CA1071918A - Forwardly foldable toolbar - Google Patents
Forwardly foldable toolbarInfo
- Publication number
- CA1071918A CA1071918A CA285,661A CA285661A CA1071918A CA 1071918 A CA1071918 A CA 1071918A CA 285661 A CA285661 A CA 285661A CA 1071918 A CA1071918 A CA 1071918A
- Authority
- CA
- Canada
- Prior art keywords
- frame
- frames
- central
- outer frames
- forwardly
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 claims description 8
- 239000000969 carrier Substances 0.000 claims description 6
- 230000000295 complement effect Effects 0.000 claims description 4
- 238000005304 joining Methods 0.000 claims description 3
- 230000007246 mechanism Effects 0.000 abstract description 7
- 230000032258 transport Effects 0.000 description 49
- 239000003337 fertilizer Substances 0.000 description 9
- 238000009826 distribution Methods 0.000 description 6
- 238000003860 storage Methods 0.000 description 5
- 238000013459 approach Methods 0.000 description 3
- 238000003971 tillage Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- 241001052209 Cylinder Species 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 210000003739 neck Anatomy 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01B—SOIL WORKING IN AGRICULTURE OR FORESTRY; PARTS, DETAILS, OR ACCESSORIES OF AGRICULTURAL MACHINES OR IMPLEMENTS, IN GENERAL
- A01B73/00—Means or arrangements to facilitate transportation of agricultural machines or implements, e.g. folding frames to reduce overall width
- A01B73/02—Folding frames
- A01B73/06—Folding frames foldable about a vertical axis
- A01B73/065—Folding frames foldable about a vertical axis to a position essentially forward of the axis, in relation to the direction of travel
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01C—PLANTING; SOWING; FERTILISING
- A01C7/00—Sowing
- A01C7/20—Parts of seeders for conducting and depositing seed
- A01C7/208—Chassis; Coupling means to a tractor or the like; Lifting means; Side markers
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Soil Sciences (AREA)
- Environmental Sciences (AREA)
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Agricultural Machines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/720,270 US4137852A (en) | 1976-09-03 | 1976-09-03 | Forwardly foldable toolbar |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1071918A true CA1071918A (en) | 1980-02-19 |
Family
ID=24893369
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA285,661A Expired CA1071918A (en) | 1976-09-03 | 1977-08-29 | Forwardly foldable toolbar |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4137852A (enExample) |
| AR (1) | AR211473Q (enExample) |
| AU (1) | AU507097B2 (enExample) |
| BE (1) | BE858271A (enExample) |
| BR (1) | BR7705895A (enExample) |
| CA (1) | CA1071918A (enExample) |
| CS (1) | CS207481B2 (enExample) |
| DE (1) | DE2737053C3 (enExample) |
| DK (1) | DK392177A (enExample) |
| ES (1) | ES462068A1 (enExample) |
| FR (1) | FR2363271A1 (enExample) |
| GB (1) | GB1572415A (enExample) |
| HU (1) | HU180713B (enExample) |
| IT (1) | IT1089831B (enExample) |
| MX (1) | MX144750A (enExample) |
| NL (1) | NL7709665A (enExample) |
| NZ (1) | NZ185063A (enExample) |
| RO (1) | RO81537B (enExample) |
| TR (1) | TR20251A (enExample) |
| YU (1) | YU203977A (enExample) |
| ZA (1) | ZA775218B (enExample) |
Families Citing this family (57)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4364581A (en) * | 1977-09-19 | 1982-12-21 | Shoup Kenneth E | Foldable implement frame and hitch |
| FR2454253A1 (fr) * | 1979-04-20 | 1980-11-14 | Fomodis Sarl | Rouleau agricole multiple |
| US4272097A (en) * | 1979-06-12 | 1981-06-09 | M & W Gear Company | Drawbar for mounting multiple farm implement tool bars |
| US4299292A (en) * | 1979-08-14 | 1981-11-10 | Australian Agricultural Machinery Pty. Ltd. | Folding boom construction including rollers and ramps for lifting wheels clear of ground |
| US4319643A (en) * | 1980-03-03 | 1982-03-16 | Carmaco, Inc. | Front folding agricultural tool bar with movable carriage to which wings coupled |
| US4368003A (en) * | 1980-11-28 | 1983-01-11 | Macdonald John T | Foldable farm implement with single port hopper-feeding auger |
| US4518046A (en) * | 1982-06-21 | 1985-05-21 | Deere & Company | Multiple implement hitch and transport |
| US4504076A (en) * | 1983-09-16 | 1985-03-12 | Deere & Company | Forward-folding agricultural implement featuring narrow row spacing |
| US4646851A (en) * | 1984-03-12 | 1987-03-03 | Duello Dennis E | Bi-fold toolbar |
| US4721167A (en) * | 1984-03-23 | 1988-01-26 | Deere & Company | Hitch flexing hinge |
| US4607708A (en) * | 1984-03-23 | 1986-08-26 | Deere & Company | Foldable frame flexing hinge |
| US4721168A (en) * | 1985-09-23 | 1988-01-26 | Kinzenbaw Jon E | Agricultural implement with raisable lift frame rotatable about vertical axis |
| US4723787A (en) * | 1986-02-28 | 1988-02-09 | Deere & Company | Implement transport hitch |
| US4945997A (en) * | 1989-08-16 | 1990-08-07 | Adee Raymond A | Folding agricultural implement |
| US5024279A (en) * | 1990-02-20 | 1991-06-18 | J.I. Case Corporation | Foldable implement carrier |
| US5113956A (en) * | 1991-01-23 | 1992-05-19 | Friesen Milford E | Forwardly folding tool bar |
| DE4136468A1 (de) * | 1991-11-06 | 1993-05-13 | Claas Ohg | Selbstfahrender maehdrescher mit klappbarem schneidwerk |
| US5398771A (en) * | 1993-02-23 | 1995-03-21 | Crustbuster/Speed King, Inc. | Grain Drill |
| US5647440A (en) * | 1994-07-01 | 1997-07-15 | Kinze Manufacturing, Inc. | Forward-folding, winged, implement frame |
| US5488996A (en) * | 1994-07-01 | 1996-02-06 | Kinze Manufacturing, Inc. | Forward-folding, winged, implement frame |
| US5535688A (en) * | 1994-12-22 | 1996-07-16 | Kaufman; Michael J. | Tool bar planter system for combines |
| US5579849A (en) * | 1995-02-13 | 1996-12-03 | Houck; Shane A. | Implement convertible between a use position and a transport position |
| US5839516A (en) * | 1996-03-12 | 1998-11-24 | Unverferth Manufacturing Co., Inc. | Folding frame assembly for a rolling harrow implement having a transport position in which the main frame is upwardly pivoted and the wing frames are forwardly pivoted |
| US6209657B1 (en) * | 1998-03-12 | 2001-04-03 | Flexi-Coil Ltd. | Forward folding tillage implement |
| US6017504A (en) * | 1998-07-16 | 2000-01-25 | Universite Laval | Process for synthesizing perovskites using high energy milling |
| US6213034B1 (en) | 1998-08-27 | 2001-04-10 | Case Corporation | Planter apparatus and method |
| US6076613A (en) * | 1998-09-08 | 2000-06-20 | Orthman Manufacturing, Inc. | Forwardly-folding agricultural implement |
| US6223831B1 (en) * | 1998-10-28 | 2001-05-01 | Flexi-Coil Ltd. | Differential connecting rod and draft cable for agricultural tillage device |
| US6205937B1 (en) | 2000-02-07 | 2001-03-27 | Kenneth E. Shoup | Folding planter frame |
| US6238170B1 (en) | 2000-07-12 | 2001-05-29 | Agco Corporation | Agricultural implement trailer |
| US6502645B1 (en) | 2000-11-07 | 2003-01-07 | Deere & Company | Folding agricultural implement frame |
| US6595148B2 (en) | 2001-12-18 | 2003-07-22 | Deere & Company | Individual seed hoppers forming banks of seed hoppers |
| US6588351B1 (en) | 2001-12-18 | 2003-07-08 | Deere & Company | Planting unit lockup device for seeding machine |
| US6581533B1 (en) | 2001-12-18 | 2003-06-24 | Deere & Company | Seed meter brushes forming a transport seed puddle |
| US6581530B1 (en) | 2001-12-18 | 2003-06-24 | Deere & Company | Folding walkway for seeding machine |
| US6688242B2 (en) | 2001-12-18 | 2004-02-10 | Deere & Company | Frame folding arrangement with vertically pivoting planting units |
| US7051663B2 (en) | 2001-12-18 | 2006-05-30 | Deere & Company | Pivoting planting units vertically |
| US6691794B2 (en) * | 2002-01-31 | 2004-02-17 | Case, Llc | Planter hitch locking and alignment apparatus |
| US6935254B2 (en) * | 2002-08-08 | 2005-08-30 | Deere & Company | Split seed hoppers for seed on demand seeding machine |
| DE10327915C5 (de) † | 2003-06-20 | 2012-04-05 | Maschinenfabrik Bernard Krone Gmbh | Heuwerbungsmaschine |
| US20060090910A1 (en) * | 2004-07-20 | 2006-05-04 | Shane Houck | Implement convertible between use configuration and transport configuration |
| SE0500805L (sv) * | 2005-04-11 | 2005-12-20 | Vaederstad Verken Ab | Skarvanordning vid en lantbruksmaskin |
| US8127861B2 (en) * | 2006-01-17 | 2012-03-06 | Agco Corporation | Front folding agricultural implement frame with rearwardly telescoping tongue |
| US7854272B2 (en) * | 2008-10-24 | 2010-12-21 | Cnh Canada, Ltd. | Agricultural implement having forward folding wing booms |
| US20100126743A1 (en) * | 2008-11-21 | 2010-05-27 | Cnh America Llc | Implement frame with front folding wings and transport wheels |
| US8141652B2 (en) * | 2008-11-21 | 2012-03-27 | Cnh America Llc | Implement frame with front folding wings and transport wheels |
| US7921932B2 (en) * | 2008-11-21 | 2011-04-12 | Cnh America Llc | Implement frame with front folding wings and transport wheels |
| FR2992144B1 (fr) * | 2012-06-22 | 2014-06-27 | Kuhn Sa | Machine agricole avec un chassis perfectionne |
| US9474200B2 (en) * | 2012-12-17 | 2016-10-25 | Precision Planting Llc | Agricultural toolbar line routing systems and methods |
| US9955621B2 (en) * | 2014-05-08 | 2018-05-01 | Kinze Manufacturing, Inc. | Front fold implement frame with pivotal draft link connection |
| FR3024938B1 (fr) * | 2014-08-25 | 2017-03-31 | Kuhn Sa | Machine agricole avec au moins une barre de semis articulee |
| US9961824B2 (en) | 2015-04-20 | 2018-05-08 | Kinze Manufacturing, Inc. | Lift and rotate agricultural implement |
| US10251330B2 (en) * | 2015-09-15 | 2019-04-09 | Harvest International, Inc. | Latch assembly for a folding toolbar wing |
| US10638653B2 (en) | 2016-10-05 | 2020-05-05 | Cnh Industrial America Llc | Caster wheel assembly for an agricultural implement system |
| US10660257B2 (en) | 2017-10-26 | 2020-05-26 | Cnh Industrial America Llc | System and method for automatically actuating wing assemblies of an agricultural implement |
| US11266055B2 (en) | 2019-01-11 | 2022-03-08 | Cnh Industrial Canada, Ltd. | Articulated component braking system |
| CN112514571B (zh) * | 2020-11-30 | 2022-12-09 | 陈成 | 一种板结土壤深层施肥设备及其方法 |
Family Cites Families (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1939460A (en) * | 1930-02-27 | 1933-12-12 | George B Nelson | Land surfacing device |
| US2113832A (en) * | 1937-06-04 | 1938-04-12 | Massey Harris Co | Combined wide and tandem disk harrow |
| US2226586A (en) * | 1939-05-01 | 1940-12-31 | Minneapolis Moline Power Co | Disk harrow |
| GB540702A (en) * | 1940-08-02 | 1941-10-27 | Bomford & Evershed Ltd | Improvements relating to draw-bar mechanism for tractor operated machinery |
| US2345803A (en) * | 1942-01-01 | 1944-04-04 | Oliver Farm Equipment Co | Disk harrow |
| US2527607A (en) * | 1944-12-06 | 1950-10-31 | Deere & Co | Disk harrow |
| US2559002A (en) * | 1947-10-03 | 1951-07-03 | Seymour F Dolgin | V-shaped expansible harrow |
| US2667366A (en) * | 1950-10-02 | 1954-01-26 | Albert M Otjen | Longitudinally adjustable draft device |
| US2706880A (en) * | 1951-02-15 | 1955-04-26 | Wilfred L Steuerwald | Harrow cart |
| US2966219A (en) * | 1957-06-24 | 1960-12-27 | French Damas | Harrow drag cart |
| US2958383A (en) * | 1958-07-03 | 1960-11-01 | Maudie J Danielson | Cultivator attachment |
| DE1104246B (de) * | 1960-03-17 | 1961-04-06 | Hans Glas G M B H Iaisariaia M | An den Geraetetraeger eines Schleppers anbaubare Drillmaschine |
| US3072201A (en) * | 1961-01-13 | 1963-01-08 | Brakhage Charles | Tractor-mounted folding drag hitch |
| US3162459A (en) * | 1962-11-15 | 1964-12-22 | Green Giant Company | Folding frame for farm implements |
| US3262505A (en) * | 1963-08-13 | 1966-07-26 | Brakhage Charles | Tractor-mounted folding drag hitch |
| US3208536A (en) * | 1963-09-09 | 1965-09-28 | Int Harvester Co | Folding agricultural implement |
| US3333645A (en) * | 1964-12-23 | 1967-08-01 | Elmer A Gustafson | Multiple purpose drawbar |
| US3321028A (en) * | 1965-01-22 | 1967-05-23 | Portable Elevator Mfg Company | Foldable implement mounting for transporting the same |
| NL6601808A (enExample) * | 1966-02-14 | 1967-08-15 | ||
| US3491836A (en) * | 1967-01-09 | 1970-01-27 | Doepker Ind Ltd | Wide-span implements having articulated frames |
| US3493246A (en) * | 1967-10-09 | 1970-02-03 | American Products Inc | Hinge means for foldable frame structures for longitudinal relative movement |
| US3493247A (en) * | 1967-10-09 | 1970-02-03 | American Products Inc | Foldable frame for agricultural implements |
| US3529674A (en) * | 1968-04-01 | 1970-09-22 | Massey Ferguson Inc | Foldable multiple section earthworking implement |
| US3521906A (en) * | 1968-12-16 | 1970-07-28 | Deere & Co | Frame for agricultural implement |
| US3620550A (en) * | 1969-11-03 | 1971-11-16 | Richard J Hornung | Double-fold frame structure |
| US3654999A (en) * | 1970-01-19 | 1972-04-11 | Int Harvester Co | Implement carrier |
| US3698488A (en) * | 1970-09-03 | 1972-10-17 | Deere & Co | Field conditioner |
| US3751071A (en) * | 1970-10-30 | 1973-08-07 | Deere & Co | Hitch structure for agricultural implements |
| US3810660A (en) * | 1972-07-21 | 1974-05-14 | H Peterson | Folding implement cart |
| US3791673A (en) * | 1972-11-08 | 1974-02-12 | American Prod Inc | Folding means for implement frame structures |
| US3971446A (en) * | 1972-11-24 | 1976-07-27 | Raymond Frank Nienberg | Agricultural do-all machine |
| US3874459A (en) * | 1973-03-08 | 1975-04-01 | Joe F Herberholz | Outrigger lockup |
| US3982773A (en) * | 1975-12-04 | 1976-09-28 | International Harvester Company | Folding frame structure for agricultural implements |
-
1976
- 1976-09-03 US US05/720,270 patent/US4137852A/en not_active Expired - Lifetime
-
1977
- 1977-07-20 AU AU27181/77A patent/AU507097B2/en not_active Expired
- 1977-08-17 DE DE2737053A patent/DE2737053C3/de not_active Expired
- 1977-08-20 YU YU02039/77A patent/YU203977A/xx unknown
- 1977-08-26 FR FR7726061A patent/FR2363271A1/fr active Granted
- 1977-08-29 CA CA285,661A patent/CA1071918A/en not_active Expired
- 1977-08-29 ZA ZA00775218A patent/ZA775218B/xx unknown
- 1977-08-29 MX MX170392A patent/MX144750A/es unknown
- 1977-08-31 BE BE180566A patent/BE858271A/xx not_active IP Right Cessation
- 1977-08-31 NZ NZ185063A patent/NZ185063A/xx unknown
- 1977-09-01 IT IT50856/77A patent/IT1089831B/it active
- 1977-09-02 CS CS775736A patent/CS207481B2/cs unknown
- 1977-09-02 NL NL7709665A patent/NL7709665A/xx not_active Application Discontinuation
- 1977-09-02 ES ES462068A patent/ES462068A1/es not_active Expired
- 1977-09-02 TR TR20251A patent/TR20251A/xx unknown
- 1977-09-02 DK DK392177A patent/DK392177A/da not_active Application Discontinuation
- 1977-09-02 GB GB36826/77A patent/GB1572415A/en not_active Expired
- 1977-09-02 RO RO91529A patent/RO81537B/ro unknown
- 1977-09-02 BR BR7705895A patent/BR7705895A/pt unknown
- 1977-09-03 HU HU77DE941A patent/HU180713B/hu unknown
- 1977-09-10 AR AR269066A patent/AR211473Q/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| HU180713B (en) | 1983-04-29 |
| MX144750A (es) | 1981-11-19 |
| FR2363271B1 (enExample) | 1984-02-17 |
| DE2737053C3 (de) | 1981-04-09 |
| AR211473Q (es) | 1977-12-30 |
| RO81537B (ro) | 1984-08-30 |
| NL7709665A (nl) | 1978-03-07 |
| BE858271A (fr) | 1977-12-16 |
| TR20251A (tr) | 1980-12-02 |
| US4137852A (en) | 1979-02-06 |
| NZ185063A (en) | 1980-05-27 |
| RO81537A (ro) | 1984-06-21 |
| ZA775218B (en) | 1978-07-26 |
| DK392177A (da) | 1978-03-04 |
| DE2737053B2 (de) | 1980-08-21 |
| CS207481B2 (en) | 1981-07-31 |
| BR7705895A (pt) | 1978-05-02 |
| ES462068A1 (es) | 1978-06-01 |
| AU2718177A (en) | 1979-01-25 |
| FR2363271A1 (fr) | 1978-03-31 |
| YU203977A (en) | 1982-06-30 |
| DE2737053A1 (de) | 1978-03-16 |
| IT1089831B (it) | 1985-06-18 |
| AU507097B2 (en) | 1980-01-31 |
| GB1572415A (en) | 1980-07-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1071918A (en) | Forwardly foldable toolbar | |
| CA1281229C (en) | Implement transport hitch | |
| US4042044A (en) | Rear folding implement | |
| US4117893A (en) | Agricultural tool bar | |
| US4821809A (en) | Multiple section drawbar | |
| US4518046A (en) | Multiple implement hitch and transport | |
| US5488996A (en) | Forward-folding, winged, implement frame | |
| US4319643A (en) | Front folding agricultural tool bar with movable carriage to which wings coupled | |
| US4360215A (en) | Drill hitch transport | |
| US4721168A (en) | Agricultural implement with raisable lift frame rotatable about vertical axis | |
| US6408950B1 (en) | Foldable implement frame and hitch | |
| US5251704A (en) | Detachable harrow sprayer | |
| US4576238A (en) | Folding outrigger attachment for farm implements | |
| US4582143A (en) | Forwardly-folding agricultural implement | |
| US5579849A (en) | Implement convertible between a use position and a transport position | |
| US3721461A (en) | Apparatus and method for converting an implement between operating and transport positions | |
| US4213628A (en) | Pulling hitch for agricultural implements | |
| US3529674A (en) | Foldable multiple section earthworking implement | |
| US4402367A (en) | Folding tool beam and lift assembly | |
| US3654999A (en) | Implement carrier | |
| US3523699A (en) | Implement carrier | |
| US4881603A (en) | Tow frame | |
| US4768334A (en) | Tractor mounted swather | |
| CA1082035A (en) | Foldable implement | |
| US3913683A (en) | Implement transport attachment |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |