CA1076128A - Bimetallic antimony and zirconium catalysts for preparing polyesters - Google Patents
Bimetallic antimony and zirconium catalysts for preparing polyestersInfo
- Publication number
- CA1076128A CA1076128A CA274,538A CA274538A CA1076128A CA 1076128 A CA1076128 A CA 1076128A CA 274538 A CA274538 A CA 274538A CA 1076128 A CA1076128 A CA 1076128A
- Authority
- CA
- Canada
- Prior art keywords
- compound
- carbon atoms
- set forth
- group
- antimony
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003054 catalyst Substances 0.000 title claims abstract description 50
- 229910052787 antimony Inorganic materials 0.000 title abstract description 22
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 title abstract description 21
- 229920000728 polyester Polymers 0.000 title abstract description 18
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 title description 9
- 229910052726 zirconium Inorganic materials 0.000 title description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims abstract description 77
- 238000006068 polycondensation reaction Methods 0.000 claims abstract description 23
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims abstract description 22
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims abstract description 18
- 229910052725 zinc Inorganic materials 0.000 claims abstract description 18
- 239000011701 zinc Substances 0.000 claims abstract description 18
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims abstract description 14
- 229910052791 calcium Inorganic materials 0.000 claims abstract description 14
- 239000011575 calcium Substances 0.000 claims abstract description 14
- 238000005809 transesterification reaction Methods 0.000 claims abstract description 14
- GBNDTYKAOXLLID-UHFFFAOYSA-N zirconium(4+) ion Chemical class [Zr+4] GBNDTYKAOXLLID-UHFFFAOYSA-N 0.000 claims abstract 4
- 150000001875 compounds Chemical class 0.000 claims description 71
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 claims description 46
- 125000004432 carbon atom Chemical group C* 0.000 claims description 40
- -1 alkylene glycol Chemical compound 0.000 claims description 29
- 239000000203 mixture Substances 0.000 claims description 29
- 150000002763 monocarboxylic acids Chemical class 0.000 claims description 29
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 27
- 150000001991 dicarboxylic acids Chemical class 0.000 claims description 20
- 125000000217 alkyl group Chemical group 0.000 claims description 18
- 150000003839 salts Chemical class 0.000 claims description 15
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 13
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 11
- 125000003118 aryl group Chemical group 0.000 claims description 10
- 150000002334 glycols Chemical class 0.000 claims description 10
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 claims description 10
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical group COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 150000001298 alcohols Chemical class 0.000 claims description 7
- 150000008064 anhydrides Chemical class 0.000 claims description 7
- 150000002148 esters Chemical class 0.000 claims description 7
- 150000002696 manganese Chemical class 0.000 claims description 7
- FAWGZAFXDJGWBB-UHFFFAOYSA-N antimony(3+) Chemical class [Sb+3] FAWGZAFXDJGWBB-UHFFFAOYSA-N 0.000 claims description 6
- 150000004703 alkoxides Chemical class 0.000 claims description 5
- 229920001283 Polyalkylene terephthalate Polymers 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 claims description 4
- VNGOYPQMJFJDLV-UHFFFAOYSA-N dimethyl benzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC=CC(C(=O)OC)=C1 VNGOYPQMJFJDLV-UHFFFAOYSA-N 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims 6
- TXTQARDVRPFFHL-UHFFFAOYSA-N [Sb].[H][H] Chemical class [Sb].[H][H] TXTQARDVRPFFHL-UHFFFAOYSA-N 0.000 claims 4
- DUFCMRCMPHIFTR-UHFFFAOYSA-N 5-(dimethylsulfamoyl)-2-methylfuran-3-carboxylic acid Chemical compound CN(C)S(=O)(=O)C1=CC(C(O)=O)=C(C)O1 DUFCMRCMPHIFTR-UHFFFAOYSA-N 0.000 claims 3
- 125000000732 arylene group Chemical group 0.000 claims 3
- 125000002993 cycloalkylene group Chemical group 0.000 claims 3
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 3
- 150000003754 zirconium Chemical class 0.000 claims 3
- 238000006243 chemical reaction Methods 0.000 abstract description 30
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 abstract description 9
- 239000011572 manganese Substances 0.000 abstract description 9
- 229910052748 manganese Inorganic materials 0.000 abstract description 9
- 239000002253 acid Substances 0.000 abstract description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract description 5
- 150000007942 carboxylates Chemical class 0.000 abstract description 3
- 150000003755 zirconium compounds Chemical class 0.000 abstract description 2
- 239000007795 chemical reaction product Substances 0.000 abstract 1
- 238000007493 shaping process Methods 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 229920000642 polymer Polymers 0.000 description 20
- 239000011541 reaction mixture Substances 0.000 description 20
- 238000001757 thermogravimetry curve Methods 0.000 description 17
- 238000009835 boiling Methods 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 238000001914 filtration Methods 0.000 description 14
- 238000002844 melting Methods 0.000 description 14
- 230000008018 melting Effects 0.000 description 14
- 238000003756 stirring Methods 0.000 description 14
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- 239000012299 nitrogen atmosphere Substances 0.000 description 12
- 239000000843 powder Substances 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 229920000139 polyethylene terephthalate Polymers 0.000 description 9
- 239000005020 polyethylene terephthalate Substances 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- 239000007790 solid phase Substances 0.000 description 9
- 239000000835 fiber Substances 0.000 description 7
- 239000012298 atmosphere Substances 0.000 description 6
- 229940082328 manganese acetate tetrahydrate Drugs 0.000 description 6
- CESXSDZNZGSWSP-UHFFFAOYSA-L manganese(2+);diacetate;tetrahydrate Chemical compound O.O.O.O.[Mn+2].CC([O-])=O.CC([O-])=O CESXSDZNZGSWSP-UHFFFAOYSA-L 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 230000032050 esterification Effects 0.000 description 5
- 238000005886 esterification reaction Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 230000000704 physical effect Effects 0.000 description 5
- YZYKBQUWMPUVEN-UHFFFAOYSA-N zafuleptine Chemical compound OC(=O)CCCCCC(C(C)C)NCC1=CC=C(F)C=C1 YZYKBQUWMPUVEN-UHFFFAOYSA-N 0.000 description 5
- 239000006227 byproduct Substances 0.000 description 4
- 230000015556 catabolic process Effects 0.000 description 4
- 238000006731 degradation reaction Methods 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 4
- LYTNHSCLZRMKON-UHFFFAOYSA-L oxygen(2-);zirconium(4+);diacetate Chemical compound [O-2].[Zr+4].CC([O-])=O.CC([O-])=O LYTNHSCLZRMKON-UHFFFAOYSA-L 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 230000002411 adverse Effects 0.000 description 3
- XQKKWWCELHKGKB-UHFFFAOYSA-L calcium acetate monohydrate Chemical compound O.[Ca+2].CC([O-])=O.CC([O-])=O XQKKWWCELHKGKB-UHFFFAOYSA-L 0.000 description 3
- 229940067460 calcium acetate monohydrate Drugs 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 238000000113 differential scanning calorimetry Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000003352 sequestering agent Substances 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- OOBNORVQFIAGPT-UHFFFAOYSA-N antimony manganese Chemical compound [Mn].[Sb] OOBNORVQFIAGPT-UHFFFAOYSA-N 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- QPKOBORKPHRBPS-UHFFFAOYSA-N bis(2-hydroxyethyl) terephthalate Chemical compound OCCOC(=O)C1=CC=C(C(=O)OCCO)C=C1 QPKOBORKPHRBPS-UHFFFAOYSA-N 0.000 description 2
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 230000003413 degradative effect Effects 0.000 description 2
- JVLRYPRBKSMEBF-UHFFFAOYSA-K diacetyloxystibanyl acetate Chemical compound [Sb+3].CC([O-])=O.CC([O-])=O.CC([O-])=O JVLRYPRBKSMEBF-UHFFFAOYSA-K 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229940071125 manganese acetate Drugs 0.000 description 2
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 2
- 238000002076 thermal analysis method Methods 0.000 description 2
- 150000005691 triesters Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- QIVUCLWGARAQIO-OLIXTKCUSA-N (3s)-n-[(3s,5s,6r)-6-methyl-2-oxo-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]-2-oxospiro[1h-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-carboxamide Chemical compound C1([C@H]2[C@H](N(C(=O)[C@@H](NC(=O)C=3C=C4C[C@]5(CC4=NC=3)C3=CC=CN=C3NC5=O)C2)CC(F)(F)F)C)=C(F)C=CC(F)=C1F QIVUCLWGARAQIO-OLIXTKCUSA-N 0.000 description 1
- LLLVZDVNHNWSDS-UHFFFAOYSA-N 4-methylidene-3,5-dioxabicyclo[5.2.2]undeca-1(9),7,10-triene-2,6-dione Chemical compound C1(C2=CC=C(C(=O)OC(=C)O1)C=C2)=O LLLVZDVNHNWSDS-UHFFFAOYSA-N 0.000 description 1
- 235000003625 Acrocomia mexicana Nutrition 0.000 description 1
- 244000202285 Acrocomia mexicana Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 101100087530 Caenorhabditis elegans rom-1 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229920001634 Copolyester Polymers 0.000 description 1
- 101100305983 Mus musculus Rom1 gene Proteins 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- BLXLSQIOCCHAHJ-UHFFFAOYSA-N [2,3,4-tri(nonyl)phenyl] dihydrogen phosphite Chemical compound CCCCCCCCCC1=CC=C(OP(O)O)C(CCCCCCCCC)=C1CCCCCCCCC BLXLSQIOCCHAHJ-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000001279 adipic acids Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 150000001462 antimony Chemical class 0.000 description 1
- 229940058905 antimony compound for treatment of leishmaniasis and trypanosomiasis Drugs 0.000 description 1
- 150000001463 antimony compounds Chemical class 0.000 description 1
- LLIZWEZMFYMWBC-UHFFFAOYSA-I antimony(3+) manganese(2+) pentaacetate Chemical compound C(C)(=O)[O-].[Sb+3].[Mn+2].C(C)(=O)[O-].C(C)(=O)[O-].C(C)(=O)[O-].C(C)(=O)[O-] LLIZWEZMFYMWBC-UHFFFAOYSA-I 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- AEDZKIACDBYJLQ-UHFFFAOYSA-N ethane-1,2-diol;hydrate Chemical compound O.OCCO AEDZKIACDBYJLQ-UHFFFAOYSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000000415 inactivating effect Effects 0.000 description 1
- 150000002531 isophthalic acids Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000000646 scanning calorimetry Methods 0.000 description 1
- 150000003330 sebacic acids Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/78—Preparation processes
- C08G63/82—Preparation processes characterised by the catalyst used
- C08G63/83—Alkali metals, alkaline earth metals, beryllium, magnesium, copper, silver, gold, zinc, cadmium, mercury, manganese, or compounds thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/78—Preparation processes
- C08G63/82—Preparation processes characterised by the catalyst used
- C08G63/85—Germanium, tin, lead, arsenic, antimony, bismuth, titanium, zirconium, hafnium, vanadium, niobium, tantalum, or compounds thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/670,654 US4122107A (en) | 1976-03-26 | 1976-03-26 | Reaction products of specific antimony compounds with a carboxylate of zinc calcium or manganese and an alcohol or glycol |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1076128A true CA1076128A (en) | 1980-04-22 |
Family
ID=24691286
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA274,538A Expired CA1076128A (en) | 1976-03-26 | 1977-03-23 | Bimetallic antimony and zirconium catalysts for preparing polyesters |
Country Status (11)
| Country | Link |
|---|---|
| US (2) | US4122107A (index.php) |
| JP (1) | JPS52125596A (index.php) |
| AU (1) | AU504820B2 (index.php) |
| BR (1) | BR7701865A (index.php) |
| CA (1) | CA1076128A (index.php) |
| DE (1) | DE2713679A1 (index.php) |
| ES (2) | ES457171A1 (index.php) |
| FR (1) | FR2345211A1 (index.php) |
| GB (1) | GB1535476A (index.php) |
| IT (1) | IT1081332B (index.php) |
| NL (1) | NL7702860A (index.php) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS58101021A (ja) * | 1981-12-12 | 1983-06-16 | Toyobo Co Ltd | ２軸延伸ポリエステルフイルム |
| FR2537593B1 (fr) * | 1982-12-10 | 1986-04-11 | Raffinage Cie Francaise | Compositions organometalliques mixtes comprenant des elements des groupes du fer et des lanthanides, procede de preparation et application desdites compositions comme additifs pour combustibles ou carburants |
| US4785060A (en) * | 1986-08-28 | 1988-11-15 | Colgate-Palmolive Company | Soil release promoting pet-poet copolymer, method of producing same and use thereof in detergent composition having soil release promoting property |
| US5166311A (en) * | 1989-05-22 | 1992-11-24 | Hoechst Celanese Corporation | Catalyst system and process for preparing high clarity, colorless polyethylene terephthalate |
| US5008230A (en) * | 1989-05-22 | 1991-04-16 | Hoechst Celanese Corporation | Catalyst for preparing high clarity, colorless polyethylene terephthalate |
| US5162488A (en) * | 1989-05-22 | 1992-11-10 | Hoechst Celanese Corporation | Catalyst system and process for preparing polyethylene terephthalate |
| US5153164A (en) * | 1989-05-22 | 1992-10-06 | Hoechst Celanese Corporation | Catalyst system for preparing polyethylene terephthalate |
| US5852164A (en) * | 1996-04-16 | 1998-12-22 | Mitsubishi Chemical Corporation | Polyester, process for producing the same and molding product therefrom |
| EP0864596A1 (en) * | 1997-03-14 | 1998-09-16 | Hoechst Diafoil GmbH | Process for the production of polyethylene terephthalate |
| AU2077601A (en) * | 1999-12-10 | 2001-06-18 | Dow Global Technologies Inc. | Catalyst systems for polycondensation reactions |
| KR20030084183A (ko) * | 2002-04-25 | 2003-11-01 | 켐엔텍 주식회사 | 폴리에스테르의 제조방법 |
| WO2004014982A2 (en) | 2002-05-09 | 2004-02-19 | Equipolymers Gmbh | Catalyst systems for polycondensation reactions |
| GB0305817D0 (en) * | 2003-03-13 | 2003-04-16 | Ic Innovations Ltd | Polymerisation initiators |
| ATE382066T1 (de) * | 2004-05-05 | 2008-01-15 | Saudi Basic Ind Corp | Verfahren zur herstellung von copolyestern aus polyethylenterephthalat |
| DE102008044487A1 (de) * | 2008-08-29 | 2010-03-04 | Lurgi Zimmer Gmbh | Verfahren zur Herstellung von Polymeren mit neutralem Farbton |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1307860A (en) * | 1919-06-24 | Seymour m | ||
| BE365818A (index.php) * | 1928-11-30 | |||
| US2281735A (en) * | 1939-10-20 | 1942-05-05 | Stauffer Chemical Co | Dusting composition |
| US2720504A (en) * | 1952-10-03 | 1955-10-11 | Eastman Kodak Co | Organo-metallic zirconium catalysts for the preparation of polyesters |
| BE536161A (index.php) * | 1954-03-02 | |||
| US2892782A (en) * | 1955-08-29 | 1959-06-30 | Texaco Inc | Mixtures of metal salts of organic hydroxy compounds |
| GB828707A (en) * | 1956-05-18 | 1960-02-24 | British Celanese | Improvements in the manufacture of high linear polyesters |
| US2927870A (en) * | 1956-08-28 | 1960-03-08 | Dow Corning | Zirconium acetate-zinc acetate catalyzed organohydrogenosiloxane emulsions and the treatment of fabrics therewith |
| NL256567A (index.php) * | 1959-10-06 | |||
| NL302660A (index.php) * | 1962-12-24 | 1900-01-01 | ||
| GB1058395A (en) * | 1964-05-20 | 1967-02-08 | Hardman & Holden Ltd | Improvements relating to zirconium compounds |
| GB1138332A (en) * | 1965-02-11 | 1969-01-01 | United States Borax Chem | Arsenic and antimony derivatives |
| FR1478334A (fr) * | 1965-05-06 | 1967-04-28 | Inst Francais Du Petrole | Catalyseur à base de métaux bivalents, sa préparation et ses applications, en particulier pour la polymérisation d'éthers cycliques |
| US3415860A (en) * | 1966-03-18 | 1968-12-10 | Monsanto Co | Preparation of antimony triacetate |
| US3484410A (en) * | 1966-11-23 | 1969-12-16 | Allied Chem | Process for preparing polyesters with antimony catalysts |
| FR1542470A (fr) | 1966-12-02 | 1968-10-18 | Inst Francais Du Petrole | Nouveaux catalyseurs de polymérisation d'oxydes d'alcoylènes |
| GB1284658A (en) * | 1969-05-02 | 1972-08-09 | Goodyear Tire & Rubber | Improved process for the preparation of polyesters |
| US3624049A (en) * | 1969-06-23 | 1971-11-30 | M & T Chemicals Inc | The preparation of poly (ethylene terephthalate) using trivalent antimony compounds as catalysts |
| US3705133A (en) * | 1969-08-21 | 1972-12-05 | Allied Chem | Polyester process |
| US3873451A (en) * | 1970-11-30 | 1975-03-25 | Du Pont | Flame retardant antimony compounds |
| US3836557A (en) * | 1971-12-03 | 1974-09-17 | Du Pont | Salts of antimony (v) esters as flame retardants |
| US3899522A (en) * | 1973-08-24 | 1975-08-12 | Nl Industries Inc | Trivalent antimony catalyst |
-
1976
- 1976-03-26 US US05/670,654 patent/US4122107A/en not_active Expired - Lifetime
-
1977
- 1977-01-21 US US05/761,338 patent/US4104263A/en not_active Expired - Lifetime
- 1977-03-04 GB GB9267/77A patent/GB1535476A/en not_active Expired
- 1977-03-08 AU AU23012/77A patent/AU504820B2/en not_active Expired
- 1977-03-16 NL NL7702860A patent/NL7702860A/xx not_active Application Discontinuation
- 1977-03-23 CA CA274,538A patent/CA1076128A/en not_active Expired
- 1977-03-24 FR FR7708844A patent/FR2345211A1/fr active Granted
- 1977-03-24 ES ES457171A patent/ES457171A1/es not_active Expired
- 1977-03-24 IT IT09385/77A patent/IT1081332B/it active
- 1977-03-25 JP JP3231077A patent/JPS52125596A/ja active Pending
- 1977-03-25 BR BR7701865A patent/BR7701865A/pt unknown
- 1977-03-28 DE DE19772713679 patent/DE2713679A1/de not_active Withdrawn
-
1978
- 1978-05-02 ES ES469365A patent/ES469365A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT1081332B (it) | 1985-05-21 |
| JPS52125596A (en) | 1977-10-21 |
| NL7702860A (nl) | 1977-09-28 |
| ES457171A1 (es) | 1978-08-16 |
| GB1535476A (en) | 1978-12-13 |
| DE2713679A1 (de) | 1977-09-29 |
| ES469365A1 (es) | 1978-11-16 |
| US4122107A (en) | 1978-10-24 |
| FR2345211B1 (index.php) | 1982-02-19 |
| AU2301277A (en) | 1978-09-14 |
| BR7701865A (pt) | 1977-11-08 |
| FR2345211A1 (fr) | 1977-10-21 |
| AU504820B2 (en) | 1979-11-01 |
| US4104263A (en) | 1978-08-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1076128A (en) | Bimetallic antimony and zirconium catalysts for preparing polyesters | |
| US3907754A (en) | Process and catalyst-inhibitor system for preparing synthetic linear polyester | |
| US5710086A (en) | Titanate catalysts | |
| EP3350246B1 (en) | Process for the preparation of a polyester | |
| US3965071A (en) | Polyester catalysts | |
| CA2366515C (en) | Process for esterifying 1,3-propanediol | |
| CZ176297A3 (cs) | Způsob přípravy esterů | |
| EP0714926A2 (en) | Process for preparing macrocyclic polyesters | |
| US20020032302A1 (en) | Process for recycling polytrimethylene terephthalate cyclic dimer | |
| WO2001056694A1 (en) | Esterification catalyst compositions | |
| US3852247A (en) | Polymerization catalyst | |
| US20060205917A1 (en) | Catalyst complex for catalysing esterification and trans-esterification reactions and process for esterification/trans-esterification using the same | |
| US8629234B2 (en) | Process for synthesizing a new catalyst complex for the production of polyethylene terephthlate | |
| JP3275045B2 (ja) | 熱可塑性芳香族ポリエステルの製法 | |
| JPH0826142B2 (ja) | ポリカーボネートの製造法 | |
| KR100635240B1 (ko) | 리튬 티타닐 옥살레이트 촉매를 사용한 폴리에스테르 중축합방법 | |
| US3385830A (en) | Process for manufacturing polyethylene terephthalate employing metal salts of halogenated haliphatic acids | |
| JPH0565339A (ja) | 難燃性ポリエステルの製法 | |
| US3453241A (en) | Preparation of highly polymeric polyesters in the presence of organo-titanium catalysts | |
| US3758535A (en) | Process of reacting a silicon compound with a titanium compound | |
| JP3083699B2 (ja) | 芳香族ポリエステルの製造方法 | |
| EP0392942B1 (en) | Preparation of poly(ethylene-2,6-naphthalene dicarboxylate) from dimethyl-2,6-naphthalene dicarboxylate and methyl hydrogen 2,6-naphthalene dicarboxylate | |
| JPS62218417A (ja) | 触媒系へのコバルトの混入による芳香族ポリエステルの色改善方法 | |
| EP1264852B1 (en) | Process for the preparation of polyester resins | |
| KR0122003B1 (ko) | 폴리에스테르의 제조방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |