CA1041543A - Process for the preparation of formylated phenoxy compounds - Google Patents
Process for the preparation of formylated phenoxy compoundsInfo
- Publication number
- CA1041543A CA1041543A CA246,157A CA246157A CA1041543A CA 1041543 A CA1041543 A CA 1041543A CA 246157 A CA246157 A CA 246157A CA 1041543 A CA1041543 A CA 1041543A
- Authority
- CA
- Canada
- Prior art keywords
- reaction
- oxygen
- catalyst
- process according
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 43
- 230000008569 process Effects 0.000 title claims abstract description 35
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 title claims abstract description 21
- 238000002360 preparation method Methods 0.000 title claims abstract description 11
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 50
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 49
- 239000001301 oxygen Substances 0.000 claims abstract description 49
- 239000003054 catalyst Substances 0.000 claims abstract description 44
- -1 PHENOXY COMPOUNDS Chemical class 0.000 claims abstract description 42
- 235000014113 dietary fatty acids Nutrition 0.000 claims abstract description 28
- 229930195729 fatty acid Natural products 0.000 claims abstract description 28
- 239000000194 fatty acid Substances 0.000 claims abstract description 28
- 150000004665 fatty acids Chemical class 0.000 claims abstract description 26
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims abstract description 20
- 150000003839 salts Chemical class 0.000 claims abstract description 17
- 229910052751 metal Inorganic materials 0.000 claims abstract description 16
- 239000002184 metal Substances 0.000 claims abstract description 16
- 150000008064 anhydrides Chemical class 0.000 claims abstract description 13
- 239000011651 chromium Substances 0.000 claims abstract description 11
- 239000007791 liquid phase Substances 0.000 claims abstract description 11
- 229910052759 nickel Inorganic materials 0.000 claims abstract description 11
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229910052804 chromium Inorganic materials 0.000 claims abstract description 10
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims abstract description 9
- 239000010941 cobalt Substances 0.000 claims abstract description 8
- 229910017052 cobalt Inorganic materials 0.000 claims abstract description 8
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims abstract description 8
- 238000006243 chemical reaction Methods 0.000 claims description 111
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 99
- 238000007254 oxidation reaction Methods 0.000 claims description 41
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 38
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 26
- 239000002904 solvent Substances 0.000 claims description 25
- 239000007810 chemical reaction solvent Substances 0.000 claims description 24
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 239000007789 gas Substances 0.000 claims description 11
- 230000036961 partial effect Effects 0.000 claims description 10
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 8
- 230000001590 oxidative effect Effects 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 229940011182 cobalt acetate Drugs 0.000 claims description 3
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 2
- 125000005595 acetylacetonate group Chemical group 0.000 claims description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 229910052748 manganese Inorganic materials 0.000 claims description 2
- 239000011572 manganese Substances 0.000 claims description 2
- 125000005609 naphthenate group Chemical group 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 claims 1
- CHLICZRVGGXEOD-UHFFFAOYSA-N 1-Methoxy-4-methylbenzene Chemical compound COC1=CC=C(C)C=C1 CHLICZRVGGXEOD-UHFFFAOYSA-N 0.000 abstract description 58
- 150000002739 metals Chemical class 0.000 abstract description 6
- 238000010438 heat treatment Methods 0.000 abstract description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 32
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- 239000007858 starting material Substances 0.000 description 21
- 150000001299 aldehydes Chemical class 0.000 description 18
- 238000002474 experimental method Methods 0.000 description 17
- 239000000047 product Substances 0.000 description 15
- ZBYYWKJVSFHYJL-UHFFFAOYSA-L cobalt(2+);diacetate;tetrahydrate Chemical compound O.O.O.O.[Co+2].CC([O-])=O.CC([O-])=O ZBYYWKJVSFHYJL-UHFFFAOYSA-L 0.000 description 13
- 230000003647 oxidation Effects 0.000 description 13
- 230000002829 reductive effect Effects 0.000 description 11
- 125000001424 substituent group Chemical group 0.000 description 10
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 8
- 239000007788 liquid Substances 0.000 description 8
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 8
- 125000001997 phenyl group Chemical class [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 8
- 150000001491 aromatic compounds Chemical class 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 6
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000012295 chemical reaction liquid Substances 0.000 description 6
- 150000001868 cobalt Chemical class 0.000 description 6
- 229910001882 dioxygen Inorganic materials 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 125000003944 tolyl group Chemical group 0.000 description 5
- OSIGJGFTADMDOB-UHFFFAOYSA-N 1-Methoxy-3-methylbenzene Chemical compound COC1=CC=CC(C)=C1 OSIGJGFTADMDOB-UHFFFAOYSA-N 0.000 description 4
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 4
- WMPDAIZRQDCGFH-UHFFFAOYSA-N 3-methoxybenzaldehyde Chemical compound COC1=CC=CC(C=O)=C1 WMPDAIZRQDCGFH-UHFFFAOYSA-N 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 4
- 229940008406 diethyl sulfate Drugs 0.000 description 4
- 229910021645 metal ion Inorganic materials 0.000 description 4
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 4
- 235000019260 propionic acid Nutrition 0.000 description 4
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 4
- UALKQROXOHJHFG-UHFFFAOYSA-N 1-ethoxy-3-methylbenzene Chemical compound CCOC1=CC=CC(C)=C1 UALKQROXOHJHFG-UHFFFAOYSA-N 0.000 description 3
- PKZJLOCLABXVMC-UHFFFAOYSA-N 2-Methoxybenzaldehyde Chemical compound COC1=CC=CC=C1C=O PKZJLOCLABXVMC-UHFFFAOYSA-N 0.000 description 3
- DTFKRVXLBCAIOZ-UHFFFAOYSA-N 2-methylanisole Chemical compound COC1=CC=CC=C1C DTFKRVXLBCAIOZ-UHFFFAOYSA-N 0.000 description 3
- VQWQYXBWRCCZGX-UHFFFAOYSA-N acetic acid;manganese Chemical compound [Mn].CC(O)=O.CC(O)=O VQWQYXBWRCCZGX-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 230000001276 controlling effect Effects 0.000 description 3
- 230000003247 decreasing effect Effects 0.000 description 3
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 3
- 238000004817 gas chromatography Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229940078487 nickel acetate tetrahydrate Drugs 0.000 description 3
- OINIXPNQKAZCRL-UHFFFAOYSA-L nickel(2+);diacetate;tetrahydrate Chemical compound O.O.O.O.[Ni+2].CC([O-])=O.CC([O-])=O OINIXPNQKAZCRL-UHFFFAOYSA-L 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- NJDSBHJSXKXNMI-UHFFFAOYSA-N 1,2-dimethyl-3-phenoxybenzene Chemical compound CC1=CC=CC(OC=2C=CC=CC=2)=C1C NJDSBHJSXKXNMI-UHFFFAOYSA-N 0.000 description 2
- OXVZEOYNXOZOFP-UHFFFAOYSA-N 1,2-dimethyl-3-propoxybenzene Chemical compound CCCOC1=CC=CC(C)=C1C OXVZEOYNXOZOFP-UHFFFAOYSA-N 0.000 description 2
- GGEGJDHYFUQUBW-UHFFFAOYSA-N 1,3,5-trimethyl-2-phenoxybenzene Chemical compound CC1=CC(C)=CC(C)=C1OC1=CC=CC=C1 GGEGJDHYFUQUBW-UHFFFAOYSA-N 0.000 description 2
- SFQKCICLBIBYQV-UHFFFAOYSA-N 1,3,5-trimethyl-2-propoxybenzene Chemical compound CCCOC1=C(C)C=C(C)C=C1C SFQKCICLBIBYQV-UHFFFAOYSA-N 0.000 description 2
- ZBTMRBYMKUEVEU-UHFFFAOYSA-N 1-bromo-4-methylbenzene Chemical compound CC1=CC=C(Br)C=C1 ZBTMRBYMKUEVEU-UHFFFAOYSA-N 0.000 description 2
- XVPUYZJFOYWSIY-UHFFFAOYSA-N 1-butoxy-2,3-dimethylbenzene Chemical compound CCCCOC1=CC=CC(C)=C1C XVPUYZJFOYWSIY-UHFFFAOYSA-N 0.000 description 2
- ZLDYMRPAVGESMU-UHFFFAOYSA-N 1-ethoxy-2,3-dimethylbenzene Chemical compound CCOC1=CC=CC(C)=C1C ZLDYMRPAVGESMU-UHFFFAOYSA-N 0.000 description 2
- JWMKUKRBNODZFA-UHFFFAOYSA-N 1-ethoxy-2-methylbenzene Chemical compound CCOC1=CC=CC=C1C JWMKUKRBNODZFA-UHFFFAOYSA-N 0.000 description 2
- BLMBNEVGYRXFNA-UHFFFAOYSA-N 1-methoxy-2,3-dimethylbenzene Chemical compound COC1=CC=CC(C)=C1C BLMBNEVGYRXFNA-UHFFFAOYSA-N 0.000 description 2
- ADFIEEKTSJBBSY-UHFFFAOYSA-N 2-butoxy-1,3,5-trimethylbenzene Chemical compound CCCCOC1=C(C)C=C(C)C=C1C ADFIEEKTSJBBSY-UHFFFAOYSA-N 0.000 description 2
- JQLCHUZDQRQSDM-UHFFFAOYSA-N 2-cyclohexyloxy-1,3,5-trimethylbenzene Chemical compound CC1=CC(C)=CC(C)=C1OC1CCCCC1 JQLCHUZDQRQSDM-UHFFFAOYSA-N 0.000 description 2
- AFLXKLWQWMNDBE-UHFFFAOYSA-N 2-ethoxy-1,3,5-trimethylbenzene Chemical compound CCOC1=C(C)C=C(C)C=C1C AFLXKLWQWMNDBE-UHFFFAOYSA-N 0.000 description 2
- HXDOZKJGKXYMEW-UHFFFAOYSA-N 4-ethylphenol Chemical compound CCC1=CC=C(O)C=C1 HXDOZKJGKXYMEW-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 229910020676 Co—N Inorganic materials 0.000 description 2
- VBNWKIADIBAREY-UHFFFAOYSA-N acetic acid nickel Chemical compound [Ni].CC(O)=O.CC(O)=O.CC(O)=O VBNWKIADIBAREY-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000003934 aromatic aldehydes Chemical class 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 230000005587 bubbling Effects 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 230000000875 corresponding effect Effects 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- ZDGGJQMSELMHLK-UHFFFAOYSA-N m-Trifluoromethylhippuric acid Chemical compound OC(=O)CNC(=O)C1=CC=CC(C(F)(F)F)=C1 ZDGGJQMSELMHLK-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- GEMHFKXPOCTAIP-UHFFFAOYSA-N n,n-dimethyl-n'-phenylcarbamimidoyl chloride Chemical compound CN(C)C(Cl)=NC1=CC=CC=C1 GEMHFKXPOCTAIP-UHFFFAOYSA-N 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- YCZXWLQUPMRTMF-UHFFFAOYSA-N 1,2-dimethyl-3-phenylmethoxybenzene Chemical compound CC1=CC=CC(OCC=2C=CC=CC=2)=C1C YCZXWLQUPMRTMF-UHFFFAOYSA-N 0.000 description 1
- REKVGPTYHRAVGP-UHFFFAOYSA-N 1,2-dimethyl-3-propan-2-yloxybenzene Chemical group CC(C)OC1=CC=CC(C)=C1C REKVGPTYHRAVGP-UHFFFAOYSA-N 0.000 description 1
- LRDRIZQHBIVHEQ-UHFFFAOYSA-N 1,3,5-trimethyl-2-phenylmethoxybenzene Chemical compound CC1=CC(C)=CC(C)=C1OCC1=CC=CC=C1 LRDRIZQHBIVHEQ-UHFFFAOYSA-N 0.000 description 1
- QSSXJPIWXQTSIX-UHFFFAOYSA-N 1-bromo-2-methylbenzene Chemical compound CC1=CC=CC=C1Br QSSXJPIWXQTSIX-UHFFFAOYSA-N 0.000 description 1
- WJIFKOVZNJTSGO-UHFFFAOYSA-N 1-bromo-3-methylbenzene Chemical compound CC1=CC=CC(Br)=C1 WJIFKOVZNJTSGO-UHFFFAOYSA-N 0.000 description 1
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 description 1
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 1
- AYCRZZPKPDDINM-UHFFFAOYSA-N 1-cyclohexyloxy-2,3-dimethylbenzene Chemical group CC1=CC=CC(OC2CCCCC2)=C1C AYCRZZPKPDDINM-UHFFFAOYSA-N 0.000 description 1
- BLBRFFGNEDJWMZ-UHFFFAOYSA-N 1-cyclohexyloxyethylbenzene Chemical compound C=1C=CC=CC=1C(C)OC1CCCCC1 BLBRFFGNEDJWMZ-UHFFFAOYSA-N 0.000 description 1
- XWYXLYCDZKRCAD-UHFFFAOYSA-N 1-methoxy-4-(2-phenylethenyl)benzene Chemical compound C1=CC(OC)=CC=C1C=CC1=CC=CC=C1 XWYXLYCDZKRCAD-UHFFFAOYSA-N 0.000 description 1
- WCOYPFBMFKXWBM-UHFFFAOYSA-N 1-methyl-2-phenoxybenzene Chemical compound CC1=CC=CC=C1OC1=CC=CC=C1 WCOYPFBMFKXWBM-UHFFFAOYSA-N 0.000 description 1
- FDLFMPKQBNPIER-UHFFFAOYSA-N 1-methyl-3-(3-methylphenoxy)benzene Chemical compound CC1=CC=CC(OC=2C=C(C)C=CC=2)=C1 FDLFMPKQBNPIER-UHFFFAOYSA-N 0.000 description 1
- XXZCIYUJYUESMD-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-3-(morpholin-4-ylmethyl)pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)CN1CCOCC1 XXZCIYUJYUESMD-UHFFFAOYSA-N 0.000 description 1
- BWLBGMIXKSTLSX-UHFFFAOYSA-N 2-hydroxyisobutyric acid Chemical compound CC(C)(O)C(O)=O BWLBGMIXKSTLSX-UHFFFAOYSA-N 0.000 description 1
- NNVKEOMPDSKFGZ-UHFFFAOYSA-N 2-methoxy-1,3,5-trimethylbenzene Chemical group COC1=C(C)C=C(C)C=C1C NNVKEOMPDSKFGZ-UHFFFAOYSA-N 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- ADHMUPZYLITZIH-UHFFFAOYSA-N 2-methylpropoxymethylbenzene Chemical compound CC(C)COCC1=CC=CC=C1 ADHMUPZYLITZIH-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- NMTKCBICYJQVBD-UHFFFAOYSA-N COC1=C(C=O)C=CC=C1.COC1=CC=C(C=C1)C Chemical compound COC1=C(C=O)C=CC=C1.COC1=CC=C(C=C1)C NMTKCBICYJQVBD-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- DJTZIDSZSYWGKR-UHFFFAOYSA-N acetic acid tetrahydrate Chemical compound O.O.O.O.CC(O)=O DJTZIDSZSYWGKR-UHFFFAOYSA-N 0.000 description 1
- WDNIVTZNAPEMHF-UHFFFAOYSA-N acetic acid;chromium Chemical compound [Cr].CC(O)=O.CC(O)=O WDNIVTZNAPEMHF-UHFFFAOYSA-N 0.000 description 1
- HJOKWYHXWROAHN-UHFFFAOYSA-N acetic acid;chromium;hydrate Chemical compound O.[Cr].CC(O)=O HJOKWYHXWROAHN-UHFFFAOYSA-N 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- MAYUYFCAPVDYBQ-UHFFFAOYSA-N butoxymethylbenzene Chemical compound CCCCOCC1=CC=CC=C1 MAYUYFCAPVDYBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-YPZZEJLDSA-N chromium-50 Chemical compound [50Cr] VYZAMTAEIAYCRO-YPZZEJLDSA-N 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- IMCZVQCVSSWPCG-UHFFFAOYSA-N cyclohexyloxymethylbenzene Chemical compound C=1C=CC=CC=1COC1CCCCC1 IMCZVQCVSSWPCG-UHFFFAOYSA-N 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012847 fine chemical Substances 0.000 description 1
- 239000007792 gaseous phase Substances 0.000 description 1
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical group O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000001282 iso-butane Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 229940071125 manganese acetate Drugs 0.000 description 1
- 229940082328 manganese acetate tetrahydrate Drugs 0.000 description 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 1
- CESXSDZNZGSWSP-UHFFFAOYSA-L manganese(2+);diacetate;tetrahydrate Chemical compound O.O.O.O.[Mn+2].CC([O-])=O.CC([O-])=O CESXSDZNZGSWSP-UHFFFAOYSA-L 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical class CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- NTUCQKRAQSWLOP-UHFFFAOYSA-N propan-2-yloxymethylbenzene Chemical compound CC(C)OCC1=CC=CC=C1 NTUCQKRAQSWLOP-UHFFFAOYSA-N 0.000 description 1
- RPTKMZRQBREOMV-UHFFFAOYSA-N propoxymethylbenzene Chemical compound CCCOCC1=CC=CC=C1 RPTKMZRQBREOMV-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/32—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with molecular oxygen
- C07C45/33—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with molecular oxygen of CHx-moieties
- C07C45/34—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with molecular oxygen of CHx-moieties in unsaturated compounds
- C07C45/36—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with molecular oxygen of CHx-moieties in unsaturated compounds in compounds containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/01—Preparation of ethers
- C07C41/16—Preparation of ethers by reaction of esters of mineral or organic acids with hydroxy or O-metal groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/575—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing ether groups, groups, groups, or groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1945875A JPS548663B2 (enExample) | 1975-02-18 | 1975-02-18 | |
| GB22407/76A GB1546397A (en) | 1975-02-18 | 1976-05-28 | Process for the preparation of formylated phenoxy compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1041543A true CA1041543A (en) | 1978-10-31 |
Family
ID=26255892
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA246,157A Expired CA1041543A (en) | 1975-02-18 | 1976-02-17 | Process for the preparation of formylated phenoxy compounds |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4113782A (enExample) |
| JP (1) | JPS548663B2 (enExample) |
| CA (1) | CA1041543A (enExample) |
| CH (1) | CH621762A5 (enExample) |
| DE (1) | DE2605678C2 (enExample) |
| GB (1) | GB1546397A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2757031C2 (de) * | 1976-12-27 | 1981-11-26 | Agency Of Industrial Science And Technology | Verfahren zur Herstellung von Aldehyden und/oder Alkoholen aus einem Toluolderivat mit Ätherbindungen |
| GB1561464A (en) * | 1977-02-02 | 1980-02-20 | Shell Int Research | Oxidation of alkaryl compounds |
| JPS5446735A (en) * | 1977-09-20 | 1979-04-12 | Agency Of Ind Science & Technol | Preparation of t-alkyl-benzaldehydes |
| JPS5581832A (en) | 1978-12-13 | 1980-06-20 | Sumitomo Chem Co Ltd | Preparation of p-hydroxybenzaldehyde derivatives |
| JPS5820947B2 (ja) * | 1979-03-12 | 1983-04-26 | 大和化成株式会社 | アニスアルデヒドの製造法 |
| DE3128987A1 (de) * | 1981-07-22 | 1983-02-10 | Dragoco Gerberding & Co Gmbh, 3450 Holzminden | Verwendung von 1-ethoxi-4-ethyl-benzol als riech- und aromastoff |
| US4814512A (en) * | 1985-12-20 | 1989-03-21 | Nippon Shokubai Kagaku Kogyo | Method for the production of p-methoxybenzaldehyde |
| JP5413844B2 (ja) * | 2010-02-10 | 2014-02-12 | 国立大学法人東京工業大学 | 芳香族アルデヒド化合物の製造方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1380277A (en) * | 1919-12-12 | 1921-05-31 | Barrett Co | Catalytic oxidation of ortho-cresol |
| US2245528A (en) * | 1938-10-18 | 1941-06-10 | Du Pont | Catalytic oxidation of alkyl substituted aromatic compounds |
| US2785199A (en) * | 1952-07-01 | 1957-03-12 | Richfield Oil Corp | Purification of toluic acids |
| US2959613A (en) * | 1957-02-08 | 1960-11-08 | Ici Ltd | Oxidation process |
| SE374098B (enExample) * | 1969-02-04 | 1975-02-24 | Labofina Sa | |
| GB1291342A (en) * | 1969-05-28 | 1972-10-04 | Tenneco Chem | Improvements in or relating to the production of benzaldehyde |
| US3910996A (en) * | 1970-04-27 | 1975-10-07 | Gulf Research Development Co | Process for oxidizing a benzenoid structure carrying a methyl substituent |
-
1975
- 1975-02-18 JP JP1945875A patent/JPS548663B2/ja not_active Expired
-
1976
- 1976-02-13 US US05/657,887 patent/US4113782A/en not_active Expired - Lifetime
- 1976-02-13 DE DE2605678A patent/DE2605678C2/de not_active Expired
- 1976-02-17 CA CA246,157A patent/CA1041543A/en not_active Expired
- 1976-02-17 CH CH192076A patent/CH621762A5/de not_active IP Right Cessation
- 1976-05-28 GB GB22407/76A patent/GB1546397A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH621762A5 (enExample) | 1981-02-27 |
| US4113782A (en) | 1978-09-12 |
| JPS5198232A (enExample) | 1976-08-30 |
| DE2605678C2 (de) | 1982-09-16 |
| JPS548663B2 (enExample) | 1979-04-17 |
| DE2605678A1 (de) | 1976-09-02 |
| GB1546397A (en) | 1979-05-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4435601A (en) | Preparation of polyphenols by oxidation of hydroxybenzaldehydes | |
| US4008266A (en) | Coupling of aromatic compounds in the presence of molecular oxygen, a mercuric oxyanion compound, and a group VIII metal or group VIII metal oxyanion compound | |
| EP1114016A2 (en) | Process for making aromatic aldehydes | |
| CA1041543A (en) | Process for the preparation of formylated phenoxy compounds | |
| JPS61293932A (ja) | 多芳香族化合物およびその製法 | |
| EP0046397B1 (en) | Process for producing trimellitic acid or pyromellitic acid | |
| US4067900A (en) | Hydrogenolysis of alcohols, ketones, aldehydes, esters and ethers | |
| US4195040A (en) | Process for preparing a methyl-substituted benzaldehyde | |
| CA1255327A (en) | Process for producing acyloxy aromatic carboxylic acid | |
| US4361706A (en) | Process for preparing aldehydes | |
| EP0338852B1 (en) | Process for the carbonylation of arylalkyl halides | |
| EP0220835A1 (en) | Process for dimerization of aromatic halide compounds | |
| US3068280A (en) | Process for production of aromatic carboxylic acids | |
| US6245936B1 (en) | Process for the selective preparation of a 2-hydroxybenzoic acid and a 4-hydroxybenzaldehyde and derivatives thereof | |
| CA2005845C (en) | Method for preparing a-(4-isobutylphenyl) propionic acid or its precursor | |
| EP0282063B1 (en) | 1-(3-vinylphenyl)-1-phenyl-hydrocarbons and method for producing the same | |
| RU99109598A (ru) | Способ селективного получения 2-гидроксибензойной кислоты и 4-гидроксибензальдегида и производных | |
| CA1093098A (en) | Process for the production of intermediate oxidation products of toluenes having ether linkages | |
| US4740614A (en) | Process for preparation of p-hydroxybenzoic acid from p-methoxytoluene | |
| US4097461A (en) | Oxidative coupling of alkylphenols or 1-naphthols catalyzed by metal complexes of diketo compounds | |
| US4244881A (en) | Process for preparing alpha-naphthol esters of aliphatic carboxylic acids | |
| US2821551A (en) | Process for production of aromatic carboxylic acids | |
| GB2155921A (en) | Process for producing 4-alkyl-4'-formylbiphenyl | |
| US3538165A (en) | Continuous oxidation of aromatic compounds | |
| US5149849A (en) | Process for the preparation of quinhydrones |