CA1077779A - Arrangement in or relating to a projectile - Google Patents
Arrangement in or relating to a projectileInfo
- Publication number
- CA1077779A CA1077779A CA281,577A CA281577A CA1077779A CA 1077779 A CA1077779 A CA 1077779A CA 281577 A CA281577 A CA 281577A CA 1077779 A CA1077779 A CA 1077779A
- Authority
- CA
- Canada
- Prior art keywords
- projectile
- primary
- penetration
- charges
- bore
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000035515 penetration Effects 0.000 claims abstract description 45
- 230000009172 bursting Effects 0.000 claims abstract description 16
- 229910052751 metal Inorganic materials 0.000 claims description 9
- 239000002184 metal Substances 0.000 claims description 9
- 238000005192 partition Methods 0.000 claims description 3
- 230000000694 effects Effects 0.000 abstract description 21
- 238000013467 fragmentation Methods 0.000 abstract description 7
- 238000006062 fragmentation reaction Methods 0.000 abstract description 7
- 206010041662 Splinter Diseases 0.000 description 12
- 229910000831 Steel Inorganic materials 0.000 description 7
- 239000010959 steel Substances 0.000 description 7
- 239000004411 aluminium Substances 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- 239000012634 fragment Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- UONOETXJSWQNOL-UHFFFAOYSA-N tungsten carbide Chemical compound [W+]#[C-] UONOETXJSWQNOL-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 229910052726 zirconium Inorganic materials 0.000 description 2
- FGRBYDKOBBBPOI-UHFFFAOYSA-N 10,10-dioxo-2-[4-(N-phenylanilino)phenyl]thioxanthen-9-one Chemical compound O=C1c2ccccc2S(=O)(=O)c2ccc(cc12)-c1ccc(cc1)N(c1ccccc1)c1ccccc1 FGRBYDKOBBBPOI-UHFFFAOYSA-N 0.000 description 1
- 229910000851 Alloy steel Inorganic materials 0.000 description 1
- 229910000760 Hardened steel Inorganic materials 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 235000019589 hardness Nutrition 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910001092 metal group alloy Inorganic materials 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000000700 radioactive tracer Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B12/00—Projectiles, missiles or mines characterised by the warhead, the intended effect, or the material
- F42B12/02—Projectiles, missiles or mines characterised by the warhead, the intended effect, or the material characterised by the warhead or the intended effect
- F42B12/20—Projectiles, missiles or mines characterised by the warhead, the intended effect, or the material characterised by the warhead or the intended effect of high-explosive type
- F42B12/201—Projectiles, missiles or mines characterised by the warhead, the intended effect, or the material characterised by the warhead or the intended effect of high-explosive type characterised by target class
- F42B12/204—Projectiles, missiles or mines characterised by the warhead, the intended effect, or the material characterised by the warhead or the intended effect of high-explosive type characterised by target class for attacking structures, e.g. specific buildings or fortifications, ships or vehicles
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B12/00—Projectiles, missiles or mines characterised by the warhead, the intended effect, or the material
- F42B12/02—Projectiles, missiles or mines characterised by the warhead, the intended effect, or the material characterised by the warhead or the intended effect
- F42B12/04—Projectiles, missiles or mines characterised by the warhead, the intended effect, or the material characterised by the warhead or the intended effect of armour-piercing type
- F42B12/06—Projectiles, missiles or mines characterised by the warhead, the intended effect, or the material characterised by the warhead or the intended effect of armour-piercing type with hard or heavy core; Kinetic energy penetrators
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B12/00—Projectiles, missiles or mines characterised by the warhead, the intended effect, or the material
- F42B12/02—Projectiles, missiles or mines characterised by the warhead, the intended effect, or the material characterised by the warhead or the intended effect
- F42B12/36—Projectiles, missiles or mines characterised by the warhead, the intended effect, or the material characterised by the warhead or the intended effect for dispensing materials; for producing chemical or physical reaction; for signalling ; for transmitting information
- F42B12/44—Projectiles, missiles or mines characterised by the warhead, the intended effect, or the material characterised by the warhead or the intended effect for dispensing materials; for producing chemical or physical reaction; for signalling ; for transmitting information of incendiary type
Landscapes
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Combustion & Propulsion (AREA)
- General Engineering & Computer Science (AREA)
- Aiming, Guidance, Guns With A Light Source, Armor, Camouflage, And Targets (AREA)
- Drilling And Exploitation, And Mining Machines And Methods (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO762297A NO137297C (no) | 1976-07-01 | 1976-07-01 | Prosjektil. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1077779A true CA1077779A (en) | 1980-05-20 |
Family
ID=19882986
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA281,577A Expired CA1077779A (en) | 1976-07-01 | 1977-06-28 | Arrangement in or relating to a projectile |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4353302A (enExample) |
| BE (1) | BE856378A (enExample) |
| CA (1) | CA1077779A (enExample) |
| DE (2) | DE7719490U1 (enExample) |
| DK (1) | DK144985C (enExample) |
| FI (1) | FI60309C (enExample) |
| FR (1) | FR2356906A1 (enExample) |
| GB (1) | GB1533697A (enExample) |
| IT (1) | IT1081008B (enExample) |
| NL (1) | NL185422C (enExample) |
| NO (1) | NO137297C (enExample) |
| SE (1) | SE413550B (enExample) |
| TR (1) | TR20496A (enExample) |
Families Citing this family (54)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH627550A5 (de) | 1978-05-30 | 1982-01-15 | Oerlikon Buehrle Ag | Drallstabilisiertes treibspiegelgeschoss zur ueberwindung eines heterogenen widerstandes. |
| DE2824703C2 (de) * | 1978-06-06 | 1982-11-25 | Diehl GmbH & Co, 8500 Nürnberg | Geschoß mit einem Durchschlagkörper |
| US4970960A (en) * | 1980-11-05 | 1990-11-20 | Feldmann Fritz K | Anti-material projectile |
| AU545632B2 (en) * | 1980-11-05 | 1985-07-25 | Pacific Technica Corp. | Frangible projectile |
| US4444112A (en) * | 1981-03-27 | 1984-04-24 | A/S Raufoss Ammunisjonsfabrikker | Multi-capability projectile and method of making same |
| US4435887A (en) | 1981-03-27 | 1984-03-13 | A/S Raufoss Ammunisjonsfabrikker | Method of making projectile |
| DE3118403C2 (de) * | 1981-05-09 | 1983-11-17 | Messerschmitt-Bölkow-Blohm GmbH, 8000 München | "Vorrichtung zum lösbaren Verriegeln einer Granate in einem kombinierten Geschoß" |
| DE3151525C1 (de) * | 1981-12-24 | 1991-10-10 | Rheinmetall Gmbh | Munitionseinheit |
| DE3209594A1 (de) * | 1982-03-17 | 1983-09-29 | L'Etat Français représenté par le Délégué Général pour l'Armement, 75997 Paris | Panzerbrechendes wuchtgeschoss insbesondere zum bekaempfen von mehrplattenzielen |
| DE3209593A1 (de) * | 1982-03-17 | 1983-09-29 | Rheinmetall GmbH, 4000 Düsseldorf | Unterkalibriges panzerbrechendes wuchtgeschoss (penetrator) |
| DE3301381C2 (de) * | 1983-01-18 | 1986-03-20 | Rheinmetall GmbH, 4000 Düsseldorf | Sprenggeschoß |
| US4829904A (en) * | 1983-06-22 | 1989-05-16 | Branscomb Corporation N. V. | Ammunition round |
| HU192037B (en) * | 1983-06-22 | 1987-04-28 | Branscomb Corp Nv | Cartridge for guns and plastic shoe for gun cartridges |
| DE3401736C1 (de) * | 1984-01-19 | 1985-10-10 | Messerschmitt-Bölkow-Blohm GmbH, 8012 Ottobrunn | Gefechtskopf zur Bekämpfung von Flugzeugen |
| US4612860A (en) * | 1984-07-02 | 1986-09-23 | Abraham Flatau | Projectile |
| US4625650A (en) * | 1984-10-29 | 1986-12-02 | Olin Corporation | Multiple effect ammunition |
| US4648324A (en) * | 1985-10-01 | 1987-03-10 | Olin Corporation | Projectile with enhanced target penetrating power |
| EP0227126A1 (fr) * | 1985-12-17 | 1987-07-01 | FABRIQUE NATIONALE HERSTAL en abrégé FN Société Anonyme | Obus à effets combinés |
| ATE52612T1 (de) * | 1986-06-09 | 1990-05-15 | Royal Ordnance Plc | Panzerbrechendes geschoss. |
| AU601371B2 (en) * | 1986-06-09 | 1990-09-13 | Royal Ordnance Plc | Armour piercing projectile |
| USH1235H (en) | 1986-06-18 | 1993-10-05 | The United States Of America As Represented By The Secretary Of The Navy | Armor-piercing projectile |
| FR2615937B1 (fr) * | 1987-05-27 | 1989-09-08 | Ladriere Serge | Perfectionnements apportes aux projectiles perforants |
| CA1333543C (fr) * | 1987-10-05 | 1994-12-20 | Jean-Pierre Denis | Projectile destine a etre tire par une arme a feu |
| FR2629580A1 (fr) * | 1988-03-31 | 1989-10-06 | Jacquier Pierre | Projectile perforant a noyau emporte-piece |
| US5020439A (en) * | 1989-05-05 | 1991-06-04 | Olin Corporation | Projectile having improved baseplug |
| US5164533A (en) * | 1990-05-23 | 1992-11-17 | Olin Corporation | Method of assembling a pyrotechnically initiated projectile |
| US5133259A (en) * | 1990-05-23 | 1992-07-28 | Olin Corporation | Seal ring for pyrotechnically initiated projectile |
| FR2664970B1 (fr) * | 1990-07-17 | 1992-09-25 | Manurhin Defense | Projectile a effet destructif explosant par impact. |
| NO172865C (no) * | 1991-08-01 | 1993-09-15 | Raufoss As | Flereffekt-prosjektil og fremgangsmaate ved dets fremstilling |
| KR100220883B1 (ko) * | 1995-06-07 | 1999-09-15 | 글렌 에이치. 렌젠 주니어 | 수중 물체에 사용하기 위한 공기 역학적으로 안정화된 발사체 시스템 |
| DE19651170A1 (de) * | 1996-12-10 | 1998-06-18 | Diehl Gmbh & Co | Zünderloses, ballistisches Sprenggeschoß |
| DE19700349C2 (de) * | 1997-01-08 | 2002-02-07 | Futurtec Ag | Geschoß oder Gefechtskopf zur Bekämpfung gepanzerter Ziele |
| DE10057673A1 (de) * | 2000-11-21 | 2002-05-23 | Rheinmetall W & M Gmbh | Gefechtskopf |
| AT412510B (de) * | 2001-09-19 | 2005-03-25 | Oregon Ets Patentverwertung | Geschoss |
| US7520224B2 (en) * | 2006-04-06 | 2009-04-21 | John D. Taylor | Advanced armor-piercing projectile construction and method |
| EP2018878A1 (de) * | 2007-07-25 | 2009-01-28 | Sorin Dr. Lenz | Keramikimplantate- Zirkonimplantate- mit einer Titan- oder Titanoxidbeschichtung des intraossären Teiles |
| EP2439183B1 (de) | 2010-10-06 | 2013-12-25 | CeramOss GmbH | Monolithischer Keramikkörper mit Mischoxid-Randbereich und metallischer Oberfläche, Verfahren zu dessen Herstellung und dessen Verwendung |
| DE102011018475A1 (de) * | 2011-04-21 | 2012-10-25 | Rwm Schweiz Ag | Vorrichtung und Verfahren zur luftdichten Abdeckung einer Leuchtspur oder dergleichen |
| RU2477831C2 (ru) * | 2011-05-27 | 2013-03-20 | Российская Федерация, от имени которой выступает Министерство обороны Российской Федерации | Артиллерийский осколочно-фугасный снаряд |
| US8960094B1 (en) | 2013-10-18 | 2015-02-24 | BPOE Associates, Trustee for Bullet push-out explosive CRT Trust | Bullet with push-out explosive |
| BR112016009057B1 (pt) * | 2013-10-25 | 2021-02-02 | Ruag Ammotec Gmbh | cartucho |
| USD813974S1 (en) | 2015-11-06 | 2018-03-27 | Vista Outdoor Operations Llc | Cartridge with an enhanced ball round |
| US10436557B2 (en) * | 2016-04-18 | 2019-10-08 | Ammo Technologies, Inc. | Armor-piercing projectile |
| SE541612C2 (sv) * | 2016-09-15 | 2019-11-12 | Bae Systems Bofors Ab | Modifierbar delningsbar projektil och metod för att modifiera en projektil |
| EP3312546B1 (de) | 2016-10-20 | 2019-01-30 | RUAG Ammotec AG | Mehrzweckgeschoss |
| US10551154B2 (en) | 2017-01-20 | 2020-02-04 | Vista Outdoor Operations Llc | Rifle cartridge with improved bullet upset and separation |
| US20190017791A1 (en) * | 2017-03-07 | 2019-01-17 | U.S. Army Research Laboratory Attn: Rdrl-Loc-I | Reduced Jacketed Bullet Bore Resistance |
| DE102017106526A1 (de) | 2017-03-27 | 2018-10-11 | Rheinmetall Waffe Munition Gmbh | Geschoss, insbesondere im Mittelkaliberbereich |
| WO2019048914A1 (de) | 2017-09-09 | 2019-03-14 | Ruag Ammotec Ag | Vollmantel-sicherheitsgeschoss, insbesondere für mehrzweckanwendungen |
| USD848569S1 (en) | 2018-01-20 | 2019-05-14 | Vista Outdoor Operations Llc | Rifle cartridge |
| RU197519U1 (ru) * | 2019-11-18 | 2020-05-12 | Анатолий Иванович Синюгин | Пуля бронебойно-зажигательная |
| RU197462U1 (ru) * | 2019-11-29 | 2020-04-28 | Анатолий Иванович Синюгин | Многоцелевой снаряд - пуля |
| CN113137897B (zh) * | 2021-03-22 | 2022-04-19 | 北京理工大学 | 一种基于活性材料和惰性材料的复合式横向效应增强弹 |
| US12253340B1 (en) * | 2023-09-01 | 2025-03-18 | True Velocity IP Holdings, Inc. | Thermal tipped penetrator bullet |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US740849A (en) * | 1903-06-18 | 1903-10-06 | Diller B Groff | Projectile. |
| US1179686A (en) * | 1914-08-18 | 1916-04-18 | Jan Willem Peppelman Van Kampen | Armor-piercing projectile. |
| FR764833A (fr) * | 1933-02-23 | 1934-05-29 | Soc Fr Munitions De Chasse | Perfectionnement dans la fabrication des projectiles d'armes à feu |
| NL76015C (enExample) * | 1947-04-02 | 1900-01-01 | ||
| US2724334A (en) * | 1949-12-12 | 1955-11-22 | William C Norton | High velocity armor piercing shot |
| BE566579A (enExample) * | 1957-05-08 | |||
| US3028808A (en) * | 1958-01-09 | 1962-04-10 | Samuel J Porter | Armor piercing incendiary projectile |
| LU36782A1 (enExample) * | 1959-01-19 | |||
| CH511415A (de) * | 1969-08-05 | 1971-08-15 | Oerlikon Buehrle Ag | Geschoss, insbesondere Panzersprenggranate |
| GB1271704A (en) * | 1969-10-13 | 1972-04-26 | Raufoss Ammunisjonsfabrikker | Projectile with multiple effect |
| NL175341C (nl) * | 1970-10-28 | 1984-10-16 | Eurometaal Nv | Werkwijze voor het samenstellen van een uit een vuurwapen te verschieten kogel met een kern van hard materiaal, alsmede kogel vervaardigd onder toepassing van die werkwijze. |
| US3890902A (en) * | 1973-12-04 | 1975-06-24 | Us Army | Projectile |
-
1976
- 1976-07-01 NO NO762297A patent/NO137297C/no unknown
-
1977
- 1977-06-21 SE SE7707203A patent/SE413550B/xx not_active IP Right Cessation
- 1977-06-22 DE DE19777719490U patent/DE7719490U1/de not_active Expired
- 1977-06-22 GB GB26155/77A patent/GB1533697A/en not_active Expired
- 1977-06-22 DE DE19772727970 patent/DE2727970A1/de active Granted
- 1977-06-28 CA CA281,577A patent/CA1077779A/en not_active Expired
- 1977-06-28 TR TR20496A patent/TR20496A/xx unknown
- 1977-06-29 FI FI772031A patent/FI60309C/fi not_active IP Right Cessation
- 1977-06-29 NL NLAANVRAGE7707213,A patent/NL185422C/xx not_active IP Right Cessation
- 1977-06-29 DK DK288977A patent/DK144985C/da active
- 1977-06-30 IT IT12664/77A patent/IT1081008B/it active
- 1977-06-30 FR FR7720123A patent/FR2356906A1/fr active Granted
- 1977-07-01 BE BE179005A patent/BE856378A/xx not_active IP Right Cessation
-
1980
- 1980-05-06 US US06/147,051 patent/US4353302A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE2727970A1 (de) | 1978-01-05 |
| SE413550B (sv) | 1980-06-02 |
| DE7719490U1 (de) | 1978-06-01 |
| FI60309C (fi) | 1981-12-10 |
| SE7707203L (sv) | 1978-01-02 |
| DK288977A (da) | 1978-01-02 |
| NL185422B (nl) | 1989-11-01 |
| FR2356906B1 (enExample) | 1982-06-18 |
| NL185422C (nl) | 1990-04-02 |
| DK144985C (da) | 1982-12-06 |
| IT1081008B (it) | 1985-05-16 |
| GB1533697A (en) | 1978-11-29 |
| NO137297B (no) | 1977-10-24 |
| NO762297L (no) | 1977-10-24 |
| FR2356906A1 (fr) | 1978-01-27 |
| NO137297C (no) | 1978-02-01 |
| FI60309B (fi) | 1981-08-31 |
| DK144985B (da) | 1982-07-19 |
| TR20496A (tr) | 1981-08-25 |
| DE2727970C2 (enExample) | 1987-05-27 |
| FI772031A7 (enExample) | 1978-01-02 |
| US4353302A (en) | 1982-10-12 |
| BE856378A (fr) | 1977-10-31 |
| NL7707213A (nl) | 1978-01-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1077779A (en) | Arrangement in or relating to a projectile | |
| US4671181A (en) | Anti-tank shell | |
| US4597333A (en) | Two-part armor-piercing projectile | |
| US4970960A (en) | Anti-material projectile | |
| US2246429A (en) | Projectile | |
| US4648324A (en) | Projectile with enhanced target penetrating power | |
| US4446794A (en) | Practice shell particularly useful for training purposes | |
| US5728968A (en) | Armor penetrating projectile | |
| US4444112A (en) | Multi-capability projectile and method of making same | |
| US5388524A (en) | Practice projectile | |
| EP0051375B1 (en) | Anti-materiel projectile | |
| US4437409A (en) | Spin-stabilized sabot projectile for overcoming a heterogeneous resistance | |
| US3388666A (en) | Rifle grenade | |
| US4760794A (en) | Explosive small arms projectile | |
| US11802755B2 (en) | Penetrator, use of a penetrator, and projectile | |
| NO163715B (no) | Drivspeilprosjektil som virker ved hjelp av kinetisk energi. | |
| USH1235H (en) | Armor-piercing projectile | |
| US4075946A (en) | Armor piercing projectile | |
| US4649829A (en) | Plastic armor piercing projectile | |
| JP7108685B2 (ja) | 特に多目的用途向けの完全被甲安全弾丸 | |
| US4481886A (en) | Hollow charge | |
| EP0196283B1 (en) | Armour piercing shell | |
| US4281599A (en) | Projectile | |
| CA1308605C (en) | Shotgun cartridge with explosive shell | |
| US5092246A (en) | Small arms ammunition |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |