CA1069259A - Bleach and method of bleaching - Google Patents
Bleach and method of bleachingInfo
- Publication number
- CA1069259A CA1069259A CA231,274A CA231274A CA1069259A CA 1069259 A CA1069259 A CA 1069259A CA 231274 A CA231274 A CA 231274A CA 1069259 A CA1069259 A CA 1069259A
- Authority
- CA
- Canada
- Prior art keywords
- bleaching
- compound
- peroxy
- activators
- detergent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000004061 bleaching Methods 0.000 title claims abstract description 108
- 238000000034 method Methods 0.000 title claims description 24
- 239000007844 bleaching agent Substances 0.000 title description 18
- 239000000203 mixture Substances 0.000 claims abstract description 172
- 239000012190 activator Substances 0.000 claims abstract description 115
- -1 activated peroxy compound Chemical class 0.000 claims abstract description 92
- 150000001875 compounds Chemical class 0.000 claims abstract description 52
- 125000000864 peroxy group Chemical group O(O*)* 0.000 claims abstract description 32
- 125000002252 acyl group Chemical group 0.000 claims abstract description 28
- 239000000460 chlorine Substances 0.000 claims abstract description 14
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 14
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims abstract description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 7
- 150000004965 peroxy acids Chemical class 0.000 claims abstract description 5
- 239000003599 detergent Substances 0.000 claims description 101
- 239000004744 fabric Substances 0.000 claims description 48
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 claims description 30
- 125000004432 carbon atom Chemical group C* 0.000 claims description 28
- 229960001922 sodium perborate Drugs 0.000 claims description 28
- 125000000217 alkyl group Chemical group 0.000 claims description 26
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 24
- 239000001301 oxygen Substances 0.000 claims description 24
- 229910052760 oxygen Inorganic materials 0.000 claims description 24
- 238000005406 washing Methods 0.000 claims description 23
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 20
- 229910052708 sodium Inorganic materials 0.000 claims description 20
- 239000011734 sodium Substances 0.000 claims description 20
- 239000012736 aqueous medium Substances 0.000 claims description 18
- 150000003839 salts Chemical class 0.000 claims description 17
- 150000002191 fatty alcohols Chemical class 0.000 claims description 15
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 12
- 239000004115 Sodium Silicate Substances 0.000 claims description 9
- 229910052783 alkali metal Inorganic materials 0.000 claims description 9
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 claims description 9
- 229940045872 sodium percarbonate Drugs 0.000 claims description 9
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical group CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 claims description 8
- 150000004996 alkyl benzenes Chemical class 0.000 claims description 8
- 125000000129 anionic group Chemical group 0.000 claims description 8
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims description 8
- 229910052911 sodium silicate Inorganic materials 0.000 claims description 8
- 229940077388 benzenesulfonate Drugs 0.000 claims description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 6
- 235000019832 sodium triphosphate Nutrition 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 6
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 claims description 6
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- GAVNYHWVCOTMTQ-UHFFFAOYSA-N 2-[(4,6-dichloro-1,3,5-triazin-2-yl)-(2-hydroxyethyl)amino]ethanol Chemical group OCCN(CCO)C1=NC(Cl)=NC(Cl)=N1 GAVNYHWVCOTMTQ-UHFFFAOYSA-N 0.000 claims description 3
- GPIQOFWTZXXOOV-UHFFFAOYSA-N 2-chloro-4,6-dimethoxy-1,3,5-triazine Chemical group COC1=NC(Cl)=NC(OC)=N1 GPIQOFWTZXXOOV-UHFFFAOYSA-N 0.000 claims description 3
- DZCAZXAJPZCSCU-UHFFFAOYSA-K sodium nitrilotriacetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O DZCAZXAJPZCSCU-UHFFFAOYSA-K 0.000 claims description 3
- 159000000000 sodium salts Chemical class 0.000 claims description 3
- 239000007859 condensation product Substances 0.000 claims description 2
- 230000003213 activating effect Effects 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- 239000000463 material Substances 0.000 description 22
- 238000012360 testing method Methods 0.000 description 19
- 239000000047 product Substances 0.000 description 18
- 229920000742 Cotton Polymers 0.000 description 15
- 230000000694 effects Effects 0.000 description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 13
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 12
- 239000000975 dye Substances 0.000 description 10
- 239000002609 medium Substances 0.000 description 10
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 238000004453 electron probe microanalysis Methods 0.000 description 7
- UFZOPKFMKMAWLU-UHFFFAOYSA-N ethoxy(methyl)phosphinic acid Chemical compound CCOP(C)(O)=O UFZOPKFMKMAWLU-UHFFFAOYSA-N 0.000 description 7
- 229910019142 PO4 Inorganic materials 0.000 description 6
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 6
- 230000002411 adverse Effects 0.000 description 6
- 239000001768 carboxy methyl cellulose Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 125000001309 chloro group Chemical group Cl* 0.000 description 6
- 238000000576 coating method Methods 0.000 description 6
- 239000002245 particle Substances 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 6
- 235000021317 phosphate Nutrition 0.000 description 6
- 239000010452 phosphate Substances 0.000 description 6
- 229920000728 polyester Polymers 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 238000009991 scouring Methods 0.000 description 6
- 239000000377 silicon dioxide Substances 0.000 description 6
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- 239000000253 Denture Cleanser Substances 0.000 description 5
- 235000019219 chocolate Nutrition 0.000 description 5
- 239000011248 coating agent Substances 0.000 description 5
- 229910052681 coesite Inorganic materials 0.000 description 5
- 229910052906 cristobalite Inorganic materials 0.000 description 5
- 235000020095 red wine Nutrition 0.000 description 5
- 229910052682 stishovite Inorganic materials 0.000 description 5
- 150000003918 triazines Chemical class 0.000 description 5
- 229910052905 tridymite Inorganic materials 0.000 description 5
- 235000016068 Berberis vulgaris Nutrition 0.000 description 4
- 241000335053 Beta vulgaris Species 0.000 description 4
- 229920001353 Dextrin Polymers 0.000 description 4
- 239000004375 Dextrin Substances 0.000 description 4
- 102000004190 Enzymes Human genes 0.000 description 4
- 108090000790 Enzymes Proteins 0.000 description 4
- 241000219095 Vitis Species 0.000 description 4
- 235000009754 Vitis X bourquina Nutrition 0.000 description 4
- 235000012333 Vitis X labruscana Nutrition 0.000 description 4
- 235000014787 Vitis vinifera Nutrition 0.000 description 4
- 229910021538 borax Inorganic materials 0.000 description 4
- 125000002091 cationic group Chemical group 0.000 description 4
- 230000008859 change Effects 0.000 description 4
- 235000019425 dextrin Nutrition 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 229940088598 enzyme Drugs 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 150000004665 fatty acids Chemical class 0.000 description 4
- 230000006872 improvement Effects 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 235000012239 silicon dioxide Nutrition 0.000 description 4
- 239000000344 soap Substances 0.000 description 4
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 4
- 239000004328 sodium tetraborate Substances 0.000 description 4
- 235000010339 sodium tetraborate Nutrition 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 230000000845 anti-microbial effect Effects 0.000 description 3
- 239000011324 bead Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229960003975 potassium Drugs 0.000 description 3
- 230000001681 protective effect Effects 0.000 description 3
- MWNQXXOSWHCCOZ-UHFFFAOYSA-L sodium;oxido carbonate Chemical compound [Na+].[O-]OC([O-])=O MWNQXXOSWHCCOZ-UHFFFAOYSA-L 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 3
- 239000008399 tap water Substances 0.000 description 3
- 235000020679 tap water Nutrition 0.000 description 3
- 150000004685 tetrahydrates Chemical class 0.000 description 3
- WODGXFMUOLGZSY-UHFFFAOYSA-J tetrasodium phosphonatooxy phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OOP([O-])([O-])=O WODGXFMUOLGZSY-UHFFFAOYSA-J 0.000 description 3
- KJFGIEUERFWKMN-UHFFFAOYSA-M tetrasodium trioxido(oxidooxy)silane Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]O[Si]([O-])([O-])[O-] KJFGIEUERFWKMN-UHFFFAOYSA-M 0.000 description 3
- LJHFIVQEAFAURQ-ZPUQHVIOSA-N (NE)-N-[(2E)-2-hydroxyiminoethylidene]hydroxylamine Chemical compound O\N=C\C=N\O LJHFIVQEAFAURQ-ZPUQHVIOSA-N 0.000 description 2
- LCPVQAHEFVXVKT-UHFFFAOYSA-N 2-(2,4-difluorophenoxy)pyridin-3-amine Chemical compound NC1=CC=CN=C1OC1=CC=C(F)C=C1F LCPVQAHEFVXVKT-UHFFFAOYSA-N 0.000 description 2
- CNGYZEMWVAWWOB-VAWYXSNFSA-N 5-[[4-anilino-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2-[(e)-2-[4-[[4-anilino-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid Chemical compound N=1C(NC=2C=C(C(\C=C\C=3C(=CC(NC=4N=C(N=C(NC=5C=CC=CC=5)N=4)N(CCO)CCO)=CC=3)S(O)(=O)=O)=CC=2)S(O)(=O)=O)=NC(N(CCO)CCO)=NC=1NC1=CC=CC=C1 CNGYZEMWVAWWOB-VAWYXSNFSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 2
- 108091005804 Peptidases Proteins 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 102000005158 Subtilisins Human genes 0.000 description 2
- 108010056079 Subtilisins Proteins 0.000 description 2
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical compound CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- BHDAXLOEFWJKTL-UHFFFAOYSA-L dipotassium;carboxylatooxy carbonate Chemical compound [K+].[K+].[O-]C(=O)OOC([O-])=O BHDAXLOEFWJKTL-UHFFFAOYSA-L 0.000 description 2
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 2
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 159000000011 group IA salts Chemical class 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 239000011256 inorganic filler Substances 0.000 description 2
- 229910003475 inorganic filler Inorganic materials 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 159000000001 potassium salts Chemical class 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 239000011253 protective coating Substances 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 2
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Substances [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- 230000003381 solubilizing effect Effects 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000001954 sterilising effect Effects 0.000 description 2
- 238000004659 sterilization and disinfection Methods 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 230000001502 supplementing effect Effects 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- KRTNITDCKAVIFI-UHFFFAOYSA-N tridecyl benzenesulfonate Chemical compound CCCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 KRTNITDCKAVIFI-UHFFFAOYSA-N 0.000 description 2
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 2
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 2
- 235000019801 trisodium phosphate Nutrition 0.000 description 2
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 description 2
- OLENANGIJWDOPG-UHFFFAOYSA-N (2-chlorobenzoyl) 2-chlorobenzoate Chemical compound ClC1=CC=CC=C1C(=O)OC(=O)C1=CC=CC=C1Cl OLENANGIJWDOPG-UHFFFAOYSA-N 0.000 description 1
- NSMXQKNUPPXBRG-SECBINFHSA-N (R)-lisofylline Chemical compound O=C1N(CCCC[C@H](O)C)C(=O)N(C)C2=C1N(C)C=N2 NSMXQKNUPPXBRG-SECBINFHSA-N 0.000 description 1
- FMKJUUQOYOHLTF-OWOJBTEDSA-N (e)-4-azaniumylbut-2-enoate Chemical compound NC\C=C\C(O)=O FMKJUUQOYOHLTF-OWOJBTEDSA-N 0.000 description 1
- WTOCSVCDHNWXCQ-UHFFFAOYSA-N 1-acetyl-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC(=O)N1C(=O)NC(=O)C1(C)C WTOCSVCDHNWXCQ-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical compound CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 1
- GDBUZIKSJGRBJP-UHFFFAOYSA-N 4-acetoxy benzoic acid Chemical compound CC(=O)OC1=CC=C(C(O)=O)C=C1 GDBUZIKSJGRBJP-UHFFFAOYSA-N 0.000 description 1
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 description 1
- 239000004382 Amylase Substances 0.000 description 1
- 102000013142 Amylases Human genes 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- 241000196224 Codium Species 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 101100532699 Drosophila melanogaster scyl gene Proteins 0.000 description 1
- 239000004129 EU approved improving agent Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- HLCFGWHYROZGBI-JJKGCWMISA-M Potassium gluconate Chemical compound [K+].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O HLCFGWHYROZGBI-JJKGCWMISA-M 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 244000269722 Thea sinensis Species 0.000 description 1
- DUJHUESDNVWCBZ-UHFFFAOYSA-N [acetyloxy(2-hydroxyethyl)amino] acetate Chemical compound CC(=O)ON(CCO)OC(C)=O DUJHUESDNVWCBZ-UHFFFAOYSA-N 0.000 description 1
- 229920006397 acrylic thermoplastic Polymers 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000004931 aggregating effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 235000019418 amylase Nutrition 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 238000007080 aromatic substitution reaction Methods 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- OGBUMNBNEWYMNJ-UHFFFAOYSA-N batilol Chemical class CCCCCCCCCCCCCCCCCCOCC(O)CO OGBUMNBNEWYMNJ-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- FGZBFIYFJUAETR-UHFFFAOYSA-N calcium;magnesium;silicate Chemical compound [Mg+2].[Ca+2].[O-][Si]([O-])([O-])[O-] FGZBFIYFJUAETR-UHFFFAOYSA-N 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 229920006184 cellulose methylcellulose Polymers 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- GFLLOMRSVVPUNQ-UHFFFAOYSA-M dimethyl-propyl-tetradecylazanium;chloride Chemical compound [Cl-].CCCCCCCCCCCCCC[N+](C)(C)CCC GFLLOMRSVVPUNQ-UHFFFAOYSA-M 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 238000004851 dishwashing Methods 0.000 description 1
- 239000003974 emollient agent Substances 0.000 description 1
- 238000004134 energy conservation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 125000001046 glycoluril group Chemical class [H]C12N(*)C(=O)N(*)C1([H])N(*)C(=O)N2* 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 150000002462 imidazolines Chemical class 0.000 description 1
- 150000004966 inorganic peroxy acids Chemical class 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 238000004900 laundering Methods 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 150000003109 potassium Chemical class 0.000 description 1
- 239000004224 potassium gluconate Substances 0.000 description 1
- 235000013926 potassium gluconate Nutrition 0.000 description 1
- 229960003189 potassium gluconate Drugs 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 1
- 235000019351 sodium silicates Nutrition 0.000 description 1
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- SFVFIFLLYFPGHH-UHFFFAOYSA-M stearalkonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 SFVFIFLLYFPGHH-UHFFFAOYSA-M 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 239000008400 supply water Substances 0.000 description 1
- ISXSCDLOGDJUNJ-UHFFFAOYSA-N tert-butyl prop-2-enoate Chemical compound CC(C)(C)OC(=O)C=C ISXSCDLOGDJUNJ-UHFFFAOYSA-N 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- 229940055764 triaz Drugs 0.000 description 1
- 239000012178 vegetable wax Substances 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 235000014101 wine Nutrition 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 230000037303 wrinkles Effects 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3907—Organic compounds
- C11D3/3917—Nitrogen-containing compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3907—Organic compounds
- C11D3/3917—Nitrogen-containing compounds
- C11D3/392—Heterocyclic compounds, e.g. cyclic imides or lactames
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/487,889 US3982892A (en) | 1974-07-12 | 1974-07-12 | Activated peroxy bleach composition |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1069259A true CA1069259A (en) | 1980-01-08 |
Family
ID=23937531
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA231,274A Expired CA1069259A (en) | 1974-07-12 | 1975-07-11 | Bleach and method of bleaching |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3982892A (enExample) |
| AU (1) | AU498695B2 (enExample) |
| BE (1) | BE831277A (enExample) |
| CA (1) | CA1069259A (enExample) |
| DE (1) | DE2530524C2 (enExample) |
| DK (1) | DK310275A (enExample) |
| FR (1) | FR2277926A1 (enExample) |
| GB (1) | GB1513305A (enExample) |
| IT (1) | IT1040925B (enExample) |
| ZA (1) | ZA754334B (enExample) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4123376A (en) * | 1973-08-24 | 1978-10-31 | Colgate-Palmolive Company | Peroxymonosulfate-base bleaching and bleaching detergent compositions |
| US4300897A (en) * | 1973-08-24 | 1981-11-17 | Colgate-Palmolive Company | Method for bleaching with peroxymonosulfate-based compositions |
| US4604224A (en) * | 1975-12-15 | 1986-08-05 | Colgate Palmolive Co. | Zeolite containing heavy duty non-phosphate detergent composition |
| US4391727A (en) * | 1975-12-15 | 1983-07-05 | Colgate Palmolive Company | Non-caking bleach containing molecular sieve zeolite |
| FR2353634A1 (fr) * | 1976-06-04 | 1977-12-30 | Ugine Kuhlmann | Activateurs phosphores pour percomposes |
| US4124356A (en) * | 1977-10-03 | 1978-11-07 | Fmc Corporation | Organophosphorus azides as peroxygen activators |
| US4120652A (en) * | 1977-10-03 | 1978-10-17 | Fmc Corporation | Aromatic sulfonyl azides as peroxygen activators |
| US4279769A (en) * | 1978-03-20 | 1981-07-21 | Kao Soap Co., Ltd. | Bleaching composition |
| DE3128336A1 (de) * | 1981-07-17 | 1983-01-27 | Henkel KGaA, 4000 Düsseldorf | "verfahren zur herstellung umhuellter koerniger bleichaktivatoren" |
| US5002691A (en) * | 1986-11-06 | 1991-03-26 | The Clorox Company | Oxidant detergent containing stable bleach activator granules |
| US5112514A (en) * | 1986-11-06 | 1992-05-12 | The Clorox Company | Oxidant detergent containing stable bleach activator granules |
| US5269962A (en) * | 1988-10-14 | 1993-12-14 | The Clorox Company | Oxidant composition containing stable bleach activator granules |
| US5055305A (en) * | 1988-12-02 | 1991-10-08 | Richardson-Vicks, Inc. | Cleansing compositions |
| JP2860798B2 (ja) * | 1989-06-27 | 1999-02-24 | 東海電化工業株式会社 | 安全な過炭酸ナトリウム組成物 |
| US5151212A (en) * | 1990-03-21 | 1992-09-29 | The Belzak Corporation | Peroxygen compound activation |
| US5374368A (en) * | 1993-10-25 | 1994-12-20 | Church & Dwight Co., Inc. | Stable sodium percarbonate formulation |
| DE4443177A1 (de) * | 1994-12-05 | 1996-06-13 | Henkel Kgaa | Aktivatormischungen für anorganische Perverbindungen |
| US5898024A (en) * | 1995-03-01 | 1999-04-27 | Charvid Limited Liability | Non-caustic cleaning composition comprising peroxygen compound and specific silicate, and method of making the same in free-flowing, particulate form |
| US6194367B1 (en) | 1995-03-01 | 2001-02-27 | Charvid Limited Liability Co. | Non-caustic cleaning composition comprising peroxygen compound and specific silicate and method of making the same in free-flowing, particulate form |
| US5663132A (en) * | 1995-03-01 | 1997-09-02 | Charvid Limited Liability Company | Non-caustic composition comprising peroxygen compound and metasilicate and cleaning methods for using same |
| US6034048A (en) * | 1995-03-01 | 2000-03-07 | Charvid Limited Liability Co. | Non-caustic cleaning composition using an alkali salt |
| JP3827022B2 (ja) * | 1995-03-09 | 2006-09-27 | 三菱瓦斯化学株式会社 | 漂白剤組成物 |
| US6019797A (en) * | 1996-06-10 | 2000-02-01 | Procter & Gamble Company | Laundry bleaching with improved safety to fabrics |
| DE10102248A1 (de) * | 2001-01-19 | 2002-07-25 | Clariant Gmbh | Verwendung von Übergangsmetallkomplexen mit Oxim-Liganden als Bleichkatalysatoren |
| US6605579B1 (en) * | 2001-05-11 | 2003-08-12 | Colgate- Palmolive Company | Antibacterial liquid dish cleaning compositions |
| US6593284B2 (en) * | 2001-05-11 | 2003-07-15 | Colgate-Palmolive Company | Antibacterial liquid dish cleaning compositions |
| US6475967B1 (en) * | 2002-03-05 | 2002-11-05 | Colgate-Palmolive Company | Liquid dish cleaning compositions containing a peroxide source |
| US20060178289A1 (en) * | 2004-07-20 | 2006-08-10 | Enrique Hernandez | Multifunctional material compositions and methods |
| US20060019865A1 (en) * | 2004-07-20 | 2006-01-26 | Enrique Hernandez | Methods and compositions of multifunctional detergent components |
| US20070161539A1 (en) * | 2006-01-12 | 2007-07-12 | Enrique Hernandez | Method of regulating degree of polymerization of an alkali metal silicate in solution using pH |
| US7470653B2 (en) * | 2006-04-07 | 2008-12-30 | Colgate-Palmolive Company | Liquid cleaning composition comprising an anionic/betaine surfactant mixture having low viscosity |
| US9034390B2 (en) * | 2006-05-02 | 2015-05-19 | Bioneutral Laboratories Corporation | Anti-microbial composition and method for making and using same |
| US20090074881A1 (en) * | 2006-05-02 | 2009-03-19 | Bioneutral Laboratories Corporation Usa | Antimicrobial cidality formulations with residual efficacy, uses thereof, and the preparation thereof |
| US20070264356A1 (en) * | 2006-05-09 | 2007-11-15 | Kelly Ann Ames | Process for the preparation of a ready-to-use disinfectant |
| US7718595B2 (en) * | 2008-06-17 | 2010-05-18 | Colgate Palmolive Company | Light duty liquid cleaning compositions and methods of manufacture and use thereof comprising organic acids |
| US8022028B2 (en) * | 2008-06-17 | 2011-09-20 | Colgate-Palmolive Company | Light duty liquid cleaning compositions and methods of manufacture and use thereof comprising organic acids |
| US8247362B2 (en) | 2008-06-17 | 2012-08-21 | Colgate-Palmolive Company | Light duty liquid cleaning compositions and methods of manufacture and use thereof |
| US20100056404A1 (en) * | 2008-08-29 | 2010-03-04 | Micro Pure Solutions, Llc | Method for treating hydrogen sulfide-containing fluids |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3715184A (en) * | 1967-12-30 | 1973-02-06 | Henkel & Cie Gmbh | Method of activating per-compounds and solid activated per-compound compositions |
| DE2047573A1 (de) * | 1970-09-28 | 1972-03-30 | Henkel & Cie GmbH, 4000 Düsseldorf | Mittel zur Herstellung von Kaltbleichflotten, insbesondere von kaltbleichwirksamen Waschlaugen |
-
1974
- 1974-07-12 US US05/487,889 patent/US3982892A/en not_active Expired - Lifetime
-
1975
- 1975-07-07 ZA ZA754334A patent/ZA754334B/xx unknown
- 1975-07-08 GB GB28712/75A patent/GB1513305A/en not_active Expired
- 1975-07-09 DE DE2530524A patent/DE2530524C2/de not_active Expired
- 1975-07-09 DK DK310275A patent/DK310275A/da unknown
- 1975-07-09 AU AU82855/75A patent/AU498695B2/en not_active Expired
- 1975-07-10 FR FR7521682A patent/FR2277926A1/fr active Granted
- 1975-07-11 IT IT50469/75A patent/IT1040925B/it active
- 1975-07-11 CA CA231,274A patent/CA1069259A/en not_active Expired
- 1975-07-11 BE BE158215A patent/BE831277A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2277926A1 (fr) | 1976-02-06 |
| DE2530524A1 (de) | 1976-01-29 |
| US3982892A (en) | 1976-09-28 |
| GB1513305A (en) | 1978-06-07 |
| BE831277A (fr) | 1975-11-03 |
| AU498695B2 (en) | 1979-03-22 |
| AU8285575A (en) | 1977-01-13 |
| ZA754334B (en) | 1977-02-23 |
| FR2277926B1 (enExample) | 1978-11-03 |
| DE2530524C2 (de) | 1986-05-22 |
| DK310275A (da) | 1976-01-13 |
| IT1040925B (it) | 1979-12-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1069259A (en) | Bleach and method of bleaching | |
| US4064062A (en) | Stabilized activated percompound bleaching compositions and methods for manufacture thereof | |
| US4123376A (en) | Peroxymonosulfate-base bleaching and bleaching detergent compositions | |
| US4055505A (en) | Activated percompound bleaching compositions | |
| US4604224A (en) | Zeolite containing heavy duty non-phosphate detergent composition | |
| US4028263A (en) | Bleaching and brightening detergent composition | |
| US4146496A (en) | Peroxy bleach system suitable for colored laundry | |
| CA2190507A1 (en) | Peroxygen bleach composition | |
| JPS61241400A (ja) | 漂白組成物 | |
| JPH05271695A (ja) | イミドペルオキシカルボン酸の懸濁物及びそのコートされた凝集物及びその使用法 | |
| US4300897A (en) | Method for bleaching with peroxymonosulfate-based compositions | |
| US4522739A (en) | Activated peroxy compound bleaching compositions and bleaching detergent compositions and process of using same | |
| US4292191A (en) | Activated peroxy compound bleaching compositions and bleaching detergent compositions | |
| EP0582478B1 (en) | Heavy duty laundry detergent compositions of reduced dye transfer properties | |
| JPS6183296A (ja) | 洗濯サイクル洗剤・柔軟剤組成物 | |
| US4107065A (en) | Activated peroxy compound bleaching compositions and bleaching detergent compositions | |
| AU674672B2 (en) | Peroxygen bleach composition | |
| JPH02196900A (ja) | 重質粒状合成有機ノニオン洗剤組成物 | |
| US3640874A (en) | Bleaching and detergent compositions | |
| US4203852A (en) | Softener, bleach and anti-cling composition | |
| US3886078A (en) | N-benzoylsaccharin as peroxygen bleach activator | |
| CA1207956A (en) | Peroxyacid bleaching and laundering composition | |
| US3058916A (en) | Colored cleaning agents | |
| US4021361A (en) | Storage-stable detergent composition containing sodium perborate and activator | |
| CA1090505A (en) | Bleaching compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |