CA1072087A - Amides as ovulation inhibitors - Google Patents
Amides as ovulation inhibitorsInfo
- Publication number
- CA1072087A CA1072087A CA263,700A CA263700A CA1072087A CA 1072087 A CA1072087 A CA 1072087A CA 263700 A CA263700 A CA 263700A CA 1072087 A CA1072087 A CA 1072087A
- Authority
- CA
- Canada
- Prior art keywords
- methoxy
- ethyl
- acetamide
- chloroindol
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003433 contraceptive agent Substances 0.000 title abstract description 5
- 150000001408 amides Chemical class 0.000 title abstract description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 45
- 150000001875 compounds Chemical class 0.000 claims description 36
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 21
- 239000001257 hydrogen Substances 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 9
- 125000005843 halogen group Chemical group 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- LUINDDOUWHRIPW-UHFFFAOYSA-N N-[2-(6-chloro-5-methoxy-1H-indol-3-yl)ethyl]acetamide Chemical compound C1=C(Cl)C(OC)=CC2=C1NC=C2CCNC(C)=O LUINDDOUWHRIPW-UHFFFAOYSA-N 0.000 claims description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 5
- CCTPUEOJGKAFCF-UHFFFAOYSA-N 2-(6-chloro-5-methoxy-1h-indol-3-yl)ethanamine Chemical compound C1=C(Cl)C(OC)=CC2=C1NC=C2CCN CCTPUEOJGKAFCF-UHFFFAOYSA-N 0.000 claims description 4
- 125000001589 carboacyl group Chemical group 0.000 claims description 4
- 125000005179 haloacetyl group Chemical group 0.000 claims description 4
- IXTRVPWZSPWNRH-UHFFFAOYSA-N n-[2-(1-acetyl-6-chloro-5-methoxyindol-3-yl)ethyl]acetamide Chemical compound C1=C(Cl)C(OC)=CC2=C1N(C(C)=O)C=C2CCNC(C)=O IXTRVPWZSPWNRH-UHFFFAOYSA-N 0.000 claims description 4
- GJIFXQUAUXBPKZ-UHFFFAOYSA-N N-[2-(6-chloro-5-methoxy-2-methyl-1H-indol-3-yl)ethyl]acetamide Chemical compound C1=C(Cl)C(OC)=CC2=C1NC(C)=C2CCNC(C)=O GJIFXQUAUXBPKZ-UHFFFAOYSA-N 0.000 claims description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 claims description 3
- 239000012346 acetyl chloride Substances 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- RIIHARHQPUATNY-UHFFFAOYSA-N n-[2-(6-chloro-5-methoxy-1h-indol-3-yl)ethyl]butanamide Chemical compound ClC1=C(OC)C=C2C(CCNC(=O)CCC)=CNC2=C1 RIIHARHQPUATNY-UHFFFAOYSA-N 0.000 claims description 3
- BTTITVUHHXXLFM-UHFFFAOYSA-N n-[2-(6-fluoro-5-methoxy-1h-indol-3-yl)ethyl]acetamide Chemical compound C1=C(F)C(OC)=CC2=C1NC=C2CCNC(C)=O BTTITVUHHXXLFM-UHFFFAOYSA-N 0.000 claims description 3
- 239000012312 sodium hydride Substances 0.000 claims description 3
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 3
- NIJFMUQMOKYJHD-UHFFFAOYSA-N 2-(6-chloro-5-methoxy-2-methyl-1h-indol-3-yl)ethanamine Chemical compound C1=C(Cl)C(OC)=CC2=C1NC(C)=C2CCN NIJFMUQMOKYJHD-UHFFFAOYSA-N 0.000 claims description 2
- BXNWEGDYEWCXEC-UHFFFAOYSA-N 2-(6-fluoro-5-methoxy-1h-indol-3-yl)ethanamine Chemical compound C1=C(F)C(OC)=CC2=C1NC=C2CCN BXNWEGDYEWCXEC-UHFFFAOYSA-N 0.000 claims description 2
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims description 2
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 7
- 239000000126 substance Substances 0.000 claims 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 3
- XSRWYGZSPYXVPC-UHFFFAOYSA-N n-[2-(6-chloro-5-methoxy-1h-indol-3-yl)ethyl]propanamide Chemical compound ClC1=C(OC)C=C2C(CCNC(=O)CC)=CNC2=C1 XSRWYGZSPYXVPC-UHFFFAOYSA-N 0.000 claims 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 66
- 239000000243 solution Substances 0.000 description 65
- -1 methoxy, ethoxy, n-propoxy, isopropoxy Chemical group 0.000 description 47
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 45
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 36
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 33
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 32
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- 239000000047 product Substances 0.000 description 23
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 20
- APJYDQYYACXCRM-UHFFFAOYSA-N tryptamine Chemical class C1=CC=C2C(CCN)=CNC2=C1 APJYDQYYACXCRM-UHFFFAOYSA-N 0.000 description 18
- 239000002904 solvent Substances 0.000 description 17
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 15
- 229940073584 methylene chloride Drugs 0.000 description 15
- 229910052938 sodium sulfate Inorganic materials 0.000 description 15
- 235000011152 sodium sulphate Nutrition 0.000 description 15
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 14
- 239000000284 extract Substances 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 9
- 229940080818 propionamide Drugs 0.000 description 9
- 239000005457 ice water Substances 0.000 description 8
- 230000016087 ovulation Effects 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- UYMKPFRHYYNDTL-UHFFFAOYSA-N ethenamine Chemical compound NC=C UYMKPFRHYYNDTL-UHFFFAOYSA-N 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 6
- YJPIGAIKUZMOQA-UHFFFAOYSA-N Melatonin Natural products COC1=CC=C2N(C(C)=O)C=C(CCN)C2=C1 YJPIGAIKUZMOQA-UHFFFAOYSA-N 0.000 description 6
- 230000002401 inhibitory effect Effects 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 6
- DRLFMBDRBRZALE-UHFFFAOYSA-N melatonin Chemical compound COC1=CC=C2NC=C(CCNC(C)=O)C2=C1 DRLFMBDRBRZALE-UHFFFAOYSA-N 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 241000271566 Aves Species 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- 239000007868 Raney catalyst Substances 0.000 description 5
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 5
- 229910000564 Raney nickel Inorganic materials 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 230000012173 estrus Effects 0.000 description 5
- 239000012280 lithium aluminium hydride Substances 0.000 description 5
- 229960003987 melatonin Drugs 0.000 description 5
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 229940093956 potassium carbonate Drugs 0.000 description 5
- 235000011181 potassium carbonates Nutrition 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 235000010288 sodium nitrite Nutrition 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- 241000282421 Canidae Species 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 4
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 150000002832 nitroso derivatives Chemical class 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 230000026234 pro-estrus Effects 0.000 description 4
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 3
- 239000005695 Ammonium acetate Substances 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 235000019257 ammonium acetate Nutrition 0.000 description 3
- 229940043376 ammonium acetate Drugs 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000012954 diazonium Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 3
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 3
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 3
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 2
- LFASSSGQIDKFOU-UHFFFAOYSA-N 2-(6-chloro-1h-indol-3-yl)ethanamine Chemical compound ClC1=CC=C2C(CCN)=CNC2=C1 LFASSSGQIDKFOU-UHFFFAOYSA-N 0.000 description 2
- VCVRNVYZNFWSOU-UHFFFAOYSA-N 2-chloro-5-methyl-4-nitrophenol Chemical compound CC1=CC(O)=C(Cl)C=C1[N+]([O-])=O VCVRNVYZNFWSOU-UHFFFAOYSA-N 0.000 description 2
- QISSVLCQDNIJCS-UHFFFAOYSA-N 2-fluoro-1h-indole Chemical compound C1=CC=C2NC(F)=CC2=C1 QISSVLCQDNIJCS-UHFFFAOYSA-N 0.000 description 2
- CJJLEUQMMMLOFI-UHFFFAOYSA-N 2-methoxy-4-methylaniline Chemical compound COC1=CC(C)=CC=C1N CJJLEUQMMMLOFI-UHFFFAOYSA-N 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- 229910004373 HOAc Inorganic materials 0.000 description 2
- XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methyl urea Chemical compound CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 241000283984 Rodentia Species 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 201000002380 X-linked amelogenesis imperfecta hypoplastic/hypomaturation 2 Diseases 0.000 description 2
- 239000000370 acceptor Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 2
- 239000003517 fume Substances 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 2
- 210000003101 oviduct Anatomy 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- HODYYXDWDKWURL-UHFFFAOYSA-N 1-(4-chloro-5-methoxy-2-nitrophenyl)propan-2-one Chemical compound COC1=CC(CC(C)=O)=C([N+]([O-])=O)C=C1Cl HODYYXDWDKWURL-UHFFFAOYSA-N 0.000 description 1
- ACCXFQTUPLPTRW-UHFFFAOYSA-N 1-chloro-2-methoxy-4-methyl-5-nitrobenzene Chemical compound COC1=CC(C)=C([N+]([O-])=O)C=C1Cl ACCXFQTUPLPTRW-UHFFFAOYSA-N 0.000 description 1
- KBRLTYHUJDMMLI-UHFFFAOYSA-N 1-chloro-2-methoxy-4-methylbenzene Chemical compound COC1=CC(C)=CC=C1Cl KBRLTYHUJDMMLI-UHFFFAOYSA-N 0.000 description 1
- GCKWCMGHWIOMRU-UHFFFAOYSA-N 1-fluoro-2-methoxy-4-methyl-5-nitrobenzene Chemical compound COC1=CC(C)=C([N+]([O-])=O)C=C1F GCKWCMGHWIOMRU-UHFFFAOYSA-N 0.000 description 1
- MOFZLPPSEOEXNJ-UHFFFAOYSA-N 1-fluoro-2-methoxy-4-methylbenzene Chemical compound COC1=CC(C)=CC=C1F MOFZLPPSEOEXNJ-UHFFFAOYSA-N 0.000 description 1
- JSXAJLMUBSEJFF-UHFFFAOYSA-N 1-fluoro-3-methyl-2-nitrobenzene Chemical compound CC1=CC=CC(F)=C1[N+]([O-])=O JSXAJLMUBSEJFF-UHFFFAOYSA-N 0.000 description 1
- SBNOTUDDIXOFSN-UHFFFAOYSA-N 1h-indole-2-carbaldehyde Chemical compound C1=CC=C2NC(C=O)=CC2=C1 SBNOTUDDIXOFSN-UHFFFAOYSA-N 0.000 description 1
- AHDSRXYHVZECER-UHFFFAOYSA-N 2,4,6-tris[(dimethylamino)methyl]phenol Chemical compound CN(C)CC1=CC(CN(C)C)=C(O)C(CN(C)C)=C1 AHDSRXYHVZECER-UHFFFAOYSA-N 0.000 description 1
- 125000006334 2,4-difluoro benzoyl group Chemical group [H]C1=C([H])C(C(*)=O)=C(F)C([H])=C1F 0.000 description 1
- ZUQXVMIIRIIGTQ-UHFFFAOYSA-N 2-(2-nitroethenyl)-1h-indole Chemical compound C1=CC=C2NC(C=C[N+](=O)[O-])=CC2=C1 ZUQXVMIIRIIGTQ-UHFFFAOYSA-N 0.000 description 1
- HBZHNVUMFPGVHW-UHFFFAOYSA-N 2-chloro-1h-indole Chemical compound C1=CC=C2NC(Cl)=CC2=C1 HBZHNVUMFPGVHW-UHFFFAOYSA-N 0.000 description 1
- PHQJCUQHZQRQFK-UHFFFAOYSA-N 2-chloro-5-methyl-4-nitrosophenol Chemical compound CC1=CC(O)=C(Cl)C=C1N=O PHQJCUQHZQRQFK-UHFFFAOYSA-N 0.000 description 1
- SMFHPCZZAAMJJO-UHFFFAOYSA-N 2-chloro-5-methylphenol Chemical compound CC1=CC=C(Cl)C(O)=C1 SMFHPCZZAAMJJO-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- XEHPMVZYZDQLDN-UHFFFAOYSA-N 2-fluoro-5-methylphenol Chemical compound CC1=CC=C(F)C(O)=C1 XEHPMVZYZDQLDN-UHFFFAOYSA-N 0.000 description 1
- HFHFGHLXUCOHLN-UHFFFAOYSA-N 2-fluorophenol Chemical compound OC1=CC=CC=C1F HFHFGHLXUCOHLN-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- CYZIVXOEJNAIBS-UHFFFAOYSA-N 2-methyl-1h-indole-3-carbaldehyde Chemical compound C1=CC=C2C(C=O)=C(C)NC2=C1 CYZIVXOEJNAIBS-UHFFFAOYSA-N 0.000 description 1
- ZFFATLKERBHVHQ-UHFFFAOYSA-N 2-methyl-1h-indole-3-carbonitrile Chemical compound C1=CC=C2C(C#N)=C(C)NC2=C1 ZFFATLKERBHVHQ-UHFFFAOYSA-N 0.000 description 1
- IPASVEYYTNTJTM-UHFFFAOYSA-N 3-(2-nitroethenyl)-1h-indole Chemical compound C1=CC=C2C(C=C[N+](=O)[O-])=CNC2=C1 IPASVEYYTNTJTM-UHFFFAOYSA-N 0.000 description 1
- GAWNBKUTBVLIPL-UHFFFAOYSA-N 3-fluoro-2-nitrophenol Chemical compound OC1=CC=CC(F)=C1[N+]([O-])=O GAWNBKUTBVLIPL-UHFFFAOYSA-N 0.000 description 1
- 125000006305 3-iodophenyl group Chemical group [H]C1=C([H])C(I)=C([H])C(*)=C1[H] 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 125000004861 4-isopropyl phenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- SSBPRGFEADRKDA-UHFFFAOYSA-N 6-chloro-5-methoxy-1h-indole Chemical compound C1=C(Cl)C(OC)=CC2=C1NC=C2 SSBPRGFEADRKDA-UHFFFAOYSA-N 0.000 description 1
- DRIAHZAFWGCRKY-UHFFFAOYSA-N 6-chloro-5-methoxy-2-methyl-1h-indole Chemical compound C1=C(Cl)C(OC)=CC2=C1NC(C)=C2 DRIAHZAFWGCRKY-UHFFFAOYSA-N 0.000 description 1
- DANYGEQACAPBOK-UHFFFAOYSA-N 6-fluoro-5-methoxy-1h-indole Chemical compound C1=C(F)C(OC)=CC2=C1NC=C2 DANYGEQACAPBOK-UHFFFAOYSA-N 0.000 description 1
- OMIHGPLIXGGMJB-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]hepta-1,3,5-triene Chemical compound C1=CC=C2OC2=C1 OMIHGPLIXGGMJB-UHFFFAOYSA-N 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- XVZXOLOFWKSDSR-UHFFFAOYSA-N Cc1cc(C)c([C]=O)c(C)c1 Chemical group Cc1cc(C)c([C]=O)c(C)c1 XVZXOLOFWKSDSR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000272201 Columbiformes Species 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- 206010062767 Hypophysitis Diseases 0.000 description 1
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 241000287182 Sturnidae Species 0.000 description 1
- 241000962283 Turdus iliacus Species 0.000 description 1
- 241000287436 Turdus merula Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000005667 attractant Substances 0.000 description 1
- 235000015278 beef Nutrition 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 102220348226 c.58A>C Human genes 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 229940124558 contraceptive agent Drugs 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000027046 diestrus Effects 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- DLLJVQNYBYOKGS-UHFFFAOYSA-N ethoxyethane;pentane Chemical compound CCCCC.CCOCC DLLJVQNYBYOKGS-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000006332 fluoro benzoyl group Chemical group 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- OLNJUISKUQQNIM-UHFFFAOYSA-N indole-3-carbaldehyde Chemical compound C1=CC=C2C(C=O)=CNC2=C1 OLNJUISKUQQNIM-UHFFFAOYSA-N 0.000 description 1
- NBKQRVSGHYZUOR-UHFFFAOYSA-N indoline-3-carbaldehyde Natural products C1=CC=C2C(C=O)CNC2=C1 NBKQRVSGHYZUOR-UHFFFAOYSA-N 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- INHCSSUBVCNVSK-UHFFFAOYSA-L lithium sulfate Inorganic materials [Li+].[Li+].[O-]S([O-])(=O)=O INHCSSUBVCNVSK-UHFFFAOYSA-L 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 description 1
- WWECJGLXBSQKRF-UHFFFAOYSA-N n,n-dimethylformamide;methanol Chemical compound OC.CN(C)C=O WWECJGLXBSQKRF-UHFFFAOYSA-N 0.000 description 1
- GXBGPRWOXOPLKY-UHFFFAOYSA-N n-[2-(6-bromo-5-methoxy-2-methyl-1-pentanoylindol-3-yl)ethyl]acetamide Chemical compound COC1=C(Br)C=C2N(C(=O)CCCC)C(C)=C(CCNC(C)=O)C2=C1 GXBGPRWOXOPLKY-UHFFFAOYSA-N 0.000 description 1
- OKXHFWYDDWNLGM-UHFFFAOYSA-N n-[2-(6-chloro-5-methoxy-2-propyl-1h-indol-3-yl)ethyl]formamide Chemical compound ClC1=C(OC)C=C2C(CCNC=O)=C(CCC)NC2=C1 OKXHFWYDDWNLGM-UHFFFAOYSA-N 0.000 description 1
- HZXPWFSTEOWWQR-UHFFFAOYSA-N n-[2-[6-bromo-2-(3-fluorophenyl)-5-methoxy-1-(2,4,6-trimethylbenzoyl)indol-3-yl]ethyl]acetamide Chemical compound CC=1C=C(C)C=C(C)C=1C(=O)N1C=2C=C(Br)C(OC)=CC=2C(CCNC(C)=O)=C1C1=CC=CC(F)=C1 HZXPWFSTEOWWQR-UHFFFAOYSA-N 0.000 description 1
- IOTTYWXETCYNEP-UHFFFAOYSA-N n-[2-[6-chloro-5-methoxy-2-(4-propylphenyl)-1h-indol-3-yl]ethyl]formamide Chemical compound C1=CC(CCC)=CC=C1C1=C(CCNC=O)C2=CC(OC)=C(Cl)C=C2N1 IOTTYWXETCYNEP-UHFFFAOYSA-N 0.000 description 1
- CESBNVKLLSBIMI-UHFFFAOYSA-N n-[2-[6-chloro-5-methoxy-2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1h-indol-3-yl]ethyl]formamide Chemical compound N1C=2C=C(Cl)C(OC)=CC=2C(CCNC=O)=C1C1=CC=C(OC(C)(C)C)C=C1 CESBNVKLLSBIMI-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 210000004560 pineal gland Anatomy 0.000 description 1
- 210000003635 pituitary gland Anatomy 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000035935 pregnancy Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical compound [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- PNGLEYLFMHGIQO-UHFFFAOYSA-M sodium;3-(n-ethyl-3-methoxyanilino)-2-hydroxypropane-1-sulfonate;dihydrate Chemical compound O.O.[Na+].[O-]S(=O)(=O)CC(O)CN(CC)C1=CC=CC(OC)=C1 PNGLEYLFMHGIQO-UHFFFAOYSA-M 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- RBTVSNLYYIMMKS-UHFFFAOYSA-N tert-butyl 3-aminoazetidine-1-carboxylate;hydrochloride Chemical compound Cl.CC(C)(C)OC(=O)N1CC(N)C1 RBTVSNLYYIMMKS-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/18—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/13—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups
- C07C205/26—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups and being further substituted by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C207/00—Compounds containing nitroso groups bound to a carbon skeleton
- C07C207/04—Compounds containing nitroso groups bound to a carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/01—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by replacing functional groups bound to a six-membered aromatic ring by hydroxy groups, e.g. by hydrolysis
- C07C37/055—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by replacing functional groups bound to a six-membered aromatic ring by hydroxy groups, e.g. by hydrolysis the substituted group being bound to oxygen, e.g. ether group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/12—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/14—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
- C07D209/16—Tryptamines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US62689075A | 1975-10-29 | 1975-10-29 | |
| US05/720,311 US4087444A (en) | 1976-09-08 | 1976-09-08 | Amides as ovulation inhibitors |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1072087A true CA1072087A (en) | 1980-02-19 |
Family
ID=27090276
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA263,700A Expired CA1072087A (en) | 1975-10-29 | 1976-10-19 | Amides as ovulation inhibitors |
Country Status (9)
| Country | Link |
|---|---|
| JP (1) | JPS6025421B2 (cs) |
| CA (1) | CA1072087A (cs) |
| CH (1) | CH602638A5 (cs) |
| DE (1) | DE2645865A1 (cs) |
| FR (1) | FR2329274A1 (cs) |
| GB (1) | GB1562825A (cs) |
| IE (1) | IE43725B1 (cs) |
| IL (1) | IL50536A (cs) |
| NL (1) | NL7611971A (cs) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA88498B (en) * | 1987-02-02 | 1989-10-25 | Lilly Co Eli | Alkylmelatonins |
| CN1047936C (zh) * | 1987-02-02 | 2000-01-05 | 伊莱利利公司 | 制备含烷基褪黑激素的药物组合物的方法 |
| WO1995027712A1 (fr) * | 1994-04-07 | 1995-10-19 | Cemaf | Nouveaux derives de spiro[indole-pyrrolidine] agonistes melatoninergiques, leur procede de preparation et leur utilisation a titre de medicament |
| AU1124399A (en) * | 1997-10-28 | 1999-05-17 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| AU1197299A (en) * | 1997-10-28 | 1999-05-17 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| US8053462B2 (en) | 2004-03-08 | 2011-11-08 | Masanori Somei | Indole derivative and application thereof |
| JP3964417B2 (ja) | 2004-09-27 | 2007-08-22 | 国立大学法人金沢大学 | インドール誘導体を有効成分とするα2受容体遮断剤及び血管拡張剤 |
| EA030459B1 (ru) * | 2014-06-19 | 2018-08-31 | Мериал, Инк. | Паразитицидные композиции, содержащие индольные производные, способы их получения и их применение |
-
1976
- 1976-09-20 IE IE2076/76A patent/IE43725B1/en unknown
- 1976-09-22 IL IL50536A patent/IL50536A/xx unknown
- 1976-10-11 DE DE19762645865 patent/DE2645865A1/de active Granted
- 1976-10-18 CH CH1318576A patent/CH602638A5/xx not_active IP Right Cessation
- 1976-10-19 CA CA263,700A patent/CA1072087A/en not_active Expired
- 1976-10-22 GB GB43853/76A patent/GB1562825A/en not_active Expired
- 1976-10-28 JP JP51130356A patent/JPS6025421B2/ja not_active Expired
- 1976-10-28 NL NL7611971A patent/NL7611971A/xx not_active Application Discontinuation
- 1976-10-29 FR FR7632864A patent/FR2329274A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| CH602638A5 (cs) | 1978-07-31 |
| IE43725L (en) | 1977-04-29 |
| DE2645865A1 (de) | 1977-05-12 |
| NL7611971A (nl) | 1977-05-03 |
| FR2329274B1 (cs) | 1978-12-22 |
| IL50536A0 (en) | 1976-11-30 |
| IE43725B1 (en) | 1981-05-06 |
| JPS6025421B2 (ja) | 1985-06-18 |
| IL50536A (en) | 1980-03-31 |
| GB1562825A (en) | 1980-03-19 |
| DE2645865C2 (cs) | 1988-07-07 |
| JPS5257169A (en) | 1977-05-11 |
| FR2329274A1 (fr) | 1977-05-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4087444A (en) | Amides as ovulation inhibitors | |
| US4587246A (en) | 1,3,4-thiadiazin-2-ones | |
| US4166907A (en) | 3,3-Dichloro-2-azetidinone derivatives having antiinflammatory activity | |
| US3810906A (en) | N1-heteroacylated phenylhydrazines | |
| US3326930A (en) | alpha-halomethyl-(1-oxazole-carbonylindol-3-yl) acetic acids and certain intermediates therefor | |
| CA1072087A (en) | Amides as ovulation inhibitors | |
| US4997845A (en) | β-alkylmelatonins as ovulation inhibitors | |
| US4656192A (en) | Tropolone derivatives, processes for the preparation thereof and the use thereof as anti-tumor agents | |
| GB1588242A (en) | N-(tetrazol-5-yl)-salicylamide derivatives | |
| US4442115A (en) | 2'Hydroxy tetrazole-5-carboxanilides and anti-allergic use thereof | |
| US3564009A (en) | Process for producing 1-acylindole derivatives | |
| US4139538A (en) | Oxazolidinones as therapeutic agents | |
| CA1088533A (en) | 3,3-dichloro-2-azetidinone derivatives having antiinflammatory activity | |
| KR960004859B1 (ko) | 알킬멜라토닌 | |
| US5449783A (en) | Diphenylthiazole derivative | |
| NO127054B (cs) | ||
| FR2580281A1 (fr) | Derives du nitrofuranne, leur preparation et leur application en therapeutique | |
| CA1129413A (en) | Tetrahydrothiopyrano ¬2,3-b| indole derivatives | |
| US4179442A (en) | 4-(Alpha-hydroxy-isopropyl)-5-phenyl-oxazolidin-2-one | |
| SU784763A3 (ru) | Способ получени производных 6- метокси-2-ацетилнафтилоксима или их хлоргидратов | |
| US3978057A (en) | Substituted amino-hydrazinopyridazines | |
| US3978044A (en) | Indazole derivatives, processes for making the same and pharmaceutical compositions | |
| US4065617A (en) | 2-(2,2,2,-Trifluoroethyl)-3,3a,4,5,6,7-hexahydro-2H-pyrazolo[4,3-c]pyridines | |
| US4104385A (en) | Cyclic alkylidenyl N-[6-(amino)-3-pyridazinyl]aminomethylenemalonates | |
| US4065571A (en) | Antiviral 5-(substituted benzal) hydantoins |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |