CA1110609A - Synthesis of zeolite zsm-5 - Google Patents
Synthesis of zeolite zsm-5Info
- Publication number
- CA1110609A CA1110609A CA300,992A CA300992A CA1110609A CA 1110609 A CA1110609 A CA 1110609A CA 300992 A CA300992 A CA 300992A CA 1110609 A CA1110609 A CA 1110609A
- Authority
- CA
- Canada
- Prior art keywords
- zeolite
- organic compound
- charge
- zsm
- hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 title claims abstract description 40
- 239000010457 zeolite Substances 0.000 title claims abstract description 37
- 229910021536 Zeolite Inorganic materials 0.000 title claims abstract description 34
- 230000015572 biosynthetic process Effects 0.000 title description 2
- 238000003786 synthesis reaction Methods 0.000 title description 2
- 150000001768 cations Chemical class 0.000 claims abstract description 28
- 239000000203 mixture Substances 0.000 claims abstract description 27
- 238000000034 method Methods 0.000 claims abstract description 26
- 239000011734 sodium Substances 0.000 claims abstract description 10
- 229910052708 sodium Inorganic materials 0.000 claims abstract description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims abstract description 8
- 239000013078 crystal Substances 0.000 claims abstract description 8
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 6
- 125000001477 organic nitrogen group Chemical group 0.000 claims abstract description 5
- 239000003054 catalyst Substances 0.000 claims description 21
- 150000002894 organic compounds Chemical class 0.000 claims description 21
- 238000006243 chemical reaction Methods 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 239000001257 hydrogen Substances 0.000 claims description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 13
- 229910052782 aluminium Inorganic materials 0.000 claims description 7
- 238000005342 ion exchange Methods 0.000 claims description 7
- 229910001868 water Inorganic materials 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 6
- 229910000323 aluminium silicate Inorganic materials 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 150000002739 metals Chemical class 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- 229910052761 rare earth metal Inorganic materials 0.000 claims description 5
- 150000002910 rare earth metals Chemical class 0.000 claims description 5
- 229910001413 alkali metal ion Inorganic materials 0.000 claims description 4
- 238000001354 calcination Methods 0.000 claims 9
- 239000002243 precursor Substances 0.000 claims 6
- 230000000737 periodic effect Effects 0.000 claims 3
- SYECJBOWSGTPLU-UHFFFAOYSA-N hexane-1,1-diamine Chemical compound CCCCCC(N)N SYECJBOWSGTPLU-UHFFFAOYSA-N 0.000 claims 1
- KJOMYNHMBRNCNY-UHFFFAOYSA-N pentane-1,1-diamine Chemical compound CCCCC(N)N KJOMYNHMBRNCNY-UHFFFAOYSA-N 0.000 claims 1
- 238000000634 powder X-ray diffraction Methods 0.000 claims 1
- 229910052710 silicon Inorganic materials 0.000 claims 1
- 239000010703 silicon Substances 0.000 claims 1
- -1 tetraalkylammonium cations Chemical class 0.000 abstract description 17
- 150000004985 diamines Chemical class 0.000 abstract description 9
- 239000011541 reaction mixture Substances 0.000 abstract description 9
- 229910001415 sodium ion Inorganic materials 0.000 abstract 2
- 238000007796 conventional method Methods 0.000 abstract 1
- 230000002194 synthesizing effect Effects 0.000 abstract 1
- OSBSFAARYOCBHB-UHFFFAOYSA-N tetrapropylammonium Chemical compound CCC[N+](CCC)(CCC)CCC OSBSFAARYOCBHB-UHFFFAOYSA-N 0.000 abstract 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 84
- 229910052681 coesite Inorganic materials 0.000 description 41
- 229910052906 cristobalite Inorganic materials 0.000 description 41
- 229910052682 stishovite Inorganic materials 0.000 description 41
- 229910052905 tridymite Inorganic materials 0.000 description 41
- 239000000377 silicon dioxide Substances 0.000 description 37
- 235000012239 silicon dioxide Nutrition 0.000 description 32
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000000463 material Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 7
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 6
- 150000001336 alkenes Chemical class 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 150000002430 hydrocarbons Chemical class 0.000 description 5
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 230000003247 decreasing effect Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000011159 matrix material Substances 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 230000003068 static effect Effects 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- JWOLLWQJKQOEOL-UHFFFAOYSA-N OOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOO JWOLLWQJKQOEOL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000002441 X-ray diffraction Methods 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N ZrO2 Inorganic materials O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000005899 aromatization reaction Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- ODPOAESBSUKMHD-UHFFFAOYSA-L 6,7-dihydrodipyrido[1,2-b:1',2'-e]pyrazine-5,8-diium;dibromide Chemical compound [Br-].[Br-].C1=CC=[N+]2CC[N+]3=CC=CC=C3C2=C1 ODPOAESBSUKMHD-UHFFFAOYSA-L 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 101100087530 Caenorhabditis elegans rom-1 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 239000005630 Diquat Substances 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 101100305983 Mus musculus Rom1 gene Proteins 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- UIQWBVPFHHQZHH-UHFFFAOYSA-N OOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOO UIQWBVPFHHQZHH-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 1
- HPTYUNKZVDYXLP-UHFFFAOYSA-N aluminum;trihydroxy(trihydroxysilyloxy)silane;hydrate Chemical group O.[Al].[Al].O[Si](O)(O)O[Si](O)(O)O HPTYUNKZVDYXLP-UHFFFAOYSA-N 0.000 description 1
- 229940045985 antineoplastic platinum compound Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 238000004517 catalytic hydrocracking Methods 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000007863 gel particle Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910052621 halloysite Inorganic materials 0.000 description 1
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000013383 initial experiment Methods 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 150000001457 metallic cations Chemical class 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 238000006384 oligomerization reaction Methods 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000003058 platinum compounds Chemical class 0.000 description 1
- CLSUSRZJUQMOHH-UHFFFAOYSA-L platinum dichloride Chemical compound Cl[Pt]Cl CLSUSRZJUQMOHH-UHFFFAOYSA-L 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000005588 protonation Effects 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 238000007669 thermal treatment Methods 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N titanium dioxide Inorganic materials O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 238000010555 transalkylation reaction Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J29/00—Catalysts comprising molecular sieves
- B01J29/04—Catalysts comprising molecular sieves having base-exchange properties, e.g. crystalline zeolites
- B01J29/06—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof
- B01J29/40—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof of the pentasil type, e.g. types ZSM-5, ZSM-8 or ZSM-11, as exemplified by patent documents US3702886, GB1334243 and US3709979, respectively
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J29/00—Catalysts comprising molecular sieves
- B01J29/04—Catalysts comprising molecular sieves having base-exchange properties, e.g. crystalline zeolites
- B01J29/06—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof
- B01J29/061—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof containing metallic elements added to the zeolite
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B39/00—Compounds having molecular sieve and base-exchange properties, e.g. crystalline zeolites; Their preparation; After-treatment, e.g. ion-exchange or dealumination
- C01B39/02—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof; Direct preparation thereof; Preparation thereof starting from a reaction mixture containing a crystalline zeolite of another type, or from preformed reactants; After-treatment thereof
- C01B39/36—Pentasil type, e.g. types ZSM-5, ZSM-8 or ZSM-11
- C01B39/38—Type ZSM-5
- C01B39/40—Type ZSM-5 using at least one organic template directing agent
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J2229/00—Aspects of molecular sieve catalysts not covered by B01J29/00
- B01J2229/10—After treatment, characterised by the effect to be obtained
- B01J2229/26—After treatment, characterised by the effect to be obtained to stabilize the total catalyst structure
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J2229/00—Aspects of molecular sieve catalysts not covered by B01J29/00
- B01J2229/30—After treatment, characterised by the means used
- B01J2229/42—Addition of matrix or binder particles
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S423/00—Chemistry of inorganic compounds
- Y10S423/22—MFI, e.g. ZSM-5. silicalite, LZ-241
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Materials Engineering (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Geology (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Life Sciences & Earth Sciences (AREA)
- Crystallography & Structural Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Silicates, Zeolites, And Molecular Sieves (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US789,899 | 1977-04-22 | ||
| US05/789,899 US4139600A (en) | 1977-04-22 | 1977-04-22 | Synthesis of zeolite ZSM-5 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1110609A true CA1110609A (en) | 1981-10-13 |
Family
ID=25149029
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA300,992A Expired CA1110609A (en) | 1977-04-22 | 1978-04-12 | Synthesis of zeolite zsm-5 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4139600A (enEXAMPLES) |
| JP (1) | JPS53134799A (enEXAMPLES) |
| AU (1) | AU514414B2 (enEXAMPLES) |
| BE (1) | BE866270A (enEXAMPLES) |
| CA (1) | CA1110609A (enEXAMPLES) |
| DE (1) | DE2817576A1 (enEXAMPLES) |
| FR (1) | FR2387908A1 (enEXAMPLES) |
| GB (1) | GB1588614A (enEXAMPLES) |
| IT (1) | IT1094919B (enEXAMPLES) |
| NL (1) | NL7804287A (enEXAMPLES) |
| NZ (1) | NZ186958A (enEXAMPLES) |
| ZA (1) | ZA782294B (enEXAMPLES) |
Families Citing this family (110)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4107195A (en) * | 1977-04-22 | 1978-08-15 | Mobil Oil Corporation | Preparation of zeolite ZSM-35 |
| US4108881A (en) * | 1977-08-01 | 1978-08-22 | Mobil Oil Corporation | Synthesis of zeolite ZSM-11 |
| DE2830787B2 (de) * | 1978-07-13 | 1981-02-19 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von stickstoffhaltigen kirstallinen Metallsilikaten mit Zeolithstniktur |
| DE2831334A1 (de) * | 1978-07-17 | 1980-02-07 | Basf Ag | Verfahren zur herstellung von kristallinen aluminosilikatzeolithen |
| CA1130265A (en) * | 1978-10-06 | 1982-08-24 | William J. Ball | Process for the production of amorphous aluminosilicates and their use as catalysts |
| AU527116B2 (en) * | 1978-11-13 | 1983-02-17 | Mobil Oil Corp. | Method for synthesis of zeolite zsm-5 |
| US4526879A (en) * | 1978-11-13 | 1985-07-02 | Mobil Oil Corporation | Synthesis of zeolite ZSM-5 |
| US4205053A (en) * | 1979-02-01 | 1980-05-27 | Mobil Oil Corporation | Manufacture of nitrogenous zeolites |
| US4518703A (en) * | 1979-02-16 | 1985-05-21 | Union Oil Company Of California | Crystalline silica catalysts |
| ZA80767B (en) * | 1979-02-21 | 1981-09-30 | Mobil Oil Corp | Crystalline zeolitic synthesis and use thereof |
| DE2909927A1 (de) * | 1979-03-14 | 1980-09-25 | Basf Ag | Verfahren zur herstellung von olefinen aus rohmethanol |
| DE2909929A1 (de) * | 1979-03-14 | 1980-09-25 | Basf Ag | Verfahren zur herstellung eines zeolithen vom strukturtyp zsm-5 |
| DE2909930C2 (de) * | 1979-03-14 | 1984-05-10 | Basf Ag, 6700 Ludwigshafen | Neue kristalline SiO↓2↓-Modifikation und Verfahren zu ihrer Herstellung |
| NZ193928A (en) * | 1979-06-11 | 1982-09-07 | Mobil Oil Corp | Preparation of large crystal zeolite zsm-5 |
| NZ193927A (en) * | 1979-06-11 | 1982-09-07 | Mobil Oil Corp | Continuous stream method of preparing crystalline zeolite |
| US4423021A (en) * | 1979-08-08 | 1983-12-27 | Mobil Oil Corporation | Method of preparing silico-crystal ZSM-48 |
| NZ193929A (en) * | 1979-10-09 | 1982-09-07 | Mobil Oil Corp | Preparation of large crystal zeolite zsm-5 |
| ZA803365B (en) * | 1979-10-09 | 1981-05-27 | Mobil Oil Corp | Synthesis of large crystal zeolite zsm-5 |
| US4274982A (en) * | 1979-10-12 | 1981-06-23 | Mobil Oil Corporation | Method for maintaining para-selectivity of modified zeolite catalyst |
| CA1144137A (en) * | 1979-12-26 | 1983-04-05 | Donald A. Hickson | Method for preparing crystalline zeolites |
| DE3006471A1 (de) | 1980-02-21 | 1981-08-27 | Basf Ag, 6700 Ludwigshafen | Kristalline isotaktische zeolithe, verfahren zur herstellung derselben sowie deren verwendung als katalysatoren |
| US4349461A (en) * | 1980-02-25 | 1982-09-14 | Mobil Oil Corporation | Group VIIA metal-modified zeolite catalysts |
| CA1167071A (en) * | 1980-03-15 | 1984-05-08 | William J. Ball | Process for the production of aromatic hydrocarbons |
| CA1153867A (en) * | 1980-05-16 | 1983-09-20 | Michael A. M. Boersma | Process for the preparation of crystalline silicates, crystalline silicates so prepared and process for carrying out catalytic reactions |
| ZA805231B (en) * | 1980-05-19 | 1981-08-26 | Mobil Oil Corp | Low acidity alkali metal containing zeolites |
| US4276437A (en) * | 1980-05-23 | 1981-06-30 | Mobil Oil Corporation | Shape selective reactions involving zeolite catalyst modified with group IIIB metal |
| DE3021580A1 (de) * | 1980-06-07 | 1981-12-24 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von zeolithen und verwendung derselben als katalysatoren |
| AU542052B2 (en) * | 1980-06-12 | 1985-02-07 | Imperial Chemical Industries Ltd. | Zeoliteeuz and its use as a catalyst |
| DE3031557C2 (de) * | 1980-08-21 | 1986-05-22 | Basf Ag, 6700 Ludwigshafen | Kristalliner Borsilikatzeolith ZBM-30 und Verfahren zu seiner Herstellung |
| CA1169038A (en) * | 1980-11-04 | 1984-06-12 | Koji Sumitani | Crystalline aluminosilicate zeolites and process for production thereof |
| DE3172377D1 (en) | 1980-12-12 | 1985-10-24 | Exxon Research Engineering Co | Composite zeolite |
| US4331643A (en) * | 1980-12-15 | 1982-05-25 | Mobil Oil Corporation | Use of diazobicyclooctane (DABCO) as a template in zeolite synthesis |
| US4410452A (en) * | 1981-01-06 | 1983-10-18 | Mobil Oil Corporation | Method of preparation of composite zeolite catalysts |
| US4323481A (en) * | 1981-02-26 | 1982-04-06 | Standard Oil Company (Indiana) | Synthesis of molecular sieves using beta-diketones as organic templates |
| DE3268503D1 (en) * | 1981-05-20 | 1986-02-27 | Ici Plc | Zeolites |
| DE3269577D1 (en) * | 1981-05-20 | 1986-04-10 | Ici Plc | Zeolites |
| DE3261680D1 (en) * | 1981-05-20 | 1985-02-07 | Ici Plc | Process for the isomerization of alkylbenzenes |
| US4877762A (en) * | 1981-05-26 | 1989-10-31 | Union Oil Company Of California | Catalyst for simultaneous hydrotreating and hydrodewaxing of hydrocarbons |
| US4790927A (en) * | 1981-05-26 | 1988-12-13 | Union Oil Company Of California | Process for simultaneous hydrotreating and hydrodewaxing of hydrocarbons |
| CA1185953A (en) * | 1981-06-30 | 1985-04-23 | Muin S. Haddad | Method for manufacture of ams-1b crystalline borosilicate molecular sieve |
| US5053211A (en) * | 1981-06-30 | 1991-10-01 | Amoco Corporation | Manufacture of AMS-18 crystalline borosilicate molecular sieve |
| DE3131648C2 (de) * | 1981-08-11 | 1983-09-29 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur Herstellung von kristallinen Metallsilikaten sowie deren Verwendung |
| NZ202099A (en) * | 1981-10-21 | 1986-07-11 | Ici Plc | Preparation of zeolite nu-10 |
| US4612387A (en) * | 1982-01-04 | 1986-09-16 | Air Products And Chemicals, Inc. | Production of carboxylic acids and esters |
| US4902406A (en) * | 1982-04-30 | 1990-02-20 | Mobil Oil Corporation | Synthesis of zeolite ZSM-22 |
| US5248841A (en) * | 1982-04-30 | 1993-09-28 | Mobil Oil Corporation | Hydrocarbon conversion with ZSM-22 zeolite |
| IT1152998B (it) * | 1982-07-01 | 1987-01-14 | Anic Spa | Procedimento per la preparazione di allumino-silicati cristallini porosi |
| US4495166A (en) * | 1982-07-19 | 1985-01-22 | Mobil Oil Corporation | Synthesis of ZSM-5 utilizing a mixture of quaternary ammonium ions and amines |
| US4576805A (en) * | 1982-08-27 | 1986-03-18 | Mobil Oil Corporation | Increasing lattice metal content of porous inorganic crystalline compositions |
| US5254770A (en) * | 1982-09-01 | 1993-10-19 | Mobil Oil Corp. | Isomerization of aromatic compounds over ZSM-22 zeolite |
| DE3362700D1 (en) * | 1982-10-01 | 1986-04-30 | Ici Plc | Zeolites |
| US4561968A (en) * | 1983-04-07 | 1985-12-31 | Ashland Oil, Inc. | Carbometallic oil conversion with zeolite y containing catalyst |
| US4585638A (en) * | 1984-07-16 | 1986-04-29 | Mobil Oil Corporation | Synthesis of crystalline silicate ZSM-5 |
| JPS6197387A (ja) * | 1984-10-18 | 1986-05-15 | Nippon Oil Co Ltd | 炭化水素油の脱ろう法 |
| US4764356A (en) * | 1984-12-21 | 1988-08-16 | Exxon Research & Engineering Co. | Process for synthesizing a zeolite catalyst on a pH controlled basis to improve catalyst life |
| US4592902A (en) * | 1985-02-26 | 1986-06-03 | Mobil Oil Corporation | Synthesis of crystalline silicate ZSM-5 with an alkyltropinium compound promoter |
| NZ215987A (en) | 1985-05-14 | 1989-07-27 | Mobil Oil Corp | Manufacture of zeolite |
| DE3535128A1 (de) * | 1985-10-02 | 1987-04-02 | Degussa | Katalytische dealkoxylierung von geminalen di-alkoxyverbindungen, geeignete katalysatoren und deren herstellung |
| US4774379A (en) * | 1987-06-09 | 1988-09-27 | Cosden Technology, Inc. | Aromatic alkylation process |
| US4894212A (en) * | 1987-07-20 | 1990-01-16 | Mobil Oil Corp. | Synthesis of crystalline silicate ZSM-11 |
| US4778780A (en) * | 1987-07-23 | 1988-10-18 | Mobil Oil Corporation | Synthesis of crystalline SAPO-17 |
| US4877593A (en) * | 1988-03-10 | 1989-10-31 | Mobil Oil Company | Synthesis of crystalline aluminophosphate composition |
| US4913796A (en) * | 1988-03-10 | 1990-04-03 | Mobil Oil Corp. | Novel crystalline silicoaluminophosphate |
| US4913795A (en) * | 1988-03-10 | 1990-04-03 | Mobil Oil Corp. | Novel crystalline metalloaluminophosphate |
| EP0437429A1 (en) * | 1988-03-10 | 1991-07-24 | Mobil Oil Corporation | Synthetic crystalline molecular sieve and its synthesis |
| US4970397A (en) * | 1989-06-16 | 1990-11-13 | Mobil Oil Corporation | Method and apparatus for activating catalysts using electromagnetic radiation |
| US5068096A (en) * | 1991-04-08 | 1991-11-26 | Mobil Oil Corporation | Synthesis of crystalline silicate MCM-47 |
| US5137705A (en) * | 1991-04-08 | 1992-08-11 | Mobil Oil Corp. | Synthesis of crystalline silicate ZSM-12 |
| US5174977A (en) * | 1991-10-04 | 1992-12-29 | Mobil Oil Corp. | Synthesis of crystalline ZSM-5-type material |
| US5209918A (en) * | 1991-10-04 | 1993-05-11 | Mobil Oil Corp. | Synthesis of crystalline ZSM-5-type material |
| US5174978A (en) * | 1991-10-04 | 1992-12-29 | Mobil Oil Corp. | Synthesis of crystalline ZSM-5-type material |
| US5174981A (en) * | 1991-10-04 | 1992-12-29 | Mobil Oil Corp. | Synthesis of crystalline ZSM-5-type material |
| US5192521A (en) * | 1991-11-19 | 1993-03-09 | Mobil Oil Corp. | Synthesis of crystalline silicate ZSM-12 |
| US5213786A (en) * | 1991-12-20 | 1993-05-25 | Mobil Oil Corp. | Synthesis of crystalline silicate ZSM-11 |
| ZA933879B (en) * | 1992-06-05 | 1993-12-27 | Exxon Chemical Patents Inc | ZSM-5-zeolite |
| US5369071A (en) * | 1992-12-11 | 1994-11-29 | Mobil Oil Corporation | Manufacture of improved catalyst |
| DE4323774A1 (de) * | 1993-07-15 | 1995-02-09 | Basf Ag | Hohlkugelartig agglomerierte Pentasilzeolithe |
| CN1041399C (zh) * | 1994-12-30 | 1998-12-30 | 中国石油化工总公司 | 一种含稀土的结晶硅酸铝沸石 |
| US5853531A (en) * | 1997-09-24 | 1998-12-29 | 1 Figments 5, Llc | Laminating machine |
| US6277355B1 (en) | 1999-07-13 | 2001-08-21 | Exxonmobil Chemical Patents Inc. | Synthesis of ZSM-5 and ZSM-11 |
| US6994142B2 (en) * | 2004-05-10 | 2006-02-07 | Murphy Willis A | Laminating machine |
| TWI355401B (en) * | 2006-09-29 | 2012-01-01 | Cheil Ind Inc | Thermoplastic resin composition and plastic articl |
| US20100160529A1 (en) * | 2008-12-18 | 2010-06-24 | Cheil Industries Inc. | Glass Fiber-Reinforced Polyester Resin Composition and Molded Product Using the Same |
| US20110117007A1 (en) * | 2009-11-13 | 2011-05-19 | Chervon U.S.A. Inc. | Method for making mfi-type molecular sieves |
| EP2658832A1 (en) | 2010-12-30 | 2013-11-06 | Virent, Inc. | Organo-catalytic biomass deconstruction |
| KR101360892B1 (ko) | 2011-06-21 | 2014-02-11 | 제일모직주식회사 | 반사성, 내열성, 내황변성 및 내습성이 우수한 폴리에스테르 수지 조성물. |
| SG188767A1 (en) | 2011-09-21 | 2013-04-30 | Agency Science Tech & Res | Aromatization of methane with combination of catalysts |
| CN103121926B (zh) * | 2011-11-18 | 2015-02-11 | 中国石油化工股份有限公司 | 聚甲氧基甲缩醛制备方法 |
| US8969640B2 (en) | 2011-11-23 | 2015-03-03 | Virent, Inc. | Dehydrogenation of alkanols to increase yield of aromatics |
| KR101549492B1 (ko) | 2011-12-28 | 2015-09-03 | 제일모직주식회사 | 내황변성과 내충격성이 우수한 폴리에스테르 수지 조성물 |
| CN104812704B (zh) | 2012-11-28 | 2017-10-24 | 埃克森美孚化学专利公司 | 具有不寻常形态的mfi |
| WO2014104485A1 (ko) | 2012-12-28 | 2014-07-03 | 제일모직 주식회사 | 열가소성 수지 조성물 및 이를 포함한 성형품 |
| KR20140086738A (ko) | 2012-12-28 | 2014-07-08 | 제일모직주식회사 | 수지 조성물 및 이를 포함한 성형품 |
| SG11201506684VA (en) | 2013-03-14 | 2015-09-29 | Virent Inc | Production of aromatics from di-and poly-oxygenates |
| US9382185B2 (en) | 2013-03-15 | 2016-07-05 | Virent, Inc. | Processes for converting biomass-derived feedstocks to chemicals and liquid fuels |
| US9873836B2 (en) | 2013-05-22 | 2018-01-23 | Virent, Inc. | Process for converting biomass to aromatic hydrocarbons |
| WO2014190124A1 (en) | 2013-05-22 | 2014-11-27 | Virent, Inc. | Hydrogenation of carboxylic acids to increase yield of aromatics |
| US10301449B2 (en) | 2013-11-29 | 2019-05-28 | Lotte Advanced Materials Co., Ltd. | Thermoplastic resin composition having excellent light stability at high temperature |
| KR101690829B1 (ko) | 2013-12-30 | 2016-12-28 | 롯데첨단소재(주) | 내충격성 및 내광성이 우수한 열가소성 수지 조성물 |
| US10636951B2 (en) | 2014-06-27 | 2020-04-28 | Lotte Advanced Materials Co., Ltd. | Thermoplastic resin composition having excellent reflectivity |
| KR101793319B1 (ko) | 2014-12-17 | 2017-11-03 | 롯데첨단소재(주) | 폴리에스테르 수지 조성물 및 이로부터 제조된 성형품 |
| KR101849830B1 (ko) | 2015-06-30 | 2018-04-18 | 롯데첨단소재(주) | 내충격성 및 광신뢰성이 우수한 폴리에스테르 수지 조성물 및 이를 이용한 성형품 |
| BR112018012536B1 (pt) | 2015-12-21 | 2021-06-22 | Shell Internationale Research Maatschappij B.V. | Métodos para melhorar um combustível de querosene para atender especificação jato a- 1 ou especificação jp-8, para atender especificação an-8, e, para atender à especificação jato a ou f-24 |
| US20180319717A1 (en) * | 2017-05-03 | 2018-11-08 | Exxonmobil Chemical Patents Inc. | Processes and Systems for the Conversion of Acyclic Hydrocarbons |
| KR20200047651A (ko) | 2017-08-31 | 2020-05-07 | 우미코레 아게 운트 코 카게 | 배기 가스 정화용 수동적 질소 산화물 흡착제로서의 팔라듐/백금/제올라이트 기반 촉매의 용도 |
| JP2020531240A (ja) | 2017-08-31 | 2020-11-05 | ユミコア・アクチエンゲゼルシャフト・ウント・コムパニー・コマンディットゲゼルシャフトUmicore AG & Co.KG | 排気ガスを浄化するためのパラジウム/ゼオライト系受動的窒素酸化物吸着剤触媒 |
| US20200378286A1 (en) | 2018-01-05 | 2020-12-03 | Umicore Ag & Co. Kg | Passive nitrogen oxide adsorber |
| EP3824988B1 (en) | 2019-11-20 | 2025-03-05 | Umicore AG & Co. KG | Catalyst for reducing nitrogen oxides |
| AU2022364851A1 (en) | 2021-10-14 | 2024-05-02 | Virent, Inc. | Methods for reforming a heavy aromatic stream |
| CA3234160A1 (en) | 2021-10-14 | 2023-04-20 | Virent, Inc. | Methods for producing high purity aromatics from a mixed aromatic feed stream |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL289199A (enEXAMPLES) * | 1962-02-21 | |||
| GB1161974A (en) * | 1967-04-14 | 1969-08-20 | Mobil Oil Corp | Synthetic Crystalline Aluminosilicate and method of preparing the same |
| US3702886A (en) * | 1969-10-10 | 1972-11-14 | Mobil Oil Corp | Crystalline zeolite zsm-5 and method of preparing the same |
| US3926782A (en) * | 1973-02-09 | 1975-12-16 | Mobil Oil Corp | Hydrocarbon conversion |
| FR2228721A1 (en) * | 1973-05-07 | 1974-12-06 | Mobil Oil | ZSM-21 synthetic crystalline aluminosilicate zeolites - for use as hydrocarbon conversion catalysts |
| JPS5034309A (enEXAMPLES) * | 1973-07-11 | 1975-04-02 | ||
| US4016245A (en) * | 1973-09-04 | 1977-04-05 | Mobil Oil Corporation | Crystalline zeolite and method of preparing same |
| CA1040187A (en) * | 1973-09-07 | 1978-10-10 | Mobil Oil Corporation | Method of preparing a crystalline aluminosilicate zeolite |
| US4107195A (en) * | 1977-04-22 | 1978-08-15 | Mobil Oil Corporation | Preparation of zeolite ZSM-35 |
-
1977
- 1977-04-22 US US05/789,899 patent/US4139600A/en not_active Expired - Lifetime
-
1978
- 1978-04-12 CA CA300,992A patent/CA1110609A/en not_active Expired
- 1978-04-12 NZ NZ186958A patent/NZ186958A/xx unknown
- 1978-04-18 GB GB15190/78A patent/GB1588614A/en not_active Expired
- 1978-04-19 AU AU35236/78A patent/AU514414B2/en not_active Expired
- 1978-04-19 FR FR7811480A patent/FR2387908A1/fr active Granted
- 1978-04-21 JP JP4672778A patent/JPS53134799A/ja active Granted
- 1978-04-21 BE BE187028A patent/BE866270A/xx not_active IP Right Cessation
- 1978-04-21 DE DE19782817576 patent/DE2817576A1/de active Granted
- 1978-04-21 ZA ZA00782294A patent/ZA782294B/xx unknown
- 1978-04-21 NL NL7804287A patent/NL7804287A/xx not_active Application Discontinuation
- 1978-04-21 IT IT22607/78A patent/IT1094919B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| US4139600A (en) | 1979-02-13 |
| IT1094919B (it) | 1985-08-10 |
| DE2817576A1 (de) | 1978-11-02 |
| NZ186958A (en) | 1979-10-25 |
| BE866270A (fr) | 1978-10-23 |
| DE2817576C2 (enEXAMPLES) | 1988-04-28 |
| IT7822607A0 (it) | 1978-04-21 |
| AU514414B2 (en) | 1981-02-05 |
| NL7804287A (nl) | 1978-10-24 |
| FR2387908A1 (fr) | 1978-11-17 |
| FR2387908B1 (enEXAMPLES) | 1982-10-01 |
| ZA782294B (en) | 1979-12-27 |
| GB1588614A (en) | 1981-04-29 |
| JPS62845B2 (enEXAMPLES) | 1987-01-09 |
| AU3523678A (en) | 1979-10-25 |
| JPS53134799A (en) | 1978-11-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1110609A (en) | Synthesis of zeolite zsm-5 | |
| CA1107709A (en) | Preparation of zeolite zsm-35 | |
| US4640829A (en) | Synthesis of crystalline silicate ZSM-50 using dibenzyldimethylammonium ions and the product produced | |
| US4076842A (en) | Crystalline zeolite ZSM-23 and synthesis thereof | |
| US4104151A (en) | Organic compound conversion over ZSM-23 | |
| US4287166A (en) | Zeolite ZSM-39 | |
| US4146584A (en) | Catalytic conversion with zsm-35 | |
| US4585639A (en) | Preparation of crystalline silicate ZSM-12 | |
| US4585746A (en) | Synthesis of crystalline silicate ZSM-12 | |
| US4592902A (en) | Synthesis of crystalline silicate ZSM-5 with an alkyltropinium compound promoter | |
| US4533649A (en) | Method of preparing crystalline aluminosilicates | |
| EP0013630B1 (en) | Zsm-12 zeolite composition, method of preparing same and catalytic conversion therewith | |
| EP0162609B1 (en) | Preparation of zeolite zsm-12 | |
| EP0015132B1 (en) | Crystalline zeolitic material, synthesis and use thereof | |
| EP0142317A2 (en) | Crystalline silicate ZSM-48 and method for its preparation | |
| EP0026963A1 (en) | Method of producing large crystal zeolite ZSM-5 with controlled crystal size, and zeolite produced by this method | |
| US4259306A (en) | Synthesis of ZSM-39 | |
| EP0064328B2 (en) | Zeolite and catalytic conversion therewith | |
| EP0112006B1 (en) | Manufacture of low sodium zeolite | |
| EP0143642A2 (en) | A process for making zeolite ZSM-45 | |
| CA1261809A (en) | Synthetic crystalline zeolite its preparation and its uses | |
| EP0159845A2 (en) | Synthesis of crystalline zeolite | |
| US4639360A (en) | Synthesis of crystalline silicate ZSM-5 using an organic sulfonic acid | |
| US4357233A (en) | Catalytic conversion with zeolite ZSM-39 | |
| US5288475A (en) | Synthesis of ZSM-35 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |