CA1096876A - Method for preparing halosilyl carbamates and isocyanates derived therefrom - Google Patents
Method for preparing halosilyl carbamates and isocyanates derived therefromInfo
- Publication number
- CA1096876A CA1096876A CA278,460A CA278460A CA1096876A CA 1096876 A CA1096876 A CA 1096876A CA 278460 A CA278460 A CA 278460A CA 1096876 A CA1096876 A CA 1096876A
- Authority
- CA
- Canada
- Prior art keywords
- halosilyl
- isocyanate
- reaction
- isocyanates
- carbamates
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000004657 carbamic acid derivatives Chemical class 0.000 title claims abstract description 18
- 239000012948 isocyanate Substances 0.000 title abstract description 49
- 150000002513 isocyanates Chemical class 0.000 title abstract description 47
- 238000000034 method Methods 0.000 title abstract description 42
- 150000001412 amines Chemical class 0.000 claims abstract description 26
- -1 amino, mercapto, nitro, sulfonamido Chemical group 0.000 claims abstract description 21
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 54
- 239000001569 carbon dioxide Substances 0.000 claims description 25
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 25
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical group 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000000524 functional group Chemical group 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000002723 alicyclic group Chemical group 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 abstract description 29
- 150000001875 compounds Chemical class 0.000 abstract description 10
- 238000010438 heat treatment Methods 0.000 abstract description 7
- 230000008569 process Effects 0.000 abstract description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract description 3
- 125000003368 amide group Chemical group 0.000 abstract description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract description 2
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate Chemical compound [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 abstract 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- 230000015572 biosynthetic process Effects 0.000 description 20
- 239000011541 reaction mixture Substances 0.000 description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 16
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 16
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 16
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- 239000007789 gas Substances 0.000 description 11
- 238000003786 synthesis reaction Methods 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 9
- 125000005843 halogen group Chemical group 0.000 description 9
- 239000000543 intermediate Substances 0.000 description 9
- DRNXZGJGRSUXHW-UHFFFAOYSA-N silyl carbamate Chemical compound NC(=O)O[SiH3] DRNXZGJGRSUXHW-UHFFFAOYSA-N 0.000 description 9
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 8
- 230000009102 absorption Effects 0.000 description 8
- 238000010521 absorption reaction Methods 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- 239000000376 reactant Substances 0.000 description 8
- 239000005049 silicon tetrachloride Substances 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 239000005051 trimethylchlorosilane Substances 0.000 description 7
- 238000005406 washing Methods 0.000 description 7
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 6
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 5
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 229910052710 silicon Inorganic materials 0.000 description 5
- 238000001228 spectrum Methods 0.000 description 5
- 101150041968 CDC13 gene Proteins 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- JJWKPURADFRFRB-UHFFFAOYSA-N carbonyl sulfide Chemical compound O=C=S JJWKPURADFRFRB-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000005054 phenyltrichlorosilane Substances 0.000 description 4
- 239000010703 silicon Substances 0.000 description 4
- ORVMIVQULIKXCP-UHFFFAOYSA-N trichloro(phenyl)silane Chemical compound Cl[Si](Cl)(Cl)C1=CC=CC=C1 ORVMIVQULIKXCP-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 229910007161 Si(CH3)3 Inorganic materials 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 235000011089 carbon dioxide Nutrition 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 125000001261 isocyanato group Chemical group *N=C=O 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000001819 mass spectrum Methods 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 238000006884 silylation reaction Methods 0.000 description 3
- 230000002194 synthesizing effect Effects 0.000 description 3
- SOWDBKWCDADBQY-UHFFFAOYSA-N trichlorosilyl carbamate Chemical compound NC(=O)O[Si](Cl)(Cl)Cl SOWDBKWCDADBQY-UHFFFAOYSA-N 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 230000005587 bubbling Effects 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical class Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000011437 continuous method Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 125000005442 diisocyanate group Chemical group 0.000 description 2
- 230000008034 disappearance Effects 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- MWZPENIJLUWBSY-VIFPVBQESA-N methyl L-tyrosinate Chemical compound COC(=O)[C@@H](N)CC1=CC=C(O)C=C1 MWZPENIJLUWBSY-VIFPVBQESA-N 0.000 description 2
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 239000012454 non-polar solvent Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 229910000077 silane Inorganic materials 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 2
- DZGWFCGJZKJUFP-UHFFFAOYSA-N tyramine Chemical compound NCCC1=CC=C(O)C=C1 DZGWFCGJZKJUFP-UHFFFAOYSA-N 0.000 description 2
- 229960003732 tyramine Drugs 0.000 description 2
- 125000005023 xylyl group Chemical group 0.000 description 2
- WYTZZXDRDKSJID-UHFFFAOYSA-N (3-aminopropyl)triethoxysilane Chemical compound CCO[Si](OCC)(OCC)CCCN WYTZZXDRDKSJID-UHFFFAOYSA-N 0.000 description 1
- 229940008841 1,6-hexamethylene diisocyanate Drugs 0.000 description 1
- OQURWGJAWSLGQG-UHFFFAOYSA-N 1-isocyanatopropane Chemical compound CCCN=C=O OQURWGJAWSLGQG-UHFFFAOYSA-N 0.000 description 1
- RQMWTTLUOXUKQW-UHFFFAOYSA-N 2-isocyanatoethoxy(trimethyl)silane Chemical compound C[Si](C)(C)OCCN=C=O RQMWTTLUOXUKQW-UHFFFAOYSA-N 0.000 description 1
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 1
- 229940082584 3-(triethoxysilyl)propylamine Drugs 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 1
- 229920002101 Chitin Polymers 0.000 description 1
- 229920001661 Chitosan Polymers 0.000 description 1
- 239000005046 Chlorosilane Substances 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical compound OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000353097 Molva molva Species 0.000 description 1
- IHKYSGJNHVOROF-FVGYRXGTSA-N N=C=O.COC(=O)[C@@H](N)CC1=CC=C(O)C=C1 Chemical compound N=C=O.COC(=O)[C@@H](N)CC1=CC=C(O)C=C1 IHKYSGJNHVOROF-FVGYRXGTSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical class C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 1
- 229910008338 Si—(CH3) Inorganic materials 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- DORHGRMBOUREIV-UHFFFAOYSA-N [4-(2-isocyanatoethyl)phenoxy]-trimethylsilane Chemical compound C[Si](C)(C)OC1=CC=C(CCN=C=O)C=C1 DORHGRMBOUREIV-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 150000001793 charged compounds Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000010961 commercial manufacture process Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- KQIFRYIYNPGWEK-UHFFFAOYSA-N cyclohexylazanium;n-cyclohexylcarbamate Chemical compound NC1CCCCC1.OC(=O)NC1CCCCC1 KQIFRYIYNPGWEK-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- JIYXHCMRGZVYMA-UHFFFAOYSA-N dimethylcarbamic acid;n-methylmethanamine Chemical compound C[NH2+]C.CN(C)C([O-])=O JIYXHCMRGZVYMA-UHFFFAOYSA-N 0.000 description 1
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229930182470 glycoside Natural products 0.000 description 1
- 150000002338 glycosides Chemical class 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- PPNLXDXRZUZRTD-UHFFFAOYSA-N methanamine;methylcarbamic acid Chemical compound NC.CNC(O)=O PPNLXDXRZUZRTD-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- ZLCYMQQQFBDVFC-UHFFFAOYSA-N methyl 2-isocyanato-3-(4-trimethylsilyloxyphenyl)propanoate Chemical compound COC(=O)C(N=C=O)CC1=CC=C(O[Si](C)(C)C)C=C1 ZLCYMQQQFBDVFC-UHFFFAOYSA-N 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N mono-n-propyl amine Natural products CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- QDQUUCRXCPZLQP-UHFFFAOYSA-N naphthalen-1-amine;potassium Chemical compound [K].C1=CC=C2C(N)=CC=CC2=C1 QDQUUCRXCPZLQP-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 150000002916 oxazoles Chemical class 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- FSWPUPQZFDRXOZ-UHFFFAOYSA-N phenyl N-cyclohexyl-N-dichlorosilylcarbamate Chemical compound C1(=CC=CC=C1)OC(N(C1CCCCC1)[SiH](Cl)Cl)=O FSWPUPQZFDRXOZ-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 150000003376 silicon Chemical class 0.000 description 1
- FDNAPBUWERUEDA-UHFFFAOYSA-N silicon tetrachloride Chemical compound Cl[Si](Cl)(Cl)Cl FDNAPBUWERUEDA-UHFFFAOYSA-N 0.000 description 1
- PYRLGKOKNUJQQN-UHFFFAOYSA-N silylcarbamic acid Chemical class OC(=O)N[SiH3] PYRLGKOKNUJQQN-UHFFFAOYSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- XTQHKBHJIVJGKJ-UHFFFAOYSA-N sulfur monoxide Chemical compound S=O XTQHKBHJIVJGKJ-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 238000013519 translation Methods 0.000 description 1
- FRGPKMWIYVTFIQ-UHFFFAOYSA-N triethoxy(3-isocyanatopropyl)silane Chemical compound CCO[Si](OCC)(OCC)CCCN=C=O FRGPKMWIYVTFIQ-UHFFFAOYSA-N 0.000 description 1
- RDEKHAYBXPYQJQ-UHFFFAOYSA-N trimethylsilyl n,n-dimethylcarbamate Chemical compound CN(C)C(=O)O[Si](C)(C)C RDEKHAYBXPYQJQ-UHFFFAOYSA-N 0.000 description 1
- GHLWPMXJVBXAGW-UHFFFAOYSA-N trimethylsilyl n-cyclohexylcarbamate Chemical compound C[Si](C)(C)OC(=O)NC1CCCCC1 GHLWPMXJVBXAGW-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C263/00—Preparation of derivatives of isocyanic acid
- C07C263/04—Preparation of derivatives of isocyanic acid from or via carbamates or carbamoyl halides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/025—Silicon compounds without C-silicon linkages
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/18—Compounds having one or more C—Si linkages as well as one or more C—O—Si linkages
- C07F7/1896—Compounds having one or more Si-O-acyl linkages
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA359,575A CA1108174A (en) | 1976-05-17 | 1980-09-04 | Method for preparing halosily carbamates and isocyanates derived therefrom |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US687,160 | 1976-05-17 | ||
| US05/687,160 US4064151A (en) | 1976-05-17 | 1976-05-17 | Halosilyl carbamates |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1096876A true CA1096876A (en) | 1981-03-03 |
Family
ID=24759320
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA278,460A Expired CA1096876A (en) | 1976-05-17 | 1977-05-16 | Method for preparing halosilyl carbamates and isocyanates derived therefrom |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US4064151A (instruction) |
| JP (2) | JPS52139020A (instruction) |
| AU (1) | AU513403B2 (instruction) |
| BE (1) | BE854693A (instruction) |
| BR (1) | BR7703145A (instruction) |
| CA (1) | CA1096876A (instruction) |
| CH (1) | CH620672A5 (instruction) |
| DE (1) | DE2722117A1 (instruction) |
| DK (1) | DK213077A (instruction) |
| FR (2) | FR2351986A1 (instruction) |
| GB (1) | GB1573170A (instruction) |
| IL (1) | IL52094A0 (instruction) |
| NL (1) | NL7705410A (instruction) |
| SE (1) | SE442994B (instruction) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4192815A (en) * | 1978-06-22 | 1980-03-11 | Glushakov Sergei N | Method of preparing isocyanates |
| US4378428A (en) * | 1981-03-30 | 1983-03-29 | Baker Instruments Corporation | Method for carrying out non-isotopic immunoassays, labeled analytes and kits for use in such assays |
| US4785080A (en) * | 1981-03-30 | 1988-11-15 | Baker Instruments Corporation | Labeled analytes |
| US4467089A (en) * | 1982-03-04 | 1984-08-21 | Air Products And Chemicals, Inc. | Carbamate and carbonate salts of tertiary amines |
| US4400526A (en) * | 1982-09-30 | 1983-08-23 | Union Carbide Corporation | Hydrogen bearing silyl carbamates |
| US4496754A (en) * | 1982-12-28 | 1985-01-29 | Union Carbide Corporation | Silyl carbamates and synthesis thereof |
| US4876323A (en) * | 1984-02-27 | 1989-10-24 | Midwest Research Institute | α-substituted acrylic acid esters, their polymers and method of synthesizing same |
| US4704466A (en) * | 1984-02-27 | 1987-11-03 | Midwest Research Institute | α-substituted acrylic acid esters |
| US4736046A (en) * | 1985-12-23 | 1988-04-05 | The Dow Chemical Company | β-isocyanato organosilanes |
| US5166243A (en) * | 1986-06-30 | 1992-11-24 | Union Carbide Chemicals & Plastics Technology Corporation | Polyorganosiloxane cross-linkers for RTV sealants |
| US5189205A (en) * | 1992-03-16 | 1993-02-23 | Monsanto Compamy | Process for preparing isocyanates |
| US5233010A (en) * | 1992-10-15 | 1993-08-03 | Monsanto Company | Process for preparing isocyanate and carbamate ester products |
| US5298651A (en) * | 1992-10-15 | 1994-03-29 | Monsanto Company | Process for preparing isocyanates using phosphazine catalysts |
| US5349081A (en) * | 1993-01-21 | 1994-09-20 | Monsanto Company | Process for preparing isocyanates |
| US5393910A (en) * | 1993-10-20 | 1995-02-28 | Osi Specialties, Inc. | Process for making isocyanatoorganosilanes |
| US5451697A (en) * | 1993-12-27 | 1995-09-19 | Monsanto Company | Process for preparing isocyanates |
| JP4171530B2 (ja) * | 1996-04-15 | 2008-10-22 | 三井化学ポリウレタン株式会社 | ケイ素含有イソシアネート化合物の製造方法 |
| US6008396A (en) * | 1997-04-11 | 1999-12-28 | Osi Specialties, Inc. | Hot oil process for producing isocyanato organosilanes |
| US7825243B2 (en) * | 2005-06-03 | 2010-11-02 | Momentive Performance Materials Inc. | Process for the production of isocyanatosilane and silylisocyanurate |
| US7060849B1 (en) | 2005-09-15 | 2006-06-13 | General Electric Company | Method for production of isocyanatosilanes |
| US7938887B2 (en) * | 2008-01-08 | 2011-05-10 | Board Of Regents, The University Of Texas System | Acidic gas capture by diamines |
| CN101965331B (zh) * | 2008-02-29 | 2014-04-16 | 日产化学工业株式会社 | 具有羧基的异硫氰基化合物的制造方法 |
| AU2009346379B2 (en) * | 2009-05-22 | 2015-12-10 | Board Of Regents, The University Of Texas System | Acidic gas capture by diamines |
| DE102009045849B4 (de) * | 2009-10-20 | 2018-03-08 | Technische Universität Bergakademie Freiberg | Verfahren zur Herstellung von Oligo- und Polysiloxanen |
| WO2011088008A1 (en) * | 2010-01-12 | 2011-07-21 | Board Of Regents, The University Of Texas System | Acidic gas removal by aqueous amine solvents |
| CN109503647B (zh) * | 2017-09-15 | 2021-09-21 | 张家港市国泰华荣化工新材料有限公司 | 3-异氰酸酯基丙基三甲氧基硅烷的制法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3642854A (en) * | 1967-04-26 | 1972-02-15 | Vladimir Petrovich Kozjukov | Method for production of isocyanates |
| US3821218A (en) * | 1967-09-20 | 1974-06-28 | Gen Electric | Nitrogen-containing organosilicon materials |
| DE1768860A1 (de) * | 1968-07-09 | 1972-01-13 | Bayer Ag | Verfahren zur Herstellung von mono- und polyfunktionellen Derivaten der Kohlensaeure |
| DE2241154A1 (de) * | 1972-08-22 | 1974-03-07 | Bayer Ag | Verfahren zur herstellung von isocyanaten |
-
1976
- 1976-05-17 US US05/687,160 patent/US4064151A/en not_active Expired - Lifetime
-
1977
- 1977-05-04 SE SE7705190A patent/SE442994B/xx not_active IP Right Cessation
- 1977-05-16 BR BR3145/77A patent/BR7703145A/pt unknown
- 1977-05-16 IL IL52094A patent/IL52094A0/xx unknown
- 1977-05-16 GB GB20471/77A patent/GB1573170A/en not_active Expired
- 1977-05-16 NL NL7705410A patent/NL7705410A/xx unknown
- 1977-05-16 CH CH606777A patent/CH620672A5/fr not_active IP Right Cessation
- 1977-05-16 CA CA278,460A patent/CA1096876A/en not_active Expired
- 1977-05-16 FR FR7714948A patent/FR2351986A1/fr active Granted
- 1977-05-16 JP JP5553777A patent/JPS52139020A/ja active Granted
- 1977-05-16 DK DK213077A patent/DK213077A/da unknown
- 1977-05-16 BE BE177622A patent/BE854693A/xx unknown
- 1977-05-16 DE DE19772722117 patent/DE2722117A1/de active Granted
- 1977-05-17 AU AU25188/77A patent/AU513403B2/en not_active Expired
- 1977-09-23 FR FR7728842A patent/FR2351955A1/fr active Granted
- 1977-12-19 US US05/862,208 patent/US4130576A/en not_active Expired - Lifetime
-
1982
- 1982-03-23 JP JP57044792A patent/JPS6033436B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IL52094A0 (en) | 1977-07-31 |
| CH620672A5 (instruction) | 1980-12-15 |
| JPS5757020B2 (instruction) | 1982-12-02 |
| FR2351986B1 (instruction) | 1980-12-05 |
| JPS57181089A (en) | 1982-11-08 |
| BR7703145A (pt) | 1978-01-31 |
| JPS6033436B2 (ja) | 1985-08-02 |
| DE2722117A1 (de) | 1977-11-24 |
| FR2351955B1 (instruction) | 1980-12-05 |
| FR2351986A1 (fr) | 1977-12-16 |
| NL7705410A (nl) | 1977-11-21 |
| SE442994B (sv) | 1986-02-10 |
| DK213077A (da) | 1977-11-18 |
| AU2518877A (en) | 1978-11-23 |
| DE2722117C2 (instruction) | 1989-02-16 |
| JPS52139020A (en) | 1977-11-19 |
| FR2351955A1 (fr) | 1977-12-16 |
| US4064151A (en) | 1977-12-20 |
| SE7705190L (sv) | 1977-11-18 |
| GB1573170A (en) | 1980-09-17 |
| BE854693A (fr) | 1977-11-16 |
| US4130576A (en) | 1978-12-19 |
| AU513403B2 (en) | 1980-11-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1096876A (en) | Method for preparing halosilyl carbamates and isocyanates derived therefrom | |
| JPH0324471B2 (instruction) | ||
| US4725660A (en) | Method for producing polysilazane | |
| US4705877A (en) | Novel aminohydrocarbyl-substituted ketoximosilanes | |
| FR2578256A1 (fr) | Carbamates de silyle, leur procede de preparation et leur utilisation pour la preparation de bis(aminoalkyl) disiloxanes. | |
| JP2538189B2 (ja) | トリアルキルシリルニトリルの製造 | |
| US4880927A (en) | Method for preparing a cyclic isocyanuric ester having organosilicon groups | |
| JPH03197486A (ja) | アルコキシシリル基を有するオルガノシロキサンの製造方法 | |
| CA1108174A (en) | Method for preparing halosily carbamates and isocyanates derived therefrom | |
| JPH01502025A (ja) | オキシモシラン類の製造法 | |
| US4176131A (en) | Chemical process | |
| US5049690A (en) | N,N'-disubstituted and N,N,N'-/N,N', N'-trisubstituted thioureas and method of their preparation (II) | |
| US5403945A (en) | Cyclotrisiloxane and process for producing the same | |
| US4946990A (en) | Process for the preparation of isocyanates and their use of the preparation of polyisocyanates containing ester groups | |
| JP4058605B2 (ja) | 嵩高い置換基を有するシリルトリフラート化合物及びその製造方法 | |
| US5087718A (en) | Process for the manufacture of ketoximosilanes | |
| US4705878A (en) | Method for preparing aminohydrocarbyl-substituted ketoximosilanes | |
| US4736046A (en) | β-isocyanato organosilanes | |
| US4663471A (en) | Method for the preparation of N-methyl-N-trimethylsilyl trifluoroacetamide | |
| Otero et al. | Pentachlorophenyl-arsenic,-antimony and-bismuth compounds | |
| SU606863A1 (ru) | Способ получени полимочевин | |
| US5362896A (en) | Silacyclo ring compound having alkenoxy groups | |
| US5914419A (en) | Organosilicon compound | |
| USRE32717E (en) | Method for the preparation of N-methyl-N-trimethylsilyl trifluoroacetamide | |
| CA2186991C (en) | Process for the preparation of acyl isocyanates |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |