFFAOYSA-N 5-(dimethylamino)-1,2-diphenylpenta-2,4-dien-1-one Chemical compound C=1C=CC=CC=1C(=CC=CN(C)C)C(=O)C1=CC=CC=C1 KVMUGKPUJQAEBH-UHFFFAOYSA-N 0.000 description 1
- MEHJSVJCSMLRFK-UHFFFAOYSA-N 6-methyl-2,3-diphenylpyridine Chemical compound C=1C=CC=CC=1C1=NC(C)=CC=C1C1=CC=CC=C1 MEHJSVJCSMLRFK-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- ZTWQTBDEQSLEAF-UHFFFAOYSA-N C(=O)C=C.N Chemical compound C(=O)C=C.N ZTWQTBDEQSLEAF-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- 244000028419 Styrax benzoin Species 0.000 description 1
- 235000000126 Styrax benzoin Nutrition 0.000 description 1
- 235000008411 Sumatra benzointree Nutrition 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 150000001399 aluminium compounds Chemical class 0.000 description 1
- 229940077746 antacid containing aluminium compound Drugs 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- ZRBROGSAUIUIJE-UHFFFAOYSA-N azanium;azane;chloride Chemical compound N.[NH4+].[Cl-] ZRBROGSAUIUIJE-UHFFFAOYSA-N 0.000 description 1
- LDDQLRUQCUTJBB-UHFFFAOYSA-O azanium;hydrofluoride Chemical compound [NH4+].F LDDQLRUQCUTJBB-UHFFFAOYSA-O 0.000 description 1
- 229960002130 benzoin Drugs 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 150000004673 fluoride salts Chemical class 0.000 description 1
- 235000019382 gum benzoic Nutrition 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000003223 protective agent Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 125000004853 tetrahydropyridinyl group Chemical class N1(CCCC=C1)* 0.000 description 1
- DWCSXQCXXITVKE-UHFFFAOYSA-N triethyloxidanium Chemical compound CC[O+](CC)CC DWCSXQCXXITVKE-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/22—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom containing two or more pyridine rings directly linked together, e.g. bipyridyl
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/08—Preparation by ring-closure
- C07D213/09—Preparation by ring-closure involving the use of ammonia, amines, amine salts, or nitriles
- C07D213/12—Preparation by ring-closure involving the use of ammonia, amines, amine salts, or nitriles from unsaturated compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772712694 DE2712694A1 (de) | 1977-03-23 | 1977-03-23 | Verfahren zur herstellung substituierter pyridine |
| DEP2712694.9 | 1977-03-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1115705A true CA1115705A (en) | 1982-01-05 |
Family
ID=6004406
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA288,852A Expired CA1115705A (en) | 1977-03-23 | 1977-10-17 | Process for producing substituted pyridines |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4169951A (enExample) |
| JP (1) | JPS5827788B2 (enExample) |
| BE (1) | BE858389A (enExample) |
| BR (1) | BR7705881A (enExample) |
| CA (1) | CA1115705A (enExample) |
| CH (1) | CH631706A5 (enExample) |
| DE (1) | DE2712694A1 (enExample) |
| FR (1) | FR2384758A1 (enExample) |
| GB (1) | GB1550724A (enExample) |
| IL (1) | IL52883A (enExample) |
| IT (1) | IT1143596B (enExample) |
| NL (1) | NL184001C (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4871859A (en) * | 1988-03-02 | 1989-10-03 | Hoechst Celanese Corporation | Process for preparing pyridine carboxylic acid esters |
| AU2003225964B2 (en) * | 2002-03-28 | 2008-11-20 | Merck Sharp & Dohme Corp. | Substituted 2,3-diphenyl pyridines |
| EP2064183A2 (en) * | 2006-09-07 | 2009-06-03 | Allergan, Inc. | Heteroaromatic compounds having sphingosine-1-phosphate (s1p) receptor agonist biological activity |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA655703A (en) * | 1963-01-08 | R. Hargrave Kenneth | Production of pyridine bases | |
| US2877228A (en) * | 1952-10-20 | 1959-03-10 | Phillips Petroleum Co | Production of substituted pyridines |
| US2780626A (en) * | 1953-08-13 | 1957-02-05 | Research Corp | 2, 6-alkylpyridines |
| US2926074A (en) * | 1954-04-30 | 1960-02-23 | Phillips Petroleum Co | Apparatus for production of substituted pyridines |
| GB917765A (en) * | 1960-11-10 | 1963-02-06 | Distillers Co Yeast Ltd | Production of pyridine bases |
| GB920526A (en) * | 1960-11-17 | 1963-03-06 | Distillers Co Yeast Ltd | Production of pyridine bases |
| GB924527A (en) * | 1961-02-17 | 1963-04-24 | Distillers Co Yeast Ltd | Production of pyridine bases |
| US3932421A (en) * | 1967-07-13 | 1976-01-13 | Koei Chemical Company, Ltd. | Process for producing alkylpyridines |
| US3946020A (en) * | 1970-12-28 | 1976-03-23 | Koei Chemical Co., Ltd. | Process for producing pyridine bases |
| BE790121A (fr) * | 1971-10-15 | 1973-02-01 | Degussa | Catalyseurs pour la preparation de pyridine et de 3-methylpyridine |
| DE2224160C3 (de) * | 1972-05-18 | 1979-10-04 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von Katalysatoren für die Herstellung von Pyridin und 3-Methylpyridin |
| DE2239801C3 (de) * | 1972-08-12 | 1979-08-23 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von Katalysatoren |
| SU567724A1 (ru) * | 1974-07-19 | 1977-08-05 | Предприятие П/Я В-8585 | Способ получени алкилпиридинов |
| DE2449340C2 (de) * | 1974-10-17 | 1987-04-09 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Pyridin und 3-Methylpyridin |
| GB1495233A (en) * | 1976-01-30 | 1977-12-14 | Ici Ltd | Manufacture of pyridine and methylpyridines |
-
1977
- 1977-03-23 DE DE19772712694 patent/DE2712694A1/de active Granted
- 1977-09-01 IT IT50863/77A patent/IT1143596B/it active
- 1977-09-02 BR BR7705881A patent/BR7705881A/pt unknown
- 1977-09-02 NL NLAANVRAGE7709709,A patent/NL184001C/xx not_active IP Right Cessation
- 1977-09-02 BE BE6046131A patent/BE858389A/xx not_active IP Right Cessation
- 1977-09-02 GB GB36772/77A patent/GB1550724A/en not_active Expired
- 1977-09-02 IL IL52883A patent/IL52883A/xx unknown
- 1977-09-02 CH CH1074977A patent/CH631706A5/de not_active IP Right Cessation
- 1977-09-02 JP JP52105730A patent/JPS5827788B2/ja not_active Expired
- 1977-09-05 FR FR7726896A patent/FR2384758A1/fr active Granted
- 1977-09-06 US US05/830,982 patent/US4169951A/en not_active Expired - Lifetime
- 1977-10-17 CA CA288,852A patent/CA1115705A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1550724A (en) | 1979-08-22 |
| NL184001C (nl) | 1989-03-16 |
| IT1143596B (it) | 1986-10-22 |
| FR2384758A1 (fr) | 1978-10-20 |
| BE858389A (fr) | 1978-03-02 |
| CH631706A5 (de) | 1982-08-31 |
| JPS53119877A (en) | 1978-10-19 |
| DE2712694A1 (de) | 1978-09-28 |
| IL52883A0 (en) | 1977-11-30 |
| DE2712694C2 (enExample) | 1988-07-21 |
| FR2384758B1 (enExample) | 1982-07-16 |
| JPS5827788B2 (ja) | 1983-06-11 |
| US4169951A (en) | 1979-10-02 |
| BR7705881A (pt) | 1978-09-26 |
| IL52883A (en) | 1980-06-30 |
| NL7709709A (nl) | 1978-09-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Woodbury et al. | Isolation and reactions of. alpha.-lithio N, N-dimethylacetamide | |
| CA1123836A (en) | Process for producing 2,3,5-trichloropyridine, 2,4,4-trichloro-4-formyl-butyronitrile as a novel compound and a process for producing it | |
| CA1085850A (en) | Producing pyridines aromatically or heteroaromatically substituted in the 2 position | |
| CA1115705A (en) | Process for producing substituted pyridines | |
| PRATT et al. | Reaction rates by distillation. IX. The condensation of anilines with benzaldehydes | |
| US2953601A (en) | Method of preparing amines | |
| US2577445A (en) | Preparing methacrolein from the dimer thereof | |
| JPS62129236A (ja) | メチルイソプロピルケトン及びジエチルケトンの製法 | |
| CN112898156B (zh) | 1-(3,3-二甲基环己基)乙醇的回收方法及伊甸麝香的制备方法 | |
| CA1084932A (en) | Producing pyridines aromatically and heteroaromatically substituted in the 2 and 6 positions | |
| CA1122986A (en) | Process for producing pyridines substituted aromatically or heteroaromatically in the 3 position | |
| CA1084934A (en) | Process for producing 2,3-cycloalkenopyridines | |
| US2807629A (en) | Catalytic dehydrogenation of dialkylene glycols | |
| US4618725A (en) | Preparation of α-methyl-substituted ketones | |
| US4083869A (en) | Process for producing imine compounds | |
| CA1088941A (en) | Process for producing bis(cycloalkeno)-pyridines | |
| US3013064A (en) | Preparation of lower alkyl carbamates | |
| US2451351A (en) | Production of unsaturated ketones | |
| JPS639495B2 (enExample) | ||
| US2799707A (en) | Preparation of alpha-diketones | |
| JPS6256141B2 (enExample) | ||
| US4237299A (en) | Process for the recovery of pyridine and 3-methylpyridine | |
| US4001336A (en) | 2,6,10-trimethyl-dodecan-1-al and 2,6,10-trimethyl-dodeca-4,8-dien-1-al | |
| SU438244A1 (ru) | Способ получени п-терфенила | |
| US3503991A (en) | Synthesis of para-dithianes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |