CA1086286A - Ram air inflatable aerofoil structure - Google Patents
Ram air inflatable aerofoil structureInfo
- Publication number
- CA1086286A CA1086286A CA285,228A CA285228A CA1086286A CA 1086286 A CA1086286 A CA 1086286A CA 285228 A CA285228 A CA 285228A CA 1086286 A CA1086286 A CA 1086286A
- Authority
- CA
- Canada
- Prior art keywords
- spar
- leading edge
- aerofoil
- edge
- flight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 claims description 11
- 239000003562 lightweight material Substances 0.000 claims description 2
- 238000011144 upstream manufacturing Methods 0.000 claims description 2
- 230000000694 effects Effects 0.000 description 6
- 238000007493 shaping process Methods 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000005755 formation reaction Methods 0.000 description 3
- 230000011514 reflex Effects 0.000 description 3
- 239000000835 fiber Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 1
- 101100331133 Mus musculus Defa1 gene Proteins 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 108091033760 Oncomir Proteins 0.000 description 1
- 235000011464 Pachycereus pringlei Nutrition 0.000 description 1
- 240000006939 Pachycereus weberi Species 0.000 description 1
- 235000011466 Pachycereus weberi Nutrition 0.000 description 1
- 206010034719 Personality change Diseases 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 238000009958 sewing Methods 0.000 description 1
- 108010003641 statine renin inhibitory peptide Proteins 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B64—AIRCRAFT; AVIATION; COSMONAUTICS
- B64C—AEROPLANES; HELICOPTERS
- B64C31/00—Aircraft intended to be sustained without power plant; Powered hang-glider-type aircraft; Microlight-type aircraft
- B64C31/028—Hang-glider-type aircraft; Microlight-type aircraft
- B64C31/036—Hang-glider-type aircraft; Microlight-type aircraft having parachute-type wing
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B64—AIRCRAFT; AVIATION; COSMONAUTICS
- B64C—AEROPLANES; HELICOPTERS
- B64C31/00—Aircraft intended to be sustained without power plant; Powered hang-glider-type aircraft; Microlight-type aircraft
- B64C31/06—Kites
- B64C2031/065—Kites of inflatable wing type
Landscapes
- Engineering & Computer Science (AREA)
- Aviation & Aerospace Engineering (AREA)
- Toys (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB35024 | 1976-08-23 | ||
| GB35024/76A GB1585099A (en) | 1976-08-23 | 1976-08-23 | Ram air inflatable aerofoil structures |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1086286A true CA1086286A (en) | 1980-09-23 |
Family
ID=10372899
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA285,228A Expired CA1086286A (en) | 1976-08-23 | 1977-08-22 | Ram air inflatable aerofoil structure |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4129272A (enExample) |
| CA (1) | CA1086286A (enExample) |
| DE (1) | DE2737597A1 (enExample) |
| GB (1) | GB1585099A (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE884431A (fr) * | 1979-07-19 | 1981-01-23 | Jones Andrew W | Structure de voilure |
| DE2933050A1 (de) * | 1979-08-16 | 1981-02-26 | Dieter Dipl Chem Dr Strasilla | Einrichtung zum vorwaertsbewegenden antreiben eines koerpers durch windkraft mittels eines segels |
| US4406433A (en) * | 1980-12-18 | 1983-09-27 | Aerovironment, Inc. | Leading edge inlet for ram air pressurized airfoil |
| USD273211S (en) | 1981-04-24 | 1984-03-27 | Zether Limited | Kite |
| FI820813L (fi) * | 1982-03-10 | 1983-09-11 | Maorten Bondestam | Drake |
| US4469296A (en) * | 1982-03-15 | 1984-09-04 | Lee Richard P | Fishing kite |
| EP0135501A1 (en) * | 1982-09-30 | 1985-04-03 | JONES, Andrew, Wilfrid | Free flyable structure |
| GB2165513B (en) * | 1984-10-15 | 1988-02-03 | Barry John Jacobson | Inflatable aeroplane wing structure |
| FR2581961A1 (fr) * | 1984-11-16 | 1986-11-21 | Dominique Legaignoux | Aile propulsive |
| DE3641790C3 (de) * | 1986-12-06 | 1993-12-02 | Friedrich K Dipl Phy Dolezalek | Gleitfallschirm |
| US4846423A (en) * | 1987-11-23 | 1989-07-11 | Pioneer Aerospace Corporation | Gliding wing parachute apparatus with staged reefing deployment means |
| US4846424A (en) * | 1988-01-29 | 1989-07-11 | Skynasaur Inc. | Controllable airfoil kite |
| DE3804892C1 (en) * | 1988-02-17 | 1989-06-01 | Karl 8011 Zorneding De Bauer | Paraglider |
| CH676452A5 (enExample) * | 1988-04-08 | 1991-01-31 | Konrad Schafroth | |
| US4892272A (en) * | 1988-10-14 | 1990-01-09 | Hadzicki Joseph R | Kite-like flying device with dual handles and four point control |
| JPH0689492B2 (ja) * | 1989-03-06 | 1994-11-09 | 東レ株式会社 | 滑空装置用クロス |
| DE4031525A1 (de) * | 1989-10-28 | 1991-05-02 | Bautek Flachdachprodukte Gmbh | Haengegleiter |
| JPH0616193A (ja) * | 1992-06-30 | 1994-01-25 | Tetsuya Kaneko | パラグライダー |
| US5417390A (en) * | 1994-03-02 | 1995-05-23 | Southwick; Jeffrey M. | Controlled ram-air inflated kite with X-braced bridle and operator harness with anchor |
| USD393295S (en) | 1997-05-14 | 1998-04-07 | Crosbie Scott C | Inflatable kite |
| CA2297643C (en) * | 2000-01-31 | 2004-12-21 | Raymond Potvin | Flexible kite |
| KR100412239B1 (ko) * | 2000-05-04 | 2003-12-31 | 주식회사 진글라이더 | 패러글라이더 |
| DE10109640C1 (de) * | 2001-03-01 | 2002-06-20 | Friedrich Van Helden | Lenkbarer Zugdrachen |
| DE60228226D1 (de) * | 2001-03-29 | 2008-09-25 | Peter Robert Lynn | Konzept für einen zugdrachen |
| US6520454B2 (en) * | 2001-06-12 | 2003-02-18 | William K. Winner | Control line assembly for kites |
| AU2002362135A1 (en) * | 2001-12-07 | 2003-07-09 | Atair Aerospace, Inc. | Ram air parachute with improved canopy design |
| DE10237034B4 (de) * | 2002-08-09 | 2004-05-27 | Steffen Born | Lenkbarer Zugdrachen |
| FR2854869B1 (fr) * | 2003-04-16 | 2006-08-04 | Diamond White Servicos De Cons | Aile propulsive a diedre negatif |
| US7093803B2 (en) * | 2003-12-16 | 2006-08-22 | Culp David A | Apparatus and method for aerodynamic wing |
| FR2866859B1 (fr) * | 2004-03-01 | 2006-05-26 | Diamond White Servicos De Cons | Aile a diedre negatif de traction d'une charge |
| FR2880868B1 (fr) * | 2005-01-20 | 2008-08-01 | Phiran Mau | Procede de locomotion aerienne et aeronef polyvalent a aile(s) gonflable(s) utilisant ce procede |
| DE102006018444B4 (de) * | 2006-04-18 | 2010-08-19 | Steffen Born | Lenkbarer Zugdrachen |
| US7578480B2 (en) * | 2007-04-20 | 2009-08-25 | Pioneer Aerospace Corporation | Reefing apparatus for controlling the inflation of a gliding wing parachute |
| US7861973B1 (en) | 2008-04-01 | 2011-01-04 | Gaylord Olson | Wind responsive power generation system |
| DK2285667T3 (da) * | 2008-05-30 | 2013-01-07 | Skysails Gmbh & Co Kg | Sejl af dragetypen med forbedret linefastgørelse |
| US20110192938A1 (en) * | 2010-02-09 | 2011-08-11 | Northrop Grumman Systems Corporation | Wind power generation system for lighter than air (lta) platforms |
| EP2635491A4 (en) * | 2010-11-03 | 2015-09-16 | Makani Power Inc | FLIGHT CONFIGURATION AND FLIGHT STRATEGY FOR WIND SPEEDS FOR FLIGHT |
| KR101276626B1 (ko) * | 2011-09-30 | 2013-06-18 | 주식회사 진글라이더 | 이격된 공기유입구를 구비한 패러글라이더. |
| CH706134A1 (de) * | 2012-02-22 | 2013-08-30 | Prospective Concepts Ag | Tragflügel aus flexiblem Material. |
| RU2534683C1 (ru) * | 2013-06-18 | 2014-12-10 | Николай Евгеньевич Староверов | Вращающийся или планирующий парашют (варианты) |
| US9216822B1 (en) * | 2013-07-29 | 2015-12-22 | Selbourne Rose | Helium assisted aerial recreational device systems |
| CN104941202B (zh) * | 2015-06-01 | 2018-07-13 | 励奇峰 | 一种单线动态风筝 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2519594A (en) * | 1949-05-28 | 1950-08-22 | Fred H Ohland | Kite |
| US2737360A (en) * | 1950-09-08 | 1956-03-06 | William M Allison | Flexible kite |
| US3091420A (en) * | 1961-05-31 | 1963-05-28 | Deguin Andre | Captive self-lifting apparatus |
| US3285546A (en) * | 1964-10-01 | 1966-11-15 | Space Recovery Res Ct Inc | Multi-cell wing type aerial device |
| FR1523592A (fr) * | 1967-05-05 | 1968-05-03 | Bekleidungswerke Seifhennerdor | Parachute planeur |
| US3972495A (en) * | 1969-09-30 | 1976-08-03 | Jalbert Domina C | Aerial sled |
| US3749337A (en) * | 1969-09-30 | 1973-07-31 | D Jalbert | Aerial sled |
| US3806071A (en) * | 1972-10-19 | 1974-04-23 | N Brown | Air foil kite |
-
1976
- 1976-08-23 GB GB35024/76A patent/GB1585099A/en not_active Expired
-
1977
- 1977-08-19 US US05/826,256 patent/US4129272A/en not_active Expired - Lifetime
- 1977-08-20 DE DE19772737597 patent/DE2737597A1/de active Granted
- 1977-08-22 CA CA285,228A patent/CA1086286A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US4129272A (en) | 1978-12-12 |
| GB1585099A (en) | 1981-02-25 |
| DE2737597C2 (enExample) | 1989-04-27 |
| DE2737597A1 (de) | 1978-03-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1086286A (en) | Ram air inflatable aerofoil structure | |
| CA1141737A (en) | Aerofoil structure | |
| US4742977A (en) | Wing structure with self-induced camber | |
| US4601443A (en) | Free flyable structure | |
| US3524613A (en) | Flexible gliding wing | |
| US4846424A (en) | Controllable airfoil kite | |
| US4424945A (en) | Parafoil | |
| US4858854A (en) | Inflatable aerodynamic wing structure | |
| US3740008A (en) | Multi-keeled kite | |
| US4815681A (en) | Stunt kite dihedral wing | |
| US3942747A (en) | Joined wing aircraft | |
| US7093803B2 (en) | Apparatus and method for aerodynamic wing | |
| US3995799A (en) | Hang glider | |
| US4116406A (en) | Hang glider having inflatable airfoil | |
| US5120006A (en) | Kite-like flying device with independent wing surface control | |
| US4865274A (en) | Passive control assembly for gliding device | |
| US3295793A (en) | Kite-type aircraft | |
| US3289976A (en) | Aircraft | |
| US5433401A (en) | Airfoil shaped kite with aileron extensions | |
| US4981273A (en) | Air baffle for stunt kite and stunt kite | |
| US4209148A (en) | Flying wing | |
| US3298635A (en) | Self-inflating wings | |
| US4901945A (en) | Hybrid wing assembly | |
| US4168816A (en) | Airplane shaped kite | |
| US5131609A (en) | Two-string stunt kite |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |