CA1095171A - Dual injector, floating gate mos electrically alterable, non-volatile semiconductor memory device - Google Patents
Dual injector, floating gate mos electrically alterable, non-volatile semiconductor memory deviceInfo
- Publication number
- CA1095171A CA1095171A CA266,827A CA266827A CA1095171A CA 1095171 A CA1095171 A CA 1095171A CA 266827 A CA266827 A CA 266827A CA 1095171 A CA1095171 A CA 1095171A
- Authority
- CA
- Canada
- Prior art keywords
- gate
- substrate
- floating gate
- capacitor
- junction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000007667 floating Methods 0.000 title claims abstract description 38
- 239000004065 semiconductor Substances 0.000 title claims abstract description 14
- 230000009977 dual effect Effects 0.000 title abstract description 5
- 238000002347 injection Methods 0.000 claims abstract description 25
- 239000007924 injection Substances 0.000 claims abstract description 25
- 239000003990 capacitor Substances 0.000 claims abstract description 23
- 239000000758 substrate Substances 0.000 claims description 19
- 239000002019 doping agent Substances 0.000 claims description 6
- 239000004020 conductor Substances 0.000 claims description 3
- 238000003860 storage Methods 0.000 claims description 2
- 230000001464 adherent effect Effects 0.000 claims 2
- 239000011810 insulating material Substances 0.000 claims 2
- 230000003472 neutralizing effect Effects 0.000 claims 1
- 238000000034 method Methods 0.000 abstract description 10
- 229910052751 metal Inorganic materials 0.000 abstract description 5
- 239000002184 metal Substances 0.000 abstract description 5
- 230000008878 coupling Effects 0.000 abstract description 2
- 238000010168 coupling process Methods 0.000 abstract description 2
- 238000005859 coupling reaction Methods 0.000 abstract description 2
- 238000009792 diffusion process Methods 0.000 description 11
- 230000015556 catabolic process Effects 0.000 description 3
- 238000003491 array Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 238000005468 ion implantation Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 238000002161 passivation Methods 0.000 description 1
- 238000000059 patterning Methods 0.000 description 1
- 229910021420 polycrystalline silicon Inorganic materials 0.000 description 1
- 229920005591 polysilicon Polymers 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- -1 sense transistor S Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10B—ELECTRONIC MEMORY DEVICES
- H10B41/00—Electrically erasable-and-programmable ROM [EEPROM] devices comprising floating gates
- H10B41/30—Electrically erasable-and-programmable ROM [EEPROM] devices comprising floating gates characterised by the memory core region
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10B—ELECTRONIC MEMORY DEVICES
- H10B41/00—Electrically erasable-and-programmable ROM [EEPROM] devices comprising floating gates
- H10B41/60—Electrically erasable-and-programmable ROM [EEPROM] devices comprising floating gates the control gate being a doped region, e.g. single-poly memory cell
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10B—ELECTRONIC MEMORY DEVICES
- H10B69/00—Erasable-and-programmable ROM [EPROM] devices not provided for in groups H10B41/00 - H10B63/00, e.g. ultraviolet erasable-and-programmable ROM [UVEPROM] devices
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10D—INORGANIC ELECTRIC SEMICONDUCTOR DEVICES
- H10D30/00—Field-effect transistors [FET]
- H10D30/60—Insulated-gate field-effect transistors [IGFET]
- H10D30/68—Floating-gate IGFETs
- H10D30/681—Floating-gate IGFETs having only two programming levels
- H10D30/684—Floating-gate IGFETs having only two programming levels programmed by hot carrier injection
- H10D30/686—Floating-gate IGFETs having only two programming levels programmed by hot carrier injection using hot carriers produced by avalanche breakdown of PN junctions, e.g. floating gate avalanche injection MOS [FAMOS]
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10D—INORGANIC ELECTRIC SEMICONDUCTOR DEVICES
- H10D84/00—Integrated devices formed in or on semiconductor substrates that comprise only semiconducting layers, e.g. on Si wafers or on GaAs-on-Si wafers
- H10D84/80—Integrated devices formed in or on semiconductor substrates that comprise only semiconducting layers, e.g. on Si wafers or on GaAs-on-Si wafers characterised by the integration of at least one component covered by groups H10D12/00 or H10D30/00, e.g. integration of IGFETs
- H10D84/811—Combinations of field-effect devices and one or more diodes, capacitors or resistors
- H10D84/813—Combinations of field-effect devices and capacitor only
Landscapes
- Non-Volatile Memory (AREA)
- Semiconductor Memories (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US644,982 | 1975-12-29 | ||
| US05/644,982 US4037242A (en) | 1975-12-29 | 1975-12-29 | Dual injector, floating gate MOS electrically alterable, non-volatile semiconductor memory device |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1095171A true CA1095171A (en) | 1981-02-03 |
Family
ID=24587168
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA266,827A Expired CA1095171A (en) | 1975-12-29 | 1976-11-29 | Dual injector, floating gate mos electrically alterable, non-volatile semiconductor memory device |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4037242A (enExample) |
| JP (1) | JPS5283074A (enExample) |
| CA (1) | CA1095171A (enExample) |
| DE (1) | DE2659296A1 (enExample) |
| FR (1) | FR2337403A1 (enExample) |
| GB (1) | GB1530717A (enExample) |
| NL (1) | NL7614537A (enExample) |
Families Citing this family (49)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2368784A1 (fr) * | 1976-10-20 | 1978-05-19 | Texas Instruments France | Cellule de memoire a grille flottante a double injection |
| GB1575741A (en) * | 1977-01-17 | 1980-09-24 | Philips Electronic Associated | Integrated circuits |
| JPS5931990B2 (ja) * | 1977-04-30 | 1984-08-06 | 株式会社東芝 | 不揮発性メモリ素子 |
| US4132904A (en) * | 1977-07-28 | 1979-01-02 | Hughes Aircraft Company | Volatile/non-volatile logic latch circuit |
| US4128773A (en) * | 1977-11-07 | 1978-12-05 | Hughes Aircraft Company | Volatile/non-volatile logic latch circuit |
| US4305083A (en) * | 1978-09-19 | 1981-12-08 | Texas Instruments Incorporated | Single junction charge injector floating gate memory cell |
| US4314265A (en) * | 1979-01-24 | 1982-02-02 | Xicor, Inc. | Dense nonvolatile electrically-alterable memory devices with four layer electrodes |
| US4300212A (en) * | 1979-01-24 | 1981-11-10 | Xicor, Inc. | Nonvolatile static random access memory devices |
| DE3029539A1 (de) | 1980-08-04 | 1982-03-11 | Deutsche Itt Industries Gmbh, 7800 Freiburg | Nichtfluechtige, programmierbare integrierte halbleiterspeicherzelle |
| FR2510260A1 (fr) * | 1981-07-24 | 1983-01-28 | Suisse Fond Rech Microtech | Dispositif semiconducteur sensible aux ions |
| DE3141390A1 (de) * | 1981-10-19 | 1983-04-28 | Deutsche Itt Industries Gmbh, 7800 Freiburg | Floating-gate-speicherzelle, bei der das schreiben und loeschen durch injektion heisser ladungstraeger erfolgt |
| US4432075A (en) * | 1981-12-04 | 1984-02-14 | Hebrew University Of Jerusalem | Electrically programmable non-volatile memory |
| DE3275790D1 (en) * | 1982-09-15 | 1987-04-23 | Itt Ind Gmbh Deutsche | Cmos memory cell with floating memory gate |
| JPS59155968A (ja) * | 1983-02-25 | 1984-09-05 | Toshiba Corp | 半導体記憶装置 |
| JPS59161873A (ja) * | 1983-03-07 | 1984-09-12 | Agency Of Ind Science & Technol | 半導体不揮発性メモリ |
| EP0215064A1 (en) * | 1985-03-08 | 1987-03-25 | Ncr Corporation | Floating gate nonvolatile field effect memory device |
| USRE37308E1 (en) * | 1986-12-22 | 2001-08-07 | Stmicroelectronics S.R.L. | EEPROM memory cell with a single level of polysilicon programmable and erasable bit by bit |
| IT1199828B (it) * | 1986-12-22 | 1989-01-05 | Sgs Microelettronica Spa | Cella di memoria eeprom a singolo livello di polisilicio scrivibile e cancellabile bit a bit |
| US4924278A (en) * | 1987-06-19 | 1990-05-08 | Advanced Micro Devices, Inc. | EEPROM using a merged source and control gate |
| JP2705106B2 (ja) * | 1988-05-25 | 1998-01-26 | セイコーエプソン株式会社 | 半導体装置の製造方法 |
| US5216269A (en) * | 1989-03-31 | 1993-06-01 | U.S. Philips Corp. | Electrically-programmable semiconductor memories with buried injector region |
| DE4020007C2 (de) * | 1989-06-22 | 1994-09-29 | Nippon Telegraph & Telephone | Nichtflüchtiger Speicher |
| US5060195A (en) * | 1989-12-29 | 1991-10-22 | Texas Instruments Incorporated | Hot electron programmable, tunnel electron erasable contactless EEPROM |
| US5640346A (en) * | 1992-03-03 | 1997-06-17 | Harris Corporation | Electrically programmable memory cell |
| US5780341A (en) * | 1996-12-06 | 1998-07-14 | Halo Lsi Design & Device Technology, Inc. | Low voltage EEPROM/NVRAM transistors and making method |
| US5889704A (en) * | 1997-02-26 | 1999-03-30 | Lucent Technologies Inc. | Load and leave memory cell |
| US6404006B2 (en) | 1998-12-01 | 2002-06-11 | Vantis Corporation | EEPROM cell with tunneling across entire separated channels |
| US6214666B1 (en) | 1998-12-18 | 2001-04-10 | Vantis Corporation | Method of forming a non-volatile memory device |
| US6232631B1 (en) | 1998-12-21 | 2001-05-15 | Vantis Corporation | Floating gate memory cell structure with programming mechanism outside the read path |
| US6282123B1 (en) | 1998-12-21 | 2001-08-28 | Lattice Semiconductor Corporation | Method of fabricating, programming, and erasing a dual pocket two sided program/erase non-volatile memory cell |
| US6294810B1 (en) | 1998-12-22 | 2001-09-25 | Vantis Corporation | EEPROM cell with tunneling at separate edge and channel regions |
| US6294809B1 (en) | 1998-12-28 | 2001-09-25 | Vantis Corporation | Avalanche programmed floating gate memory cell structure with program element in polysilicon |
| US6215700B1 (en) | 1999-01-07 | 2001-04-10 | Vantis Corporation | PMOS avalanche programmed floating gate memory cell structure |
| US6294811B1 (en) | 1999-02-05 | 2001-09-25 | Vantis Corporation | Two transistor EEPROM cell |
| US6534816B1 (en) | 1999-03-24 | 2003-03-18 | John M. Caywood | Method and apparatus for injecting charge onto the floating gate of a nonvolatile memory cell |
| US6384451B1 (en) | 1999-03-24 | 2002-05-07 | John Caywood | Method and apparatus for injecting charge onto the floating gate of a nonvolatile memory cell |
| US20040021170A1 (en) * | 1999-03-24 | 2004-02-05 | Caywood John M. | Method and apparatus for injecting charge onto the floating gate of a nonvolatile memory cell |
| US6326663B1 (en) * | 1999-03-26 | 2001-12-04 | Vantis Corporation | Avalanche injection EEPROM memory cell with P-type control gate |
| US6172392B1 (en) * | 1999-03-29 | 2001-01-09 | Vantis Corporation | Boron doped silicon capacitor plate |
| US6424000B1 (en) | 1999-05-11 | 2002-07-23 | Vantis Corporation | Floating gate memory apparatus and method for selected programming thereof |
| US6583012B1 (en) | 2001-02-13 | 2003-06-24 | Advanced Micro Devices, Inc. | Semiconductor devices utilizing differently composed metal-based in-laid gate electrodes |
| US20040206999A1 (en) * | 2002-05-09 | 2004-10-21 | Impinj, Inc., A Delaware Corporation | Metal dielectric semiconductor floating gate variable capacitor |
| US6909389B1 (en) | 2002-06-14 | 2005-06-21 | Impinj, Inc. | Method and apparatus for calibration of an array of scaled electronic circuit elements |
| US7257033B2 (en) * | 2005-03-17 | 2007-08-14 | Impinj, Inc. | Inverter non-volatile memory cell and array system |
| US7715236B2 (en) * | 2005-03-30 | 2010-05-11 | Virage Logic Corporation | Fault tolerant non volatile memories and methods |
| US7679957B2 (en) * | 2005-03-31 | 2010-03-16 | Virage Logic Corporation | Redundant non-volatile memory cell |
| JP4622902B2 (ja) * | 2006-03-17 | 2011-02-02 | セイコーエプソン株式会社 | 不揮発性半導体記憶装置 |
| US7719896B1 (en) | 2007-04-24 | 2010-05-18 | Virage Logic Corporation | Configurable single bit/dual bits memory |
| US7920423B1 (en) | 2007-07-31 | 2011-04-05 | Synopsys, Inc. | Non volatile memory circuit with tailored reliability |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3886583A (en) * | 1971-07-01 | 1975-05-27 | Motorola Inc | Insulated gate-field-effect transistor |
| US3740731A (en) * | 1971-08-02 | 1973-06-19 | Texas Instruments Inc | One transistor dynamic memory cell |
| US3882469A (en) * | 1971-11-30 | 1975-05-06 | Texas Instruments Inc | Non-volatile variable threshold memory cell |
| US3868187A (en) * | 1972-08-31 | 1975-02-25 | Tokyo Shibaura Electric Co | Avalanche injection type mos memory |
| US3893146A (en) * | 1973-12-26 | 1975-07-01 | Teletype Corp | Semiconductor capacitor structure and memory cell, and method of making |
-
1975
- 1975-12-29 US US05/644,982 patent/US4037242A/en not_active Expired - Lifetime
-
1976
- 1976-11-29 CA CA266,827A patent/CA1095171A/en not_active Expired
- 1976-12-10 GB GB51704/76A patent/GB1530717A/en not_active Expired
- 1976-12-27 JP JP16100776A patent/JPS5283074A/ja active Granted
- 1976-12-29 DE DE19762659296 patent/DE2659296A1/de not_active Withdrawn
- 1976-12-29 FR FR7639467A patent/FR2337403A1/fr active Granted
- 1976-12-29 NL NL7614537A patent/NL7614537A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| US4037242A (en) | 1977-07-19 |
| JPS6112396B2 (enExample) | 1986-04-08 |
| DE2659296A1 (de) | 1977-07-07 |
| JPS5283074A (en) | 1977-07-11 |
| FR2337403B1 (enExample) | 1983-02-04 |
| GB1530717A (en) | 1978-11-01 |
| FR2337403A1 (fr) | 1977-07-29 |
| NL7614537A (nl) | 1977-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1095171A (en) | Dual injector, floating gate mos electrically alterable, non-volatile semiconductor memory device | |
| US4131983A (en) | Adjustment of avalanche voltage in DIFMOS memory devices by control of impurity doping | |
| US5291439A (en) | Semiconductor memory cell and memory array with inversion layer | |
| US5301150A (en) | Flash erasable single poly EPROM device | |
| EP0974146B1 (en) | Nonvolatile memory | |
| US5260593A (en) | Semiconductor floating gate device having improved channel-floating gate interaction | |
| EP0051158B1 (en) | Electrically alterable double dense memory | |
| KR100306670B1 (ko) | Pmos단일다결정비휘발성메모리구조체 | |
| US4412311A (en) | Storage cell for nonvolatile electrically alterable memory | |
| US4425631A (en) | Non-volatile programmable integrated semiconductor memory cell | |
| EP0100572B1 (en) | Electrically erasable prom-cell | |
| WO1996026522A1 (en) | Flash programming of flash eeprom array | |
| US7301794B2 (en) | Non-volatile memory array with simultaneous write and erase feature | |
| EP0177816B1 (en) | Non-volatile dynamic random access memory cell | |
| US4665417A (en) | Non-volatile dynamic random access memory cell | |
| US4432075A (en) | Electrically programmable non-volatile memory | |
| US5140551A (en) | Non-volatile dynamic random access memory array and the method of fabricating thereof | |
| WO1983003166A1 (en) | An electrically alterable, nonvolatile floating-gate memory device | |
| EP0087012A2 (en) | Electrically alterable read-only storage cell and method of operating same | |
| US7224620B2 (en) | CAcT-Tg (CATT) low voltage NVM cells | |
| KR100665413B1 (ko) | 반도체 디바이스 | |
| EP0176714B1 (en) | Memory cell storing logic data in volatile and non-volatile forms |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |