CA1115295A - Process for preparing p-aminophenol - Google Patents
Process for preparing p-aminophenolInfo
- Publication number
- CA1115295A CA1115295A CA336,177A CA336177A CA1115295A CA 1115295 A CA1115295 A CA 1115295A CA 336177 A CA336177 A CA 336177A CA 1115295 A CA1115295 A CA 1115295A
- Authority
- CA
- Canada
- Prior art keywords
- aniline
- aminophenol
- nitrobenzene
- pap
- reaction medium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 title claims abstract description 58
- 238000004519 manufacturing process Methods 0.000 title abstract description 7
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims abstract description 46
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 claims abstract description 39
- 239000006227 byproduct Substances 0.000 claims abstract description 11
- 239000012429 reaction media Substances 0.000 claims abstract description 9
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims abstract description 7
- HIWXNYSKAQSEON-UHFFFAOYSA-N n,n-dimethyldodecan-1-amine;sulfuric acid Chemical class OS(O)(=O)=O.CCCCCCCCCCCCN(C)C HIWXNYSKAQSEON-UHFFFAOYSA-N 0.000 claims abstract description 4
- 238000000034 method Methods 0.000 claims description 21
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 9
- 239000004094 surface-active agent Substances 0.000 claims description 9
- VFFDVELHRCMPLY-UHFFFAOYSA-N dimethyldodecyl amine Natural products CC(C)CCCCCCCCCCCN VFFDVELHRCMPLY-UHFFFAOYSA-N 0.000 claims description 7
- YWFWDNVOPHGWMX-UHFFFAOYSA-N n,n-dimethyldodecan-1-amine Chemical compound CCCCCCCCCCCCN(C)C YWFWDNVOPHGWMX-UHFFFAOYSA-N 0.000 claims description 7
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 7
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 230000006872 improvement Effects 0.000 claims description 4
- 229910052697 platinum Inorganic materials 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 239000012736 aqueous medium Substances 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 abstract description 10
- 239000002253 acid Substances 0.000 abstract description 9
- DDXLVDQZPFLQMZ-UHFFFAOYSA-M dodecyl(trimethyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)C DDXLVDQZPFLQMZ-UHFFFAOYSA-M 0.000 abstract description 5
- 239000012535 impurity Substances 0.000 abstract description 5
- 238000002360 preparation method Methods 0.000 abstract description 4
- 150000003839 salts Chemical group 0.000 abstract description 4
- QMGBIPKOKCSUCL-UHFFFAOYSA-N 3-propan-2-yloxyaniline Chemical compound CC(C)OC1=CC=CC(N)=C1 QMGBIPKOKCSUCL-UHFFFAOYSA-N 0.000 abstract description 3
- 230000015572 biosynthetic process Effects 0.000 abstract description 3
- 230000000694 effects Effects 0.000 abstract description 3
- 230000002411 adverse Effects 0.000 abstract description 2
- KUDPGZONDFORKU-UHFFFAOYSA-N n-chloroaniline Chemical compound ClNC1=CC=CC=C1 KUDPGZONDFORKU-UHFFFAOYSA-N 0.000 abstract description 2
- 238000006467 substitution reaction Methods 0.000 abstract 1
- 230000008569 process Effects 0.000 description 12
- 239000008346 aqueous phase Substances 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000005984 hydrogenation reaction Methods 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- -1 tertiary amine salts Chemical class 0.000 description 4
- 239000000654 additive Substances 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 3
- 229960004592 isopropanol Drugs 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 241001527806 Iti Species 0.000 description 2
- CKRZKMFTZCFYGB-UHFFFAOYSA-N N-phenylhydroxylamine Chemical compound ONC1=CC=CC=C1 CKRZKMFTZCFYGB-UHFFFAOYSA-N 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000005755 formation reaction Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 description 2
- AMLFJZRZIOZGPW-NSCUHMNNSA-N (e)-prop-1-en-1-amine Chemical compound C\C=C\N AMLFJZRZIOZGPW-NSCUHMNNSA-N 0.000 description 1
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
- PZOZYLSYQJYXBI-UHFFFAOYSA-N 2-propan-2-yloxyaniline Chemical compound CC(C)OC1=CC=CC=C1N PZOZYLSYQJYXBI-UHFFFAOYSA-N 0.000 description 1
- MLNFMFAMNBGAQT-UHFFFAOYSA-N 4-propan-2-yloxyaniline Chemical compound CC(C)OC1=CC=C(N)C=C1 MLNFMFAMNBGAQT-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- BXEAHACUGNJIPF-UHFFFAOYSA-N NCCCCCCCCCC.C(CCCCCCCCC)N Chemical compound NCCCCCCCCCC.C(CCCCCCCCC)N BXEAHACUGNJIPF-UHFFFAOYSA-N 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 239000002535 acidifier Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000012431 aqueous reaction media Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- JNONJXMVMJSMTC-UHFFFAOYSA-N hydron;triethylazanium;sulfate Chemical compound OS(O)(=O)=O.CCN(CC)CC JNONJXMVMJSMTC-UHFFFAOYSA-N 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- BPEQZXOPABVVLH-UHFFFAOYSA-N n,n-dibutylbutan-1-amine;sulfuric acid Chemical compound OS([O-])(=O)=O.CCCC[NH+](CCCC)CCCC BPEQZXOPABVVLH-UHFFFAOYSA-N 0.000 description 1
- YYNTXBIGYMPBKG-UHFFFAOYSA-N n-propan-2-yloxyaniline Chemical class CC(C)ONC1=CC=CC=C1 YYNTXBIGYMPBKG-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229960005489 paracetamol Drugs 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/74—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C215/76—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US955,442 | 1978-10-27 | ||
| US05/955,442 US4176138A (en) | 1978-10-27 | 1978-10-27 | Process for preparing p-aminophenol in the presence of dimethyldodecylamine sulfate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1115295A true CA1115295A (en) | 1981-12-29 |
Family
ID=25496830
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA336,177A Expired CA1115295A (en) | 1978-10-27 | 1979-09-24 | Process for preparing p-aminophenol |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4176138A (en:Method) |
| JP (1) | JPS5559145A (en:Method) |
| BE (1) | BE879663A (en:Method) |
| CA (1) | CA1115295A (en:Method) |
| CH (1) | CH643235A5 (en:Method) |
| DE (1) | DE2943360A1 (en:Method) |
| FR (1) | FR2439766A1 (en:Method) |
| GB (1) | GB2032427B (en:Method) |
| GR (1) | GR65673B (en:Method) |
| IT (1) | IT1120037B (en:Method) |
| NL (1) | NL188524C (en:Method) |
| SE (1) | SE7907676L (en:Method) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4307249A (en) * | 1981-01-07 | 1981-12-22 | Mallinckrodt, Inc. | Process for the selective preparation of p-aminophenol from nitrobenzene |
| US4571437A (en) * | 1982-01-29 | 1986-02-18 | Mallinckrodt, Inc. | Process for preparing p-aminophenol and alkyl substituted p-aminophenol |
| US4415753A (en) * | 1982-01-29 | 1983-11-15 | Mallinckrodt, Inc. | Process for preparing p-aminophenol and alkyl substituted p-aminophenol |
| JPH0261799A (ja) * | 1988-08-26 | 1990-03-01 | Fujitsu Ten Ltd | 車間距離制御装置 |
| FR2688001B1 (fr) * | 1992-02-28 | 1994-05-20 | Rhone Poulenc Chimie | Procede de preparation de p-aminophenols. |
| US5312991A (en) * | 1992-06-09 | 1994-05-17 | Mallinckrodt Specialty Chemicals Company | Surfactant improvement for para-aminophenol process |
| CN115197074A (zh) * | 2022-06-28 | 2022-10-18 | 辽宁世星药化有限公司 | 一种对氨基苯酚的生产方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2198249A (en) * | 1938-10-13 | 1940-04-23 | Du Pont | Reduction of aryl nitro compounds |
| FR1071868A (fr) * | 1951-12-05 | 1954-09-06 | Du Pont | Perfectionnements à la préparation du p-aminophénol |
| US2765342A (en) * | 1952-10-22 | 1956-10-02 | Du Pont | Manufacture of aromatic parahydroxyamines |
| GB856366A (en) * | 1958-05-12 | 1960-12-14 | Ici Ltd | Process for the production of p-aminophenol from nitrobenzene |
| US3383416A (en) * | 1965-07-08 | 1968-05-14 | Roland G. Benner | Process for preparing aminophenol |
| US3535382A (en) * | 1967-11-02 | 1970-10-20 | Cpc International Inc | Amino phenol production |
| FR1559841A (en:Method) * | 1968-01-30 | 1969-03-14 |
-
1978
- 1978-10-27 US US05/955,442 patent/US4176138A/en not_active Expired - Lifetime
-
1979
- 1979-09-07 GB GB7931061A patent/GB2032427B/en not_active Expired
- 1979-09-10 FR FR7922588A patent/FR2439766A1/fr active Granted
- 1979-09-14 SE SE7907676A patent/SE7907676L/xx not_active Application Discontinuation
- 1979-09-14 GR GR60037A patent/GR65673B/el unknown
- 1979-09-24 CA CA336,177A patent/CA1115295A/en not_active Expired
- 1979-10-09 IT IT50500/79A patent/IT1120037B/it active
- 1979-10-17 CH CH934479A patent/CH643235A5/de not_active IP Right Cessation
- 1979-10-22 NL NLAANVRAGE7907758,A patent/NL188524C/xx not_active IP Right Cessation
- 1979-10-26 DE DE19792943360 patent/DE2943360A1/de active Granted
- 1979-10-26 JP JP13921079A patent/JPS5559145A/ja active Granted
- 1979-10-26 BE BE0/197839A patent/BE879663A/fr not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5559145A (en) | 1980-05-02 |
| NL188524C (nl) | 1992-07-16 |
| DE2943360C2 (en:Method) | 1992-01-16 |
| GB2032427A (en) | 1980-05-08 |
| DE2943360A1 (de) | 1980-05-08 |
| GR65673B (en) | 1980-10-16 |
| IT1120037B (it) | 1986-03-19 |
| NL188524B (nl) | 1992-02-17 |
| SE7907676L (sv) | 1980-04-28 |
| IT7950500A0 (it) | 1979-10-09 |
| BE879663A (fr) | 1980-02-15 |
| FR2439766A1 (fr) | 1980-05-23 |
| US4176138A (en) | 1979-11-27 |
| FR2439766B1 (en:Method) | 1981-11-20 |
| GB2032427B (en) | 1982-11-10 |
| JPS6228950B2 (en:Method) | 1987-06-23 |
| NL7907758A (nl) | 1980-04-29 |
| CH643235A5 (de) | 1984-05-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3019582C2 (en:Method) | ||
| US4723030A (en) | Moderated reduction reactions for producing arylhydroxylamines | |
| WO2003022812A1 (de) | Organische sulfate als ionische flüssigkeiten | |
| DE4038192A1 (de) | Verfahren zur herstellung von 1,3-propandiol | |
| DE69200624T2 (de) | Direktsynthese von wasserstoffperoxid durch heterogene katalyse, katalysator fuer diese synthese und verfahren zur herstellung dieser katalysator. | |
| CA1115295A (en) | Process for preparing p-aminophenol | |
| CA1132996A (en) | Process for producing naphthoquinone | |
| US4307249A (en) | Process for the selective preparation of p-aminophenol from nitrobenzene | |
| DE69414155T2 (de) | Verfahren zur Herstellung von 6-Alkyl-4-(pyridin-3-yl-methylenamino)-4,5-dihydro-1,2,4-triazin-3(2H)-one | |
| US5312991A (en) | Surfactant improvement for para-aminophenol process | |
| DE69800265T2 (de) | Verfahren zur Hydroxylierung von aromatischen Kohlenwasserstoffen | |
| US4420616A (en) | Oxidative process for the preparation of copper quinolinate | |
| US5101031A (en) | Preparation of 2,4,5-triamino-6-hydroxypyrimidine by catalytic hydrogenation of 2,4-diamino-6-hydroxy-5-nitroso-pyrimidine | |
| DE2922688A1 (de) | Nitrosierungsverfahren | |
| EP0054809B1 (de) | Verfahren zur Herstellung von 5-Amino-2,4-dimethyl-acetanilid | |
| DE2646733A1 (de) | Verfahren zur ueberfuehrung von nitrilen in amide durch behandeln mit wasser | |
| DE60010258T2 (de) | Herstellung von substituierten aromatischen aminen | |
| EP0723809A1 (de) | Verfahren zur Herstellung eines Hydrierungskatalysators | |
| JP2002542221A (ja) | 芳香族ジアミンのリン酸塩 | |
| JP2633040B2 (ja) | N―t―ブチルアクリルアミドの精製方法 | |
| DE3338882C2 (en:Method) | ||
| Lee | Synthesis and resolution of enantiomeric quaternary ammonium halides | |
| DD209619A5 (de) | Verfahren zur herstellung von 2-(e)-phenylmethylen-cycloheptan-1-on-(e)-oxim | |
| DE2750951A1 (de) | Verfahren zur herstellung aromatischer substituierter amine | |
| JPH02204482A (ja) | 5,6,7,8―テトラヒドロイソキノリンの濃縮分離法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |