CA1097347A - Pyrazolo[1,5-c]quinazoline derivatives and related compounds - Google Patents
Pyrazolo[1,5-c]quinazoline derivatives and related compoundsInfo
- Publication number
- CA1097347A CA1097347A CA279,853A CA279853A CA1097347A CA 1097347 A CA1097347 A CA 1097347A CA 279853 A CA279853 A CA 279853A CA 1097347 A CA1097347 A CA 1097347A
- Authority
- CA
- Canada
- Prior art keywords
- hydrogen
- phenyl
- alkyl
- carbons
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims abstract description 164
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 105
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 98
- 239000001257 hydrogen Substances 0.000 claims abstract description 97
- -1 benzyloxy, hydroxy Chemical group 0.000 claims abstract description 90
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 68
- 150000002431 hydrogen Chemical group 0.000 claims abstract description 47
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 32
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 21
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 18
- 150000002367 halogens Chemical class 0.000 claims abstract description 18
- 125000001589 carboacyl group Chemical group 0.000 claims abstract description 15
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 13
- 125000004423 acyloxy group Chemical group 0.000 claims abstract description 9
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 8
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 8
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 8
- 125000003435 aroyl group Chemical group 0.000 claims abstract description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 6
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 84
- 238000000034 method Methods 0.000 claims description 70
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 25
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 25
- 150000003839 salts Chemical class 0.000 claims description 25
- 150000003254 radicals Chemical class 0.000 claims description 16
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 15
- 239000000460 chlorine Substances 0.000 claims description 14
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 12
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 claims description 9
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 239000002168 alkylating agent Substances 0.000 claims description 5
- 229940100198 alkylating agent Drugs 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical group O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 claims 9
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 2
- 239000011737 fluorine Substances 0.000 claims 2
- 239000012435 aralkylating agent Substances 0.000 claims 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 abstract description 2
- 206010027654 Allergic conditions Diseases 0.000 abstract description 2
- 208000006673 asthma Diseases 0.000 abstract description 2
- 206010039083 rhinitis Diseases 0.000 abstract description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 119
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 69
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 69
- 239000000047 product Substances 0.000 description 66
- 239000000243 solution Substances 0.000 description 59
- 238000006243 chemical reaction Methods 0.000 description 56
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 54
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 45
- 239000011541 reaction mixture Substances 0.000 description 44
- 239000000203 mixture Substances 0.000 description 43
- 239000002244 precipitate Substances 0.000 description 42
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 40
- JUWOBCNAWKDBSM-UHFFFAOYSA-N 3-diazonio-1h-indol-2-olate Chemical compound C1=CC=C2C([N+]#N)=C([O-])NC2=C1 JUWOBCNAWKDBSM-UHFFFAOYSA-N 0.000 description 36
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 36
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 33
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 32
- 239000000706 filtrate Substances 0.000 description 30
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 26
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 26
- 239000007787 solid Substances 0.000 description 25
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 24
- 239000002904 solvent Substances 0.000 description 23
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 239000012043 crude product Substances 0.000 description 21
- 239000000725 suspension Substances 0.000 description 20
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 20
- 239000002253 acid Substances 0.000 description 19
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 15
- 239000000463 material Substances 0.000 description 15
- 229960000583 acetic acid Drugs 0.000 description 14
- 239000002585 base Substances 0.000 description 14
- 239000003960 organic solvent Substances 0.000 description 13
- TVDSBUOJIPERQY-UHFFFAOYSA-N prop-2-yn-1-ol Chemical compound OCC#C TVDSBUOJIPERQY-UHFFFAOYSA-N 0.000 description 13
- 238000010992 reflux Methods 0.000 description 13
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 12
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 229910052757 nitrogen Inorganic materials 0.000 description 12
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 11
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 11
- 238000001953 recrystallisation Methods 0.000 description 11
- 239000011734 sodium Substances 0.000 description 11
- 229910052708 sodium Inorganic materials 0.000 description 11
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 235000011054 acetic acid Nutrition 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 150000002170 ethers Chemical class 0.000 description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 8
- 235000011167 hydrochloric acid Nutrition 0.000 description 8
- 229960000443 hydrochloric acid Drugs 0.000 description 8
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 8
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 8
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 8
- JXDYKVIHCLTXOP-UHFFFAOYSA-N Pseudoisatin Natural products C1=CC=C2C(=O)C(=O)NC2=C1 JXDYKVIHCLTXOP-UHFFFAOYSA-N 0.000 description 7
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 7
- 125000003118 aryl group Chemical group 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 239000012279 sodium borohydride Substances 0.000 description 7
- 229910000033 sodium borohydride Inorganic materials 0.000 description 7
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 6
- 229910052783 alkali metal Inorganic materials 0.000 description 6
- 150000001340 alkali metals Chemical class 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 235000011089 carbon dioxide Nutrition 0.000 description 6
- 239000003638 chemical reducing agent Substances 0.000 description 6
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
- XLUKOGNIEDDIMV-UHFFFAOYSA-N pirquinozol Chemical compound C12=CC=CC=C2NC(=O)N2C1=CC(CO)=N2 XLUKOGNIEDDIMV-UHFFFAOYSA-N 0.000 description 6
- 229920006395 saturated elastomer Polymers 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 229910052786 argon Inorganic materials 0.000 description 5
- XRGPFNGLRSIPSA-UHFFFAOYSA-N butyn-2-one Chemical compound CC(=O)C#C XRGPFNGLRSIPSA-UHFFFAOYSA-N 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 5
- 229910052987 metal hydride Inorganic materials 0.000 description 5
- 150000004681 metal hydrides Chemical class 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- 239000007868 Raney catalyst Substances 0.000 description 4
- 229910000564 Raney nickel Inorganic materials 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000000908 ammonium hydroxide Substances 0.000 description 4
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 4
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- FMVJYQGSRWVMQV-UHFFFAOYSA-N ethyl propiolate Chemical compound CCOC(=O)C#C FMVJYQGSRWVMQV-UHFFFAOYSA-N 0.000 description 4
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 150000008282 halocarbons Chemical class 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- SMUQFGGVLNAIOZ-UHFFFAOYSA-N quinaldine Chemical compound C1=CC=CC2=NC(C)=CC=C21 SMUQFGGVLNAIOZ-UHFFFAOYSA-N 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- JITPLZPWKYUTDM-UHFFFAOYSA-N 1-phenylprop-2-yn-1-one Chemical group C#CC(=O)C1=CC=CC=C1 JITPLZPWKYUTDM-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- XNMQEEKYCVKGBD-UHFFFAOYSA-N 2-butyne Chemical compound CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 description 3
- CEBKHWWANWSNTI-UHFFFAOYSA-N 2-methylbut-3-yn-2-ol Chemical compound CC(C)(O)C#C CEBKHWWANWSNTI-UHFFFAOYSA-N 0.000 description 3
- KSLSOBUAIFEGLT-UHFFFAOYSA-N 2-phenylbut-3-yn-2-ol Chemical compound C#CC(O)(C)C1=CC=CC=C1 KSLSOBUAIFEGLT-UHFFFAOYSA-N 0.000 description 3
- CKPMFAQSMTWPDN-UHFFFAOYSA-N 3-methoxy-2-(5-methyl-1h-pyrazol-3-yl)aniline Chemical compound COC1=CC=CC(N)=C1C1=CC(C)=NN1 CKPMFAQSMTWPDN-UHFFFAOYSA-N 0.000 description 3
- ICGLPKIVTVWCFT-UHFFFAOYSA-N 4-methylbenzenesulfonohydrazide Chemical compound CC1=CC=C(S(=O)(=O)NN)C=C1 ICGLPKIVTVWCFT-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- 239000012448 Lithium borohydride Substances 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229910052770 Uranium Inorganic materials 0.000 description 3
- UDGOUYHRLVFCGU-UHFFFAOYSA-N [3-(2-nitrophenyl)-1h-pyrazol-5-yl]methyl acetate Chemical compound N1N=C(COC(=O)C)C=C1C1=CC=CC=C1[N+]([O-])=O UDGOUYHRLVFCGU-UHFFFAOYSA-N 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000000538 analytical sample Substances 0.000 description 3
- 229910000085 borane Inorganic materials 0.000 description 3
- ZGHSPCCBCXPOFH-UHFFFAOYSA-N chembl267256 Chemical compound C12=CC=CC=C2NC(=O)N2C1=CC(C(=O)O)=N2 ZGHSPCCBCXPOFH-UHFFFAOYSA-N 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- VHILMKFSCRWWIJ-UHFFFAOYSA-N dimethyl acetylenedicarboxylate Chemical compound COC(=O)C#CC(=O)OC VHILMKFSCRWWIJ-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000001640 fractional crystallisation Methods 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 238000002955 isolation Methods 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- YRPFQVYBQRBZCM-UHFFFAOYSA-N (3Z)-3-diazo-5-fluoro-1H-indol-2-one Chemical compound FC1=CC=C2NC(=O)C(=[N+]=[N-])C2=C1 YRPFQVYBQRBZCM-UHFFFAOYSA-N 0.000 description 2
- QVLAWKAXOMEXPM-UHFFFAOYSA-N 1,1,1,2-tetrachloroethane Chemical class ClCC(Cl)(Cl)Cl QVLAWKAXOMEXPM-UHFFFAOYSA-N 0.000 description 2
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- WNZNCUDUZGTJAE-UHFFFAOYSA-N 1,2-bis(hydroxymethyl)-6H-pyrazolo[1,5-c]quinazolin-5-one Chemical compound C1=CC=C2NC(=O)N3N=C(CO)C(CO)=C3C2=C1 WNZNCUDUZGTJAE-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- UIGLAZDLBZDVBL-UHFFFAOYSA-N 1-phenylprop-2-yn-1-ol Chemical compound C#CC(O)C1=CC=CC=C1 UIGLAZDLBZDVBL-UHFFFAOYSA-N 0.000 description 2
- UUYXQNZKKIRMCK-UHFFFAOYSA-N 10-chloro-2-(hydroxymethyl)-7-methoxy-6H-pyrazolo[1,5-c]quinazolin-5-one Chemical compound ClC=1C=2C=3N(C(NC2C(=CC1)OC)=O)N=C(C3)CO UUYXQNZKKIRMCK-UHFFFAOYSA-N 0.000 description 2
- KOPFEFZSAMLEHK-UHFFFAOYSA-N 1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1C=CNN=1 KOPFEFZSAMLEHK-UHFFFAOYSA-N 0.000 description 2
- HPYNZHMRTTWQTB-UHFFFAOYSA-N 2,3-dimethylpyridine Chemical compound CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 2
- PBZDFEPKMLPQJQ-UHFFFAOYSA-N 2-(5-oxo-6H-pyrazolo[1,5-c]quinazolin-2-yl)acetic acid Chemical compound C12=CC=CC=C2NC(=O)N2C1=CC(CC(=O)O)=N2 PBZDFEPKMLPQJQ-UHFFFAOYSA-N 0.000 description 2
- RUJKZIIUEMRWEG-UHFFFAOYSA-N 2-acetyl-6H-pyrazolo[1,5-c]quinazolin-5-one Chemical compound C12=CC=CC=C2NC(=O)N2C1=CC(C(=O)C)=N2 RUJKZIIUEMRWEG-UHFFFAOYSA-N 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- NECRQCBKTGZNMH-UHFFFAOYSA-N 3,5-dimethylhex-1-yn-3-ol Chemical compound CC(C)CC(C)(O)C#C NECRQCBKTGZNMH-UHFFFAOYSA-N 0.000 description 2
- COWFALGRNJAHKW-UHFFFAOYSA-N 3,6-dimethylhept-1-yn-3-ol Chemical compound CC(C)CCC(C)(O)C#C COWFALGRNJAHKW-UHFFFAOYSA-N 0.000 description 2
- QUQXOCIXAORUES-UHFFFAOYSA-N 3-(2-nitrophenyl)-1h-pyrazole-5-carboxylic acid Chemical group N1N=C(C(=O)O)C=C1C1=CC=CC=C1[N+]([O-])=O QUQXOCIXAORUES-UHFFFAOYSA-N 0.000 description 2
- HSYFISNDMZKGRS-UHFFFAOYSA-N 4-chloro-1h-indole-2,3-dione Chemical compound ClC1=CC=CC2=C1C(=O)C(=O)N2 HSYFISNDMZKGRS-UHFFFAOYSA-N 0.000 description 2
- DIFXCBNNWBBNCA-UHFFFAOYSA-N 4-methyl-3-propan-2-ylpent-1-yn-3-ol Chemical compound CC(C)C(O)(C#C)C(C)C DIFXCBNNWBBNCA-UHFFFAOYSA-N 0.000 description 2
- IBHSROAJVVUWSC-UHFFFAOYSA-N 4-phenylbut-3-yn-1-ol Chemical compound OCCC#CC1=CC=CC=C1 IBHSROAJVVUWSC-UHFFFAOYSA-N 0.000 description 2
- GKODDAXOSGGARJ-UHFFFAOYSA-N 5-Fluoroisatin Chemical compound FC1=CC=C2NC(=O)C(=O)C2=C1 GKODDAXOSGGARJ-UHFFFAOYSA-N 0.000 description 2
- VQZRVPWIZFFSQD-UHFFFAOYSA-N 6h-quinazolin-5-one Chemical compound C1=NC=C2C(=O)CC=CC2=N1 VQZRVPWIZFFSQD-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 208000006820 Arthralgia Diseases 0.000 description 2
- 241000167854 Bourreria succulenta Species 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- AAIPPVGJNQQVHN-UHFFFAOYSA-N ClC1=CC=CC2=C1C(=[N+]=[N-])C(=O)N2 Chemical compound ClC1=CC=CC2=C1C(=[N+]=[N-])C(=O)N2 AAIPPVGJNQQVHN-UHFFFAOYSA-N 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical class OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- 239000007818 Grignard reagent Substances 0.000 description 2
- NYHBQMYGNKIUIF-UUOKFMHZSA-N Guanosine Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O NYHBQMYGNKIUIF-UUOKFMHZSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 102000004861 Phosphoric Diester Hydrolases Human genes 0.000 description 2
- 108090001050 Phosphoric Diester Hydrolases Proteins 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- WKMTUSDFNWHAEX-UHFFFAOYSA-N [N].C1=CC=C2C(=O)C(=O)NC2=C1 Chemical group [N].C1=CC=C2C(=O)C(=O)NC2=C1 WKMTUSDFNWHAEX-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 230000003266 anti-allergic effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000005228 aryl sulfonate group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 229960004424 carbon dioxide Drugs 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 235000019693 cherries Nutrition 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 2
- AHXGRMIPHCAXFP-UHFFFAOYSA-L chromyl dichloride Chemical compound Cl[Cr](Cl)(=O)=O AHXGRMIPHCAXFP-UHFFFAOYSA-L 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000005265 dialkylamine group Chemical group 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 230000008014 freezing Effects 0.000 description 2
- 238000007710 freezing Methods 0.000 description 2
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 2
- 230000004927 fusion Effects 0.000 description 2
- 150000004795 grignard reagents Chemical class 0.000 description 2
- BTDWSZJDLLLTMI-UHFFFAOYSA-N hex-2-yn-1-ol Chemical compound CCCC#CCO BTDWSZJDLLLTMI-UHFFFAOYSA-N 0.000 description 2
- ODEHKVYXWLXRRR-UHFFFAOYSA-N hex-3-yn-1-ol Chemical compound CCC#CCCO ODEHKVYXWLXRRR-UHFFFAOYSA-N 0.000 description 2
- GOQJMMHTSOQIEI-UHFFFAOYSA-N hex-5-yn-1-ol Chemical compound OCCCCC#C GOQJMMHTSOQIEI-UHFFFAOYSA-N 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- VCJMYUPGQJHHFU-UHFFFAOYSA-N iron(3+);trinitrate Chemical compound [Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O VCJMYUPGQJHHFU-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- CCERQOYLJJULMD-UHFFFAOYSA-M magnesium;carbanide;chloride Chemical compound [CH3-].[Mg+2].[Cl-] CCERQOYLJJULMD-UHFFFAOYSA-M 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- YKYONYBAUNKHLG-UHFFFAOYSA-N n-Propyl acetate Natural products CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 2
- XVDBWWRIXBMVJV-UHFFFAOYSA-N n-[bis(dimethylamino)phosphanyl]-n-methylmethanamine Chemical compound CN(C)P(N(C)C)N(C)C XVDBWWRIXBMVJV-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- UYYCVBASZNFFRX-UHFFFAOYSA-N n-propan-2-ylcyclohexanamine Chemical compound CC(C)NC1CCCCC1 UYYCVBASZNFFRX-UHFFFAOYSA-N 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 125000003884 phenylalkyl group Chemical group 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- RIZZXCJMFIGMON-UHFFFAOYSA-N prop-2-ynyl acetate Chemical compound CC(=O)OCC#C RIZZXCJMFIGMON-UHFFFAOYSA-N 0.000 description 2
- 229940090181 propyl acetate Drugs 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 229920002545 silicone oil Polymers 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- GURJQHUTWUWLQT-UHFFFAOYSA-N (3Z)-3-diazo-1H-indol-2-one Chemical class C1=CC=C2C(=[N+]=[N-])C(=O)NC2=C1 GURJQHUTWUWLQT-UHFFFAOYSA-N 0.000 description 1
- XWBPLMGROVGKKF-UHFFFAOYSA-N (5-oxo-6H-pyrazolo[1,5-c]quinazolin-2-yl)methyl benzoate Chemical compound C1=C2C3=CC=CC=C3NC(=O)N2N=C1COC(=O)C1=CC=CC=C1 XWBPLMGROVGKKF-UHFFFAOYSA-N 0.000 description 1
- YFPYSIWEUQYAAE-UHFFFAOYSA-N (5-oxo-6H-pyrazolo[1,5-c]quinazolin-2-yl)methyl formate Chemical compound C12=CC=CC=C2NC(=O)N2C1=CC(COC=O)=N2 YFPYSIWEUQYAAE-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- SMCLTAARQYTXLW-UHFFFAOYSA-N 1,1-diphenylprop-2-yn-1-ol Chemical compound C=1C=CC=CC=1C(C#C)(O)C1=CC=CC=C1 SMCLTAARQYTXLW-UHFFFAOYSA-N 0.000 description 1
- ZDUXLFHBOAAXED-UHFFFAOYSA-N 1-(2-phenylethynyl)cyclopentan-1-ol Chemical group C=1C=CC=CC=1C#CC1(O)CCCC1 ZDUXLFHBOAAXED-UHFFFAOYSA-N 0.000 description 1
- LHIZLWMLLQYDJI-UHFFFAOYSA-N 1-(3-bromophenyl)prop-2-yn-1-one Chemical group BrC1=CC=CC(C(=O)C#C)=C1 LHIZLWMLLQYDJI-UHFFFAOYSA-N 0.000 description 1
- SAXCWLJQKWWFPP-UHFFFAOYSA-N 1-(4-ethylphenyl)prop-2-yn-1-one Chemical group CCC1=CC=C(C(=O)C#C)C=C1 SAXCWLJQKWWFPP-UHFFFAOYSA-N 0.000 description 1
- RESASAWFRNZNAI-UHFFFAOYSA-N 1-(4-methoxy-1h-indol-3-yl)ethanone Chemical compound COC1=CC=CC2=C1C(C(C)=O)=CN2 RESASAWFRNZNAI-UHFFFAOYSA-N 0.000 description 1
- GIGRWGTZFONRKA-UHFFFAOYSA-N 1-(bromomethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CBr)C=C1 GIGRWGTZFONRKA-UHFFFAOYSA-N 0.000 description 1
- VAPHNPPYYNVABJ-UHFFFAOYSA-N 1-acetyloxybut-2-ynyl acetate Chemical compound CC#CC(OC(C)=O)OC(C)=O VAPHNPPYYNVABJ-UHFFFAOYSA-N 0.000 description 1
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 1
- WTKFRAVINPCRPO-UHFFFAOYSA-N 1-ethoxyhex-2-yne Chemical compound CCCC#CCOCC WTKFRAVINPCRPO-UHFFFAOYSA-N 0.000 description 1
- CZJRAKLNHAXUMW-UHFFFAOYSA-N 1-ethoxypent-2-yne Chemical compound CCOCC#CCC CZJRAKLNHAXUMW-UHFFFAOYSA-N 0.000 description 1
- QYLFHLNFIHBCPR-UHFFFAOYSA-N 1-ethynylcyclohexan-1-ol Chemical compound C#CC1(O)CCCCC1 QYLFHLNFIHBCPR-UHFFFAOYSA-N 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- USIWFRXFQFZXGK-UHFFFAOYSA-N 1-methoxybut-2-yne Chemical compound COCC#CC USIWFRXFQFZXGK-UHFFFAOYSA-N 0.000 description 1
- CXBDYQVECUFKRK-UHFFFAOYSA-N 1-methoxybutane Chemical compound CCCCOC CXBDYQVECUFKRK-UHFFFAOYSA-N 0.000 description 1
- ZWEGEEXPHXUUFO-UHFFFAOYSA-N 1-methoxyhex-2-yne Chemical compound CCCC#CCOC ZWEGEEXPHXUUFO-UHFFFAOYSA-N 0.000 description 1
- CITQCULWWBRCLV-UHFFFAOYSA-N 1-methyl-5-oxo-6H-pyrazolo[1,5-c]quinazoline-2-carboxylic acid Chemical compound C1=CC=C2NC(=O)N3N=C(C(O)=O)C(C)=C3C2=C1 CITQCULWWBRCLV-UHFFFAOYSA-N 0.000 description 1
- KCIHLNMGMBTAIB-UHFFFAOYSA-N 1-methyl-6H-pyrazolo[1,5-c]quinazolin-5-one Chemical compound C1=CC=C2NC(=O)N3N=CC(C)=C3C2=C1 KCIHLNMGMBTAIB-UHFFFAOYSA-N 0.000 description 1
- HGUIQUVFOYTZNC-UHFFFAOYSA-N 1-phenylhex-1-yn-3-ol Chemical compound CCCC(O)C#CC1=CC=CC=C1 HGUIQUVFOYTZNC-UHFFFAOYSA-N 0.000 description 1
- QWCMSASONHVIHV-UHFFFAOYSA-N 1-phenylpent-1-yn-3-ol Chemical compound CCC(O)C#CC1=CC=CC=C1 QWCMSASONHVIHV-UHFFFAOYSA-N 0.000 description 1
- DVMVFRCTQPYCGE-UHFFFAOYSA-N 1-prop-2-ynoxybutane Chemical compound CCCCOCC#C DVMVFRCTQPYCGE-UHFFFAOYSA-N 0.000 description 1
- MSYFIWASYMWJLU-UHFFFAOYSA-N 1-prop-2-ynoxyhexane Chemical compound CCCCCCOCC#C MSYFIWASYMWJLU-UHFFFAOYSA-N 0.000 description 1
- ABSZGCMDKLBNDD-UHFFFAOYSA-N 10-chloro-2-(hydroxymethyl)-6H-pyrazolo[1,5-c]quinazolin-5-one Chemical compound ClC=1C=2C=3N(C(NC2C=CC1)=O)N=C(C3)CO ABSZGCMDKLBNDD-UHFFFAOYSA-N 0.000 description 1
- QIANDAMJJYNOQS-UHFFFAOYSA-N 10-methoxy-5-oxo-6H-pyrazolo[1,5-c]quinazoline-2-carbaldehyde Chemical group COC=1C=2C=3N(C(NC2C=CC1)=O)N=C(C3)C=O QIANDAMJJYNOQS-UHFFFAOYSA-N 0.000 description 1
- LXOFYPKXCSULTL-UHFFFAOYSA-N 2,4,7,9-tetramethyldec-5-yne-4,7-diol Chemical compound CC(C)CC(C)(O)C#CC(C)(O)CC(C)C LXOFYPKXCSULTL-UHFFFAOYSA-N 0.000 description 1
- CENDNMFHRRPMJG-UHFFFAOYSA-N 2,5-dichloro-n-ethylaniline Chemical compound CCNC1=CC(Cl)=CC=C1Cl CENDNMFHRRPMJG-UHFFFAOYSA-N 0.000 description 1
- JQBFREYGLSKPCL-UHFFFAOYSA-N 2,5-dimethylhex-3-yn-2-ol Chemical compound CC(C)C#CC(C)(C)O JQBFREYGLSKPCL-UHFFFAOYSA-N 0.000 description 1
- IHJUECRFYCQBMW-UHFFFAOYSA-N 2,5-dimethylhex-3-yne-2,5-diol Chemical compound CC(C)(O)C#CC(C)(C)O IHJUECRFYCQBMW-UHFFFAOYSA-N 0.000 description 1
- DARFJHUIIOKVKX-UHFFFAOYSA-N 2-(1-hydroxyethyl)-6-methylpyrazolo[1,5-c]quinazolin-5-one Chemical compound C12=CC=CC=C2N(C)C(=O)N2C1=CC(C(O)C)=N2 DARFJHUIIOKVKX-UHFFFAOYSA-N 0.000 description 1
- GCIKOONKARCIJK-UHFFFAOYSA-N 2-(2-hydroxyethyl)-9-methoxy-6-methylpyrazolo[1,5-c]quinazolin-5-one Chemical compound CN1C(=O)N2N=C(CCO)C=C2C2=CC(OC)=CC=C21 GCIKOONKARCIJK-UHFFFAOYSA-N 0.000 description 1
- PNIVUKKVMLDPEZ-UHFFFAOYSA-N 2-(2-morpholin-4-yl-2-sulfanylideneethyl)-6H-pyrazolo[1,5-c]quinazolin-5-one Chemical compound N=1N2C(=O)NC3=CC=CC=C3C2=CC=1CC(=S)N1CCOCC1 PNIVUKKVMLDPEZ-UHFFFAOYSA-N 0.000 description 1
- FRBPQCLLIANCNT-UHFFFAOYSA-N 2-(hydroxymethyl)-10-methoxy-6H-pyrazolo[1,5-c]quinazolin-5-one Chemical compound OCC1=NN2C(NC=3C=CC=C(C3C2=C1)OC)=O FRBPQCLLIANCNT-UHFFFAOYSA-N 0.000 description 1
- YWKBMTRZVIUCAO-UHFFFAOYSA-N 2-(hydroxymethyl)-6-methylpyrazolo[1,5-c]quinazolin-5-one Chemical compound C1=CC=C2C3=CC(CO)=NN3C(=O)N(C)C2=C1 YWKBMTRZVIUCAO-UHFFFAOYSA-N 0.000 description 1
- BQKOTQVQHGZPSB-UHFFFAOYSA-N 2-(hydroxymethyl)-7-(trifluoromethyl)-6H-pyrazolo[1,5-c]quinazolin-5-one Chemical compound C12=CC=CC(C(F)(F)F)=C2NC(=O)N2C1=CC(CO)=N2 BQKOTQVQHGZPSB-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- JVKRKMWZYMKVTQ-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]pyrazol-1-yl]-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C=NN(C=1)CC(=O)NC1=CC2=C(NC(O2)=O)C=C1 JVKRKMWZYMKVTQ-UHFFFAOYSA-N 0.000 description 1
- AVVVCBGNVKCHKR-UHFFFAOYSA-N 2-[hydroxy(phenyl)methyl]-6H-pyrazolo[1,5-c]quinazolin-5-one Chemical compound C1=C2C3=CC=CC=C3NC(=O)N2N=C1C(O)C1=CC=CC=C1 AVVVCBGNVKCHKR-UHFFFAOYSA-N 0.000 description 1
- QIGSPXPODKLGRK-UHFFFAOYSA-N 2-methyl-2-prop-2-ynoxypropane Chemical compound CC(C)(C)OCC#C QIGSPXPODKLGRK-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- SPLYFWRRAFIWQH-UHFFFAOYSA-N 2-methylhex-3-yn-2-ol Chemical compound CCC#CC(C)(C)O SPLYFWRRAFIWQH-UHFFFAOYSA-N 0.000 description 1
- GVCJLTJIXQROOE-UHFFFAOYSA-N 2-methyloct-3-yn-2-ol Chemical compound CCCCC#CC(C)(C)O GVCJLTJIXQROOE-UHFFFAOYSA-N 0.000 description 1
- JPKQHUHDYLMRJW-UHFFFAOYSA-N 2-methylpent-3-yn-2-ol Chemical compound CC#CC(C)(C)O JPKQHUHDYLMRJW-UHFFFAOYSA-N 0.000 description 1
- ZAWLBSATNLQTON-UHFFFAOYSA-N 2-nonynoic acid Chemical compound CCCCCCC#CC(O)=O ZAWLBSATNLQTON-UHFFFAOYSA-N 0.000 description 1
- BQDKCWCMDBMLEH-UHFFFAOYSA-N 2-octynoic acid Chemical compound CCCCCC#CC(O)=O BQDKCWCMDBMLEH-UHFFFAOYSA-N 0.000 description 1
- XXWIEGOAVMLISY-UHFFFAOYSA-N 3,4,4-trimethylpent-1-yn-3-ol Chemical compound CC(C)(C)C(C)(O)C#C XXWIEGOAVMLISY-UHFFFAOYSA-N 0.000 description 1
- DZNLEQBXXLGELU-UHFFFAOYSA-N 3,4-dimethylpent-1-yn-3-ol Chemical compound CC(C)C(C)(O)C#C DZNLEQBXXLGELU-UHFFFAOYSA-N 0.000 description 1
- FADIFRKKGSXQIQ-UHFFFAOYSA-N 3,6-diethyloct-4-yne-3,6-diol Chemical compound CCC(O)(CC)C#CC(O)(CC)CC FADIFRKKGSXQIQ-UHFFFAOYSA-N 0.000 description 1
- FKJVXCCFZNLKSJ-UHFFFAOYSA-N 3,6-dimethyloct-4-yne Chemical compound CCC(C)C#CC(C)CC FKJVXCCFZNLKSJ-UHFFFAOYSA-N 0.000 description 1
- NUYADIDKTLPDGG-UHFFFAOYSA-N 3,6-dimethyloct-4-yne-3,6-diol Chemical compound CCC(C)(O)C#CC(C)(O)CC NUYADIDKTLPDGG-UHFFFAOYSA-N 0.000 description 1
- BDVJDCNYDDTQAY-UHFFFAOYSA-N 3-diazonio-1-methylindol-2-olate Chemical compound C1=CC=C2N(C)C([O-])=C([N+]#N)C2=C1 BDVJDCNYDDTQAY-UHFFFAOYSA-N 0.000 description 1
- ADJMUEKUQLFLQP-UHFFFAOYSA-N 3-ethoxyprop-1-yne Chemical compound CCOCC#C ADJMUEKUQLFLQP-UHFFFAOYSA-N 0.000 description 1
- FMLRBVOUYLRDRV-UHFFFAOYSA-N 3-ethyl-5-methylhept-1-yn-3-ol Chemical compound CCC(C)CC(O)(CC)C#C FMLRBVOUYLRDRV-UHFFFAOYSA-N 0.000 description 1
- TXCLTIFWSNGTIK-UHFFFAOYSA-N 3-ethylhept-1-yn-3-ol Chemical compound CCCCC(O)(CC)C#C TXCLTIFWSNGTIK-UHFFFAOYSA-N 0.000 description 1
- PUNRPAWKFTXZIW-UHFFFAOYSA-N 3-ethylpent-1-yn-3-ol Chemical compound CCC(O)(CC)C#C PUNRPAWKFTXZIW-UHFFFAOYSA-N 0.000 description 1
- YACFFSVYSPMSGS-UHFFFAOYSA-N 3-methoxyprop-1-yne Chemical compound COCC#C YACFFSVYSPMSGS-UHFFFAOYSA-N 0.000 description 1
- MTBIBEIZKLZPIM-UHFFFAOYSA-N 3-methyl-1-phenylpent-1-yn-3-ol Chemical compound CCC(C)(O)C#CC1=CC=CC=C1 MTBIBEIZKLZPIM-UHFFFAOYSA-N 0.000 description 1
- KHKXRZKMAVADSE-UHFFFAOYSA-N 3-methylhept-1-yn-3-ol Chemical compound CCCCC(C)(O)C#C KHKXRZKMAVADSE-UHFFFAOYSA-N 0.000 description 1
- RPXNDOUSGSHEJE-UHFFFAOYSA-N 3-methylhept-4-yn-3-ol Chemical compound CCC#CC(C)(O)CC RPXNDOUSGSHEJE-UHFFFAOYSA-N 0.000 description 1
- DTGUZRPEDLHAAO-UHFFFAOYSA-N 3-methylhex-1-yn-3-ol Chemical compound CCCC(C)(O)C#C DTGUZRPEDLHAAO-UHFFFAOYSA-N 0.000 description 1
- JVURSYOTRJKAQC-UHFFFAOYSA-N 3-methylnon-1-yne Chemical compound CCCCCCC(C)C#C JVURSYOTRJKAQC-UHFFFAOYSA-N 0.000 description 1
- NITUNGCLDSFVDL-UHFFFAOYSA-N 3-phenylprop-2-yn-1-ol Chemical compound OCC#CC1=CC=CC=C1 NITUNGCLDSFVDL-UHFFFAOYSA-N 0.000 description 1
- IDASOVSVRKONFS-UHFFFAOYSA-N 3-phenylprop-2-ynal Chemical compound O=CC#CC1=CC=CC=C1 IDASOVSVRKONFS-UHFFFAOYSA-N 0.000 description 1
- HRDCVMSNCBAMAM-UHFFFAOYSA-N 3-prop-2-ynoxyprop-1-yne Chemical compound C#CCOCC#C HRDCVMSNCBAMAM-UHFFFAOYSA-N 0.000 description 1
- HCKFFIBKYQSDRD-UHFFFAOYSA-N 4,7-dimethyldec-5-yne-4,7-diol Chemical compound CCCC(C)(O)C#CC(C)(O)CCC HCKFFIBKYQSDRD-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- VZPMNHWRRJFLFO-UHFFFAOYSA-N 4-chloro-7-methoxy-1h-indole-2,3-dione Chemical compound COC1=CC=C(Cl)C2=C1NC(=O)C2=O VZPMNHWRRJFLFO-UHFFFAOYSA-N 0.000 description 1
- OLXSSIGLMQHXHR-UHFFFAOYSA-N 4-ethylhex-1-yn-3-ol Chemical compound CCC(CC)C(O)C#C OLXSSIGLMQHXHR-UHFFFAOYSA-N 0.000 description 1
- CUUQUEAUUPYEKK-UHFFFAOYSA-N 4-ethyloct-1-yn-3-ol Chemical compound CCCCC(CC)C(O)C#C CUUQUEAUUPYEKK-UHFFFAOYSA-N 0.000 description 1
- OOCSBICJYSHWEV-UHFFFAOYSA-N 4-methyl-n'-[3-oxo-7-(trifluoromethyl)indol-2-yl]benzenesulfonohydrazide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NN=C1C(=O)C(C=CC=C2C(F)(F)F)=C2N1 OOCSBICJYSHWEV-UHFFFAOYSA-N 0.000 description 1
- WONUPNLSAKXVSN-UHFFFAOYSA-N 4-methylhept-1-yn-3-ol Chemical compound CCCC(C)C(O)C#C WONUPNLSAKXVSN-UHFFFAOYSA-N 0.000 description 1
- HWVNLGPDLREHJB-UHFFFAOYSA-N 4-methyloct-2-yn-4-ol Chemical compound CCCCC(C)(O)C#CC HWVNLGPDLREHJB-UHFFFAOYSA-N 0.000 description 1
- UTIFIONYBLSHIL-UHFFFAOYSA-N 4-methylpent-1-yn-3-ol Chemical compound CC(C)C(O)C#C UTIFIONYBLSHIL-UHFFFAOYSA-N 0.000 description 1
- ZYXFHJONEBDDTB-UHFFFAOYSA-N 4-phenylbut-3-yn-2-one Chemical compound C1(=CC=CC=C1)C#CC(C)=O.C(C)(=O)C#CC1=CC=CC=C1 ZYXFHJONEBDDTB-UHFFFAOYSA-N 0.000 description 1
- XKVUYEYANWFIJX-UHFFFAOYSA-N 5-methyl-1h-pyrazole Chemical compound CC1=CC=NN1 XKVUYEYANWFIJX-UHFFFAOYSA-N 0.000 description 1
- NTNUBJHPRAMQPC-UHFFFAOYSA-N 5-methylhex-1-yn-3-ol Chemical compound CC(C)CC(O)C#C NTNUBJHPRAMQPC-UHFFFAOYSA-N 0.000 description 1
- XOEQKPGAZHISQQ-UHFFFAOYSA-N 5-methylhex-3-yn-1-ol Chemical compound CC(C)C#CCCO XOEQKPGAZHISQQ-UHFFFAOYSA-N 0.000 description 1
- UWQZATMGBARJPE-UHFFFAOYSA-N 5-nonyn-3-ol Chemical compound CCCC#CCC(O)CC UWQZATMGBARJPE-UHFFFAOYSA-N 0.000 description 1
- NZHQPHNRHGXTEE-UHFFFAOYSA-N 5-oxo-6H-pyrazolo[1,5-c]quinazoline-1-carbaldehyde Chemical compound C1=CC=C2NC(=O)N3N=CC(C=O)=C3C2=C1 NZHQPHNRHGXTEE-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- BWIOURVJVDKDOC-UHFFFAOYSA-N 6-bromo-1-(chloromethyl)-2-methoxynaphthalene Chemical compound C1=C(Br)C=CC2=C(CCl)C(OC)=CC=C21 BWIOURVJVDKDOC-UHFFFAOYSA-N 0.000 description 1
- JVUYLVMRBQNROA-UHFFFAOYSA-N 6-phenylhex-5-yn-3-ol Chemical compound CCC(O)CC#CC1=CC=CC=C1 JVUYLVMRBQNROA-UHFFFAOYSA-N 0.000 description 1
- MXLDJTXXAYVWDF-UHFFFAOYSA-N 7-(trifluoromethyl)-1h-indole-2,3-dione Chemical compound FC(F)(F)C1=CC=CC2=C1NC(=O)C2=O MXLDJTXXAYVWDF-UHFFFAOYSA-N 0.000 description 1
- LLQIWGSLABQXHM-UHFFFAOYSA-N 9-chloro-2-(hydroxymethyl)-6H-pyrazolo[1,5-c]quinazolin-5-one Chemical compound C12=CC(Cl)=CC=C2NC(=O)N2C1=CC(CO)=N2 LLQIWGSLABQXHM-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- 241000156724 Antirhea Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 1
- DCWRDGVXEBJCOY-UHFFFAOYSA-N COC1=CC=C(Cl)C2=C1NC(=O)C2=[N+]=[N-] Chemical compound COC1=CC=C(Cl)C2=C1NC(=O)C2=[N+]=[N-] DCWRDGVXEBJCOY-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 240000007681 Catha edulis Species 0.000 description 1
- 235000006696 Catha edulis Nutrition 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 238000003716 Corey-Seebach umpolung reaction Methods 0.000 description 1
- MIKUYHXYGGJMLM-GIMIYPNGSA-N Crotonoside Natural products C1=NC2=C(N)NC(=O)N=C2N1[C@H]1O[C@@H](CO)[C@H](O)[C@@H]1O MIKUYHXYGGJMLM-GIMIYPNGSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- NYHBQMYGNKIUIF-UHFFFAOYSA-N D-guanosine Natural products C1=2NC(N)=NC(=O)C=2N=CN1C1OC(CO)C(O)C1O NYHBQMYGNKIUIF-UHFFFAOYSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000257303 Hymenoptera Species 0.000 description 1
- 208000001718 Immediate Hypersensitivity Diseases 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 206010023230 Joint stiffness Diseases 0.000 description 1
- 206010023232 Joint swelling Diseases 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- DTAFLBZLAZYRDX-UHFFFAOYSA-N OOOOOO Chemical compound OOOOOO DTAFLBZLAZYRDX-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- ZTHYODDOHIVTJV-UHFFFAOYSA-N Propyl gallate Chemical compound CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 ZTHYODDOHIVTJV-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 206010045240 Type I hypersensitivity Diseases 0.000 description 1
- 238000005672 Willgerodt-Kindler rearrangement reaction Methods 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- GANNOFFDYMSBSZ-UHFFFAOYSA-N [AlH3].[Mg] Chemical compound [AlH3].[Mg] GANNOFFDYMSBSZ-UHFFFAOYSA-N 0.000 description 1
- JEDZLBFUGJTJGQ-UHFFFAOYSA-N [Na].COCCO[AlH]OCCOC Chemical compound [Na].COCCO[AlH]OCCOC JEDZLBFUGJTJGQ-UHFFFAOYSA-N 0.000 description 1
- GOPYZMJAIPBUGX-UHFFFAOYSA-N [O-2].[O-2].[Mn+4] Chemical class [O-2].[O-2].[Mn+4] GOPYZMJAIPBUGX-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- PZAGQUOSOTUKEC-UHFFFAOYSA-N acetic acid;sulfuric acid Chemical compound CC(O)=O.OS(O)(=O)=O PZAGQUOSOTUKEC-UHFFFAOYSA-N 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 229960005305 adenosine Drugs 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical class Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- BIVUUOPIAYRCAP-UHFFFAOYSA-N aminoazanium;chloride Chemical compound Cl.NN BIVUUOPIAYRCAP-UHFFFAOYSA-N 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 208000003455 anaphylaxis Diseases 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 239000000043 antiallergic agent Substances 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000002249 anxiolytic agent Substances 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 208000010216 atopic IgE responsiveness Diseases 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- AZWXAPCAJCYGIA-UHFFFAOYSA-N bis(2-methylpropyl)alumane Chemical compound CC(C)C[AlH]CC(C)C AZWXAPCAJCYGIA-UHFFFAOYSA-N 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 239000000168 bronchodilator agent Substances 0.000 description 1
- FFFMSANAQQVUJA-UHFFFAOYSA-N but-1-ynylbenzene Chemical compound CCC#CC1=CC=CC=C1 FFFMSANAQQVUJA-UHFFFAOYSA-N 0.000 description 1
- OTJZCIYGRUNXTP-UHFFFAOYSA-N but-3-yn-1-ol Chemical compound OCCC#C OTJZCIYGRUNXTP-UHFFFAOYSA-N 0.000 description 1
- GKPOMITUDGXOSB-UHFFFAOYSA-N but-3-yn-2-ol Chemical compound CC(O)C#C GKPOMITUDGXOSB-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- YTIVTFGABIZHHX-UHFFFAOYSA-N butynedioic acid Chemical compound OC(=O)C#CC(O)=O YTIVTFGABIZHHX-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229960000846 camphor Drugs 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229950005499 carbon tetrachloride Drugs 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- VSSQXOURQLCLKF-UHFFFAOYSA-N chembl1399597 Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N=NC1=C(O)NC2=CC=CC=C12 VSSQXOURQLCLKF-UHFFFAOYSA-N 0.000 description 1
- FBJYBPMTLRBZRC-UHFFFAOYSA-N chembl267929 Chemical compound C12=CC=CC=C2NC(=O)N2C1=CC(C(=O)OCC)=N2 FBJYBPMTLRBZRC-UHFFFAOYSA-N 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 239000007958 cherry flavor Substances 0.000 description 1
- 229940112822 chewing gum Drugs 0.000 description 1
- 235000015218 chewing gum Nutrition 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- IQFVPQOLBLOTPF-HKXUKFGYSA-L congo red Chemical compound [Na+].[Na+].C1=CC=CC2=C(N)C(/N=N/C3=CC=C(C=C3)C3=CC=C(C=C3)/N=N/C3=C(C4=CC=CC=C4C(=C3)S([O-])(=O)=O)N)=CC(S([O-])(=O)=O)=C21 IQFVPQOLBLOTPF-HKXUKFGYSA-L 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 229940045803 cuprous chloride Drugs 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- GFLHGTKUCYPXHB-UHFFFAOYSA-N dec-2-yn-1-ol Chemical compound CCCCCCCC#CCO GFLHGTKUCYPXHB-UHFFFAOYSA-N 0.000 description 1
- YGEQBZUDPQQIFI-UHFFFAOYSA-N dec-3-yn-1-ol Chemical compound CCCCCCC#CCCO YGEQBZUDPQQIFI-UHFFFAOYSA-N 0.000 description 1
- 230000000911 decarboxylating effect Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 125000005266 diarylamine group Chemical class 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- STRNXFOUBFLVIN-UHFFFAOYSA-N diethyl but-2-ynedioate Chemical compound CCOC(=O)C#CC(=O)OCC STRNXFOUBFLVIN-UHFFFAOYSA-N 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- UTKODRSJSBALCZ-UHFFFAOYSA-N dimethyl 5-oxo-6H-pyrazolo[1,5-c]quinazoline-1,2-dicarboxylate Chemical compound C=1(C(=NN2C(NC=3C=CC=CC=3C2=1)=O)C(=O)OC)C(=O)OC UTKODRSJSBALCZ-UHFFFAOYSA-N 0.000 description 1
- HXJFQNUWPUICNY-UHFFFAOYSA-N disiamylborane Chemical compound CC(C)C(C)BC(C)C(C)C HXJFQNUWPUICNY-UHFFFAOYSA-N 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- HFTNNOZFRQLFQB-UHFFFAOYSA-N ethenoxy(trimethyl)silane Chemical compound C[Si](C)(C)OC=C HFTNNOZFRQLFQB-UHFFFAOYSA-N 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 1
- MLIWKCFQRXJSII-UHFFFAOYSA-N ethyl 3-(4-ethoxyphenyl)prop-2-ynoate Chemical compound CCOC(=O)C#CC1=CC=C(OCC)C=C1 MLIWKCFQRXJSII-UHFFFAOYSA-N 0.000 description 1
- ACJOYTKWHPEIHW-UHFFFAOYSA-N ethyl 3-phenylprop-2-ynoate Chemical compound CCOC(=O)C#CC1=CC=CC=C1 ACJOYTKWHPEIHW-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- GDCQMGYMFGPMCX-UHFFFAOYSA-N ethyl hept-2-ynoate Chemical compound CCCCC#CC(=O)OCC GDCQMGYMFGPMCX-UHFFFAOYSA-N 0.000 description 1
- QPMDWYXUSMRVKT-UHFFFAOYSA-N ethyl oct-2-ynoate Chemical compound CCCCCC#CC(=O)OCC QPMDWYXUSMRVKT-UHFFFAOYSA-N 0.000 description 1
- XDPRPKSTFBPPHU-UHFFFAOYSA-N ethyl pent-2-ynoate Chemical compound CCOC(=O)C#CCC XDPRPKSTFBPPHU-UHFFFAOYSA-N 0.000 description 1
- WMYNMYVRWWCRPS-UHFFFAOYSA-N ethynoxyethane Chemical group CCOC#C WMYNMYVRWWCRPS-UHFFFAOYSA-N 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229940029575 guanosine Drugs 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- OGDYROFIIXDTQK-UHFFFAOYSA-N hept-2-yn-1-ol Chemical compound CCCCC#CCO OGDYROFIIXDTQK-UHFFFAOYSA-N 0.000 description 1
- AYFRKLSJSAVMRG-UHFFFAOYSA-N hept-2-yn-4-ol Chemical compound CCCC(O)C#CC AYFRKLSJSAVMRG-UHFFFAOYSA-N 0.000 description 1
- UEERQXQKEJPYBR-UHFFFAOYSA-N hept-2-ynoic acid Chemical compound CCCCC#CC(O)=O UEERQXQKEJPYBR-UHFFFAOYSA-N 0.000 description 1
- PSWHODJVUOXHKA-UHFFFAOYSA-N hept-3-yn-1-ol Chemical compound CCCC#CCCO PSWHODJVUOXHKA-UHFFFAOYSA-N 0.000 description 1
- KVCFELYYDWVHQI-UHFFFAOYSA-N hept-3-yn-2-one Chemical compound CCCC#CC(C)=O KVCFELYYDWVHQI-UHFFFAOYSA-N 0.000 description 1
- CXVIEBMEWKSONY-UHFFFAOYSA-N hept-4-yn-2-ol Chemical compound CCC#CCC(C)O CXVIEBMEWKSONY-UHFFFAOYSA-N 0.000 description 1
- FMOKAMXPKGORIR-UHFFFAOYSA-N hept-4-yn-3-ol Chemical compound CCC#CC(O)CC FMOKAMXPKGORIR-UHFFFAOYSA-N 0.000 description 1
- VOHBMHAELZLACG-UHFFFAOYSA-N hept-5-yn-3-ol Chemical compound CCC(O)CC#CC VOHBMHAELZLACG-UHFFFAOYSA-N 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- KSJAIMUFADDAOP-UHFFFAOYSA-N hex-1-yn-3-one Chemical compound CCCC(=O)C#C KSJAIMUFADDAOP-UHFFFAOYSA-N 0.000 description 1
- AKYAUBWOTZJUBI-UHFFFAOYSA-N hex-2-ynoic acid Chemical compound CCCC#CC(O)=O AKYAUBWOTZJUBI-UHFFFAOYSA-N 0.000 description 1
- IFCAMPHNVKBSTF-UHFFFAOYSA-N hex-3-yn-2-ol Chemical compound CCC#CC(C)O IFCAMPHNVKBSTF-UHFFFAOYSA-N 0.000 description 1
- KDOWHHULNTXTNS-UHFFFAOYSA-N hex-3-yne-2,5-diol Chemical compound CC(O)C#CC(C)O KDOWHHULNTXTNS-UHFFFAOYSA-N 0.000 description 1
- KARLLBDFLHNKBO-UHFFFAOYSA-N hex-4-yn-3-ol Chemical compound CCC(O)C#CC KARLLBDFLHNKBO-UHFFFAOYSA-N 0.000 description 1
- AJYGRAORQSCNED-UHFFFAOYSA-N hex-5-yn-3-ol Chemical compound CCC(O)CC#C AJYGRAORQSCNED-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000002506 high-vacuum sublimation Methods 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- BICAGYDGRXJYGD-UHFFFAOYSA-N hydrobromide;hydrochloride Chemical compound Cl.Br BICAGYDGRXJYGD-UHFFFAOYSA-N 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 208000026278 immune system disease Diseases 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 125000006303 iodophenyl group Chemical group 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- XMGQYMWWDOXHJM-UHFFFAOYSA-N limonene Chemical compound CC(=C)C1CCC(C)=CC1 XMGQYMWWDOXHJM-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- QRNDDJXJUHBGSG-UHFFFAOYSA-N methoxyethyne Chemical group COC#C QRNDDJXJUHBGSG-UHFFFAOYSA-N 0.000 description 1
- PTGOHFYICMWCAG-UHFFFAOYSA-N methyl 3-(3-chlorophenyl)prop-2-ynoate Chemical compound COC(=O)C#CC1=CC=CC(Cl)=C1 PTGOHFYICMWCAG-UHFFFAOYSA-N 0.000 description 1
- UJQCANQILFWSDJ-UHFFFAOYSA-N methyl but-2-ynoate Chemical compound COC(=O)C#CC UJQCANQILFWSDJ-UHFFFAOYSA-N 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- IMAKHNTVDGLIRY-UHFFFAOYSA-N methyl prop-2-ynoate Chemical compound COC(=O)C#C IMAKHNTVDGLIRY-UHFFFAOYSA-N 0.000 description 1
- QXLPXWSKPNOQLE-UHFFFAOYSA-N methylpentynol Chemical compound CCC(C)(O)C#C QXLPXWSKPNOQLE-UHFFFAOYSA-N 0.000 description 1
- QWMBNUKJLSUYAQ-UHFFFAOYSA-N n'-(4-chloro-2-oxoindol-3-yl)-4-methylbenzenesulfonohydrazide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NNC1=C(C(Cl)=CC=C2)C2=NC1=O QWMBNUKJLSUYAQ-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 230000010925 negative regulation of granuloma formation Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 125000004971 nitroalkyl group Chemical group 0.000 description 1
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- XERDOEKKHDALKJ-UHFFFAOYSA-N non-2-yn-1-ol Chemical compound CCCCCCC#CCO XERDOEKKHDALKJ-UHFFFAOYSA-N 0.000 description 1
- TZZVRLFUTNYDEG-UHFFFAOYSA-N non-3-yn-1-ol Chemical compound CCCCCC#CCCO TZZVRLFUTNYDEG-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- VUGRNZHKYVHZSN-UHFFFAOYSA-N oct-1-yn-3-ol Chemical compound CCCCCC(O)C#C VUGRNZHKYVHZSN-UHFFFAOYSA-N 0.000 description 1
- TTWYFVOMGMBZCF-UHFFFAOYSA-N oct-2-yn-1-ol Chemical compound CCCCCC#CCO TTWYFVOMGMBZCF-UHFFFAOYSA-N 0.000 description 1
- VJKHTMGYHCBXHV-UHFFFAOYSA-N oct-3-yn-2-one Chemical compound CCCCC#CC(C)=O VJKHTMGYHCBXHV-UHFFFAOYSA-N 0.000 description 1
- BKGZMBTUPJVTIZ-UHFFFAOYSA-N oct-4-yn-2-ol Chemical compound CCCC#CCC(C)O BKGZMBTUPJVTIZ-UHFFFAOYSA-N 0.000 description 1
- GGXQZVKQXYOPTF-UHFFFAOYSA-N oct-5-yn-3-ol Chemical compound CCC#CCC(O)CC GGXQZVKQXYOPTF-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000007968 orange flavor Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- GBCOTHPVQOTZKQ-UHFFFAOYSA-N pent-1-yn-3-one Chemical compound CCC(=O)C#C GBCOTHPVQOTZKQ-UHFFFAOYSA-N 0.000 description 1
- WLPYSOCRPHTIDZ-UHFFFAOYSA-N pent-2-yn-1-ol Chemical compound CCC#CCO WLPYSOCRPHTIDZ-UHFFFAOYSA-N 0.000 description 1
- MINRDQDGBLQBGD-UHFFFAOYSA-N pent-2-ynoic acid Chemical compound CCC#CC(O)=O MINRDQDGBLQBGD-UHFFFAOYSA-N 0.000 description 1
- IDYNOORNKYEHHO-UHFFFAOYSA-N pent-3-yn-1-ol Chemical compound CC#CCCO IDYNOORNKYEHHO-UHFFFAOYSA-N 0.000 description 1
- HJFRLXPEVRXBQZ-UHFFFAOYSA-N pent-3-yn-2-ol Chemical compound CC#CC(C)O HJFRLXPEVRXBQZ-UHFFFAOYSA-N 0.000 description 1
- NIZKVZYBUGUDTI-UHFFFAOYSA-N pent-3-ynoic acid Chemical compound CC#CCC(O)=O NIZKVZYBUGUDTI-UHFFFAOYSA-N 0.000 description 1
- CRWVOXFUXPYTRK-UHFFFAOYSA-N pent-4-yn-1-ol Chemical compound OCCCC#C CRWVOXFUXPYTRK-UHFFFAOYSA-N 0.000 description 1
- ASVQKRFMRKDHTD-UHFFFAOYSA-N pent-4-yn-2-one Chemical compound CC(=O)CC#C ASVQKRFMRKDHTD-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229960002895 phenylbutazone Drugs 0.000 description 1
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- XNERWVPQCYSMLC-UHFFFAOYSA-N phenylpropiolic acid Chemical compound OC(=O)C#CC1=CC=CC=C1 XNERWVPQCYSMLC-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical class OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- BGRYSGVIVVUJHH-UHFFFAOYSA-N prop-2-ynyl propanoate Chemical compound CCC(=O)OCC#C BGRYSGVIVVUJHH-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- WWFXVBNAJVNPKQ-UHFFFAOYSA-N propyl hex-2-ynoate Chemical compound CCCOC(=O)C#CCCC WWFXVBNAJVNPKQ-UHFFFAOYSA-N 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- UORVCLMRJXCDCP-UHFFFAOYSA-N propynoic acid Chemical compound OC(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-N 0.000 description 1
- YIYRXCXJFKZQBC-UHFFFAOYSA-N quinazoline-2-carbaldehyde Chemical compound C1=CC=CC2=NC(C=O)=NC=C21 YIYRXCXJFKZQBC-UHFFFAOYSA-N 0.000 description 1
- CNLPQMSBEVFNTN-UHFFFAOYSA-N quinazoline-2-carbonyl chloride Chemical compound C1=CC=CC2=NC(C(=O)Cl)=NC=C21 CNLPQMSBEVFNTN-UHFFFAOYSA-N 0.000 description 1
- 150000003246 quinazolines Chemical class 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 125000005208 trialkylammonium group Chemical group 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- UBOXGVDOUJQMTN-UHFFFAOYSA-N trichloroethylene Natural products ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/29—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of hydroxy groups
- C07C45/292—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of hydroxy groups with chromium derivatives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/794—Ketones containing a keto group bound to a six-membered aromatic ring having unsaturation outside an aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/40—Nitrogen atoms, not forming part of a nitro radical, e.g. isatin semicarbazone
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pulmonology (AREA)
- Immunology (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US702,364 | 1976-07-02 | ||
| US05/702,364 US4076818A (en) | 1976-07-02 | 1976-07-02 | Pyrazolo [1,5-C]quinazoline derivatives and related compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1097347A true CA1097347A (en) | 1981-03-10 |
Family
ID=24820927
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA279,853A Expired CA1097347A (en) | 1976-07-02 | 1977-06-03 | Pyrazolo[1,5-c]quinazoline derivatives and related compounds |
Country Status (15)
| Country | Link |
|---|---|
| US (2) | US4076818A (en:Method) |
| JP (1) | JPS5312894A (en:Method) |
| AT (1) | AT361487B (en:Method) |
| AU (1) | AU512177B2 (en:Method) |
| BE (1) | BE856386A (en:Method) |
| CA (1) | CA1097347A (en:Method) |
| DE (1) | DE2726389A1 (en:Method) |
| FR (1) | FR2356650A1 (en:Method) |
| GB (1) | GB1585681A (en:Method) |
| HU (1) | HU173531B (en:Method) |
| NL (1) | NL7707086A (en:Method) |
| PH (1) | PH12768A (en:Method) |
| PL (1) | PL106659B1 (en:Method) |
| SU (1) | SU730306A3 (en:Method) |
| ZA (1) | ZA773319B (en:Method) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4128644A (en) * | 1977-07-29 | 1978-12-05 | E. R. Squibb & Sons, Inc. | Pyrazolo(1,5-c)quinazoline derivatives and related compounds |
| US4282226A (en) * | 1978-04-26 | 1981-08-04 | E. R. Squibb & Sons, Inc. | Thioxopyrazolo[1,5-c]quinazoline derivatives, anti-allergic compositions and methods for treating allergic conditions by parenteral administration, aerosol or insufflation |
| CA1111033A (en) * | 1978-04-26 | 1981-10-20 | Berthold R. Vogt | Thioxopyrazolo[1,5-c]quinazoline derivatives and related compounds |
| US4198412A (en) * | 1978-12-13 | 1980-04-15 | E. R. Squibb & Sons, Inc. | Pyrazolo [1,5-C] quinazoline derivatives and their use in treating allergic conditions |
| US4239896A (en) * | 1978-12-13 | 1980-12-16 | E. R. Squibb & Sons, Inc. | 5-(Optionally substituted 2-aminophenyl)-1H-pyrazole-3-methanol |
| HU178523B (en) * | 1979-05-18 | 1982-05-28 | Egyt Gyogyszervegyeszeti Gyar | Process for preparing new pyrazolo-quinazoline derivatives |
| US4312870A (en) * | 1979-06-21 | 1982-01-26 | Ciba-Geigy Corporation | Pyrazoloquinolines |
| US4252945A (en) * | 1979-07-11 | 1981-02-24 | E. R. Squibb & Sons, Inc. | Process for preparing pyrazolo[1,5-c]-quinazoline derivatives and novel intermediates |
| US4307099A (en) * | 1980-06-25 | 1981-12-22 | E. R. Squibb & Sons, Inc. | Reaction products of pyrazolo[1,5-c]quinazoline derivatives and proline derivatives and methods for reducing blood pressure while inhibiting allergic reactions with them |
| US4459298A (en) * | 1982-09-28 | 1984-07-10 | Ciba-Geigy Corporation | Method of suppressing appetite |
| US4713383A (en) * | 1984-10-01 | 1987-12-15 | Ciba-Geigy Corporation | Triazoloquinazoline compounds, and their methods of preparation, pharmaceutical compositions, and uses |
| US4831013A (en) * | 1986-03-20 | 1989-05-16 | Ciba-Geigy Corporation | 2-substituted-e-fused-[1,2,4]triazolo[1,5-c]pyrimidines, pharmaceutical compositions, and uses thereof |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1111505B (de) * | 1960-02-11 | 1961-07-20 | Agfa Ag | Verfahren zur Herstellung von farbigen photographischen Aufsichts- oder Durchsichtsbildern nach dem Farbentwicklungsverfahren |
| US3313815A (en) * | 1964-05-04 | 1967-04-11 | Sterling Drug Inc | 8-chloropyrazolo-[1, 5-c]quinazoline derivatives and methods of preparing same |
| US3531482A (en) * | 1966-10-13 | 1970-09-29 | Sandoz Ag | Pyrazolo(1,5-c)quinazolines |
| DE2058501A1 (de) * | 1970-11-27 | 1972-05-31 | Bayer Ag | Verfahren zur Herstellung von neuen N-verbrueckten bicyclischen Heteroaromaten |
| JPS50116498A (en:Method) * | 1974-02-27 | 1975-09-11 | ||
| US3903106A (en) * | 1974-04-12 | 1975-09-02 | Lilly Co Eli | Pyrazole-3-carboxylic acids |
| US3890324A (en) * | 1974-04-12 | 1975-06-17 | Lilly Co Eli | 1h-pyrazolo(4,3-)quinol-4(5h)-one-3-carboxylic acids |
| US3897434A (en) * | 1974-04-12 | 1975-07-29 | Lilly Co Eli | Pyrazolo{8 1,5-c{9 quinazolin-5(6H)-ones |
| US3895027A (en) * | 1974-04-12 | 1975-07-15 | Lilly Co Eli | Process for preparing pyrazole-3-carboxylic acids |
| US3899508A (en) * | 1974-04-12 | 1975-08-12 | Lilly Co Eli | 5-(2-Aminophenyl)pyrazole-3-carboxylic acids and esters thereof |
-
1976
- 1976-07-02 US US05/702,364 patent/US4076818A/en not_active Expired - Lifetime
-
1977
- 1977-03-17 US US05/778,397 patent/US4112096A/en not_active Expired - Lifetime
- 1977-06-02 ZA ZA00773319A patent/ZA773319B/xx unknown
- 1977-06-03 CA CA279,853A patent/CA1097347A/en not_active Expired
- 1977-06-03 GB GB23732/77A patent/GB1585681A/en not_active Expired
- 1977-06-03 AU AU25830/77A patent/AU512177B2/en not_active Expired
- 1977-06-09 PH PH19862A patent/PH12768A/en unknown
- 1977-06-10 DE DE19772726389 patent/DE2726389A1/de not_active Withdrawn
- 1977-06-15 AT AT424077A patent/AT361487B/de not_active IP Right Cessation
- 1977-06-27 NL NL7707086A patent/NL7707086A/xx not_active Application Discontinuation
- 1977-06-30 PL PL1977199270A patent/PL106659B1/pl unknown
- 1977-06-30 FR FR7720120A patent/FR2356650A1/fr active Granted
- 1977-06-30 HU HU77SU949A patent/HU173531B/hu unknown
- 1977-07-01 BE BE179013A patent/BE856386A/xx unknown
- 1977-07-01 SU SU772499601A patent/SU730306A3/ru active
- 1977-07-01 JP JP7943877A patent/JPS5312894A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| AU2583077A (en) | 1978-12-07 |
| AT361487B (de) | 1981-03-10 |
| SU730306A3 (ru) | 1980-04-25 |
| JPS5312894A (en) | 1978-02-04 |
| FR2356650A1 (fr) | 1978-01-27 |
| NL7707086A (nl) | 1978-01-04 |
| PL199270A1 (pl) | 1978-09-11 |
| US4076818A (en) | 1978-02-28 |
| ZA773319B (en) | 1978-04-26 |
| ATA424077A (de) | 1980-08-15 |
| AU512177B2 (en) | 1980-09-25 |
| FR2356650B1 (en:Method) | 1981-08-28 |
| PL106659B1 (pl) | 1980-01-31 |
| PH12768A (en) | 1979-08-17 |
| US4112096A (en) | 1978-09-05 |
| GB1585681A (en) | 1981-03-11 |
| HU173531B (en) | 1979-06-28 |
| BE856386A (fr) | 1978-01-02 |
| DE2726389A1 (de) | 1978-01-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1097347A (en) | Pyrazolo[1,5-c]quinazoline derivatives and related compounds | |
| US4278673A (en) | Pharmacologically active compounds | |
| US4665074A (en) | 6-(polyfluoroalkoxyphenyl) pyridazinones, their compositions, synthesis and use | |
| US4146643A (en) | Increasing vigilance or treating cerebral insufficiency with substituted vincamines | |
| Adcock et al. | Synthesis of 4-substituted bicyclo [2.2. 2] oct-1-yl fluorides | |
| CA2120997A1 (en) | Triazolopyridazine derivatives, their production and use | |
| HU191083B (en) | Process for producing pyridazinone derivatives | |
| CA1327571C (en) | Imidazodiazepine derivatives | |
| EP0054398B1 (en) | Pharmacologically active benzopyrano-(2,3-d)-v-triazoles | |
| IE46975B1 (en) | Pyrido-indole tranquilising agents | |
| EP0007727B1 (en) | Benzopyranotriazoles, preparation of these compounds and pharmaceutical composition containing them | |
| US4110452A (en) | Pyrazolo (1,5-c) quinazoline derivatives and related compounds | |
| JOJIMA et al. | Pyridazines. IV. Intramolecular Cycloaddition of 3-Chloro-6-(2-allyloxyphenoxy) pyridazines | |
| US4454136A (en) | Substituted benzopyranotriazoles and antiallergic use | |
| CA1122215A (en) | Pyrazolo[1,5-c]quinazoline derivatives | |
| GB1584461A (en) | Imidazotriazines imidazotriazinones and pharmaceutical compositions containing them | |
| OISHI et al. | Condensed Pyridazines. VI. Reaction of 7-(Methylsulfonyl) 1-phenyl-1H-1, 2, 3-triazolo [4, 5-d] pyridazine with Carbanions and Enamines | |
| US3824278A (en) | 1,6-disubstituted pyrocatechol derivatives | |
| US4431823A (en) | 1H-Pyrrole-3-carbonitrile-4(2-benzoyl)phenyl derivatives as intermediates for pyrrolo[3,4-D][2]benzazepines | |
| US4354973A (en) | Pyrrolo[3,4-d][2]benzazepines | |
| EP0091181B1 (en) | Aroyl pyrrolizine compounds, process for their preparation and pharmaceutical compositions containing them | |
| Gambacorta et al. | Bicyclo [3.3. 1] nonane approach to triquinanes. Formal synthesis of (+/-) Δ9 (12) capnellen and (+/-) Δ9 (12) capnellen-8β-10α-diol | |
| US4409390A (en) | Pyrrolo[3,4-D][2]Benzazepines | |
| Coffen et al. | Friedlaendar synthesis and rearrangement of 10-(o-fluoropheny)-1, 4-ethanobezo [b]-1, 5-naphthyridines to benzo [b] indolo [3, 2, 1-d, e]-1, 5-naphthyridines | |
| US4124648A (en) | Process for the preparation of norpatchoulenol and intermediates therefor |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry | ||
| MKEX | Expiry |
Effective date: 19980310 |