CA1092844A - 3-pyridyl-oxy-alkanecarboxylic acid amides - Google Patents
3-pyridyl-oxy-alkanecarboxylic acid amidesInfo
- Publication number
- CA1092844A CA1092844A CA259,643A CA259643A CA1092844A CA 1092844 A CA1092844 A CA 1092844A CA 259643 A CA259643 A CA 259643A CA 1092844 A CA1092844 A CA 1092844A
- Authority
- CA
- Canada
- Prior art keywords
- oxy
- pyridyl
- composition according
- acid amide
- dimethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001408 amides Chemical class 0.000 title claims abstract description 21
- 239000004009 herbicide Substances 0.000 claims abstract description 36
- 239000000203 mixture Substances 0.000 claims abstract description 36
- 239000013543 active substance Substances 0.000 claims abstract description 30
- 239000000729 antidote Substances 0.000 claims abstract description 25
- 239000001257 hydrogen Substances 0.000 claims abstract description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 14
- 238000000034 method Methods 0.000 claims abstract description 10
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 7
- 230000008635 plant growth Effects 0.000 claims abstract description 6
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 3
- 229910052736 halogen Inorganic materials 0.000 claims abstract 3
- 150000002367 halogens Chemical class 0.000 claims abstract 3
- 230000002363 herbicidal effect Effects 0.000 claims description 28
- -1 nitro, amino, carbamoyl Chemical group 0.000 claims description 14
- 244000062793 Sorghum vulgare Species 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 4
- 235000019713 millet Nutrition 0.000 claims description 4
- 230000001105 regulatory effect Effects 0.000 claims description 4
- 150000003918 triazines Chemical class 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 235000013339 cereals Nutrition 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 1
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 1
- RFONUFROQZJJFB-UHFFFAOYSA-N 2-(2,6-dibromopyridin-3-yl)oxy-n,n-dimethylpropanamide Chemical compound CN(C)C(=O)C(C)OC1=CC=C(Br)N=C1Br RFONUFROQZJJFB-UHFFFAOYSA-N 0.000 claims 1
- PCWSUEZKKUCAFB-UHFFFAOYSA-N 2-(2,6-dimethylpyridin-3-yl)oxy-n,n-dimethylpropanamide Chemical compound CN(C)C(=O)C(C)OC1=CC=C(C)N=C1C PCWSUEZKKUCAFB-UHFFFAOYSA-N 0.000 claims 1
- MOUIQLHWWUEZRR-UHFFFAOYSA-N 2-(6-bromo-2-chloropyridin-3-yl)oxy-n,n-dimethylacetamide Chemical compound CN(C)C(=O)COC1=CC=C(Br)N=C1Cl MOUIQLHWWUEZRR-UHFFFAOYSA-N 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- ZMCRAOPUSGZEMJ-UHFFFAOYSA-N n,n-dimethyl-2-(2,4,6-tribromopyridin-3-yl)oxypropanamide Chemical compound CN(C)C(=O)C(C)OC1=C(Br)C=C(Br)N=C1Br ZMCRAOPUSGZEMJ-UHFFFAOYSA-N 0.000 claims 1
- 229940075522 antidotes Drugs 0.000 abstract description 5
- 125000000217 alkyl group Chemical group 0.000 abstract description 3
- 238000004519 manufacturing process Methods 0.000 abstract description 3
- 125000003545 alkoxy group Chemical group 0.000 abstract description 2
- 125000004093 cyano group Chemical group *C#N 0.000 abstract description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract description 2
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000000304 alkynyl group Chemical group 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 239000000460 chlorine Substances 0.000 description 76
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 39
- 241000196324 Embryophyta Species 0.000 description 30
- 150000001875 compounds Chemical class 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- 239000000243 solution Substances 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- GRFNBEZIAWKNCO-UHFFFAOYSA-N 3-pyridinol Chemical class OC1=CC=CN=C1 GRFNBEZIAWKNCO-UHFFFAOYSA-N 0.000 description 13
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- 239000000839 emulsion Substances 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 9
- 239000008187 granular material Substances 0.000 description 9
- 239000006072 paste Substances 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000012141 concentrate Substances 0.000 description 8
- 229920000151 polyglycol Polymers 0.000 description 8
- 239000010695 polyglycol Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 239000000725 suspension Substances 0.000 description 7
- 239000005995 Aluminium silicate Substances 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 235000012211 aluminium silicate Nutrition 0.000 description 6
- 239000000969 carrier Substances 0.000 description 6
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- IROINLKCQGIITA-UHFFFAOYSA-N terbutryn Chemical compound CCNC1=NC(NC(C)(C)C)=NC(SC)=N1 IROINLKCQGIITA-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 239000000470 constituent Substances 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 230000012010 growth Effects 0.000 description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- 239000004563 wettable powder Substances 0.000 description 4
- CDDCESLWCVAQMG-UHFFFAOYSA-N 2,6-dichloropyridin-3-ol Chemical compound OC1=CC=C(Cl)N=C1Cl CDDCESLWCVAQMG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 244000068988 Glycine max Species 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- YYPNJNDODFVZLE-UHFFFAOYSA-N 3-methylbut-2-enoic acid Chemical compound CC(C)=CC(O)=O YYPNJNDODFVZLE-UHFFFAOYSA-N 0.000 description 2
- DHLUJPLHLZJUBW-UHFFFAOYSA-N 6-methylpyridin-3-ol Chemical compound CC1=CC=C(O)C=N1 DHLUJPLHLZJUBW-UHFFFAOYSA-N 0.000 description 2
- 102100038916 Caspase-5 Human genes 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 244000299507 Gossypium hirsutum Species 0.000 description 2
- 101100112336 Homo sapiens CASP5 gene Proteins 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 101100273286 Mus musculus Casp4 gene Proteins 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 239000002518 antifoaming agent Substances 0.000 description 2
- 230000003115 biocidal effect Effects 0.000 description 2
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000005520 cutting process Methods 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- 239000004491 dispersible concentrate Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 239000000417 fungicide Substances 0.000 description 2
- DDRPCXLAQZKBJP-UHFFFAOYSA-N furfurylamine Chemical compound NCC1=CC=CO1 DDRPCXLAQZKBJP-UHFFFAOYSA-N 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 238000009331 sowing Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- LDVVMCZRFWMZSG-OLQVQODUSA-N (3ar,7as)-2-(trichloromethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)Cl)C(=O)[C@H]21 LDVVMCZRFWMZSG-OLQVQODUSA-N 0.000 description 1
- IAKOZHOLGAGEJT-UHFFFAOYSA-N 1,1,1-trichloro-2,2-bis(p-methoxyphenyl)-Ethane Chemical compound C1=CC(OC)=CC=C1C(C(Cl)(Cl)Cl)C1=CC=C(OC)C=C1 IAKOZHOLGAGEJT-UHFFFAOYSA-N 0.000 description 1
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 1
- WWASEMAXCHAPTH-UHFFFAOYSA-N 2-(2,6-dichloropyridin-3-yl)oxy-n,n-diethylacetamide Chemical compound CCN(CC)C(=O)COC1=CC=C(Cl)N=C1Cl WWASEMAXCHAPTH-UHFFFAOYSA-N 0.000 description 1
- KJZWHOYBGAVNPM-UHFFFAOYSA-N 2-(2,6-dichloropyridin-3-yl)oxy-n,n-dimethylpropanamide Chemical compound CN(C)C(=O)C(C)OC1=CC=C(Cl)N=C1Cl KJZWHOYBGAVNPM-UHFFFAOYSA-N 0.000 description 1
- JEQISUUILXLGHZ-UHFFFAOYSA-N 2-(2,6-dichloropyridin-3-yl)oxypropanamide Chemical compound NC(=O)C(C)OC1=CC=C(Cl)N=C1Cl JEQISUUILXLGHZ-UHFFFAOYSA-N 0.000 description 1
- MJNKZXXQJLAHRD-UHFFFAOYSA-N 2-(2,6-dichloropyridin-3-yl)oxypropanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)N=C1Cl MJNKZXXQJLAHRD-UHFFFAOYSA-N 0.000 description 1
- DXZKMXCPZLRLOB-UHFFFAOYSA-N 2-(2,6-dichloropyridin-3-yl)oxypropanoyl chloride Chemical compound ClC(=O)C(C)OC1=CC=C(Cl)N=C1Cl DXZKMXCPZLRLOB-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- MFYSUUPKMDJYPF-UHFFFAOYSA-N 2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-n-phenylbutanamide Chemical compound C=1C=CC=CC=1NC(=O)C(C(=O)C)N=NC1=CC=C(C)C=C1[N+]([O-])=O MFYSUUPKMDJYPF-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- MONMFXREYOKQTI-UHFFFAOYSA-N 2-bromopropanoic acid Chemical compound CC(Br)C(O)=O MONMFXREYOKQTI-UHFFFAOYSA-N 0.000 description 1
- CQQUWTMMFMJEFE-UHFFFAOYSA-N 2-chloro-n,n-diethylacetamide Chemical compound CCN(CC)C(=O)CCl CQQUWTMMFMJEFE-UHFFFAOYSA-N 0.000 description 1
- RSOPTYAZDFSMTN-UHFFFAOYSA-N 2-chloropyridin-3-ol Chemical compound OC1=CC=CN=C1Cl RSOPTYAZDFSMTN-UHFFFAOYSA-N 0.000 description 1
- IULJSGIJJZZUMF-UHFFFAOYSA-N 2-hydroxybenzenesulfonic acid Chemical compound OC1=CC=CC=C1S(O)(=O)=O IULJSGIJJZZUMF-UHFFFAOYSA-N 0.000 description 1
- VIIGRJHHIKFIDH-UHFFFAOYSA-N 2-pyridin-3-yloxyacetamide Chemical class NC(=O)COC1=CC=CN=C1 VIIGRJHHIKFIDH-UHFFFAOYSA-N 0.000 description 1
- QEYMMOKECZBKAC-UHFFFAOYSA-N 3-chloropropanoic acid Chemical compound OC(=O)CCCl QEYMMOKECZBKAC-UHFFFAOYSA-N 0.000 description 1
- SVUYXAZRYGXWEG-UHFFFAOYSA-N 4-(1-thiomorpholin-4-ylpiperazin-2-yl)morpholine Chemical compound O1CCN(CC1)C1N(CCNC1)N1CCSCC1 SVUYXAZRYGXWEG-UHFFFAOYSA-N 0.000 description 1
- TUIDQYRZDZRHPQ-UHFFFAOYSA-N 5-chloropyridin-3-ol Chemical compound OC1=CN=CC(Cl)=C1 TUIDQYRZDZRHPQ-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 239000005745 Captan Substances 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000518994 Conta Species 0.000 description 1
- 244000152970 Digitaria sanguinalis Species 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical class CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 1
- 241000220485 Fabaceae Species 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 241000209056 Secale Species 0.000 description 1
- 235000007238 Secale cereale Nutrition 0.000 description 1
- 240000005498 Setaria italica Species 0.000 description 1
- 235000007226 Setaria italica Nutrition 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 229940115440 aluminum sodium silicate Drugs 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 239000000022 bacteriostatic agent Substances 0.000 description 1
- 230000003385 bacteriostatic effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229940117949 captan Drugs 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 235000019993 champagne Nutrition 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- IXRWATYWILEKCQ-UHFFFAOYSA-N ethyl 2-(2,6-dichloropyridin-3-yl)oxypropanoate Chemical compound CCOC(=O)C(C)OC1=CC=C(Cl)N=C1Cl IXRWATYWILEKCQ-UHFFFAOYSA-N 0.000 description 1
- ARFLASKVLJTEJD-UHFFFAOYSA-N ethyl 2-bromopropanoate Chemical compound CCOC(=O)C(C)Br ARFLASKVLJTEJD-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000001408 fungistatic effect Effects 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- VCFRZZCKWZMRAE-UHFFFAOYSA-N hydroxy-imino-oxo-$l^{5}-bromane Chemical class OBr(=N)=O VCFRZZCKWZMRAE-UHFFFAOYSA-N 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000007689 inspection Methods 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 230000003641 microbiacidal effect Effects 0.000 description 1
- XOVBWLOLNBOMON-UHFFFAOYSA-N n-benzyl-2-(2,6-dichloropyridin-3-yl)oxypropanamide Chemical compound C=1C=CC=CC=1CNC(=O)C(C)OC1=CC=C(Cl)N=C1Cl XOVBWLOLNBOMON-UHFFFAOYSA-N 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 231100001184 nonphytotoxic Toxicity 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical group C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000000441 potassium aluminium silicate Substances 0.000 description 1
- 235000012219 potassium aluminium silicate Nutrition 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- WDZVYHXDNNXLFP-UHFFFAOYSA-N pyridin-3-yl carbamate Chemical compound NC(=O)OC1=CC=CN=C1 WDZVYHXDNNXLFP-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 239000000429 sodium aluminium silicate Substances 0.000 description 1
- 235000012217 sodium aluminium silicate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- KZOJQMWTKJDSQJ-UHFFFAOYSA-M sodium;2,3-dibutylnaphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S([O-])(=O)=O)=C(CCCC)C(CCCC)=CC2=C1 KZOJQMWTKJDSQJ-UHFFFAOYSA-M 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000003019 stabilising effect Effects 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- UIERETOOQGIECD-ONEGZZNKSA-N tiglic acid Chemical compound C\C=C(/C)C(O)=O UIERETOOQGIECD-ONEGZZNKSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 230000009105 vegetative growth Effects 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/65—One oxygen atom attached in position 3 or 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1096375 | 1975-08-25 | ||
| CH10963/75 | 1975-08-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1092844A true CA1092844A (en) | 1981-01-06 |
Family
ID=4368638
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA259,643A Expired CA1092844A (en) | 1975-08-25 | 1976-08-23 | 3-pyridyl-oxy-alkanecarboxylic acid amides |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4067725A (enExample) |
| JP (1) | JPS5227773A (enExample) |
| BE (1) | BE845449A (enExample) |
| CA (1) | CA1092844A (enExample) |
| DE (1) | DE2637886A1 (enExample) |
| ES (1) | ES450943A1 (enExample) |
| FR (1) | FR2321842A1 (enExample) |
| GB (1) | GB1548033A (enExample) |
| IL (1) | IL50338A (enExample) |
| NL (1) | NL185647C (enExample) |
| SU (1) | SU917679A3 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0006608B1 (de) * | 1978-06-29 | 1982-06-30 | Ciba-Geigy Ag | Herbizid wirksame, optisch aktive R(+)-Dichlorpyridyloxy-alpha-phenoxy-propionsäure-propargylester, Verfahren zu ihrer Herstellung und deren Verwendung in Mitteln zur Unkrautbekämpfung |
| EP0018497B1 (de) * | 1979-04-06 | 1982-04-28 | Bayer Ag | Azolyloxy-essigsäureamide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide |
| DE2946432A1 (de) * | 1979-11-17 | 1981-06-11 | Bayer Ag, 5090 Leverkusen | Tetrazolyloxycarbonsaeureamide, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| JPS57126473A (en) * | 1981-01-28 | 1982-08-06 | Nippon Tokushu Noyaku Seizo Kk | 2-pyridyloxyacetic anilide and its preparation application |
| JPS57149268A (en) * | 1981-03-12 | 1982-09-14 | Nippon Tokushu Noyaku Seizo Kk | 2-pyridyloxyacetanilide compound, its preparation and herbicide |
| US4753674A (en) * | 1981-10-20 | 1988-06-28 | Ube Industries, Ltd. | Herbicidal composition containing a phenoxyalkylamide derivative and method for controlling weeds by the use of the same |
| US5380732A (en) * | 1986-11-28 | 1995-01-10 | Roussel-Uclaf | Pesticidal compounds |
| GB8628467D0 (en) * | 1986-11-28 | 1987-01-07 | Wellcome Found | Pesticidal compounds |
| TW259690B (enExample) | 1992-08-01 | 1995-10-11 | Hoechst Ag | |
| RU2408582C1 (ru) * | 2009-07-01 | 2011-01-10 | Федеральное государственное образовательное учреждение высшего профессионального образования Кубанский государственный аграрный университет | N-бензил-n-фенил-4,6-диметил-2-хлорпиридил-3-карбоксамид, проявляющий рострегулирующую активность |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3249619A (en) * | 1964-07-24 | 1966-05-03 | Dow Chemical Co | Carbamate esters of trichloro and tetrachloro pyridine |
| DE2103728C3 (de) * | 1971-01-27 | 1981-01-15 | C.H. Boehringer Sohn, 6507 Ingelheim | 2-Methyl-3,5-dibrom-4-hydroxy-6chlorpyridin-Derivate, Verfahren zu ihrer Herstellung und sie enthaltende herbizide Mittel CH. Boehringer Sohn, 6507 Ingelheim |
| US3755339A (en) * | 1971-07-26 | 1973-08-28 | Dow Chemical Co | Esters of aminohalopyridyloxy acids |
| US3761486A (en) * | 1971-07-26 | 1973-09-25 | Dow Chemical Co | Aminohalopyridyloxy acids and derivatives thereof |
| US3987050A (en) * | 1974-01-22 | 1976-10-19 | The Dow Chemical Company | Substituted pyridinylalkoxy-, pyridinylalkylsulfonyl and pyridinylalkylthio-phenyl-lower-alkanamides |
| US4003734A (en) * | 1974-01-22 | 1977-01-18 | The Dow Chemical Company | Substituted pyridinyloxy(thio)phenyl-acetamides, -ureas and urea derivatives and herbicidal compositions and methods containing said compounds |
| US4026937A (en) * | 1974-01-22 | 1977-05-31 | The Dow Chemical Company | Substituted pyridinylalkoxy-, pyridinylalkylsulfonyl- and pyridinylalkylthio-phenylureas |
-
1976
- 1976-08-18 US US05/715,351 patent/US4067725A/en not_active Expired - Lifetime
- 1976-08-23 CA CA259,643A patent/CA1092844A/en not_active Expired
- 1976-08-23 FR FR7625480A patent/FR2321842A1/fr active Granted
- 1976-08-23 IL IL50338A patent/IL50338A/xx unknown
- 1976-08-23 DE DE19762637886 patent/DE2637886A1/de active Granted
- 1976-08-24 GB GB35216/76A patent/GB1548033A/en not_active Expired
- 1976-08-24 BE BE170016A patent/BE845449A/xx not_active IP Right Cessation
- 1976-08-24 ES ES450943A patent/ES450943A1/es not_active Expired
- 1976-08-25 SU SU762392200A patent/SU917679A3/ru active
- 1976-08-25 JP JP51101522A patent/JPS5227773A/ja active Granted
- 1976-08-25 NL NLAANVRAGE7609454,A patent/NL185647C/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6147835B2 (enExample) | 1986-10-21 |
| NL185647C (nl) | 1990-06-18 |
| ES450943A1 (es) | 1977-09-01 |
| JPS5227773A (en) | 1977-03-02 |
| SU917679A3 (ru) | 1982-03-30 |
| IL50338A0 (en) | 1976-10-31 |
| US4067725A (en) | 1978-01-10 |
| GB1548033A (en) | 1979-07-04 |
| FR2321842A1 (fr) | 1977-03-25 |
| IL50338A (en) | 1980-09-16 |
| DE2637886A1 (de) | 1977-03-10 |
| NL7609454A (nl) | 1977-03-01 |
| BE845449A (fr) | 1977-02-24 |
| DE2637886C2 (enExample) | 1988-10-13 |
| NL185647B (nl) | 1990-01-16 |
| FR2321842B1 (enExample) | 1979-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0363818B1 (de) | Oximether-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende Fungizide | |
| US4629493A (en) | Heterocyclic ether type phenoxy fatty acid derivatives and herbicidal composition | |
| DK168380B1 (da) | Halogensubstituerede quinoxalin-N-oxider til anvendelse som mellemprodukter til fremstilling af herbicide quinoxalinyloxyphenoxyalkancarboxylsyrederivater | |
| US4134751A (en) | Herbicidal compound, herbicidal composition containing the same and method of use thereof | |
| US4213774A (en) | Pyridyloxy-phenoxy-α-propionic acid aminoalkyl esters | |
| KR900005134B1 (ko) | 피리딜(옥시/티오) 페녹시 화합물, 이의 제조 방법 및 이를 포함하는 제초제 조성물 | |
| US4348221A (en) | Herbicidal derivatives of pyrid-2-yloxyphenoxy-acetic acids and esters | |
| US3823135A (en) | Pyrimidone herbicides | |
| IE42046B1 (en) | Propionic acid derivatives, processes for their preparation and herbicidal compositions containing them | |
| KR20010034505A (ko) | 살균제로서 유용한 2-피리딜메틸아민 유도체 | |
| GB1561616A (en) | Pyridyloxyphenoxy-alkanecarboxylic acid derivatives which are effective as herbicides and as agents regulating plant growth | |
| US4543413A (en) | Sulphonyl derivatives of N-phenyl pyridineamines | |
| CA1092844A (en) | 3-pyridyl-oxy-alkanecarboxylic acid amides | |
| US4221584A (en) | Herbicidal and plant-growth-regulating N-(heterocyclyl)-methylacetanilides | |
| US4783459A (en) | Anilinopyrimidine fungicides | |
| RU2017725C1 (ru) | Производные бензанилидов или бензиламидов, гербицидная композиция и способ борьбы с ростом нежелательной растительности | |
| US4477276A (en) | Heterocyclic phenyl ethers and their herbicidal use | |
| KR840002123B1 (ko) | 0-(피리딜옥시-페닐)-락트산에스테르의 제조방법 | |
| US4404020A (en) | Certain esters of 2-[(2,6-dichloro-3-pyridyl)oxy]propionic acid, compositions containing same and their herbicidal properties | |
| SU1452454A3 (ru) | Способ борьбы с нежелательной растительностью | |
| US4423222A (en) | Pyridinyl fungicides and herbicides | |
| CH635324A5 (en) | Compounds having agronomic use | |
| US4596801A (en) | 4H-3,1-benzoxazine derivatives, process for producing the same and agricultural or horticultural fungicide containing the same | |
| US4851539A (en) | 2,3-Difluoropyridine and 3-fluoro-2-pyridinyloxyphenol compounds | |
| US4678509A (en) | Certain pyridyloxy or thio-phenoxy-propanoic acids or salts thereof useful as herbicides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |