CA1046526A - Pesticidal n-carbamoyl-n-phenyl formamidine derivatives - Google Patents
Pesticidal n-carbamoyl-n-phenyl formamidine derivativesInfo
- Publication number
- CA1046526A CA1046526A CA195,997A CA195997A CA1046526A CA 1046526 A CA1046526 A CA 1046526A CA 195997 A CA195997 A CA 195997A CA 1046526 A CA1046526 A CA 1046526A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- corresponds
- product
- formamidine
- radicals
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000000361 pesticidal effect Effects 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 7
- 150000001450 anions Chemical class 0.000 claims abstract description 6
- 125000005843 halogen group Chemical group 0.000 claims abstract description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 5
- 229910052500 inorganic mineral Inorganic materials 0.000 claims abstract description 5
- 239000011707 mineral Substances 0.000 claims abstract description 5
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 4
- 150000007524 organic acids Chemical class 0.000 claims abstract description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims abstract description 3
- -1 alkyl radical Chemical class 0.000 claims description 42
- 238000000034 method Methods 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 17
- 238000002360 preparation method Methods 0.000 claims description 17
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical class NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 claims description 12
- 241000196324 Embryophyta Species 0.000 claims description 6
- 150000003254 radicals Chemical class 0.000 claims description 6
- 150000001408 amides Chemical class 0.000 claims description 5
- 238000010992 reflux Methods 0.000 claims description 5
- 235000010755 mineral Nutrition 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 2
- 230000000875 corresponding effect Effects 0.000 claims 7
- RYTLGWCJESCDMY-UHFFFAOYSA-N carbamimidoyl chloride Chemical compound NC(Cl)=N RYTLGWCJESCDMY-UHFFFAOYSA-N 0.000 claims 2
- 239000003701 inert diluent Substances 0.000 claims 1
- 150000004820 halides Chemical class 0.000 abstract description 20
- 239000004009 herbicide Substances 0.000 abstract description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 abstract description 3
- 239000002253 acid Substances 0.000 abstract description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 abstract description 2
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 abstract description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 238000002844 melting Methods 0.000 description 12
- 230000008018 melting Effects 0.000 description 12
- 240000008620 Fagopyrum esculentum Species 0.000 description 10
- 235000009419 Fagopyrum esculentum Nutrition 0.000 description 10
- 239000000047 product Substances 0.000 description 9
- 241001621841 Alopecurus myosuroides Species 0.000 description 8
- 244000299507 Gossypium hirsutum Species 0.000 description 8
- 229940093499 ethyl acetate Drugs 0.000 description 8
- 235000019439 ethyl acetate Nutrition 0.000 description 8
- 235000006463 Brassica alba Nutrition 0.000 description 7
- 244000140786 Brassica hirta Species 0.000 description 7
- 244000058871 Echinochloa crus-galli Species 0.000 description 7
- 241000209082 Lolium Species 0.000 description 7
- 241000209140 Triticum Species 0.000 description 7
- 235000021307 Triticum Nutrition 0.000 description 7
- 230000002363 herbicidal effect Effects 0.000 description 7
- 240000006122 Chenopodium album Species 0.000 description 6
- 235000009344 Chenopodium album Nutrition 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 6
- 235000011371 Brassica hirta Nutrition 0.000 description 5
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 5
- 240000006694 Stellaria media Species 0.000 description 5
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 4
- 240000008042 Zea mays Species 0.000 description 4
- 239000011149 active material Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 3
- 235000004135 Amaranthus viridis Nutrition 0.000 description 3
- 235000005484 Chenopodium berlandieri Nutrition 0.000 description 3
- 235000009332 Chenopodium rubrum Nutrition 0.000 description 3
- 235000003222 Helianthus annuus Nutrition 0.000 description 3
- 240000007594 Oryza sativa Species 0.000 description 3
- 235000007164 Oryza sativa Nutrition 0.000 description 3
- 240000003829 Sorghum propinquum Species 0.000 description 3
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- 241001233957 eudicotyledons Species 0.000 description 3
- 235000009973 maize Nutrition 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 241000209764 Avena fatua Species 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- 235000007319 Avena orientalis Nutrition 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 2
- 244000020551 Helianthus annuus Species 0.000 description 2
- 235000019687 Lamb Nutrition 0.000 description 2
- 235000011999 Panicum crusgalli Nutrition 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- 244000098338 Triticum aestivum Species 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- NMVVJCLUYUWBSZ-UHFFFAOYSA-N aminomethylideneazanium;chloride Chemical compound Cl.NC=N NMVVJCLUYUWBSZ-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 230000035784 germination Effects 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- VOLGAXAGEUPBDM-UHFFFAOYSA-N $l^{1}-oxidanylethane Chemical compound CC[O] VOLGAXAGEUPBDM-UHFFFAOYSA-N 0.000 description 1
- MGBCODKFLBUYQK-UHFFFAOYSA-M (n-[butyl(methyl)carbamoyl]-3,4-dichloroanilino)methylidene-dimethylazanium;chloride Chemical compound [Cl-].CCCCN(C)C(=O)N(C=[N+](C)C)C1=CC=C(Cl)C(Cl)=C1 MGBCODKFLBUYQK-UHFFFAOYSA-M 0.000 description 1
- NQJWXALBUBGNBS-UHFFFAOYSA-M 1-[N-(dimethylcarbamoyl)-3-(trifluoromethyl)anilino]ethylidene-dimethylazanium chloride Chemical compound [Cl-].CN(C)C(=O)N(C(C)=[N+](C)C)C1=CC=CC(C(F)(F)F)=C1 NQJWXALBUBGNBS-UHFFFAOYSA-M 0.000 description 1
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 244000298916 Arachis sp Species 0.000 description 1
- 235000007826 Arachis sp Nutrition 0.000 description 1
- 235000007320 Avena fatua Nutrition 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 241000208818 Helianthus Species 0.000 description 1
- 244000100545 Lolium multiflorum Species 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000010624 Medicago sativa Nutrition 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- 241000208292 Solanaceae Species 0.000 description 1
- 241000209072 Sorghum Species 0.000 description 1
- 235000007244 Zea mays Nutrition 0.000 description 1
- IXWBLJXQLDSNMA-UHFFFAOYSA-M [3,4-dichloro-n-(dimethylcarbamoyl)anilino]methylidene-dimethylazanium;chloride Chemical compound [Cl-].CN(C)C(=O)N(C=[N+](C)C)C1=CC=C(Cl)C(Cl)=C1 IXWBLJXQLDSNMA-UHFFFAOYSA-M 0.000 description 1
- VVOMCBPTAVBZBG-UHFFFAOYSA-M [3-chloro-n-(dimethylcarbamoyl)-4-methoxyanilino]methylidene-dimethylazanium;chloride Chemical compound [Cl-].COC1=CC=C(N(C=[N+](C)C)C(=O)N(C)C)C=C1Cl VVOMCBPTAVBZBG-UHFFFAOYSA-M 0.000 description 1
- CKYRODOSCSTNCQ-UHFFFAOYSA-M [n-(dimethylcarbamoyl)-3-(trifluoromethyl)anilino]methylidene-dimethylazanium;chloride Chemical compound [Cl-].CN(C)C(=O)N(C=[N+](C)C)C1=CC=CC(C(F)(F)F)=C1 CKYRODOSCSTNCQ-UHFFFAOYSA-M 0.000 description 1
- SCAZPERCPQQWFR-UHFFFAOYSA-M [n-(dimethylcarbamoyl)-4-propan-2-ylanilino]methylidene-dimethylazanium;chloride Chemical compound [Cl-].CC(C)C1=CC=C(N(C=[N+](C)C)C(=O)N(C)C)C=C1 SCAZPERCPQQWFR-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001253 acrylic acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 235000005489 dwarf bean Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920005610 lignin Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- DSWNRHCOGVRDOE-UHFFFAOYSA-N n,n-dimethylmethanimidamide Chemical compound CN(C)C=N DSWNRHCOGVRDOE-UHFFFAOYSA-N 0.000 description 1
- 230000017066 negative regulation of growth Effects 0.000 description 1
- 239000012875 nonionic emulsifier Substances 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 239000013008 thixotropic agent Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7311843A FR2223361B1 (enExample) | 1973-03-27 | 1973-03-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1046526A true CA1046526A (en) | 1979-01-16 |
Family
ID=9117272
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA195,997A Expired CA1046526A (en) | 1973-03-27 | 1974-03-26 | Pesticidal n-carbamoyl-n-phenyl formamidine derivatives |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4013716A (enExample) |
| JP (1) | JPS49125528A (enExample) |
| AT (1) | AT342068B (enExample) |
| AU (1) | AU6722674A (enExample) |
| BE (1) | BE812901A (enExample) |
| BR (1) | BR7402370D0 (enExample) |
| CA (1) | CA1046526A (enExample) |
| CH (1) | CH592412A5 (enExample) |
| DD (1) | DD114210A5 (enExample) |
| DE (1) | DE2412340A1 (enExample) |
| ES (1) | ES424648A1 (enExample) |
| FR (1) | FR2223361B1 (enExample) |
| GB (1) | GB1445806A (enExample) |
| HU (1) | HU167651B (enExample) |
| IE (1) | IE39107B1 (enExample) |
| IL (1) | IL44393A (enExample) |
| IN (1) | IN138852B (enExample) |
| IT (1) | IT1056059B (enExample) |
| NL (1) | NL7403542A (enExample) |
| OA (1) | OA04626A (enExample) |
| SU (2) | SU607548A3 (enExample) |
| TR (1) | TR17954A (enExample) |
| ZA (1) | ZA741964B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2920174A1 (de) * | 1979-05-18 | 1980-11-20 | Hoechst Ag | Technetium-99m-markierte acetanilidoiminodiacetate zur leberfunktionsdiagnostik |
| IN172842B (enExample) * | 1990-05-17 | 1993-12-11 | Boots Pharmaceuticals Limited |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL110691C (enExample) * | 1959-12-23 | |||
| DE1138390B (de) | 1960-11-30 | 1962-10-25 | Bayer Ag | Verfahren zur Herstellung von tetra-substituierten Formamidochlorformamidinen |
| FR1357946A (fr) * | 1962-05-16 | 1964-04-10 | Basf Ag | Herbicides |
| DE1175223B (de) * | 1963-06-12 | 1964-08-06 | Basf Ag | Verfahren zur Herstellung von Harnstoffderivaten |
| GB1194835A (en) * | 1966-07-07 | 1970-06-10 | Wellcome Found | Novel 1-Amidino-3-Phenyl-Urea Derivatives, the preparation thereof and Compositions containing the same |
| US3629455A (en) * | 1968-03-07 | 1971-12-21 | Sterling Drug Inc | Method of treating helminthiasis and imidoylurea compositions therefor |
| US3547937A (en) * | 1968-03-07 | 1970-12-15 | Sterling Drug Inc | Certain 4-thiazolecarboxamidines |
| US3790631A (en) * | 1968-03-07 | 1974-02-05 | Sterling Drug Inc | Carbimidoyl ureas |
| US3830839A (en) * | 1968-03-07 | 1974-08-20 | Sterling Drug Inc | Imidoyl ureas |
| US3898277A (en) * | 1971-01-22 | 1975-08-05 | Ciba Geigy Corp | N-substituted aryl formimidoyl compounds |
| CH576432A5 (enExample) * | 1972-02-29 | 1976-06-15 | Sandoz Ag | |
| US3823179A (en) * | 1972-12-07 | 1974-07-09 | J Fuchs | Amidinothiocarbamates |
| US3903084A (en) * | 1974-02-11 | 1975-09-02 | Upjohn Co | Carboximidoyl urea derivatives |
-
1973
- 1973-03-27 FR FR7311843A patent/FR2223361B1/fr not_active Expired
-
1974
- 1974-03-11 IL IL44393A patent/IL44393A/xx unknown
- 1974-03-14 DE DE2412340A patent/DE2412340A1/de not_active Withdrawn
- 1974-03-15 NL NL7403542A patent/NL7403542A/xx unknown
- 1974-03-15 IN IN555/CAL/74A patent/IN138852B/en unknown
- 1974-03-19 TR TR17954A patent/TR17954A/xx unknown
- 1974-03-20 JP JP49032194A patent/JPS49125528A/ja active Pending
- 1974-03-20 CH CH384174A patent/CH592412A5/xx not_active IP Right Cessation
- 1974-03-25 US US05/454,303 patent/US4013716A/en not_active Expired - Lifetime
- 1974-03-26 DD DD177461A patent/DD114210A5/xx unknown
- 1974-03-26 ES ES424648A patent/ES424648A1/es not_active Expired
- 1974-03-26 HU HUPE913A patent/HU167651B/hu unknown
- 1974-03-26 BR BR2370/74A patent/BR7402370D0/pt unknown
- 1974-03-26 OA OA55156A patent/OA04626A/xx unknown
- 1974-03-26 SU SU742012013A patent/SU607548A3/ru active
- 1974-03-26 CA CA195,997A patent/CA1046526A/en not_active Expired
- 1974-03-27 GB GB1354174A patent/GB1445806A/en not_active Expired
- 1974-03-27 AT AT255374A patent/AT342068B/de not_active IP Right Cessation
- 1974-03-27 AU AU67226/74A patent/AU6722674A/en not_active Expired
- 1974-03-27 ZA ZA00741964A patent/ZA741964B/xx unknown
- 1974-03-27 BE BE142507A patent/BE812901A/xx unknown
- 1974-03-27 IE IE00671/74A patent/IE39107B1/xx unknown
- 1974-03-27 IT IT7447757A patent/IT1056059B/it active
-
1975
- 1975-09-01 SU SU752167219A patent/SU793355A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| JPS49125528A (enExample) | 1974-12-02 |
| ZA741964B (en) | 1975-11-26 |
| FR2223361A1 (enExample) | 1974-10-25 |
| AT342068B (de) | 1978-03-10 |
| SU793355A3 (ru) | 1980-12-30 |
| IT1056059B (it) | 1982-01-30 |
| DD114210A5 (enExample) | 1975-07-20 |
| DE2412340A1 (de) | 1974-10-17 |
| US4013716A (en) | 1977-03-22 |
| CH592412A5 (enExample) | 1977-10-31 |
| BR7402370D0 (pt) | 1974-11-19 |
| ATA255374A (de) | 1977-07-15 |
| AU6722674A (en) | 1975-10-02 |
| BE812901A (fr) | 1974-09-27 |
| OA04626A (fr) | 1980-07-31 |
| IL44393A (en) | 1978-01-31 |
| IE39107B1 (en) | 1978-08-02 |
| IL44393A0 (en) | 1974-06-30 |
| NL7403542A (enExample) | 1974-10-01 |
| ES424648A1 (es) | 1976-06-01 |
| SU607548A3 (ru) | 1978-05-15 |
| FR2223361B1 (enExample) | 1977-04-29 |
| TR17954A (tr) | 1976-07-23 |
| HU167651B (enExample) | 1975-11-28 |
| GB1445806A (en) | 1976-08-11 |
| IE39107L (en) | 1974-09-27 |
| IN138852B (enExample) | 1976-04-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0033984B1 (en) | New sulphonyl compounds, method of preparing the new compounds, as well as aphicidal compositions on the basis of the new compounds | |
| DK173602B1 (da) | Halogenbenzoyl-phenylurinstofderivater, fremgangsmåde til fremstilling af sådanne forbindelser, fremgangsmåde til bekæmpelse af angreb af skadelige insekter og insekticid blanding | |
| US3551442A (en) | Thiazole derivatives | |
| US3734961A (en) | Herbicidal fluorinated phenyl ureas and thioureas | |
| EP0116729B1 (en) | Benzoylurea compounds and pesticidal compositions comprisingsame | |
| CA1046526A (en) | Pesticidal n-carbamoyl-n-phenyl formamidine derivatives | |
| US3891675A (en) | Dioxolanyl carbonyl ureas and thioureas | |
| US3794683A (en) | Halocarboxylic acid anilides | |
| US3755347A (en) | Certain n-thiazolyl-ureas | |
| US3937726A (en) | Urea derivatives and their use as herbicides | |
| US3823006A (en) | Method for selective weed control in beets | |
| US3726662A (en) | Herbicidal anilinomethylene-malononitriles | |
| CA1063613A (en) | 1-aryl-5-alkylidene-2,4-dioxo-imidazolidines | |
| KR910000042B1 (ko) | 페닐우레아 및 그 제조방법 | |
| US4101575A (en) | N-aryl-N'-(2,3-dihalogeno-alkanoyl)-ureas | |
| US3962306A (en) | Sulfonyloxyphenylurea compounds and herbicidal compositions | |
| CA1058217A (en) | Selective herbicidal phenylureas | |
| US3778247A (en) | Method for regulating plant growth | |
| DE2116956A1 (de) | Herbicide | |
| EP0250744B1 (en) | Cyanoacetamide derivatives having fungicidal activity | |
| US3761241A (en) | Phytotoxic use of n 1 cycloalken 1 yl ureas and thioureas | |
| CA1073466A (en) | Herbicidal trifluoremethylphenyl urea derivatives | |
| US3127408A (en) | 4-thiocyanato-2-butynyl carbamates | |
| US4560738A (en) | Pest-combating agent having increased duration of action | |
| US3660436A (en) | Sulfamoylaryl ureas |